diff --git a/.github/workflows/binaries_dev.yml b/.github/workflows/binaries_dev.yml index 84845817c..2411bd1be 100644 --- a/.github/workflows/binaries_dev.yml +++ b/.github/workflows/binaries_dev.yml @@ -44,7 +44,7 @@ jobs: run: echo BUILD_TIME=$(date -u +%Y%m%d-%H%M) >> ${GITHUB_ENV} - name: Go Release Binaries Large Disk - uses: wangyoucao577/go-release-action@6ac7dba1f9e61850053324549cb6bc88e4b473d2 # v1.22 + uses: wangyoucao577/go-release-action@2aa2977ad6a4534f9179e22bd0ff146a1e1d3466 # v1.22 with: github_token: ${{ secrets.GITHUB_TOKEN }} goos: ${{ matrix.goos }} @@ -60,7 +60,7 @@ jobs: asset_name: "weed-large-disk-${{ env.BUILD_TIME }}-${{ matrix.goos }}-${{ matrix.goarch }}" - name: Go Release Binaries Normal Volume Size - uses: wangyoucao577/go-release-action@6ac7dba1f9e61850053324549cb6bc88e4b473d2 # v1.22 + uses: wangyoucao577/go-release-action@2aa2977ad6a4534f9179e22bd0ff146a1e1d3466 # v1.22 with: github_token: ${{ secrets.GITHUB_TOKEN }} goos: ${{ matrix.goos }} @@ -93,7 +93,7 @@ jobs: run: echo BUILD_TIME=$(date -u +%Y%m%d-%H%M) >> ${GITHUB_ENV} - name: Go Release Binaries Large Disk - uses: wangyoucao577/go-release-action@6ac7dba1f9e61850053324549cb6bc88e4b473d2 # v1.22 + uses: wangyoucao577/go-release-action@2aa2977ad6a4534f9179e22bd0ff146a1e1d3466 # v1.22 with: github_token: ${{ secrets.GITHUB_TOKEN }} goos: ${{ matrix.goos }} @@ -109,7 +109,7 @@ jobs: asset_name: "weed-large-disk-${{ env.BUILD_TIME }}-${{ matrix.goos }}-${{ matrix.goarch }}" - name: Go Release Binaries Normal Volume Size - uses: wangyoucao577/go-release-action@6ac7dba1f9e61850053324549cb6bc88e4b473d2 # v1.22 + uses: wangyoucao577/go-release-action@2aa2977ad6a4534f9179e22bd0ff146a1e1d3466 # v1.22 with: github_token: ${{ secrets.GITHUB_TOKEN }} goos: ${{ matrix.goos }} diff --git a/.github/workflows/binaries_release0.yml b/.github/workflows/binaries_release0.yml index c59ad26dd..cc7d63967 100644 --- a/.github/workflows/binaries_release0.yml +++ b/.github/workflows/binaries_release0.yml @@ -30,7 +30,7 @@ jobs: # Checks-out your repository under $GITHUB_WORKSPACE, so your job can access it - uses: actions/checkout@9bb56186c3b09b4f86b1c65136769dd318469633 # v2 - name: Go Release Binaries Normal Volume Size - uses: wangyoucao577/go-release-action@6ac7dba1f9e61850053324549cb6bc88e4b473d2 # v1.22 + uses: wangyoucao577/go-release-action@2aa2977ad6a4534f9179e22bd0ff146a1e1d3466 # v1.22 with: github_token: ${{ secrets.GITHUB_TOKEN }} goos: ${{ matrix.goos }} @@ -44,7 +44,7 @@ jobs: binary_name: weed asset_name: "${{ matrix.goos }}_${{ matrix.goarch }}" - name: Go Release Large Disk Binaries - uses: wangyoucao577/go-release-action@6ac7dba1f9e61850053324549cb6bc88e4b473d2 # v1.22 + uses: wangyoucao577/go-release-action@2aa2977ad6a4534f9179e22bd0ff146a1e1d3466 # v1.22 with: github_token: ${{ secrets.GITHUB_TOKEN }} goos: ${{ matrix.goos }} diff --git a/.github/workflows/binaries_release1.yml b/.github/workflows/binaries_release1.yml index 10120c2dd..c2adda6ee 100644 --- a/.github/workflows/binaries_release1.yml +++ b/.github/workflows/binaries_release1.yml @@ -30,7 +30,7 @@ jobs: # Checks-out your repository under $GITHUB_WORKSPACE, so your job can access it - uses: actions/checkout@9bb56186c3b09b4f86b1c65136769dd318469633 # v2 - name: Go Release Binaries Normal Volume Size - uses: wangyoucao577/go-release-action@6ac7dba1f9e61850053324549cb6bc88e4b473d2 # v1.22 + uses: wangyoucao577/go-release-action@2aa2977ad6a4534f9179e22bd0ff146a1e1d3466 # v1.22 with: github_token: ${{ secrets.GITHUB_TOKEN }} goos: ${{ matrix.goos }} @@ -44,7 +44,7 @@ jobs: binary_name: weed asset_name: "${{ matrix.goos }}_${{ matrix.goarch }}" - name: Go Release Large Disk Binaries - uses: wangyoucao577/go-release-action@6ac7dba1f9e61850053324549cb6bc88e4b473d2 # v1.22 + uses: wangyoucao577/go-release-action@2aa2977ad6a4534f9179e22bd0ff146a1e1d3466 # v1.22 with: github_token: ${{ secrets.GITHUB_TOKEN }} goos: ${{ matrix.goos }} diff --git a/.github/workflows/binaries_release2.yml b/.github/workflows/binaries_release2.yml index 4efa6509a..40caa524f 100644 --- a/.github/workflows/binaries_release2.yml +++ b/.github/workflows/binaries_release2.yml @@ -30,7 +30,7 @@ jobs: # Checks-out your repository under $GITHUB_WORKSPACE, so your job can access it - uses: actions/checkout@9bb56186c3b09b4f86b1c65136769dd318469633 # v2 - name: Go Release Binaries Normal Volume Size - uses: wangyoucao577/go-release-action@6ac7dba1f9e61850053324549cb6bc88e4b473d2 # v1.22 + uses: wangyoucao577/go-release-action@2aa2977ad6a4534f9179e22bd0ff146a1e1d3466 # v1.22 with: github_token: ${{ secrets.GITHUB_TOKEN }} goos: ${{ matrix.goos }} @@ -44,7 +44,7 @@ jobs: binary_name: weed asset_name: "${{ matrix.goos }}_${{ matrix.goarch }}" - name: Go Release Large Disk Binaries - uses: wangyoucao577/go-release-action@6ac7dba1f9e61850053324549cb6bc88e4b473d2 # v1.22 + uses: wangyoucao577/go-release-action@2aa2977ad6a4534f9179e22bd0ff146a1e1d3466 # v1.22 with: github_token: ${{ secrets.GITHUB_TOKEN }} goos: ${{ matrix.goos }} diff --git a/.github/workflows/binaries_release3.yml b/.github/workflows/binaries_release3.yml index fa8405067..29fe93556 100644 --- a/.github/workflows/binaries_release3.yml +++ b/.github/workflows/binaries_release3.yml @@ -30,7 +30,7 @@ jobs: # Checks-out your repository under $GITHUB_WORKSPACE, so your job can access it - uses: actions/checkout@9bb56186c3b09b4f86b1c65136769dd318469633 # v2 - name: Go Release Binaries Normal Volume Size - uses: wangyoucao577/go-release-action@6ac7dba1f9e61850053324549cb6bc88e4b473d2 # v1.22 + uses: wangyoucao577/go-release-action@2aa2977ad6a4534f9179e22bd0ff146a1e1d3466 # v1.22 with: github_token: ${{ secrets.GITHUB_TOKEN }} goos: ${{ matrix.goos }} @@ -44,7 +44,7 @@ jobs: binary_name: weed asset_name: "${{ matrix.goos }}_${{ matrix.goarch }}" - name: Go Release Large Disk Binaries - uses: wangyoucao577/go-release-action@6ac7dba1f9e61850053324549cb6bc88e4b473d2 # v1.22 + uses: wangyoucao577/go-release-action@2aa2977ad6a4534f9179e22bd0ff146a1e1d3466 # v1.22 with: github_token: ${{ secrets.GITHUB_TOKEN }} goos: ${{ matrix.goos }} diff --git a/.github/workflows/binaries_release4.yml b/.github/workflows/binaries_release4.yml index cf760a816..79a3bff9f 100644 --- a/.github/workflows/binaries_release4.yml +++ b/.github/workflows/binaries_release4.yml @@ -30,13 +30,13 @@ jobs: # Checks-out your repository under $GITHUB_WORKSPACE, so your job can access it - uses: actions/checkout@9bb56186c3b09b4f86b1c65136769dd318469633 # v2 - name: Go Release Binaries Normal Volume Size - uses: wangyoucao577/go-release-action@6ac7dba1f9e61850053324549cb6bc88e4b473d2 # v1.22 + uses: wangyoucao577/go-release-action@2aa2977ad6a4534f9179e22bd0ff146a1e1d3466 # v1.22 with: github_token: ${{ secrets.GITHUB_TOKEN }} goos: ${{ matrix.goos }} goarch: ${{ matrix.goarch }} overwrite: true - build_flags: -tags elastic,gocdk,sqlite,ydb,tikv,rclone + build_flags: -tags elastic,gocdk,rclone,sqlite,tikv,ydb pre_command: export CGO_ENABLED=0 && export GODEBUG=http2client=0 # build_flags: -tags 5BytesOffset # optional, default is ldflags: -s -w -extldflags -static -X github.com/seaweedfs/seaweedfs/weed/util.COMMIT=${{github.sha}} @@ -45,14 +45,14 @@ jobs: binary_name: weed asset_name: "${{ matrix.goos }}_${{ matrix.goarch }}_full" - name: Go Release Large Disk Binaries - uses: wangyoucao577/go-release-action@6ac7dba1f9e61850053324549cb6bc88e4b473d2 # v1.22 + uses: wangyoucao577/go-release-action@2aa2977ad6a4534f9179e22bd0ff146a1e1d3466 # v1.22 with: github_token: ${{ secrets.GITHUB_TOKEN }} goos: ${{ matrix.goos }} goarch: ${{ matrix.goarch }} overwrite: true pre_command: export CGO_ENABLED=0 && export GODEBUG=http2client=0 - build_flags: -tags 5BytesOffset,elastic,gocdk,sqlite,ydb,tikv,rclone + build_flags: -tags 5BytesOffset,elastic,gocdk,rclone,sqlite,tikv,ydb ldflags: -s -w -extldflags -static -X github.com/seaweedfs/seaweedfs/weed/util.COMMIT=${{github.sha}} # Where to run `go build .` project_path: weed diff --git a/.github/workflows/binaries_release5.yml b/.github/workflows/binaries_release5.yml index c41ac2187..a208d16ae 100644 --- a/.github/workflows/binaries_release5.yml +++ b/.github/workflows/binaries_release5.yml @@ -30,7 +30,7 @@ jobs: # Checks-out your repository under $GITHUB_WORKSPACE, so your job can access it - uses: actions/checkout@9bb56186c3b09b4f86b1c65136769dd318469633 # v2 - name: Go Release Binaries Normal Volume Size - uses: wangyoucao577/go-release-action@6ac7dba1f9e61850053324549cb6bc88e4b473d2 # v1.22 + uses: wangyoucao577/go-release-action@2aa2977ad6a4534f9179e22bd0ff146a1e1d3466 # v1.22 with: github_token: ${{ secrets.GITHUB_TOKEN }} goos: ${{ matrix.goos }} @@ -44,7 +44,7 @@ jobs: binary_name: weed asset_name: "${{ matrix.goos }}_${{ matrix.goarch }}" - name: Go Release Large Disk Binaries - uses: wangyoucao577/go-release-action@6ac7dba1f9e61850053324549cb6bc88e4b473d2 # v1.22 + uses: wangyoucao577/go-release-action@2aa2977ad6a4534f9179e22bd0ff146a1e1d3466 # v1.22 with: github_token: ${{ secrets.GITHUB_TOKEN }} goos: ${{ matrix.goos }} diff --git a/.github/workflows/container_dev.yml b/.github/workflows/container_dev.yml index c6512186b..7ade272ed 100644 --- a/.github/workflows/container_dev.yml +++ b/.github/workflows/container_dev.yml @@ -36,7 +36,7 @@ jobs: uses: docker/setup-qemu-action@49b3bc8e6bdd4a60e6116a5414239cba5943d3cf # v1 - name: Set up Docker Buildx - uses: docker/setup-buildx-action@988b5a0280414f521da01fcc63a27aeeb4b104db # v1 + uses: docker/setup-buildx-action@c47758b77c9736f4b2ef4073d4d51994fabfe349 # v1 with: buildkitd-flags: "--debug" - @@ -56,7 +56,7 @@ jobs: password: ${{ secrets.GHCR_TOKEN }} - name: Build - uses: docker/build-push-action@5cd11c3a4ced054e52742c5fd54dca954e0edd85 # v2 + uses: docker/build-push-action@4f58ea79222b3b9dc2c8bbdd6debcef730109a75 # v2 with: context: ./docker push: ${{ github.event_name != 'pull_request' }} diff --git a/.github/workflows/container_latest.yml b/.github/workflows/container_latest.yml index 6c0dd896a..82b9533eb 100644 --- a/.github/workflows/container_latest.yml +++ b/.github/workflows/container_latest.yml @@ -37,7 +37,7 @@ jobs: uses: docker/setup-qemu-action@49b3bc8e6bdd4a60e6116a5414239cba5943d3cf # v1 - name: Set up Docker Buildx - uses: docker/setup-buildx-action@988b5a0280414f521da01fcc63a27aeeb4b104db # v1 + uses: docker/setup-buildx-action@c47758b77c9736f4b2ef4073d4d51994fabfe349 # v1 with: buildkitd-flags: "--debug" - @@ -57,7 +57,7 @@ jobs: password: ${{ secrets.GHCR_TOKEN }} - name: Build - uses: docker/build-push-action@5cd11c3a4ced054e52742c5fd54dca954e0edd85 # v2 + uses: docker/build-push-action@4f58ea79222b3b9dc2c8bbdd6debcef730109a75 # v2 with: context: ./docker push: ${{ github.event_name != 'pull_request' }} diff --git a/.github/workflows/container_release1.yml b/.github/workflows/container_release1.yml index c8c880dc1..d51c361c3 100644 --- a/.github/workflows/container_release1.yml +++ b/.github/workflows/container_release1.yml @@ -37,7 +37,7 @@ jobs: uses: docker/setup-qemu-action@49b3bc8e6bdd4a60e6116a5414239cba5943d3cf # v1 - name: Set up Docker Buildx - uses: docker/setup-buildx-action@988b5a0280414f521da01fcc63a27aeeb4b104db # v1 + uses: docker/setup-buildx-action@c47758b77c9736f4b2ef4073d4d51994fabfe349 # v1 - name: Login to Docker Hub if: github.event_name != 'pull_request' @@ -47,7 +47,7 @@ jobs: password: ${{ secrets.DOCKER_PASSWORD }} - name: Build - uses: docker/build-push-action@5cd11c3a4ced054e52742c5fd54dca954e0edd85 # v2 + uses: docker/build-push-action@4f58ea79222b3b9dc2c8bbdd6debcef730109a75 # v2 with: context: ./docker push: ${{ github.event_name != 'pull_request' }} diff --git a/.github/workflows/container_release2.yml b/.github/workflows/container_release2.yml index 6376b459c..ac9d0f1e5 100644 --- a/.github/workflows/container_release2.yml +++ b/.github/workflows/container_release2.yml @@ -38,7 +38,7 @@ jobs: uses: docker/setup-qemu-action@49b3bc8e6bdd4a60e6116a5414239cba5943d3cf # v1 - name: Set up Docker Buildx - uses: docker/setup-buildx-action@988b5a0280414f521da01fcc63a27aeeb4b104db # v1 + uses: docker/setup-buildx-action@c47758b77c9736f4b2ef4073d4d51994fabfe349 # v1 - name: Login to Docker Hub if: github.event_name != 'pull_request' @@ -48,7 +48,7 @@ jobs: password: ${{ secrets.DOCKER_PASSWORD }} - name: Build - uses: docker/build-push-action@5cd11c3a4ced054e52742c5fd54dca954e0edd85 # v2 + uses: docker/build-push-action@4f58ea79222b3b9dc2c8bbdd6debcef730109a75 # v2 with: context: ./docker push: ${{ github.event_name != 'pull_request' }} diff --git a/.github/workflows/container_release3.yml b/.github/workflows/container_release3.yml index 91d549876..70441f66f 100644 --- a/.github/workflows/container_release3.yml +++ b/.github/workflows/container_release3.yml @@ -38,7 +38,7 @@ jobs: uses: docker/setup-qemu-action@49b3bc8e6bdd4a60e6116a5414239cba5943d3cf # v1 - name: Set up Docker Buildx - uses: docker/setup-buildx-action@988b5a0280414f521da01fcc63a27aeeb4b104db # v1 + uses: docker/setup-buildx-action@c47758b77c9736f4b2ef4073d4d51994fabfe349 # v1 - name: Login to Docker Hub if: github.event_name != 'pull_request' @@ -48,7 +48,7 @@ jobs: password: ${{ secrets.DOCKER_PASSWORD }} - name: Build - uses: docker/build-push-action@5cd11c3a4ced054e52742c5fd54dca954e0edd85 # v2 + uses: docker/build-push-action@4f58ea79222b3b9dc2c8bbdd6debcef730109a75 # v2 with: context: ./docker push: ${{ github.event_name != 'pull_request' }} diff --git a/.github/workflows/container_release4.yml b/.github/workflows/container_release4.yml index 178110e70..e5f05c50d 100644 --- a/.github/workflows/container_release4.yml +++ b/.github/workflows/container_release4.yml @@ -37,7 +37,7 @@ jobs: uses: docker/setup-qemu-action@49b3bc8e6bdd4a60e6116a5414239cba5943d3cf # v1 - name: Set up Docker Buildx - uses: docker/setup-buildx-action@988b5a0280414f521da01fcc63a27aeeb4b104db # v1 + uses: docker/setup-buildx-action@c47758b77c9736f4b2ef4073d4d51994fabfe349 # v1 - name: Login to Docker Hub if: github.event_name != 'pull_request' @@ -47,12 +47,12 @@ jobs: password: ${{ secrets.DOCKER_PASSWORD }} - name: Build - uses: docker/build-push-action@5cd11c3a4ced054e52742c5fd54dca954e0edd85 # v2 + uses: docker/build-push-action@4f58ea79222b3b9dc2c8bbdd6debcef730109a75 # v2 with: context: ./docker push: ${{ github.event_name != 'pull_request' }} file: ./docker/Dockerfile.go_build - build-args: TAGS=elastic,gocdk,sqlite,ydb,tikv,rclone + build-args: TAGS=elastic,gocdk,rclone,sqlite,tikv,ydb platforms: linux/amd64 tags: ${{ steps.docker_meta.outputs.tags }} labels: ${{ steps.docker_meta.outputs.labels }} diff --git a/.github/workflows/container_release5.yml b/.github/workflows/container_release5.yml index 9ec8b7453..385e75031 100644 --- a/.github/workflows/container_release5.yml +++ b/.github/workflows/container_release5.yml @@ -37,7 +37,7 @@ jobs: uses: docker/setup-qemu-action@49b3bc8e6bdd4a60e6116a5414239cba5943d3cf # v1 - name: Set up Docker Buildx - uses: docker/setup-buildx-action@988b5a0280414f521da01fcc63a27aeeb4b104db # v1 + uses: docker/setup-buildx-action@c47758b77c9736f4b2ef4073d4d51994fabfe349 # v1 - name: Login to Docker Hub if: github.event_name != 'pull_request' @@ -47,12 +47,12 @@ jobs: password: ${{ secrets.DOCKER_PASSWORD }} - name: Build - uses: docker/build-push-action@5cd11c3a4ced054e52742c5fd54dca954e0edd85 # v2 + uses: docker/build-push-action@4f58ea79222b3b9dc2c8bbdd6debcef730109a75 # v2 with: context: ./docker push: ${{ github.event_name != 'pull_request' }} file: ./docker/Dockerfile.go_build - build-args: TAGS=5BytesOffset,elastic,gocdk,sqlite,ydb,tikv,rclone + build-args: TAGS=5BytesOffset,elastic,gocdk,rclone,sqlite,tikv,ydb platforms: linux/amd64 tags: ${{ steps.docker_meta.outputs.tags }} labels: ${{ steps.docker_meta.outputs.labels }} diff --git a/Makefile b/Makefile index bc63bc708..17eceafd3 100644 --- a/Makefile +++ b/Makefile @@ -1,3 +1,5 @@ +.PHONY: test + BINARY = weed SOURCE_DIR = . diff --git a/go.mod b/go.mod index 6aab666d6..0429cc715 100644 --- a/go.mod +++ b/go.mod @@ -3,9 +3,9 @@ module github.com/seaweedfs/seaweedfs go 1.22.0 require ( - cloud.google.com/go v0.115.1 // indirect - cloud.google.com/go/pubsub v1.43.0 - cloud.google.com/go/storage v1.43.0 + cloud.google.com/go v0.116.0 // indirect + cloud.google.com/go/pubsub v1.45.1 + cloud.google.com/go/storage v1.45.0 github.com/Azure/azure-pipeline-go v0.2.3 github.com/Azure/azure-storage-blob-go v0.15.0 github.com/Shopify/sarama v1.38.1 @@ -32,7 +32,7 @@ require ( github.com/go-redsync/redsync/v4 v4.13.0 github.com/go-sql-driver/mysql v1.8.1 github.com/go-zookeeper/zk v1.0.3 // indirect - github.com/gocql/gocql v1.6.0 + github.com/gocql/gocql v1.7.0 github.com/golang/groupcache v0.0.0-20210331224755-41bb18bfe9da // indirect github.com/golang/protobuf v1.5.4 github.com/golang/snappy v0.0.4 // indirect @@ -56,7 +56,7 @@ require ( github.com/klauspost/reedsolomon v1.12.4 github.com/kurin/blazer v0.5.3 github.com/lib/pq v1.10.9 - github.com/linxGnu/grocksdb v1.9.3 + github.com/linxGnu/grocksdb v1.9.5 github.com/magiconair/properties v1.8.7 // indirect github.com/mailru/easyjson v0.7.7 // indirect github.com/mattn/go-ieproxy v0.0.11 // indirect @@ -70,7 +70,7 @@ require ( github.com/pmezard/go-difflib v1.0.1-0.20181226105442-5d4384ee4fb2 // indirect github.com/posener/complete v1.2.3 github.com/pquerna/cachecontrol v0.2.0 - github.com/prometheus/client_golang v1.20.3 + github.com/prometheus/client_golang v1.20.5 github.com/prometheus/client_model v0.6.1 // indirect github.com/prometheus/common v0.55.0 // indirect github.com/prometheus/procfs v0.15.1 @@ -85,7 +85,7 @@ require ( github.com/stretchr/testify v1.9.0 github.com/stvp/tempredis v0.0.0-20181119212430-b82af8480203 github.com/syndtr/goleveldb v1.0.1-0.20190318030020-c3a204f8e965 - github.com/tidwall/gjson v1.17.3 + github.com/tidwall/gjson v1.18.0 github.com/tidwall/match v1.1.1 github.com/tidwall/pretty v1.2.0 // indirect github.com/tsuna/gohbase v0.0.0-20201125011725-348991136365 @@ -99,58 +99,58 @@ require ( go.etcd.io/etcd/client/v3 v3.5.16 go.mongodb.org/mongo-driver v1.16.0 go.opencensus.io v0.24.0 // indirect - gocloud.dev v0.39.0 - gocloud.dev/pubsub/natspubsub v0.39.0 - gocloud.dev/pubsub/rabbitpubsub v0.39.0 - golang.org/x/crypto v0.27.0 // indirect + gocloud.dev v0.40.0 + gocloud.dev/pubsub/natspubsub v0.40.0 + gocloud.dev/pubsub/rabbitpubsub v0.40.0 + golang.org/x/crypto v0.28.0 // indirect golang.org/x/exp v0.0.0-20240719175910-8a7402abbf56 - golang.org/x/image v0.18.0 - golang.org/x/net v0.29.0 + golang.org/x/image v0.21.0 + golang.org/x/net v0.30.0 golang.org/x/oauth2 v0.23.0 // indirect - golang.org/x/sys v0.25.0 - golang.org/x/text v0.18.0 // indirect - golang.org/x/tools v0.25.0 + golang.org/x/sys v0.26.0 + golang.org/x/text v0.19.0 // indirect + golang.org/x/tools v0.26.0 golang.org/x/xerrors v0.0.0-20240716161551-93cc26a95ae9 // indirect - google.golang.org/api v0.198.0 - google.golang.org/genproto v0.0.0-20240903143218-8af14fe29dc1 // indirect - google.golang.org/grpc v1.66.2 - google.golang.org/protobuf v1.34.2 + google.golang.org/api v0.203.0 + google.golang.org/genproto v0.0.0-20241015192408-796eee8c2d53 // indirect + google.golang.org/grpc v1.67.1 + google.golang.org/protobuf v1.35.1 gopkg.in/inf.v0 v0.9.1 // indirect modernc.org/b v1.0.0 // indirect modernc.org/mathutil v1.6.0 modernc.org/memory v1.8.0 // indirect - modernc.org/sqlite v1.33.0 + modernc.org/sqlite v1.33.1 modernc.org/strutil v1.2.0 modernc.org/token v1.1.0 // indirect ) require ( github.com/Jille/raft-grpc-transport v1.6.1 - github.com/arangodb/go-driver v1.6.2 + github.com/arangodb/go-driver v1.6.4 github.com/armon/go-metrics v0.4.1 - github.com/aws/aws-sdk-go-v2 v1.31.0 - github.com/aws/aws-sdk-go-v2/config v1.27.33 - github.com/aws/aws-sdk-go-v2/credentials v1.17.32 - github.com/aws/aws-sdk-go-v2/service/s3 v1.61.2 + github.com/aws/aws-sdk-go-v2 v1.32.3 + github.com/aws/aws-sdk-go-v2/config v1.28.0 + github.com/aws/aws-sdk-go-v2/credentials v1.17.41 + github.com/aws/aws-sdk-go-v2/service/s3 v1.66.2 github.com/cognusion/imaging v1.0.1 github.com/fluent/fluent-logger-golang v1.9.0 - github.com/getsentry/sentry-go v0.29.0 + github.com/getsentry/sentry-go v0.29.1 github.com/golang-jwt/jwt/v5 v5.2.1 github.com/google/flatbuffers/go v0.0.0-20230108230133-3b8644d32c50 - github.com/hanwen/go-fuse/v2 v2.5.1 + github.com/hanwen/go-fuse/v2 v2.6.1 github.com/hashicorp/raft v1.7.1 github.com/hashicorp/raft-boltdb/v2 v2.3.0 github.com/orcaman/concurrent-map/v2 v2.0.1 - github.com/parquet-go/parquet-go v0.23.0 + github.com/parquet-go/parquet-go v0.23.1-0.20241011155651-6446d1d0d2fe github.com/rabbitmq/amqp091-go v1.10.0 - github.com/rclone/rclone v1.68.0 + github.com/rclone/rclone v1.68.1 github.com/rdleal/intervalst v1.4.0 - github.com/redis/go-redis/v9 v9.6.1 - github.com/schollz/progressbar/v3 v3.14.4 + github.com/redis/go-redis/v9 v9.7.0 + github.com/schollz/progressbar/v3 v3.16.0 github.com/shirou/gopsutil/v3 v3.24.5 github.com/tikv/client-go/v2 v2.0.7 github.com/ydb-platform/ydb-go-sdk-auth-environ v0.5.0 - github.com/ydb-platform/ydb-go-sdk/v3 v3.77.1 + github.com/ydb-platform/ydb-go-sdk/v3 v3.89.2 go.etcd.io/etcd/client/pkg/v3 v3.5.16 go.uber.org/atomic v1.11.0 golang.org/x/sync v0.8.0 @@ -158,10 +158,12 @@ require ( ) require ( - cloud.google.com/go/auth v0.9.4 // indirect + cel.dev/expr v0.16.1 // indirect + cloud.google.com/go/auth v0.9.9 // indirect cloud.google.com/go/auth/oauth2adapt v0.2.4 // indirect - cloud.google.com/go/compute/metadata v0.5.1 // indirect - cloud.google.com/go/iam v1.2.0 // indirect + cloud.google.com/go/compute/metadata v0.5.2 // indirect + cloud.google.com/go/iam v1.2.1 // indirect + cloud.google.com/go/monitoring v1.21.1 // indirect filippo.io/edwards25519 v1.1.0 // indirect gitee.com/chunanyong/dm v1.8.16 // indirect github.com/Azure/azure-sdk-for-go/sdk/azcore v1.14.0 // indirect @@ -172,6 +174,9 @@ require ( github.com/Azure/go-ntlmssp v0.0.0-20221128193559-754e69321358 // indirect github.com/AzureAD/microsoft-authentication-library-for-go v1.2.2 // indirect github.com/Files-com/files-sdk-go/v3 v3.2.34 // indirect + github.com/GoogleCloudPlatform/opentelemetry-operations-go/detectors/gcp v1.24.1 // indirect + github.com/GoogleCloudPlatform/opentelemetry-operations-go/exporter/metric v0.48.1 // indirect + github.com/GoogleCloudPlatform/opentelemetry-operations-go/internal/resourcemapping v0.48.1 // indirect github.com/Max-Sum/base32768 v0.0.0-20230304063302-18e6ce5945fd // indirect github.com/Microsoft/go-winio v0.6.1 // indirect github.com/ProtonMail/bcrypt v0.0.0-20211005172633-e235017c1baf // indirect @@ -186,31 +191,33 @@ require ( github.com/andybalholm/cascadia v1.3.2 // indirect github.com/appscode/go-querystring v0.0.0-20170504095604-0126cfb3f1dc // indirect github.com/arangodb/go-velocypack v0.0.0-20200318135517-5af53c29c67e // indirect - github.com/aws/aws-sdk-go-v2/aws/protocol/eventstream v1.6.4 // indirect - github.com/aws/aws-sdk-go-v2/feature/ec2/imds v1.16.13 // indirect + github.com/aws/aws-sdk-go-v2/aws/protocol/eventstream v1.6.6 // indirect + github.com/aws/aws-sdk-go-v2/feature/ec2/imds v1.16.17 // indirect github.com/aws/aws-sdk-go-v2/feature/s3/manager v1.17.10 // indirect - github.com/aws/aws-sdk-go-v2/internal/configsources v1.3.17 // indirect - github.com/aws/aws-sdk-go-v2/internal/endpoints/v2 v2.6.17 // indirect + github.com/aws/aws-sdk-go-v2/internal/configsources v1.3.22 // indirect + github.com/aws/aws-sdk-go-v2/internal/endpoints/v2 v2.6.22 // indirect github.com/aws/aws-sdk-go-v2/internal/ini v1.8.1 // indirect - github.com/aws/aws-sdk-go-v2/internal/v4a v1.3.17 // indirect - github.com/aws/aws-sdk-go-v2/service/internal/accept-encoding v1.11.4 // indirect - github.com/aws/aws-sdk-go-v2/service/internal/checksum v1.3.19 // indirect - github.com/aws/aws-sdk-go-v2/service/internal/presigned-url v1.11.19 // indirect - github.com/aws/aws-sdk-go-v2/service/internal/s3shared v1.17.17 // indirect + github.com/aws/aws-sdk-go-v2/internal/v4a v1.3.22 // indirect + github.com/aws/aws-sdk-go-v2/service/internal/accept-encoding v1.12.0 // indirect + github.com/aws/aws-sdk-go-v2/service/internal/checksum v1.4.3 // indirect + github.com/aws/aws-sdk-go-v2/service/internal/presigned-url v1.12.3 // indirect + github.com/aws/aws-sdk-go-v2/service/internal/s3shared v1.18.3 // indirect github.com/aws/aws-sdk-go-v2/service/sns v1.31.3 // indirect github.com/aws/aws-sdk-go-v2/service/sqs v1.34.3 // indirect - github.com/aws/aws-sdk-go-v2/service/sso v1.22.7 // indirect - github.com/aws/aws-sdk-go-v2/service/ssooidc v1.26.7 // indirect - github.com/aws/aws-sdk-go-v2/service/sts v1.30.7 // indirect - github.com/aws/smithy-go v1.21.0 // indirect + github.com/aws/aws-sdk-go-v2/service/sso v1.24.2 // indirect + github.com/aws/aws-sdk-go-v2/service/ssooidc v1.28.2 // indirect + github.com/aws/aws-sdk-go-v2/service/sts v1.32.2 // indirect + github.com/aws/smithy-go v1.22.0 // indirect github.com/boltdb/bolt v1.3.1 // indirect github.com/bradenaw/juniper v0.15.2 // indirect github.com/bradfitz/iter v0.0.0-20191230175014-e8f45d346db8 // indirect github.com/buengese/sgzip v0.1.1 // indirect github.com/calebcase/tmpfile v1.0.3 // indirect + github.com/census-instrumentation/opencensus-proto v0.4.1 // indirect github.com/chilts/sid v0.0.0-20190607042430-660e94789ec9 // indirect github.com/cloudflare/circl v1.3.7 // indirect github.com/cloudsoda/go-smb2 v0.0.0-20231124195312-f3ec8ae2c891 // indirect + github.com/cncf/xds/go v0.0.0-20240905190251-b4127c9b8d78 // indirect github.com/colinmarc/hdfs/v2 v2.4.0 // indirect github.com/cronokirby/saferith v0.33.0 // indirect github.com/cznic/mathutil v0.0.0-20181122101859-297441e03548 // indirect @@ -221,6 +228,8 @@ require ( github.com/emersion/go-message v0.18.0 // indirect github.com/emersion/go-textwrapper v0.0.0-20200911093747-65d896831594 // indirect github.com/emersion/go-vcard v0.0.0-20230815062825-8fda7d206ec9 // indirect + github.com/envoyproxy/go-control-plane v0.13.0 // indirect + github.com/envoyproxy/protoc-gen-validate v1.1.0 // indirect github.com/fatih/color v1.16.0 // indirect github.com/fclairamb/go-log v0.5.0 // indirect github.com/felixge/httpsnoop v1.0.4 // indirect @@ -265,7 +274,7 @@ require ( github.com/lpar/date v1.0.0 // indirect github.com/lufia/plan9stats v0.0.0-20231016141302-07b5767bb0ed // indirect github.com/mattn/go-colorable v0.1.13 // indirect - github.com/mattn/go-runewidth v0.0.15 // indirect + github.com/mattn/go-runewidth v0.0.16 // indirect github.com/mitchellh/colorstring v0.0.0-20190213212951-d06e56a500db // indirect github.com/mitchellh/go-homedir v1.1.0 // indirect github.com/montanaflynn/stats v0.7.1 // indirect @@ -291,6 +300,7 @@ require ( github.com/pkg/browser v0.0.0-20240102092130-5ac0b6a4141c // indirect github.com/pkg/sftp v1.13.6 // indirect github.com/pkg/xattr v0.4.9 // indirect + github.com/planetscale/vtprotobuf v0.6.1-0.20240319094008-0393e58bdf10 // indirect github.com/power-devops/perfstat v0.0.0-20221212215047-62379fc7944b // indirect github.com/putdotio/go-putio/putio v0.0.0-20200123120452-16d982cac2b8 // indirect github.com/relvacode/iso8601 v1.3.0 // indirect @@ -319,7 +329,7 @@ require ( github.com/unknwon/goconfig v1.0.0 // indirect github.com/xanzy/ssh-agent v0.3.3 // indirect github.com/yandex-cloud/go-genproto v0.0.0-20211115083454-9ca41db5ed9e // indirect - github.com/ydb-platform/ydb-go-genproto v0.0.0-20240528144234-5d5a685e41f7 // indirect + github.com/ydb-platform/ydb-go-genproto v0.0.0-20241022174402-dd276c7f197b // indirect github.com/ydb-platform/ydb-go-yc v0.12.1 // indirect github.com/ydb-platform/ydb-go-yc-metadata v0.6.1 // indirect github.com/yunify/qingstor-sdk-go/v3 v3.2.0 // indirect @@ -328,24 +338,29 @@ require ( github.com/zeebo/errs v1.3.0 // indirect go.etcd.io/bbolt v1.3.10 // indirect go.etcd.io/etcd/api/v3 v3.5.16 // indirect + go.opentelemetry.io/contrib/detectors/gcp v1.29.0 // indirect go.opentelemetry.io/contrib/instrumentation/google.golang.org/grpc/otelgrpc v0.54.0 // indirect go.opentelemetry.io/contrib/instrumentation/net/http/otelhttp v0.54.0 // indirect go.opentelemetry.io/otel v1.29.0 // indirect go.opentelemetry.io/otel/metric v1.29.0 // indirect + go.opentelemetry.io/otel/sdk v1.29.0 // indirect + go.opentelemetry.io/otel/sdk/metric v1.29.0 // indirect go.opentelemetry.io/otel/trace v1.29.0 // indirect go.uber.org/multierr v1.11.0 // indirect go.uber.org/zap v1.27.0 // indirect golang.org/x/mod v0.21.0 // indirect - golang.org/x/term v0.24.0 // indirect - golang.org/x/time v0.6.0 // indirect - google.golang.org/genproto/googleapis/api v0.0.0-20240903143218-8af14fe29dc1 // indirect - google.golang.org/genproto/googleapis/rpc v0.0.0-20240903143218-8af14fe29dc1 // indirect + golang.org/x/term v0.25.0 // indirect + golang.org/x/time v0.7.0 // indirect + google.golang.org/genproto/googleapis/api v0.0.0-20241007155032-5fefd90f89a9 // indirect + google.golang.org/genproto/googleapis/rpc v0.0.0-20241015192408-796eee8c2d53 // indirect + google.golang.org/grpc/stats/opentelemetry v0.0.0-20240907200651-3ffb98b2c93a // indirect gopkg.in/ini.v1 v1.67.0 // indirect gopkg.in/natefinch/lumberjack.v2 v2.2.1 // indirect gopkg.in/validator.v2 v2.0.1 // indirect gopkg.in/yaml.v2 v2.4.0 // indirect gopkg.in/yaml.v3 v3.0.1 // indirect modernc.org/gc/v3 v3.0.0-20240107210532-573471604cb6 // indirect + modernc.org/libc v1.55.3 // indirect moul.io/http2curl/v2 v2.3.0 // indirect storj.io/common v0.0.0-20240812101423-26b53789c348 // indirect storj.io/drpc v0.0.35-0.20240709171858-0075ac871661 // indirect diff --git a/go.sum b/go.sum index 64b4dc036..430227fd6 100644 --- a/go.sum +++ b/go.sum @@ -1,3 +1,5 @@ +cel.dev/expr v0.16.1 h1:NR0+oFYzR1CqLFhTAqg3ql59G9VfN8fKq1TCHJ6gq1g= +cel.dev/expr v0.16.1/go.mod h1:AsGA5zb3WruAEQeQng1RZdGEXmBj0jvMWh6l5SnNuC8= cloud.google.com/go v0.26.0/go.mod h1:aQUYkXzVsufM+DwF1aE+0xfcU+56JwCaLick0ClmMTw= cloud.google.com/go v0.34.0/go.mod h1:aQUYkXzVsufM+DwF1aE+0xfcU+56JwCaLick0ClmMTw= cloud.google.com/go v0.38.0/go.mod h1:990N+gfupTy94rShfmMCWGDn0LpTmnzTp2qbd1dvSRU= @@ -36,8 +38,8 @@ cloud.google.com/go v0.104.0/go.mod h1:OO6xxXdJyvuJPcEPBLN9BJPD+jep5G1+2U5B5gkRY cloud.google.com/go v0.105.0/go.mod h1:PrLgOJNe5nfE9UMxKxgXj4mD3voiP+YQ6gdt6KMFOKM= cloud.google.com/go v0.107.0/go.mod h1:wpc2eNrD7hXUTy8EKS10jkxpZBjASrORK7goS+3YX2I= cloud.google.com/go v0.110.0/go.mod h1:SJnCLqQ0FCFGSZMUNUf84MV3Aia54kn7pi8st7tMzaY= -cloud.google.com/go v0.115.1 h1:Jo0SM9cQnSkYfp44+v+NQXHpcHqlnRJk2qxh6yvxxxQ= -cloud.google.com/go v0.115.1/go.mod h1:DuujITeaufu3gL68/lOFIirVNJwQeyf5UXyi+Wbgknc= +cloud.google.com/go v0.116.0 h1:B3fRrSDkLRt5qSHWe40ERJvhvnQwdZiHu0bJOpldweE= +cloud.google.com/go v0.116.0/go.mod h1:cEPSRWPzZEswwdr9BxE6ChEn01dWlTaF05LiC2Xs70U= cloud.google.com/go/accessapproval v1.4.0/go.mod h1:zybIuC3KpDOvotz59lFe5qxRZx6C75OtwbisN56xYB4= cloud.google.com/go/accessapproval v1.5.0/go.mod h1:HFy3tuiGvMdcd/u+Cu5b9NkO1pEICJ46IR82PoUdplw= cloud.google.com/go/accessapproval v1.6.0/go.mod h1:R0EiYnwV5fsRFiKZkPHr6mwyk2wxUJ30nL4j2pcFY2E= @@ -84,8 +86,8 @@ cloud.google.com/go/assuredworkloads v1.7.0/go.mod h1:z/736/oNmtGAyU47reJgGN+KVo cloud.google.com/go/assuredworkloads v1.8.0/go.mod h1:AsX2cqyNCOvEQC8RMPnoc0yEarXQk6WEKkxYfL6kGIo= cloud.google.com/go/assuredworkloads v1.9.0/go.mod h1:kFuI1P78bplYtT77Tb1hi0FMxM0vVpRC7VVoJC3ZoT0= cloud.google.com/go/assuredworkloads v1.10.0/go.mod h1:kwdUQuXcedVdsIaKgKTp9t0UJkE5+PAVNhdQm4ZVq2E= -cloud.google.com/go/auth v0.9.4 h1:DxF7imbEbiFu9+zdKC6cKBko1e8XeJnipNqIbWZ+kDI= -cloud.google.com/go/auth v0.9.4/go.mod h1:SHia8n6//Ya940F1rLimhJCjjx7KE17t0ctFEci3HkA= +cloud.google.com/go/auth v0.9.9 h1:BmtbpNQozo8ZwW2t7QJjnrQtdganSdmqeIBxHxNkEZQ= +cloud.google.com/go/auth v0.9.9/go.mod h1:xxA5AqpDrvS+Gkmo9RqrGGRh6WSNKKOXhY3zNOr38tI= cloud.google.com/go/auth/oauth2adapt v0.2.4 h1:0GWE/FUsXhf6C+jAkWgYm7X9tK8cuEIfy19DBn6B6bY= cloud.google.com/go/auth/oauth2adapt v0.2.4/go.mod h1:jC/jOpwFP6JBxhB3P5Rr0a9HLMC/Pe3eaL4NmdvqPtc= cloud.google.com/go/automl v1.5.0/go.mod h1:34EjfoFGMZ5sgJ9EoLsRtdPSNZLcfflJR39VbVNS2M0= @@ -156,8 +158,8 @@ cloud.google.com/go/compute/metadata v0.1.0/go.mod h1:Z1VN+bulIf6bt4P/C37K4DyZYZ cloud.google.com/go/compute/metadata v0.2.0/go.mod h1:zFmK7XCadkQkj6TtorcaGlCW1hT1fIilQDwofLpJ20k= cloud.google.com/go/compute/metadata v0.2.1/go.mod h1:jgHgmJd2RKBGzXqF5LR2EZMGxBkeanZ9wwa75XHJgOM= cloud.google.com/go/compute/metadata v0.2.3/go.mod h1:VAV5nSsACxMJvgaAuX6Pk2AawlZn8kiOGuCv6gTkwuA= -cloud.google.com/go/compute/metadata v0.5.1 h1:NM6oZeZNlYjiwYje+sYFjEpP0Q0zCan1bmQW/KmIrGs= -cloud.google.com/go/compute/metadata v0.5.1/go.mod h1:C66sj2AluDcIqakBq/M8lw8/ybHgOZqin2obFxa/E5k= +cloud.google.com/go/compute/metadata v0.5.2 h1:UxK4uu/Tn+I3p2dYWTfiX4wva7aYlKixAHn3fyqngqo= +cloud.google.com/go/compute/metadata v0.5.2/go.mod h1:C66sj2AluDcIqakBq/M8lw8/ybHgOZqin2obFxa/E5k= cloud.google.com/go/contactcenterinsights v1.3.0/go.mod h1:Eu2oemoePuEFc/xKFPjbTuPSj0fYJcPls9TFlPNnHHY= cloud.google.com/go/contactcenterinsights v1.4.0/go.mod h1:L2YzkGbPsv+vMQMCADxJoT9YiTTnSEd6fEvCeHTYVck= cloud.google.com/go/contactcenterinsights v1.6.0/go.mod h1:IIDlT6CLcDoyv79kDv8iWxMSTZhLxSCofVV5W6YFM/w= @@ -273,8 +275,8 @@ cloud.google.com/go/iam v0.7.0/go.mod h1:H5Br8wRaDGNc8XP3keLc4unfUUZeyH3Sfl9XpQE cloud.google.com/go/iam v0.8.0/go.mod h1:lga0/y3iH6CX7sYqypWJ33hf7kkfXJag67naqGESjkE= cloud.google.com/go/iam v0.11.0/go.mod h1:9PiLDanza5D+oWFZiH1uG+RnRCfEGKoyl6yo4cgWZGY= cloud.google.com/go/iam v0.12.0/go.mod h1:knyHGviacl11zrtZUoDuYpDgLjvr28sLQaG0YB2GYAY= -cloud.google.com/go/iam v1.2.0 h1:kZKMKVNk/IsSSc/udOb83K0hL/Yh/Gcqpz+oAkoIFN8= -cloud.google.com/go/iam v1.2.0/go.mod h1:zITGuWgsLZxd8OwAlX+eMFgZDXzBm7icj1PVTYG766Q= +cloud.google.com/go/iam v1.2.1 h1:QFct02HRb7H12J/3utj0qf5tobFh9V4vR6h9eX5EBRU= +cloud.google.com/go/iam v1.2.1/go.mod h1:3VUIJDPpwT6p/amXRC5GY8fCCh70lxPygguVtI0Z4/g= cloud.google.com/go/iap v1.4.0/go.mod h1:RGFwRJdihTINIe4wZ2iCP0zF/qu18ZwyKxrhMhygBEc= cloud.google.com/go/iap v1.5.0/go.mod h1:UH/CGgKd4KyohZL5Pt0jSKE4m3FR51qg6FKQ/z/Ix9A= cloud.google.com/go/iap v1.6.0/go.mod h1:NSuvI9C/j7UdjGjIde7t7HBz+QTwBcapPE07+sSRcLk= @@ -288,8 +290,8 @@ cloud.google.com/go/kms v1.4.0/go.mod h1:fajBHndQ+6ubNw6Ss2sSd+SWvjL26RNo/dr7uxs cloud.google.com/go/kms v1.5.0/go.mod h1:QJS2YY0eJGBg3mnDfuaCyLauWwBJiHRboYxJ++1xJNg= cloud.google.com/go/kms v1.6.0/go.mod h1:Jjy850yySiasBUDi6KFUwUv2n1+o7QZFyuUJg6OgjA0= cloud.google.com/go/kms v1.9.0/go.mod h1:qb1tPTgfF9RQP8e1wq4cLFErVuTJv7UsSC915J8dh3w= -cloud.google.com/go/kms v1.19.0 h1:x0OVJDl6UH1BSX4THKlMfdcFWoE4ruh90ZHuilZekrU= -cloud.google.com/go/kms v1.19.0/go.mod h1:e4imokuPJUc17Trz2s6lEXFDt8bgDmvpVynH39bdrHM= +cloud.google.com/go/kms v1.20.0 h1:uKUvjGqbBlI96xGE669hcVnEMw1Px/Mvfa62dhM5UrY= +cloud.google.com/go/kms v1.20.0/go.mod h1:/dMbFF1tLLFnQV44AoI2GlotbjowyUfgVwezxW291fM= cloud.google.com/go/language v1.4.0/go.mod h1:F9dRpNFQmJbkaop6g0JhSBXCNlO90e1KWx5iDdxbWic= cloud.google.com/go/language v1.6.0/go.mod h1:6dJ8t3B+lUYfStgls25GusK04NLh3eDLQnWM3mdEbhI= cloud.google.com/go/language v1.7.0/go.mod h1:DJ6dYN/W+SQOjF8e1hLQXMF21AkH2w9wiPzPCJa2MIE= @@ -300,11 +302,13 @@ cloud.google.com/go/lifesciences v0.6.0/go.mod h1:ddj6tSX/7BOnhxCSd3ZcETvtNr8NZ6 cloud.google.com/go/lifesciences v0.8.0/go.mod h1:lFxiEOMqII6XggGbOnKiyZ7IBwoIqA84ClvoezaA/bo= cloud.google.com/go/logging v1.6.1/go.mod h1:5ZO0mHHbvm8gEmeEUHrmDlTDSu5imF6MUP9OfilNXBw= cloud.google.com/go/logging v1.7.0/go.mod h1:3xjP2CjkM3ZkO73aj4ASA5wRPGGCRrPIAeNqVNkzY8M= +cloud.google.com/go/logging v1.11.0 h1:v3ktVzXMV7CwHq1MBF65wcqLMA7i+z3YxbUsoK7mOKs= +cloud.google.com/go/logging v1.11.0/go.mod h1:5LDiJC/RxTt+fHc1LAt20R9TKiUTReDg6RuuFOZ67+A= cloud.google.com/go/longrunning v0.1.1/go.mod h1:UUFxuDWkv22EuY93jjmDMFT5GPQKeFVJBIF6QlTqdsE= cloud.google.com/go/longrunning v0.3.0/go.mod h1:qth9Y41RRSUE69rDcOn6DdK3HfQfsUI0YSmW3iIlLJc= cloud.google.com/go/longrunning v0.4.1/go.mod h1:4iWDqhBZ70CvZ6BfETbvam3T8FMvLK+eFj0E6AaRQTo= -cloud.google.com/go/longrunning v0.6.0 h1:mM1ZmaNsQsnb+5n1DNPeL0KwQd9jQRqSqSDEkBZr+aI= -cloud.google.com/go/longrunning v0.6.0/go.mod h1:uHzSZqW89h7/pasCWNYdUpwGz3PcVWhrWupreVPYLts= +cloud.google.com/go/longrunning v0.6.1 h1:lOLTFxYpr8hcRtcwWir5ITh1PAKUD/sG2lKrTSYjyMc= +cloud.google.com/go/longrunning v0.6.1/go.mod h1:nHISoOZpBcmlwbJmiVk5oDRz0qG/ZxPynEGs1iZ79s0= cloud.google.com/go/managedidentities v1.3.0/go.mod h1:UzlW3cBOiPrzucO5qWkNkh0w33KFtBJU281hacNvsdE= cloud.google.com/go/managedidentities v1.4.0/go.mod h1:NWSBYbEMgqmbZsLIyKvxrYbtqOsxY1ZrGM+9RgDqInM= cloud.google.com/go/managedidentities v1.5.0/go.mod h1:+dWcZ0JlUmpuxpIDfyP5pP5y0bLdRwOS4Lp7gMni/LA= @@ -326,6 +330,8 @@ cloud.google.com/go/metastore v1.10.0/go.mod h1:fPEnH3g4JJAk+gMRnrAnoqyv2lpUCqJP cloud.google.com/go/monitoring v1.7.0/go.mod h1:HpYse6kkGo//7p6sT0wsIC6IBDET0RhIsnmlA53dvEk= cloud.google.com/go/monitoring v1.8.0/go.mod h1:E7PtoMJ1kQXWxPjB6mv2fhC5/15jInuulFdYYtlcvT4= cloud.google.com/go/monitoring v1.12.0/go.mod h1:yx8Jj2fZNEkL/GYZyTLS4ZtZEZN8WtDEiEqG4kLK50w= +cloud.google.com/go/monitoring v1.21.1 h1:zWtbIoBMnU5LP9A/fz8LmWMGHpk4skdfeiaa66QdFGc= +cloud.google.com/go/monitoring v1.21.1/go.mod h1:Rj++LKrlht9uBi8+Eb530dIrzG/cU/lB8mt+lbeFK1c= cloud.google.com/go/networkconnectivity v1.4.0/go.mod h1:nOl7YL8odKyAOtzNX73/M5/mGZgqqMeryi6UPZTk/rA= cloud.google.com/go/networkconnectivity v1.5.0/go.mod h1:3GzqJx7uhtlM3kln0+x5wyFvuVH1pIBJjhCpjzSt75o= cloud.google.com/go/networkconnectivity v1.6.0/go.mod h1:OJOoEXW+0LAxHh89nXd64uGG+FbQoeH8DtxCHVOMlaM= @@ -377,8 +383,8 @@ cloud.google.com/go/pubsub v1.3.1/go.mod h1:i+ucay31+CNRpDW4Lu78I4xXG+O1r/MAHgjp cloud.google.com/go/pubsub v1.26.0/go.mod h1:QgBH3U/jdJy/ftjPhTkyXNj543Tin1pRYcdcPRnFIRI= cloud.google.com/go/pubsub v1.27.1/go.mod h1:hQN39ymbV9geqBnfQq6Xf63yNhUAhv9CZhzp5O6qsW0= cloud.google.com/go/pubsub v1.28.0/go.mod h1:vuXFpwaVoIPQMGXqRyUQigu/AX1S3IWugR9xznmcXX8= -cloud.google.com/go/pubsub v1.43.0 h1:s3Qx+F96J7Kwey/uVHdK3QxFLIlOvvw4SfMYw2jFjb4= -cloud.google.com/go/pubsub v1.43.0/go.mod h1:LNLfqItblovg7mHWgU5g84Vhza4J8kTxx0YqIeTzcXY= +cloud.google.com/go/pubsub v1.45.1 h1:ZC/UzYcrmK12THWn1P72z+Pnp2vu/zCZRXyhAfP1hJY= +cloud.google.com/go/pubsub v1.45.1/go.mod h1:3bn7fTmzZFwaUjllitv1WlsNMkqBgGUb3UdMhI54eCc= cloud.google.com/go/pubsublite v1.5.0/go.mod h1:xapqNQ1CuLfGi23Yda/9l4bBCKz/wC3KIJ5gKcxveZg= cloud.google.com/go/pubsublite v1.6.0/go.mod h1:1eFCS0U11xlOuMFV/0iBqw3zP12kddMeCbj/F3FSj9k= cloud.google.com/go/recaptchaenterprise v1.3.1/go.mod h1:OdD+q+y4XGeAlxRaMn1Y7/GveP6zmq76byL6tjPE7d4= @@ -469,8 +475,8 @@ cloud.google.com/go/storage v1.22.1/go.mod h1:S8N1cAStu7BOeFfE8KAQzmyyLkK8p/vmRq cloud.google.com/go/storage v1.23.0/go.mod h1:vOEEDNFnciUMhBeT6hsJIn3ieU5cFRmzeLgDvXzfIXc= cloud.google.com/go/storage v1.27.0/go.mod h1:x9DOL8TK/ygDUMieqwfhdpQryTeEkhGKMi80i/iqR2s= cloud.google.com/go/storage v1.28.1/go.mod h1:Qnisd4CqDdo6BGs2AD5LLnEsmSQ80wQ5ogcBBKhU86Y= -cloud.google.com/go/storage v1.43.0 h1:CcxnSohZwizt4LCzQHWvBf1/kvtHUn7gk9QERXPyXFs= -cloud.google.com/go/storage v1.43.0/go.mod h1:ajvxEa7WmZS1PxvKRq4bq0tFT3vMd502JwstCcYv0Q0= +cloud.google.com/go/storage v1.45.0 h1:5av0QcIVj77t+44mV4gffFC/LscFRUhto6UBMB5SimM= +cloud.google.com/go/storage v1.45.0/go.mod h1:wpPblkIuMP5jCB/E48Pz9zIo2S/zD8g+ITmxKkPCITE= cloud.google.com/go/storagetransfer v1.5.0/go.mod h1:dxNzUopWy7RQevYFHewchb29POFv3/AaBgnhqzqiK0w= cloud.google.com/go/storagetransfer v1.6.0/go.mod h1:y77xm4CQV/ZhFZH75PLEXY0ROiS7Gh6pSKrM8dJyg6I= cloud.google.com/go/storagetransfer v1.7.0/go.mod h1:8Giuj1QNb1kfLAiWM1bN6dHzfdlDAVC9rv9abHot2W4= @@ -488,6 +494,8 @@ cloud.google.com/go/tpu v1.5.0/go.mod h1:8zVo1rYDFuW2l4yZVY0R0fb/v44xLh3llq7RuV6 cloud.google.com/go/trace v1.3.0/go.mod h1:FFUE83d9Ca57C+K8rDl/Ih8LwOzWIV1krKgxg6N0G28= cloud.google.com/go/trace v1.4.0/go.mod h1:UG0v8UBqzusp+z63o7FK74SdFE+AXpCLdFb1rshXG+Y= cloud.google.com/go/trace v1.8.0/go.mod h1:zH7vcsbAhklH8hWFig58HvxcxyQbaIqMarMg9hn5ECA= +cloud.google.com/go/trace v1.11.1 h1:UNqdP+HYYtnm6lb91aNA5JQ0X14GnxkABGlfz2PzPew= +cloud.google.com/go/trace v1.11.1/go.mod h1:IQKNQuBzH72EGaXEodKlNJrWykGZxet2zgjtS60OtjA= cloud.google.com/go/translate v1.3.0/go.mod h1:gzMUwRjvOqj5i69y/LYLd8RrNQk+hOmIXTi9+nb3Djs= cloud.google.com/go/translate v1.4.0/go.mod h1:06Dn/ppvLD6WvA5Rhdp029IX2Mi3Mn7fpMRLPvXT5Wg= cloud.google.com/go/translate v1.6.0/go.mod h1:lMGRudH1pu7I3n3PETiOB2507gf3HnfLV8qlkHZEyos= @@ -570,6 +578,14 @@ github.com/DataDog/datadog-go v3.2.0+incompatible/go.mod h1:LButxg5PwREeZtORoXG3 github.com/DataDog/zstd v1.5.2/go.mod h1:g4AWEaM3yOg3HYfnJ3YIawPnVdXJh9QME85blwSAmyw= github.com/Files-com/files-sdk-go/v3 v3.2.34 h1:j6gSzu6BF1wWH1z4itRe7eKhQSCrx/I78SDNiBBUtvI= github.com/Files-com/files-sdk-go/v3 v3.2.34/go.mod h1:Y/bCHoPJNPKz2hw1ADXjQXJP378HODwK+g/5SR2gqfU= +github.com/GoogleCloudPlatform/opentelemetry-operations-go/detectors/gcp v1.24.1 h1:pB2F2JKCj1Znmp2rwxxt1J0Fg0wezTMgWYk5Mpbi1kg= +github.com/GoogleCloudPlatform/opentelemetry-operations-go/detectors/gcp v1.24.1/go.mod h1:itPGVDKf9cC/ov4MdvJ2QZ0khw4bfoo9jzwTJlaxy2k= +github.com/GoogleCloudPlatform/opentelemetry-operations-go/exporter/metric v0.48.1 h1:UQ0AhxogsIRZDkElkblfnwjc3IaltCm2HUMvezQaL7s= +github.com/GoogleCloudPlatform/opentelemetry-operations-go/exporter/metric v0.48.1/go.mod h1:jyqM3eLpJ3IbIFDTKVz2rF9T/xWGW0rIriGwnz8l9Tk= +github.com/GoogleCloudPlatform/opentelemetry-operations-go/internal/cloudmock v0.48.1 h1:oTX4vsorBZo/Zdum6OKPA4o7544hm6smoRv1QjpTwGo= +github.com/GoogleCloudPlatform/opentelemetry-operations-go/internal/cloudmock v0.48.1/go.mod h1:0wEl7vrAD8mehJyohS9HZy+WyEOaQO2mJx86Cvh93kM= +github.com/GoogleCloudPlatform/opentelemetry-operations-go/internal/resourcemapping v0.48.1 h1:8nn+rsCvTq9axyEh382S0PFLBeaFwNsT43IrPWzctRU= +github.com/GoogleCloudPlatform/opentelemetry-operations-go/internal/resourcemapping v0.48.1/go.mod h1:viRWSEhtMZqz1rhwmOVKkWl6SwmVowfL9O2YR5gI2PE= github.com/Jille/raft-grpc-transport v1.6.1 h1:gN3sjapb+fVbiebS7AfQQgbV2ecTOI7ur7NPPC7Mhoc= github.com/Jille/raft-grpc-transport v1.6.1/go.mod h1:HbOjEdu/yzCJ/mjTF6wEOJNbAUpHfU2UOA2hVD4CNFg= github.com/JohnCGriffin/overflow v0.0.0-20211019200055-46fa312c352c/go.mod h1:X0CRv0ky0k6m906ixxpzmDRLvX58TFUKS2eePweuyxk= @@ -626,56 +642,56 @@ github.com/apache/arrow/go/v10 v10.0.1/go.mod h1:YvhnlEePVnBS4+0z3fhPfUy7W1Ikj0I github.com/apache/thrift v0.16.0/go.mod h1:PHK3hniurgQaNMZYaCLEqXKsYK8upmhPbmdP2FXSqgU= github.com/appscode/go-querystring v0.0.0-20170504095604-0126cfb3f1dc h1:LoL75er+LKDHDUfU5tRvFwxH0LjPpZN8OoG8Ll+liGU= github.com/appscode/go-querystring v0.0.0-20170504095604-0126cfb3f1dc/go.mod h1:w648aMHEgFYS6xb0KVMMtZ2uMeemhiKCuD2vj6gY52A= -github.com/arangodb/go-driver v1.6.2 h1:3o4inejwR7VMmsKvQJ6hepx4au9sUT6C/RDrXykuD1g= -github.com/arangodb/go-driver v1.6.2/go.mod h1:2BCE6y3DNSLqIXnDvf4CR6WdzZZloYudEy+sasimLiQ= +github.com/arangodb/go-driver v1.6.4 h1:tuizDP620e3OFaoFkEh07n4bHSTvCOvm5qVGQ/+zMrs= +github.com/arangodb/go-driver v1.6.4/go.mod h1:oLZCzkEGh82I2XBcMkrDtqsMXFg6QkIRgbqLGalh6jc= github.com/arangodb/go-velocypack v0.0.0-20200318135517-5af53c29c67e h1:Xg+hGrY2LcQBbxd0ZFdbGSyRKTYMZCfBbw/pMJFOk1g= github.com/arangodb/go-velocypack v0.0.0-20200318135517-5af53c29c67e/go.mod h1:mq7Shfa/CaixoDxiyAAc5jZ6CVBAyPaNQCGS7mkj4Ho= github.com/armon/go-metrics v0.4.1 h1:hR91U9KYmb6bLBYLQjyM+3j+rcd/UhE+G78SFnF8gJA= github.com/armon/go-metrics v0.4.1/go.mod h1:E6amYzXo6aW1tqzoZGT755KkbgrJsSdpwZ+3JqfkOG4= github.com/aws/aws-sdk-go v1.55.5 h1:KKUZBfBoyqy5d3swXyiC7Q76ic40rYcbqH7qjh59kzU= github.com/aws/aws-sdk-go v1.55.5/go.mod h1:eRwEWoyTWFMVYVQzKMNHWP5/RV4xIUGMQfXQHfHkpNU= -github.com/aws/aws-sdk-go-v2 v1.31.0 h1:3V05LbxTSItI5kUqNwhJrrrY1BAXxXt0sN0l72QmG5U= -github.com/aws/aws-sdk-go-v2 v1.31.0/go.mod h1:ztolYtaEUtdpf9Wftr31CJfLVjOnD/CVRkKOOYgF8hA= -github.com/aws/aws-sdk-go-v2/aws/protocol/eventstream v1.6.4 h1:70PVAiL15/aBMh5LThwgXdSQorVr91L127ttckI9QQU= -github.com/aws/aws-sdk-go-v2/aws/protocol/eventstream v1.6.4/go.mod h1:/MQxMqci8tlqDH+pjmoLu1i0tbWCUP1hhyMRuFxpQCw= -github.com/aws/aws-sdk-go-v2/config v1.27.33 h1:Nof9o/MsmH4oa0s2q9a0k7tMz5x/Yj5k06lDODWz3BU= -github.com/aws/aws-sdk-go-v2/config v1.27.33/go.mod h1:kEqdYzRb8dd8Sy2pOdEbExTTF5v7ozEXX0McgPE7xks= -github.com/aws/aws-sdk-go-v2/credentials v1.17.32 h1:7Cxhp/BnT2RcGy4VisJ9miUPecY+lyE9I8JvcZofn9I= -github.com/aws/aws-sdk-go-v2/credentials v1.17.32/go.mod h1:P5/QMF3/DCHbXGEGkdbilXHsyTBX5D3HSwcrSc9p20I= -github.com/aws/aws-sdk-go-v2/feature/ec2/imds v1.16.13 h1:pfQ2sqNpMVK6xz2RbqLEL0GH87JOwSxPV2rzm8Zsb74= -github.com/aws/aws-sdk-go-v2/feature/ec2/imds v1.16.13/go.mod h1:NG7RXPUlqfsCLLFfi0+IpKN4sCB9D9fw/qTaSB+xRoU= +github.com/aws/aws-sdk-go-v2 v1.32.3 h1:T0dRlFBKcdaUPGNtkBSwHZxrtis8CQU17UpNBZYd0wk= +github.com/aws/aws-sdk-go-v2 v1.32.3/go.mod h1:2SK5n0a2karNTv5tbP1SjsX0uhttou00v/HpXKM1ZUo= +github.com/aws/aws-sdk-go-v2/aws/protocol/eventstream v1.6.6 h1:pT3hpW0cOHRJx8Y0DfJUEQuqPild8jRGmSFmBgvydr0= +github.com/aws/aws-sdk-go-v2/aws/protocol/eventstream v1.6.6/go.mod h1:j/I2++U0xX+cr44QjHay4Cvxj6FUbnxrgmqN3H1jTZA= +github.com/aws/aws-sdk-go-v2/config v1.28.0 h1:FosVYWcqEtWNxHn8gB/Vs6jOlNwSoyOCA/g/sxyySOQ= +github.com/aws/aws-sdk-go-v2/config v1.28.0/go.mod h1:pYhbtvg1siOOg8h5an77rXle9tVG8T+BWLWAo7cOukc= +github.com/aws/aws-sdk-go-v2/credentials v1.17.41 h1:7gXo+Axmp+R4Z+AK8YFQO0ZV3L0gizGINCOWxSLY9W8= +github.com/aws/aws-sdk-go-v2/credentials v1.17.41/go.mod h1:u4Eb8d3394YLubphT4jLEwN1rLNq2wFOlT6OuxFwPzU= +github.com/aws/aws-sdk-go-v2/feature/ec2/imds v1.16.17 h1:TMH3f/SCAWdNtXXVPPu5D6wrr4G5hI1rAxbcocKfC7Q= +github.com/aws/aws-sdk-go-v2/feature/ec2/imds v1.16.17/go.mod h1:1ZRXLdTpzdJb9fwTMXiLipENRxkGMTn1sfKexGllQCw= github.com/aws/aws-sdk-go-v2/feature/s3/manager v1.17.10 h1:zeN9UtUlA6FTx0vFSayxSX32HDw73Yb6Hh2izDSFxXY= github.com/aws/aws-sdk-go-v2/feature/s3/manager v1.17.10/go.mod h1:3HKuexPDcwLWPaqpW2UR/9n8N/u/3CKcGAzSs8p8u8g= -github.com/aws/aws-sdk-go-v2/internal/configsources v1.3.17 h1:pI7Bzt0BJtYA0N/JEC6B8fJ4RBrEMi1LBrkMdFYNSnQ= -github.com/aws/aws-sdk-go-v2/internal/configsources v1.3.17/go.mod h1:Dh5zzJYMtxfIjYW+/evjQ8uj2OyR/ve2KROHGHlSFqE= -github.com/aws/aws-sdk-go-v2/internal/endpoints/v2 v2.6.17 h1:Mqr/V5gvrhA2gvgnF42Zh5iMiQNcOYthFYwCyrnuWlc= -github.com/aws/aws-sdk-go-v2/internal/endpoints/v2 v2.6.17/go.mod h1:aLJpZlCmjE+V+KtN1q1uyZkfnUWpQGpbsn89XPKyzfU= +github.com/aws/aws-sdk-go-v2/internal/configsources v1.3.22 h1:Jw50LwEkVjuVzE1NzkhNKkBf9cRN7MtE1F/b2cOKTUM= +github.com/aws/aws-sdk-go-v2/internal/configsources v1.3.22/go.mod h1:Y/SmAyPcOTmpeVaWSzSKiILfXTVJwrGmYZhcRbhWuEY= +github.com/aws/aws-sdk-go-v2/internal/endpoints/v2 v2.6.22 h1:981MHwBaRZM7+9QSR6XamDzF/o7ouUGxFzr+nVSIhrs= +github.com/aws/aws-sdk-go-v2/internal/endpoints/v2 v2.6.22/go.mod h1:1RA1+aBEfn+CAB/Mh0MB6LsdCYCnjZm7tKXtnk499ZQ= github.com/aws/aws-sdk-go-v2/internal/ini v1.8.1 h1:VaRN3TlFdd6KxX1x3ILT5ynH6HvKgqdiXoTxAF4HQcQ= github.com/aws/aws-sdk-go-v2/internal/ini v1.8.1/go.mod h1:FbtygfRFze9usAadmnGJNc8KsP346kEe+y2/oyhGAGc= -github.com/aws/aws-sdk-go-v2/internal/v4a v1.3.17 h1:Roo69qTpfu8OlJ2Tb7pAYVuF0CpuUMB0IYWwYP/4DZM= -github.com/aws/aws-sdk-go-v2/internal/v4a v1.3.17/go.mod h1:NcWPxQzGM1USQggaTVwz6VpqMZPX1CvDJLDh6jnOCa4= -github.com/aws/aws-sdk-go-v2/service/internal/accept-encoding v1.11.4 h1:KypMCbLPPHEmf9DgMGw51jMj77VfGPAN2Kv4cfhlfgI= -github.com/aws/aws-sdk-go-v2/service/internal/accept-encoding v1.11.4/go.mod h1:Vz1JQXliGcQktFTN/LN6uGppAIRoLBR2bMvIMP0gOjc= -github.com/aws/aws-sdk-go-v2/service/internal/checksum v1.3.19 h1:FLMkfEiRjhgeDTCjjLoc3URo/TBkgeQbocA78lfkzSI= -github.com/aws/aws-sdk-go-v2/service/internal/checksum v1.3.19/go.mod h1:Vx+GucNSsdhaxs3aZIKfSUjKVGsxN25nX2SRcdhuw08= -github.com/aws/aws-sdk-go-v2/service/internal/presigned-url v1.11.19 h1:rfprUlsdzgl7ZL2KlXiUAoJnI/VxfHCvDFr2QDFj6u4= -github.com/aws/aws-sdk-go-v2/service/internal/presigned-url v1.11.19/go.mod h1:SCWkEdRq8/7EK60NcvvQ6NXKuTcchAD4ROAsC37VEZE= -github.com/aws/aws-sdk-go-v2/service/internal/s3shared v1.17.17 h1:u+EfGmksnJc/x5tq3A+OD7LrMbSSR/5TrKLvkdy/fhY= -github.com/aws/aws-sdk-go-v2/service/internal/s3shared v1.17.17/go.mod h1:VaMx6302JHax2vHJWgRo+5n9zvbacs3bLU/23DNQrTY= -github.com/aws/aws-sdk-go-v2/service/s3 v1.61.2 h1:Kp6PWAlXwP1UvIflkIP6MFZYBNDCa4mFCGtxrpICVOg= -github.com/aws/aws-sdk-go-v2/service/s3 v1.61.2/go.mod h1:5FmD/Dqq57gP+XwaUnd5WFPipAuzrf0HmupX27Gvjvc= +github.com/aws/aws-sdk-go-v2/internal/v4a v1.3.22 h1:yV+hCAHZZYJQcwAaszoBNwLbPItHvApxT0kVIw6jRgs= +github.com/aws/aws-sdk-go-v2/internal/v4a v1.3.22/go.mod h1:kbR1TL8llqB1eGnVbybcA4/wgScxdylOdyAd51yxPdw= +github.com/aws/aws-sdk-go-v2/service/internal/accept-encoding v1.12.0 h1:TToQNkvGguu209puTojY/ozlqy2d/SFNcoLIqTFi42g= +github.com/aws/aws-sdk-go-v2/service/internal/accept-encoding v1.12.0/go.mod h1:0jp+ltwkf+SwG2fm/PKo8t4y8pJSgOCO4D8Lz3k0aHQ= +github.com/aws/aws-sdk-go-v2/service/internal/checksum v1.4.3 h1:kT6BcZsmMtNkP/iYMcRG+mIEA/IbeiUimXtGmqF39y0= +github.com/aws/aws-sdk-go-v2/service/internal/checksum v1.4.3/go.mod h1:Z8uGua2k4PPaGOYn66pK02rhMrot3Xk3tpBuUFPomZU= +github.com/aws/aws-sdk-go-v2/service/internal/presigned-url v1.12.3 h1:qcxX0JYlgWH3hpPUnd6U0ikcl6LLA9sLkXE2w1fpMvY= +github.com/aws/aws-sdk-go-v2/service/internal/presigned-url v1.12.3/go.mod h1:cLSNEmI45soc+Ef8K/L+8sEA3A3pYFEYf5B5UI+6bH4= +github.com/aws/aws-sdk-go-v2/service/internal/s3shared v1.18.3 h1:ZC7Y/XgKUxwqcdhO5LE8P6oGP1eh6xlQReWNKfhvJno= +github.com/aws/aws-sdk-go-v2/service/internal/s3shared v1.18.3/go.mod h1:WqfO7M9l9yUAw0HcHaikwRd/H6gzYdz7vjejCA5e2oY= +github.com/aws/aws-sdk-go-v2/service/s3 v1.66.2 h1:p9TNFL8bFUMd+38YIpTAXpoxyz0MxC7FlbFEH4P4E1U= +github.com/aws/aws-sdk-go-v2/service/s3 v1.66.2/go.mod h1:fNjyo0Coen9QTwQLWeV6WO2Nytwiu+cCcWaTdKCAqqE= github.com/aws/aws-sdk-go-v2/service/sns v1.31.3 h1:eSTEdxkfle2G98FE+Xl3db/XAXXVTJPNQo9K/Ar8oAI= github.com/aws/aws-sdk-go-v2/service/sns v1.31.3/go.mod h1:1dn0delSO3J69THuty5iwP0US2Glt0mx2qBBlI13pvw= github.com/aws/aws-sdk-go-v2/service/sqs v1.34.3 h1:Vjqy5BZCOIsn4Pj8xzyqgGmsSqzz7y/WXbN3RgOoVrc= github.com/aws/aws-sdk-go-v2/service/sqs v1.34.3/go.mod h1:L0enV3GCRd5iG9B64W35C4/hwsCB00Ib+DKVGTadKHI= -github.com/aws/aws-sdk-go-v2/service/sso v1.22.7 h1:pIaGg+08llrP7Q5aiz9ICWbY8cqhTkyy+0SHvfzQpTc= -github.com/aws/aws-sdk-go-v2/service/sso v1.22.7/go.mod h1:eEygMHnTKH/3kNp9Jr1n3PdejuSNcgwLe1dWgQtO0VQ= -github.com/aws/aws-sdk-go-v2/service/ssooidc v1.26.7 h1:/Cfdu0XV3mONYKaOt1Gr0k1KvQzkzPyiKUdlWJqy+J4= -github.com/aws/aws-sdk-go-v2/service/ssooidc v1.26.7/go.mod h1:bCbAxKDqNvkHxRaIMnyVPXPo+OaPRwvmgzMxbz1VKSA= -github.com/aws/aws-sdk-go-v2/service/sts v1.30.7 h1:NKTa1eqZYw8tiHSRGpP0VtTdub/8KNk8sDkNPFaOKDE= -github.com/aws/aws-sdk-go-v2/service/sts v1.30.7/go.mod h1:NXi1dIAGteSaRLqYgarlhP/Ij0cFT+qmCwiJqWh/U5o= -github.com/aws/smithy-go v1.21.0 h1:H7L8dtDRk0P1Qm6y0ji7MCYMQObJ5R9CRpyPhRUkLYA= -github.com/aws/smithy-go v1.21.0/go.mod h1:irrKGvNn1InZwb2d7fkIRNucdfwR8R+Ts3wxYa/cJHg= +github.com/aws/aws-sdk-go-v2/service/sso v1.24.2 h1:bSYXVyUzoTHoKalBmwaZxs97HU9DWWI3ehHSAMa7xOk= +github.com/aws/aws-sdk-go-v2/service/sso v1.24.2/go.mod h1:skMqY7JElusiOUjMJMOv1jJsP7YUg7DrhgqZZWuzu1U= +github.com/aws/aws-sdk-go-v2/service/ssooidc v1.28.2 h1:AhmO1fHINP9vFYUE0LHzCWg/LfUWUF+zFPEcY9QXb7o= +github.com/aws/aws-sdk-go-v2/service/ssooidc v1.28.2/go.mod h1:o8aQygT2+MVP0NaV6kbdE1YnnIM8RRVQzoeUH45GOdI= +github.com/aws/aws-sdk-go-v2/service/sts v1.32.2 h1:CiS7i0+FUe+/YY1GvIBLLrR/XNGZ4CtM1Ll0XavNuVo= +github.com/aws/aws-sdk-go-v2/service/sts v1.32.2/go.mod h1:HtaiBI8CjYoNVde8arShXb94UbQQi9L4EMr6D+xGBwo= +github.com/aws/smithy-go v1.22.0 h1:uunKnWlcoL3zO7q+gG2Pk53joueEOsnNB28QdMsmiMM= +github.com/aws/smithy-go v1.22.0/go.mod h1:irrKGvNn1InZwb2d7fkIRNucdfwR8R+Ts3wxYa/cJHg= github.com/benbjohnson/clock v1.1.0/go.mod h1:J11/hYXuz8f4ySSvYwY0FKfm+ezbsZBKZxNJlLklBHA= github.com/beorn7/perks v0.0.0-20180321164747-3a771d992973/go.mod h1:Dwedo/Wpr24TaqPxmxbtue+5NUziq4I4S80YR8gNf3Q= github.com/beorn7/perks v1.0.0/go.mod h1:KWe93zE9D1o94FZ5RNwFwVgaQK1VOXiVxmqh+CedLV8= @@ -713,12 +729,15 @@ github.com/cenkalti/backoff/v4 v4.3.0 h1:MyRJ/UdXutAwSAT+s3wNd7MfTIcy71VQueUuFK3 github.com/cenkalti/backoff/v4 v4.3.0/go.mod h1:Y3VNntkOUPxTVeUxJ/G5vcM//AlwfmyYozVcomhLiZE= github.com/census-instrumentation/opencensus-proto v0.2.1/go.mod h1:f6KPmirojxKA12rnyqOA5BBL4O983OfeGPqjHWSTneU= github.com/census-instrumentation/opencensus-proto v0.3.0/go.mod h1:f6KPmirojxKA12rnyqOA5BBL4O983OfeGPqjHWSTneU= +github.com/census-instrumentation/opencensus-proto v0.4.1 h1:iKLQ0xPNFxR/2hzXZMrBo8f1j86j5WHzznCCQxV/b8g= github.com/census-instrumentation/opencensus-proto v0.4.1/go.mod h1:4T9NM4+4Vw91VeyqjLS6ao50K5bOcLKN6Q42XnYaRYw= github.com/cespare/xxhash v1.1.0/go.mod h1:XrSqR1VqqWfGrhpAt58auRo0WTKS1nRRg3ghfAqPWnc= github.com/cespare/xxhash/v2 v2.1.1/go.mod h1:VGX0DQ3Q6kWi7AoAeZDth3/j3BFtOZR5XLFGgcrjCOs= github.com/cespare/xxhash/v2 v2.2.0/go.mod h1:VGX0DQ3Q6kWi7AoAeZDth3/j3BFtOZR5XLFGgcrjCOs= github.com/cespare/xxhash/v2 v2.3.0 h1:UL815xU9SqsFlibzuggzjXhog7bL6oX9BbNZnL2UFvs= github.com/cespare/xxhash/v2 v2.3.0/go.mod h1:VGX0DQ3Q6kWi7AoAeZDth3/j3BFtOZR5XLFGgcrjCOs= +github.com/chengxilo/virtualterm v1.0.4 h1:Z6IpERbRVlfB8WkOmtbHiDbBANU7cimRIof7mk9/PwM= +github.com/chengxilo/virtualterm v1.0.4/go.mod h1:DyxxBZz/x1iqJjFxTFcr6/x+jSpqN0iwWCOK1q10rlY= github.com/chilts/sid v0.0.0-20190607042430-660e94789ec9 h1:z0uK8UQqjMVYzvk4tiiu3obv2B44+XBsvgEJREQfnO8= github.com/chilts/sid v0.0.0-20190607042430-660e94789ec9/go.mod h1:Jl2neWsQaDanWORdqZ4emBl50J4/aRBBS4FyyG9/PFo= github.com/chzyer/logex v1.1.10/go.mod h1:+Ywpsq7O8HXn0nuIou7OrIPyXbp3wmkHB+jjWRnGsAI= @@ -750,6 +769,8 @@ github.com/cncf/xds/go v0.0.0-20211011173535-cb28da3451f1/go.mod h1:eXthEFrGJvWH github.com/cncf/xds/go v0.0.0-20220314180256-7f1daf1720fc/go.mod h1:eXthEFrGJvWHgFFCl3hGmgk+/aYT6PnTQLykKQRLhEs= github.com/cncf/xds/go v0.0.0-20230105202645-06c439db220b/go.mod h1:eXthEFrGJvWHgFFCl3hGmgk+/aYT6PnTQLykKQRLhEs= github.com/cncf/xds/go v0.0.0-20230310173818-32f1caf87195/go.mod h1:eXthEFrGJvWHgFFCl3hGmgk+/aYT6PnTQLykKQRLhEs= +github.com/cncf/xds/go v0.0.0-20240905190251-b4127c9b8d78 h1:QVw89YDxXxEe+l8gU8ETbOasdwEV+avkR75ZzsVV9WI= +github.com/cncf/xds/go v0.0.0-20240905190251-b4127c9b8d78/go.mod h1:W+zGtBO5Y1IgJhy4+A9GOqVhqLpfZi+vwmdNXUehLA8= github.com/cognusion/imaging v1.0.1 h1:jJa1+jYHvr2zS5zZxoluYthH5KbVz4LEvD3xy/W2L90= github.com/cognusion/imaging v1.0.1/go.mod h1:ucYm08RsFoQvYXEV5XMsRBppxrWzD1AGxm6iod5/rvM= github.com/colinmarc/hdfs/v2 v2.4.0 h1:v6R8oBx/Wu9fHpdPoJJjpGSUxo8NhHIwrwsfhFvU9W0= @@ -811,10 +832,14 @@ github.com/envoyproxy/go-control-plane v0.9.10-0.20210907150352-cf90f659a021/go. github.com/envoyproxy/go-control-plane v0.10.2-0.20220325020618-49ff273808a1/go.mod h1:KJwIaB5Mv44NWtYuAOFCVOjcI94vtpEz2JU/D2v6IjE= github.com/envoyproxy/go-control-plane v0.10.3/go.mod h1:fJJn/j26vwOu972OllsvAgJJM//w9BV6Fxbg2LuVd34= github.com/envoyproxy/go-control-plane v0.11.0/go.mod h1:VnHyVMpzcLvCFt9yUz1UnCwHLhwx1WguiVDV7pTG/tI= +github.com/envoyproxy/go-control-plane v0.13.0 h1:HzkeUz1Knt+3bK+8LG1bxOO/jzWZmdxpwC51i202les= +github.com/envoyproxy/go-control-plane v0.13.0/go.mod h1:GRaKG3dwvFoTg4nj7aXdZnvMg4d7nvT/wl9WgVXn3Q8= github.com/envoyproxy/protoc-gen-validate v0.1.0/go.mod h1:iSmxcyjqTsJpI2R4NaDN7+kN2VEUnK/pcBlmesArF7c= github.com/envoyproxy/protoc-gen-validate v0.6.7/go.mod h1:dyJXwwfPK2VSqiB9Klm1J6romD608Ba7Hij42vrOBCo= github.com/envoyproxy/protoc-gen-validate v0.9.1/go.mod h1:OKNgG7TCp5pF4d6XftA0++PMirau2/yoOwVac3AbF2w= github.com/envoyproxy/protoc-gen-validate v0.10.0/go.mod h1:DRjgyB0I43LtJapqN6NiRwroiAU2PaFuvk/vjgh61ss= +github.com/envoyproxy/protoc-gen-validate v1.1.0 h1:tntQDh69XqOCOZsDz0lVJQez/2L6Uu2PdjCQwWCJ3bM= +github.com/envoyproxy/protoc-gen-validate v1.1.0/go.mod h1:sXRDRVmzEbkM7CVcM06s9shE/m23dg3wzjl0UWqJ2q4= github.com/facebookgo/clock v0.0.0-20150410010913-600d898af40a h1:yDWHCSQ40h88yih2JAcL6Ls/kVkSE8GFACTGVnMPruw= github.com/facebookgo/clock v0.0.0-20150410010913-600d898af40a/go.mod h1:7Ga40egUymuWXxAe151lTNnCv97MddSOVsjpPPkityA= github.com/facebookgo/ensure v0.0.0-20200202191622-63f1cf65ac4c h1:8ISkoahWXwZR41ois5lSJBSVw4D0OV19Ht/JSTzvSv0= @@ -853,8 +878,8 @@ github.com/gabriel-vasile/mimetype v1.4.4 h1:QjV6pZ7/XZ7ryI2KuyeEDE8wnh7fHP9YnQy github.com/gabriel-vasile/mimetype v1.4.4/go.mod h1:JwLei5XPtWdGiMFB5Pjle1oEeoSeEuJfJE+TtfvdB/s= github.com/geoffgarside/ber v1.1.0 h1:qTmFG4jJbwiSzSXoNJeHcOprVzZ8Ulde2Rrrifu5U9w= github.com/geoffgarside/ber v1.1.0/go.mod h1:jVPKeCbj6MvQZhwLYsGwaGI52oUorHoHKNecGT85ZCc= -github.com/getsentry/sentry-go v0.29.0 h1:YtWluuCFg9OfcqnaujpY918N/AhCCwarIDWOYSBAjCA= -github.com/getsentry/sentry-go v0.29.0/go.mod h1:jhPesDAL0Q0W2+2YEuVOvdWmVtdsr1+jtBrlDEVWwLY= +github.com/getsentry/sentry-go v0.29.1 h1:DyZuChN8Hz3ARxGVV8ePaNXh1dQ7d76AiB117xcREwA= +github.com/getsentry/sentry-go v0.29.1/go.mod h1:x3AtIzN01d6SiWkderzaH28Tm0lgkafpJ5Bm3li39O0= github.com/ghodss/yaml v1.0.0/go.mod h1:4dBDuWmgqj2HViK6kFavaiC9ZROes6MMH2rRYeMEF04= github.com/gin-contrib/sse v0.1.0 h1:Y/yl/+YNO8GZSjAhjMsSuLt29uWRFHdHYUb5lYOV9qE= github.com/gin-contrib/sse v0.1.0/go.mod h1:RHrZQHXnP2xjPF+u1gW/2HnVO7nvIa9PG3Gm+fLHvGI= @@ -922,8 +947,8 @@ github.com/go-zookeeper/zk v1.0.3/go.mod h1:nOB03cncLtlp4t+UAkGSV+9beXP/akpekBwL github.com/goccy/go-json v0.9.11/go.mod h1:6MelG93GURQebXPDq3khkgXZkazVtN9CRI+MGFi0w8I= github.com/goccy/go-json v0.10.3 h1:KZ5WoDbxAIgm2HNbYckL0se1fHD6rz5j4ywS6ebzDqA= github.com/goccy/go-json v0.10.3/go.mod h1:oq7eo15ShAhp70Anwd5lgX2pLfOS3QCiwU/PULtXL6M= -github.com/gocql/gocql v1.6.0 h1:IdFdOTbnpbd0pDhl4REKQDM+Q0SzKXQ1Yh+YZZ8T/qU= -github.com/gocql/gocql v1.6.0/go.mod h1:3gM2c4D3AnkISwBxGnMMsS8Oy4y2lhbPRsH4xnJrHG8= +github.com/gocql/gocql v1.7.0 h1:O+7U7/1gSN7QTEAaMEsJc1Oq2QHXvCWoF3DFK9HDHus= +github.com/gocql/gocql v1.7.0/go.mod h1:vnlvXyFZeLBF0Wy+RS8hrOdbn0UWsWtdg07XJnFxZ+4= github.com/godbus/dbus/v5 v5.0.4/go.mod h1:xhWf0FNVPg57R7Z0UbKHbJfkEywrmjJnf7w5xrFpKfA= github.com/gofrs/flock v0.8.1 h1:+gYjHKf32LDeiEEFhQaotPbLuUXjY5ZqxKgXy7n59aw= github.com/gofrs/flock v0.8.1/go.mod h1:F1TvTiK9OcQqauNUHlbJvyl9Qa1QvF/gOUDKA14jxHU= @@ -1084,8 +1109,8 @@ github.com/grpc-ecosystem/grpc-gateway/v2 v2.7.0/go.mod h1:hgWBS7lorOAVIJEQMi4Zs github.com/grpc-ecosystem/grpc-gateway/v2 v2.11.3/go.mod h1:o//XUCC/F+yRGJoPO/VU0GSB0f8Nhgmxx0VIRUvaC0w= github.com/hailocab/go-hostpool v0.0.0-20160125115350-e80d13ce29ed h1:5upAirOpQc1Q53c0bnx2ufif5kANL7bfZWcc6VJWJd8= github.com/hailocab/go-hostpool v0.0.0-20160125115350-e80d13ce29ed/go.mod h1:tMWxXQ9wFIaZeTI9F+hmhFiGpFmhOHzyShyFUhRm0H4= -github.com/hanwen/go-fuse/v2 v2.5.1 h1:OQBE8zVemSocRxA4OaFJbjJ5hlpCmIWbGr7r0M4uoQQ= -github.com/hanwen/go-fuse/v2 v2.5.1/go.mod h1:xKwi1cF7nXAOBCXujD5ie0ZKsxc8GGSA1rlMJc+8IJs= +github.com/hanwen/go-fuse/v2 v2.6.1 h1:F3RUMbAuRhVTi3fvgf8HjMPvOm9xEv5wjuy/AXJtEwI= +github.com/hanwen/go-fuse/v2 v2.6.1/go.mod h1:ugNaD/iv5JYyS1Rcvi57Wz7/vrLQJo10mmketmoef48= github.com/hashicorp/errwrap v1.0.0/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4= github.com/hashicorp/errwrap v1.1.0 h1:OxrOeh75EUXMY8TBjag2fzXGZ40LB6IKw45YeGUDY2I= github.com/hashicorp/errwrap v1.1.0/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4= @@ -1178,7 +1203,6 @@ github.com/jung-kurt/gofpdf v1.0.0/go.mod h1:7Id9E/uU8ce6rXgefFLlgrJj/GYY22cpxn+ github.com/jung-kurt/gofpdf v1.0.3-0.20190309125859-24315acbbda5/go.mod h1:7Id9E/uU8ce6rXgefFLlgrJj/GYY22cpxn+r32jIOes= github.com/jzelinskie/whirlpool v0.0.0-20201016144138-0675e54bb004 h1:G+9t9cEtnC9jFiTxyptEKuNIAbiN5ZCQzX2a74lj3xg= github.com/jzelinskie/whirlpool v0.0.0-20201016144138-0675e54bb004/go.mod h1:KmHnJWQrgEvbuy0vcvj00gtMqbvNn1L+3YUZLK/B92c= -github.com/k0kubun/go-ansi v0.0.0-20180517002512-3bf9e2903213/go.mod h1:vNUNkEQ1e29fT/6vq2aBdFsgNPmy8qMdSay1npru+Sw= github.com/karlseguin/ccache/v2 v2.0.8 h1:lT38cE//uyf6KcFok0rlgXtGFBWxkI6h/qg4tbFyDnA= github.com/karlseguin/ccache/v2 v2.0.8/go.mod h1:2BDThcfQMf/c0jnZowt16eW405XIqZPavt+HoYEtcxQ= github.com/karlseguin/expect v1.0.2-0.20190806010014-778a5f0c6003 h1:vJ0Snvo+SLMY72r5J4sEfkuE7AFbixEP2qRbEcum/wA= @@ -1215,15 +1239,14 @@ github.com/kr/text v0.2.0 h1:5Nx0Ya0ZqY2ygV366QzturHI13Jq95ApcVaJBhpS+AY= github.com/kr/text v0.2.0/go.mod h1:eLer722TekiGuMkidMxC/pM04lWEeraHUUmBw8l2grE= github.com/kurin/blazer v0.5.3 h1:SAgYv0TKU0kN/ETfO5ExjNAPyMt2FocO2s/UlCHfjAk= github.com/kurin/blazer v0.5.3/go.mod h1:4FCXMUWo9DllR2Do4TtBd377ezyAJ51vB5uTBjt0pGU= -github.com/kylelemons/godebug v0.0.0-20170820004349-d65d576e9348/go.mod h1:B69LEHPfb2qLo0BaaOLcbitczOKLWTsrBG9LczfCD4k= github.com/kylelemons/godebug v1.1.0 h1:RPNrshWIDI6G2gRW9EHilWtl7Z6Sb1BR0xunSBf0SNc= github.com/kylelemons/godebug v1.1.0/go.mod h1:9/0rRGxNHcop5bhtWyNeEfOS8JIWk580+fNqagV/RAw= github.com/leodido/go-urn v1.4.0 h1:WT9HwE9SGECu3lg4d/dIA+jxlljEa1/ffXKmRjqdmIQ= github.com/leodido/go-urn v1.4.0/go.mod h1:bvxc+MVxLKB4z00jd1z+Dvzr47oO32F/QSNjSBOlFxI= github.com/lib/pq v1.10.9 h1:YXG7RB+JIjhP29X+OtkiDnYaXQwpS4JEWq7dtCCRUEw= github.com/lib/pq v1.10.9/go.mod h1:AlVN5x4E4T544tWzH6hKfbfQvm3HdbOxrmggDNAPY9o= -github.com/linxGnu/grocksdb v1.9.3 h1:s1cbPcOd0cU2SKXRG1nEqCOWYAELQjdqg3RVI2MH9ik= -github.com/linxGnu/grocksdb v1.9.3/go.mod h1:QYiYypR2d4v63Wj1adOOfzglnoII0gLj3PNh4fZkcFA= +github.com/linxGnu/grocksdb v1.9.5 h1:Pqx1DTR5bdJSZic8CJwc9UNZR60qoAOK09feMg4SoaI= +github.com/linxGnu/grocksdb v1.9.5/go.mod h1:QYiYypR2d4v63Wj1adOOfzglnoII0gLj3PNh4fZkcFA= github.com/lpar/date v1.0.0 h1:bq/zVqFTUmsxvd/CylidY4Udqpr9BOFrParoP6p0x/I= github.com/lpar/date v1.0.0/go.mod h1:KjYe0dDyMQTgpqcUz4LEIeM5VZwhggjVx/V2dtc8NSo= github.com/lufia/plan9stats v0.0.0-20231016141302-07b5767bb0ed h1:036IscGBfJsFIgJQzlui7nK1Ncm0tp2ktmPj8xO4N/0= @@ -1249,8 +1272,8 @@ github.com/mattn/go-isatty v0.0.20 h1:xfD0iDuEKnDkl03q4limB+vH+GxLEtL/jb4xVJSWWE github.com/mattn/go-isatty v0.0.20/go.mod h1:W+V8PltTTMOvKvAeJH7IuucS94S2C6jfK/D7dTCTo3Y= github.com/mattn/go-runewidth v0.0.3/go.mod h1:LwmH8dsx7+W8Uxz3IHJYH5QSwggIsqBzpuz5H//U1FU= github.com/mattn/go-runewidth v0.0.9/go.mod h1:H031xJmbD/WCDINGzjvQ9THkh0rPKHF+m2gUSrubnMI= -github.com/mattn/go-runewidth v0.0.15 h1:UNAjwbU9l54TA3KzvqLGxwWjHmMgBUVhBiTjelZgg3U= -github.com/mattn/go-runewidth v0.0.15/go.mod h1:Jdepj2loyihRzMpdS35Xk/zdY8IAYHsh153qUoGf23w= +github.com/mattn/go-runewidth v0.0.16 h1:E5ScNMtiwvlvB5paMFdw9p4kSQzbXFikJ5SQO6TULQc= +github.com/mattn/go-runewidth v0.0.16/go.mod h1:Jdepj2loyihRzMpdS35Xk/zdY8IAYHsh153qUoGf23w= github.com/mattn/go-sqlite3 v1.14.14/go.mod h1:NyWgC/yNuGj7Q9rpYnZvas74GogHl5/Z4A/KQRfk6bU= github.com/matttproud/golang_protobuf_extensions v1.0.1/go.mod h1:D8He9yQNgCq6Z5Ld7szi9bcBfOoFv/3dc6xSMkL2PC0= github.com/minio/asm2plan9s v0.0.0-20200509001527-cdd76441f9d8/go.mod h1:mC1jAcsrzbxHt8iiaC+zU4b1ylILSosueou12R++wfY= @@ -1263,7 +1286,6 @@ github.com/mitchellh/go-homedir v1.1.0 h1:lukF9ziXFxDFPkA1vsr5zpc1XuPDn/wFntq5mG github.com/mitchellh/go-homedir v1.1.0/go.mod h1:SfyaCUpYCn1Vlf4IUYiD9fPX4A5wJrkLzIz1N1q0pr0= github.com/mitchellh/mapstructure v1.5.0 h1:jeMsZIYE/09sWLaz43PL7Gy6RuMjD2eJVyuac5Z2hdY= github.com/mitchellh/mapstructure v1.5.0/go.mod h1:bFUtVrKA4DC2yAKiSyO/QUcy7e+RRV2QTWOzhPopBRo= -github.com/moby/sys/mountinfo v0.6.2/go.mod h1:IJb6JQeOklcdMU9F5xQ8ZALD+CUr5VlGpwtX+VE0rpI= github.com/moby/sys/mountinfo v0.7.2 h1:1shs6aH5s4o5H2zQLn796ADW1wMrIwHsyJ2v9KouLrg= github.com/moby/sys/mountinfo v0.7.2/go.mod h1:1YOa8w8Ih7uW0wALDUgT1dTTSBrZ+HiBLGws92L2RU4= github.com/modern-go/concurrent v0.0.0-20180228061459-e0a39a4cb421/go.mod h1:6dJC0mAP4ikYIbvyc7fijjWJddQyLn8Ig3JB5CqoB9Q= @@ -1318,6 +1340,8 @@ github.com/panjf2000/ants/v2 v2.9.1 h1:Q5vh5xohbsZXGcD6hhszzGqB7jSSc2/CRr3QKIga8 github.com/panjf2000/ants/v2 v2.9.1/go.mod h1:7ZxyxsqE4vvW0M7LSD8aI3cKwgFhBHbxnlN8mDqHa1I= github.com/parquet-go/parquet-go v0.23.0 h1:dyEU5oiHCtbASyItMCD2tXtT2nPmoPbKpqf0+nnGrmk= github.com/parquet-go/parquet-go v0.23.0/go.mod h1:MnwbUcFHU6uBYMymKAlPPAw9yh3kE1wWl6Gl1uLdkNk= +github.com/parquet-go/parquet-go v0.23.1-0.20241011155651-6446d1d0d2fe h1:oUJ5TPnrEK/z+/PeoLL+jCgfngAZIDMyhZASetRcYYg= +github.com/parquet-go/parquet-go v0.23.1-0.20241011155651-6446d1d0d2fe/go.mod h1:OqBBRGBl7+llplCvDMql8dEKaDqjaFA/VAPw+OJiNiw= github.com/pascaldekloe/goe v0.1.0 h1:cBOtyMzM9HTpWjXfbbunk26uA6nG3a8n06Wieeh0MwY= github.com/pascaldekloe/goe v0.1.0/go.mod h1:lzWF7FIEvWOWxwDKqyGYQf6ZUaNfKdP144TG7ZOy1lc= github.com/patrickmn/go-cache v2.1.0+incompatible h1:HRMgzkcYKYpi3C8ajMPV8OFXaaRUnok+kx1WdO15EQc= @@ -1362,6 +1386,8 @@ github.com/pkg/sftp v1.13.6 h1:JFZT4XbOU7l77xGSpOdW+pwIMqP044IyjXX6FGyEKFo= github.com/pkg/sftp v1.13.6/go.mod h1:tz1ryNURKu77RL+GuCzmoJYxQczL3wLNNpPWagdg4Qk= github.com/pkg/xattr v0.4.9 h1:5883YPCtkSd8LFbs13nXplj9g9tlrwoJRjgpgMu1/fE= github.com/pkg/xattr v0.4.9/go.mod h1:di8WF84zAKk8jzR1UBTEWh9AUlIZZ7M/JNt8e9B6ktU= +github.com/planetscale/vtprotobuf v0.6.1-0.20240319094008-0393e58bdf10 h1:GFCKgmp0tecUJ0sJuv4pzYCqS9+RGSn52M3FUwPs+uo= +github.com/planetscale/vtprotobuf v0.6.1-0.20240319094008-0393e58bdf10/go.mod h1:t/avpk3KcrXxUnYOhZhMXJlSEyie6gQbtLq5NM3loB8= github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4= github.com/pmezard/go-difflib v1.0.1-0.20181226105442-5d4384ee4fb2 h1:Jamvg5psRIccs7FGNTlIRMkT8wgtp5eCXdBlqhYGL6U= github.com/pmezard/go-difflib v1.0.1-0.20181226105442-5d4384ee4fb2/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4= @@ -1375,8 +1401,8 @@ github.com/pquerna/ffjson v0.0.0-20190930134022-aa0246cd15f7/go.mod h1:YARuvh7BU github.com/prometheus/client_golang v0.9.1/go.mod h1:7SWBe2y4D6OKWSNQJUaRYU/AaXPKyh/dDVn+NZz0KFw= github.com/prometheus/client_golang v1.0.0/go.mod h1:db9x61etRT2tGnBNRi70OPL5FsnadC4Ky3P0J6CfImo= github.com/prometheus/client_golang v1.4.0/go.mod h1:e9GMxYsXl05ICDXkRhurwBS4Q3OK1iX/F2sw+iXX5zU= -github.com/prometheus/client_golang v1.20.3 h1:oPksm4K8B+Vt35tUhw6GbSNSgVlVSBH0qELP/7u83l4= -github.com/prometheus/client_golang v1.20.3/go.mod h1:PIEt8X02hGcP8JWbeHyeZ53Y/jReSnHgO035n//V5WE= +github.com/prometheus/client_golang v1.20.5 h1:cxppBPuYhUnsO6yo/aoRol4L7q7UFfdm+bR9r+8l63Y= +github.com/prometheus/client_golang v1.20.5/go.mod h1:PIEt8X02hGcP8JWbeHyeZ53Y/jReSnHgO035n//V5WE= github.com/prometheus/client_model v0.0.0-20180712105110-5c3871d89910/go.mod h1:MbSGuTsp3dbXC40dX6PRTWyKYBIrTGTE9sqQNg2J8bo= github.com/prometheus/client_model v0.0.0-20190129233127-fd36f4220a90/go.mod h1:xMI15A0UPsDsEKsMN9yxemIoYk6Tm2C1GtYGdfGttqA= github.com/prometheus/client_model v0.0.0-20190812154241-14fe0d1b01d4/go.mod h1:xMI15A0UPsDsEKsMN9yxemIoYk6Tm2C1GtYGdfGttqA= @@ -1401,14 +1427,14 @@ github.com/quic-go/quic-go v0.40.1 h1:X3AGzUNFs0jVuO3esAGnTfvdgvL4fq655WaOi1snv1 github.com/quic-go/quic-go v0.40.1/go.mod h1:PeN7kuVJ4xZbxSv/4OX6S1USOX8MJvydwpTx31vx60c= github.com/rabbitmq/amqp091-go v1.10.0 h1:STpn5XsHlHGcecLmMFCtg7mqq0RnD+zFr4uzukfVhBw= github.com/rabbitmq/amqp091-go v1.10.0/go.mod h1:Hy4jKW5kQART1u+JkDTF9YYOQUHXqMuhrgxOEeS7G4o= -github.com/rclone/rclone v1.68.0 h1:tsPAAlf7Mu2WPs+hA12v34ojCcgwcOlHas9b8Ju6HYw= -github.com/rclone/rclone v1.68.0/go.mod h1:T8XKOt/2Fb9INROUtFH9eF9q9o9rI1W2qTrW2bw2cYU= +github.com/rclone/rclone v1.68.1 h1:vlEOAuPv4gGxWECM0NIaCwBNUt3ZQY7mCsyBtZjY+68= +github.com/rclone/rclone v1.68.1/go.mod h1:T8XKOt/2Fb9INROUtFH9eF9q9o9rI1W2qTrW2bw2cYU= github.com/rcrowley/go-metrics v0.0.0-20201227073835-cf1acfcdf475 h1:N/ElC8H3+5XpJzTSTfLsJV/mx9Q9g7kxmchpfZyxgzM= github.com/rcrowley/go-metrics v0.0.0-20201227073835-cf1acfcdf475/go.mod h1:bCqnVzQkZxMG4s8nGwiZ5l3QUCyqpo9Y+/ZMZ9VjZe4= github.com/rdleal/intervalst v1.4.0 h1:DWrcNJ9kxPOYnXxExrQkta1xsKFRN0rTOVXkBDJzVYg= github.com/rdleal/intervalst v1.4.0/go.mod h1:xO89Z6BC+LQDH+IPQQw/OESt5UADgFD41tYMUINGpxQ= -github.com/redis/go-redis/v9 v9.6.1 h1:HHDteefn6ZkTtY5fGUE8tj8uy85AHk6zP7CpzIAM0y4= -github.com/redis/go-redis/v9 v9.6.1/go.mod h1:0C0c6ycQsdpVNQpxb1njEQIqkx5UcsM8FJCQLgE9+RA= +github.com/redis/go-redis/v9 v9.7.0 h1:HhLSs+B6O021gwzl+locl0zEDnyNkxMtf/Z3NNBMa9E= +github.com/redis/go-redis/v9 v9.7.0/go.mod h1:f6zhXITC7JUJIlPEiBOTXxJgPLdZcA93GewI7inzyWw= github.com/redis/rueidis v1.0.19 h1:s65oWtotzlIFN8eMPhyYwxlwLR1lUdhza2KtWprKYSo= github.com/redis/rueidis v1.0.19/go.mod h1:8B+r5wdnjwK3lTFml5VtxjzGOQAC+5UmujoD12pDrEo= github.com/rekby/fixenv v0.3.2/go.mod h1:/b5LRc06BYJtslRtHKxsPWFT/ySpHV+rWvzTg+XWk4c= @@ -1440,8 +1466,8 @@ github.com/sagikazarmark/slog-shim v0.1.0 h1:diDBnUNK9N/354PgrxMywXnAwEr1QZcOr6g github.com/sagikazarmark/slog-shim v0.1.0/go.mod h1:SrcSrq8aKtyuqEI1uvTDTK1arOWRIczQRv+GVI1AkeQ= github.com/samber/lo v1.47.0 h1:z7RynLwP5nbyRscyvcD043DWYoOcYRv3mV8lBeqOCLc= github.com/samber/lo v1.47.0/go.mod h1:RmDH9Ct32Qy3gduHQuKJ3gW1fMHAnE/fAzQuf6He5cU= -github.com/schollz/progressbar/v3 v3.14.4 h1:W9ZrDSJk7eqmQhd3uxFNNcTr0QL+xuGNI9dEMrw0r74= -github.com/schollz/progressbar/v3 v3.14.4/go.mod h1:aT3UQ7yGm+2ZjeXPqsjTenwL3ddUiuZ0kfQ/2tHlyNI= +github.com/schollz/progressbar/v3 v3.16.0 h1:+MbBim/cE9DqDb8UXRfLJ6RZdyDkXG1BDy/sWc5s0Mc= +github.com/schollz/progressbar/v3 v3.16.0/go.mod h1:lLiKjKJ9/yzc9Q8jk+sVLfxWxgXKsktvUf6TO+4Y2nw= github.com/seaweedfs/goexif v1.0.3 h1:ve/OjI7dxPW8X9YQsv3JuVMaxEyF9Rvfd04ouL+Bz30= github.com/seaweedfs/goexif v1.0.3/go.mod h1:Oni780Z236sXpIQzk1XoJlTwqrJ02smEin9zQeff7Fk= github.com/seaweedfs/raft v1.1.3 h1:5B6hgneQ7IuU4Ceom/f6QUt8pEeqjcsRo+IxlyPZCws= @@ -1523,8 +1549,8 @@ github.com/t3rm1n4l/go-mega v0.0.0-20240219080617-d494b6a8ace7/go.mod h1:suDIky6 github.com/tailscale/depaware v0.0.0-20210622194025-720c4b409502/go.mod h1:p9lPsd+cx33L3H9nNoecRRxPssFKUwwI50I3pZ0yT+8= github.com/tiancaiamao/gp v0.0.0-20221230034425-4025bc8a4d4a h1:J/YdBZ46WKpXsxsW93SG+q0F8KI+yFrcIDT4c/RNoc4= github.com/tiancaiamao/gp v0.0.0-20221230034425-4025bc8a4d4a/go.mod h1:h4xBhSNtOeEosLJ4P7JyKXX7Cabg7AVkWCK5gV2vOrM= -github.com/tidwall/gjson v1.17.3 h1:bwWLZU7icoKRG+C+0PNwIKC6FCJO/Q3p2pZvuP0jN94= -github.com/tidwall/gjson v1.17.3/go.mod h1:/wbyibRr2FHMks5tjHJ5F8dMZh3AcwJEMf5vlfC0lxk= +github.com/tidwall/gjson v1.18.0 h1:FIDeeyB800efLX89e5a8Y0BNH+LOngJyGrIWxG2FKQY= +github.com/tidwall/gjson v1.18.0/go.mod h1:/wbyibRr2FHMks5tjHJ5F8dMZh3AcwJEMf5vlfC0lxk= github.com/tidwall/match v1.1.1 h1:+Ho715JplO36QYgwN9PGYNhgZvoUSc9X2c80KVTi+GA= github.com/tidwall/match v1.1.1/go.mod h1:eRSPERbgtNPcGhD8UCthc6PmLEQXEWd3PRB5JTxsfmM= github.com/tidwall/pretty v1.2.0 h1:RWIZEg2iJ8/g6fDDYzMpobmaoGh5OLl4AXtGUGPcqCs= @@ -1574,14 +1600,14 @@ github.com/yandex-cloud/go-genproto v0.0.0-20211115083454-9ca41db5ed9e h1:9LPdmD github.com/yandex-cloud/go-genproto v0.0.0-20211115083454-9ca41db5ed9e/go.mod h1:HEUYX/p8966tMUHHT+TsS0hF/Ca/NYwqprC5WXSDMfE= github.com/ydb-platform/ydb-go-genproto v0.0.0-20221215182650-986f9d10542f/go.mod h1:Er+FePu1dNUieD+XTMDduGpQuCPssK5Q4BjF+IIXJ3I= github.com/ydb-platform/ydb-go-genproto v0.0.0-20230528143953-42c825ace222/go.mod h1:Er+FePu1dNUieD+XTMDduGpQuCPssK5Q4BjF+IIXJ3I= -github.com/ydb-platform/ydb-go-genproto v0.0.0-20240528144234-5d5a685e41f7 h1:nL8XwD6fSst7xFUirkaWJmE7kM0CdWRYgu6+YQer1d4= -github.com/ydb-platform/ydb-go-genproto v0.0.0-20240528144234-5d5a685e41f7/go.mod h1:Er+FePu1dNUieD+XTMDduGpQuCPssK5Q4BjF+IIXJ3I= +github.com/ydb-platform/ydb-go-genproto v0.0.0-20241022174402-dd276c7f197b h1:8yiv/W+1xTdifJh1Stkck0gFJjys9kg0/r86Buljuss= +github.com/ydb-platform/ydb-go-genproto v0.0.0-20241022174402-dd276c7f197b/go.mod h1:Er+FePu1dNUieD+XTMDduGpQuCPssK5Q4BjF+IIXJ3I= github.com/ydb-platform/ydb-go-sdk-auth-environ v0.5.0 h1:/NyPd9KnCJgzrEXCArqk1ThqCH2Dh31uUwl88o/VkuM= github.com/ydb-platform/ydb-go-sdk-auth-environ v0.5.0/go.mod h1:9YzkhlIymWaJGX6KMU3vh5sOf3UKbCXkG/ZdjaI3zNM= github.com/ydb-platform/ydb-go-sdk/v3 v3.44.0/go.mod h1:oSLwnuilwIpaF5bJJMAofnGgzPJusoI3zWMNb8I+GnM= github.com/ydb-platform/ydb-go-sdk/v3 v3.47.3/go.mod h1:bWnOIcUHd7+Sl7DN+yhyY1H/I61z53GczvwJgXMgvj0= -github.com/ydb-platform/ydb-go-sdk/v3 v3.77.1 h1:1ICGD18cquyG7/bKQ1ZFdQYSvDvmF7m62b5bIYC8Dkw= -github.com/ydb-platform/ydb-go-sdk/v3 v3.77.1/go.mod h1:IHwuXyolaAmGK2Dp7+dlhsnXphG1pwCoaP/OITT3+tU= +github.com/ydb-platform/ydb-go-sdk/v3 v3.89.2 h1:yVubsh4bTmSk7bc1Gss8K4OUs59eWBfJhxmH/uDtv6g= +github.com/ydb-platform/ydb-go-sdk/v3 v3.89.2/go.mod h1:ah+n4KaEcANFM+CBKnJ5VrmR0IvWfYFvkofW/56076c= github.com/ydb-platform/ydb-go-yc v0.12.1 h1:qw3Fa+T81+Kpu5Io2vYHJOwcrYrVjgJlT6t/0dOXJrA= github.com/ydb-platform/ydb-go-yc v0.12.1/go.mod h1:t/ZA4ECdgPWjAb4jyDe8AzQZB5dhpGbi3iCahFaNwBY= github.com/ydb-platform/ydb-go-yc-metadata v0.6.1 h1:9E5q8Nsy2RiJMZDNVy0A3KUrIMBPakJ2VgloeWbcI84= @@ -1631,6 +1657,8 @@ go.opencensus.io v0.22.5/go.mod h1:5pWMHQbX5EPX2/62yrJeAkowc+lfs/XD7Uxpq3pI6kk= go.opencensus.io v0.23.0/go.mod h1:XItmlyltB5F7CS4xOC1DcqMoFqwtC6OG2xF7mCv7P7E= go.opencensus.io v0.24.0 h1:y73uSU6J157QMP2kn2r30vwW1A2W2WFwSCGnAVxeaD0= go.opencensus.io v0.24.0/go.mod h1:vNK8G9p7aAivkbmorf4v+7Hgx+Zs0yY+0fOtgBfjQKo= +go.opentelemetry.io/contrib/detectors/gcp v1.29.0 h1:TiaiXB4DpGD3sdzNlYQxruQngn5Apwzi1X0DRhuGvDQ= +go.opentelemetry.io/contrib/detectors/gcp v1.29.0/go.mod h1:GW2aWZNwR2ZxDLdv8OyC2G8zkRoQBuURgV7RPQgcPoU= go.opentelemetry.io/contrib/instrumentation/google.golang.org/grpc/otelgrpc v0.54.0 h1:r6I7RJCN86bpD/FQwedZ0vSixDpwuWREjW9oRMsmqDc= go.opentelemetry.io/contrib/instrumentation/google.golang.org/grpc/otelgrpc v0.54.0/go.mod h1:B9yO6b04uB80CzjedvewuqDhxJxi11s7/GtiGa8bAjI= go.opentelemetry.io/contrib/instrumentation/net/http/otelhttp v0.54.0 h1:TT4fX+nBOA/+LUkobKGW1ydGcn+G3vRw9+g5HwCphpk= @@ -1641,6 +1669,8 @@ go.opentelemetry.io/otel/metric v1.29.0 h1:vPf/HFWTNkPu1aYeIsc98l4ktOQaL6LeSoeV2 go.opentelemetry.io/otel/metric v1.29.0/go.mod h1:auu/QWieFVWx+DmQOUMgj0F8LHWdgalxXqvp7BII/W8= go.opentelemetry.io/otel/sdk v1.29.0 h1:vkqKjk7gwhS8VaWb0POZKmIEDimRCMsopNYnriHyryo= go.opentelemetry.io/otel/sdk v1.29.0/go.mod h1:pM8Dx5WKnvxLCb+8lG1PRNIDxu9g9b9g59Qr7hfAAok= +go.opentelemetry.io/otel/sdk/metric v1.29.0 h1:K2CfmJohnRgvZ9UAj2/FhIf/okdWcNdBwe1m8xFXiSY= +go.opentelemetry.io/otel/sdk/metric v1.29.0/go.mod h1:6zZLdCl2fkauYoZIOn/soQIDSWFmNSRcICarHfuhNJQ= go.opentelemetry.io/otel/trace v1.29.0 h1:J/8ZNK4XgR7a21DZUAsbF8pZ5Jcw1VhACmnYt39JTi4= go.opentelemetry.io/otel/trace v1.29.0/go.mod h1:eHl3w0sp3paPkYstJOmAimxhiFXPg+MMTlEh3nsQgWQ= go.opentelemetry.io/proto/otlp v0.7.0/go.mod h1:PqfVotwruBrMGOCsRd/89rSnXhoiJIqeYNgFYFoEGnI= @@ -1667,12 +1697,12 @@ go.uber.org/zap v1.10.0/go.mod h1:vwi/ZaCAaUcBkycHslxD9B2zi4UTXhF60s6SWpuDF0Q= go.uber.org/zap v1.19.0/go.mod h1:xg/QME4nWcxGxrpdeYfq7UvYrLh66cuVKdrbD1XF/NI= go.uber.org/zap v1.27.0 h1:aJMhYGrd5QSmlpLMr2MftRKl7t8J8PTZPA732ud/XR8= go.uber.org/zap v1.27.0/go.mod h1:GB2qFLM7cTU87MWRP2mPIjqfIDnGu+VIO4V/SdhGo2E= -gocloud.dev v0.39.0 h1:EYABYGhAalPUaMrbSKOr5lejxoxvXj99nE8XFtsDgds= -gocloud.dev v0.39.0/go.mod h1:drz+VyYNBvrMTW0KZiBAYEdl8lbNZx+OQ7oQvdrFmSQ= -gocloud.dev/pubsub/natspubsub v0.39.0 h1:T5fOoUtlnttE/NrggpJ0mutN8ui6qd6+ys2Dmq9h1L8= -gocloud.dev/pubsub/natspubsub v0.39.0/go.mod h1:UsxWgxP2/Qv2U5pcN0Y3EHbbjuqUxuqeP7H8ALEnCrk= -gocloud.dev/pubsub/rabbitpubsub v0.39.0 h1:ArMHrrehu5IvvemBVDX235BsARgiEv+KhB26Fr7kOm0= -gocloud.dev/pubsub/rabbitpubsub v0.39.0/go.mod h1:t9Dl2UcBJO9MtrcXlhvR77ebOZ4sLJSfY26uxFoIX7s= +gocloud.dev v0.40.0 h1:f8LgP+4WDqOG/RXoUcyLpeIAGOcAbZrZbDQCUee10ng= +gocloud.dev v0.40.0/go.mod h1:drz+VyYNBvrMTW0KZiBAYEdl8lbNZx+OQ7oQvdrFmSQ= +gocloud.dev/pubsub/natspubsub v0.40.0 h1:KUDqVV1i724df37v2F6EN+bg02WvekUNYFqLKhgBm94= +gocloud.dev/pubsub/natspubsub v0.40.0/go.mod h1:yjUqZCV4qaLjoUlxapY4kja49uMr0L5mxug+3SEZDTk= +gocloud.dev/pubsub/rabbitpubsub v0.40.0 h1:Gz2otW0qiYAA+A3gIgrrXXIyAiv7euoRmXB8LYCVKSs= +gocloud.dev/pubsub/rabbitpubsub v0.40.0/go.mod h1:Z8fouI+E7u3sxuOX/Tq1FpRWl36SF5+iE361SJTjuGQ= golang.org/x/arch v0.8.0 h1:3wRIsP3pM4yUptoR96otTUOXI367OS0+c9eeRi9doIc= golang.org/x/arch v0.8.0/go.mod h1:FEVrYAQjsQXMVJ1nsMoVVXPZg6p2JE2mx8psSWTDQys= golang.org/x/crypto v0.0.0-20180904163835-0709b304e793/go.mod h1:6SG95UA2DQfeDnfUPMdvaQW0Q7yPrPDi9nlGo2tz2b4= @@ -1697,8 +1727,8 @@ golang.org/x/crypto v0.7.0/go.mod h1:pYwdfH91IfpZVANVyUOhSIPZaFoJGxTFbZhFTx+dXZU golang.org/x/crypto v0.13.0/go.mod h1:y6Z2r+Rw4iayiXXAIxJIDAJ1zMW4yaTpebo8fPOliYc= golang.org/x/crypto v0.14.0/go.mod h1:MVFd36DqK4CsrnJYDkBA3VC4m2GkXAM0PvzMCn4JQf4= golang.org/x/crypto v0.18.0/go.mod h1:R0j02AL6hcrfOiy9T4ZYp/rcWeMxM3L6QYxlOuEG1mg= -golang.org/x/crypto v0.27.0 h1:GXm2NjJrPaiv/h1tb2UH8QfgC/hOf/+z0p6PT8o1w7A= -golang.org/x/crypto v0.27.0/go.mod h1:1Xngt8kV6Dvbssa53Ziq6Eqn0HqbZi5Z6R0ZpwQzt70= +golang.org/x/crypto v0.28.0 h1:GBDwsMXVQi34v5CCYUm2jkJvu4cbtru2U4TN2PSyQnw= +golang.org/x/crypto v0.28.0/go.mod h1:rmgy+3RHxRZMyY0jjAJShp2zgEdOqj2AO7U0pYmeQ7U= golang.org/x/exp v0.0.0-20180321215751-8460e604b9de/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA= golang.org/x/exp v0.0.0-20180807140117-3d87b88a115f/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA= golang.org/x/exp v0.0.0-20190121172915-509febef88a4/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA= @@ -1729,8 +1759,8 @@ golang.org/x/image v0.0.0-20210607152325-775e3b0c77b9/go.mod h1:023OzeP/+EPmXeap golang.org/x/image v0.0.0-20210628002857-a66eb6448b8d/go.mod h1:023OzeP/+EPmXeapQh35lcL3II3LrY8Ic+EFFKVhULM= golang.org/x/image v0.0.0-20211028202545-6944b10bf410/go.mod h1:023OzeP/+EPmXeapQh35lcL3II3LrY8Ic+EFFKVhULM= golang.org/x/image v0.0.0-20220302094943-723b81ca9867/go.mod h1:023OzeP/+EPmXeapQh35lcL3II3LrY8Ic+EFFKVhULM= -golang.org/x/image v0.18.0 h1:jGzIakQa/ZXI1I0Fxvaa9W7yP25TqT6cHIHn+6CqvSQ= -golang.org/x/image v0.18.0/go.mod h1:4yyo5vMFQjVjUcVk4jEQcU9MGy/rulF5WvUILseCM2E= +golang.org/x/image v0.21.0 h1:c5qV36ajHpdj4Qi0GnE0jUc/yuo33OLFaa0d+crTD5s= +golang.org/x/image v0.21.0/go.mod h1:vUbsLavqK/W303ZroQQVKQ+Af3Yl6Uz1Ppu5J/cLz78= golang.org/x/lint v0.0.0-20181026193005-c67002cb31c3/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE= golang.org/x/lint v0.0.0-20190227174305-5b3e6a55c961/go.mod h1:wehouNa3lNwaWXcvxsM5YxQ5yQlVC4a0KAMCusXpPoU= golang.org/x/lint v0.0.0-20190301231843-5614ed5bae6f/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE= @@ -1836,8 +1866,8 @@ golang.org/x/net v0.15.0/go.mod h1:idbUs1IY1+zTqbi8yxTbhexhEEk5ur9LInksu6HrEpk= golang.org/x/net v0.16.0/go.mod h1:NxSsAGuq816PNPmqtQdLE42eU2Fs7NoRIZrHJAlaCOE= golang.org/x/net v0.17.0/go.mod h1:NxSsAGuq816PNPmqtQdLE42eU2Fs7NoRIZrHJAlaCOE= golang.org/x/net v0.20.0/go.mod h1:z8BVo6PvndSri0LbOE3hAn0apkU+1YvI6E70E9jsnvY= -golang.org/x/net v0.29.0 h1:5ORfpBpCs4HzDYoodCDBbwHzdR5UrLBZ3sOnUJmFoHo= -golang.org/x/net v0.29.0/go.mod h1:gLkgy8jTGERgjzMic6DS9+SP0ajcu6Xu3Orq/SpETg0= +golang.org/x/net v0.30.0 h1:AcW1SDZMkb8IpzCdQUaIq2sP4sZ4zw+55h6ynffypl4= +golang.org/x/net v0.30.0/go.mod h1:2wGyMJ5iFasEhkwi13ChkO/t1ECNC4X4eBKkVFyYFlU= golang.org/x/oauth2 v0.0.0-20180821212333-d2e6202438be/go.mod h1:N/0e6XlmueqKjAGxoOufVs8QHGRruUQn6yWY3a++T0U= golang.org/x/oauth2 v0.0.0-20190226205417-e64efc72b421/go.mod h1:gOpvHmFTYa4IltrdGE7lF6nIHvwfUNPOp7c8zoXwtLw= golang.org/x/oauth2 v0.0.0-20190604053449-0f29369cfe45/go.mod h1:gOpvHmFTYa4IltrdGE7lF6nIHvwfUNPOp7c8zoXwtLw= @@ -1985,9 +2015,8 @@ golang.org/x/sys v0.8.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.12.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.13.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.16.0/go.mod h1:/VUhepiaJMQUp4+oa/7Zr1D23ma6VTLIYjOOTFZPUcA= -golang.org/x/sys v0.20.0/go.mod h1:/VUhepiaJMQUp4+oa/7Zr1D23ma6VTLIYjOOTFZPUcA= -golang.org/x/sys v0.25.0 h1:r+8e+loiHxRqhXVl6ML1nO3l1+oFoWbnlu2Ehimmi34= -golang.org/x/sys v0.25.0/go.mod h1:/VUhepiaJMQUp4+oa/7Zr1D23ma6VTLIYjOOTFZPUcA= +golang.org/x/sys v0.26.0 h1:KHjCJyddX0LoSTb3J+vWpupP9p0oznkqVk/IfjymZbo= +golang.org/x/sys v0.26.0/go.mod h1:/VUhepiaJMQUp4+oa/7Zr1D23ma6VTLIYjOOTFZPUcA= golang.org/x/term v0.0.0-20201126162022-7de9c90e9dd1/go.mod h1:bj7SfCRtBDWHUb9snDiAeCFNEtKQo2Wmx5Cou7ajbmo= golang.org/x/term v0.0.0-20210927222741-03fcf44c2211/go.mod h1:jbD1KX2456YbFQfuXm/mYQcufACuNUgVhRMnK/tPxf8= golang.org/x/term v0.1.0/go.mod h1:jbD1KX2456YbFQfuXm/mYQcufACuNUgVhRMnK/tPxf8= @@ -2001,9 +2030,8 @@ golang.org/x/term v0.8.0/go.mod h1:xPskH00ivmX89bAKVGSKKtLOWNx2+17Eiy94tnKShWo= golang.org/x/term v0.12.0/go.mod h1:owVbMEjm3cBLCHdkQu9b1opXd4ETQWc3BhuQGKgXgvU= golang.org/x/term v0.13.0/go.mod h1:LTmsnFJwVN6bCy1rVCoS+qHT1HhALEFxKncY3WNNh4U= golang.org/x/term v0.16.0/go.mod h1:yn7UURbUtPyrVJPGPq404EukNFxcm/foM+bV/bfcDsY= -golang.org/x/term v0.20.0/go.mod h1:8UkIAJTvZgivsXaD6/pH6U9ecQzZ45awqEOzuCvwpFY= -golang.org/x/term v0.24.0 h1:Mh5cbb+Zk2hqqXNO7S1iTjEphVL+jb8ZWaqh/g+JWkM= -golang.org/x/term v0.24.0/go.mod h1:lOBK/LVxemqiMij05LGJ0tzNr8xlmwBRJ81PX6wVLH8= +golang.org/x/term v0.25.0 h1:WtHI/ltw4NvSUig5KARz9h521QvRC8RmF/cuYqifU24= +golang.org/x/term v0.25.0/go.mod h1:RPyXicDX+6vLxogjjRxjgD2TKtmAO6NZBsBRfrOLu7M= golang.org/x/text v0.0.0-20170915032832-14c0d48ead0c/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= golang.org/x/text v0.3.1-0.20180807135948-17ff2d5776d2/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= @@ -2022,16 +2050,16 @@ golang.org/x/text v0.8.0/go.mod h1:e1OnstbJyHTd6l/uOt8jFFHp6TRDWZR/bV3emEE/zU8= golang.org/x/text v0.9.0/go.mod h1:e1OnstbJyHTd6l/uOt8jFFHp6TRDWZR/bV3emEE/zU8= golang.org/x/text v0.13.0/go.mod h1:TvPlkZtksWOMsz7fbANvkp4WM8x/WCo/om8BMLbz+aE= golang.org/x/text v0.14.0/go.mod h1:18ZOQIKpY8NJVqYksKHtTdi31H5itFRjB5/qKTNYzSU= -golang.org/x/text v0.18.0 h1:XvMDiNzPAl0jr17s6W9lcaIhGUfUORdGCNsuLmPG224= -golang.org/x/text v0.18.0/go.mod h1:BuEKDfySbSR4drPmRPG/7iBdf8hvFMuRexcpahXilzY= +golang.org/x/text v0.19.0 h1:kTxAhCbGbxhK0IwgSKiMO5awPoDQ0RpfiVYBfK860YM= +golang.org/x/text v0.19.0/go.mod h1:BuEKDfySbSR4drPmRPG/7iBdf8hvFMuRexcpahXilzY= golang.org/x/time v0.0.0-20181108054448-85acf8d2951c/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ= golang.org/x/time v0.0.0-20190308202827-9d24e82272b4/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ= golang.org/x/time v0.0.0-20191024005414-555d28b269f0/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ= golang.org/x/time v0.0.0-20220922220347-f3bd1da661af/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ= golang.org/x/time v0.1.0/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ= golang.org/x/time v0.3.0/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ= -golang.org/x/time v0.6.0 h1:eTDhh4ZXt5Qf0augr54TN6suAUudPcawVZeIAPU7D4U= -golang.org/x/time v0.6.0/go.mod h1:3BpzKBy/shNhVucY/MWOyx10tF3SFh9QdLuxbVysPQM= +golang.org/x/time v0.7.0 h1:ntUhktv3OPE6TgYxXWv9vKvUSJyIFJlyohwbkEwPrKQ= +golang.org/x/time v0.7.0/go.mod h1:3BpzKBy/shNhVucY/MWOyx10tF3SFh9QdLuxbVysPQM= golang.org/x/tools v0.0.0-20180525024113-a5b4c53f6e8b/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= golang.org/x/tools v0.0.0-20190114222345-bf090417da8b/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= @@ -2102,8 +2130,8 @@ golang.org/x/tools v0.7.0/go.mod h1:4pg6aUX35JBAogB10C9AtvVL+qowtN4pT3CGSQex14s= golang.org/x/tools v0.13.0/go.mod h1:HvlwmtVNQAhOuCjW7xxvovg8wbNq7LwfXh/k7wXUl58= golang.org/x/tools v0.14.0/go.mod h1:uYBEerGOWcJyEORxN+Ek8+TT266gXkNlHdJBwexUsBg= golang.org/x/tools v0.17.0/go.mod h1:xsh6VxdV005rRVaS6SSAf9oiAqljS7UZUacMZ8Bnsps= -golang.org/x/tools v0.25.0 h1:oFU9pkj/iJgs+0DT+VMHrx+oBKs/LJMV+Uvg78sl+fE= -golang.org/x/tools v0.25.0/go.mod h1:/vtpO8WL1N9cQC3FN5zPqb//fRXskFHbLKk4OW1Q7rg= +golang.org/x/tools v0.26.0 h1:v/60pFQmzmT9ExmjDv2gGIfi3OqfKoEP6I5+umXlbnQ= +golang.org/x/tools v0.26.0/go.mod h1:TPVVj70c7JJ3WCazhD8OdXcZg/og+b9+tH/KxylGwH0= golang.org/x/xerrors v0.0.0-20190717185122-a985d3407aa7/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0= golang.org/x/xerrors v0.0.0-20191011141410-1b5146add898/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0= golang.org/x/xerrors v0.0.0-20191204190536-9bdfabe68543/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0= @@ -2177,8 +2205,8 @@ google.golang.org/api v0.106.0/go.mod h1:2Ts0XTHNVWxypznxWOYUeI4g3WdP9Pk2Qk58+a/ google.golang.org/api v0.107.0/go.mod h1:2Ts0XTHNVWxypznxWOYUeI4g3WdP9Pk2Qk58+a/O9MY= google.golang.org/api v0.108.0/go.mod h1:2Ts0XTHNVWxypznxWOYUeI4g3WdP9Pk2Qk58+a/O9MY= google.golang.org/api v0.110.0/go.mod h1:7FC4Vvx1Mooxh8C5HWjzZHcavuS2f6pmJpZx60ca7iI= -google.golang.org/api v0.198.0 h1:OOH5fZatk57iN0A7tjJQzt6aPfYQ1JiWkt1yGseazks= -google.golang.org/api v0.198.0/go.mod h1:/Lblzl3/Xqqk9hw/yS97TImKTUwnf1bv89v7+OagJzc= +google.golang.org/api v0.203.0 h1:SrEeuwU3S11Wlscsn+LA1kb/Y5xT8uggJSkIhD08NAU= +google.golang.org/api v0.203.0/go.mod h1:BuOVyCSYEPwJb3npWvDnNmFI92f3GeRnHNkETneT3SI= google.golang.org/appengine v1.1.0/go.mod h1:EbEs0AVv82hx2wNQdGPgUI5lhzA/G0D9YwlJXL52JkM= google.golang.org/appengine v1.4.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4= google.golang.org/appengine v1.5.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4= @@ -2312,12 +2340,12 @@ google.golang.org/genproto v0.0.0-20230209215440-0dfe4f8abfcc/go.mod h1:RGgjbofJ google.golang.org/genproto v0.0.0-20230216225411-c8e22ba71e44/go.mod h1:8B0gmkoRebU8ukX6HP+4wrVQUY1+6PkQ44BSyIlflHA= google.golang.org/genproto v0.0.0-20230222225845-10f96fb3dbec/go.mod h1:3Dl5ZL0q0isWJt+FVcfpQyirqemEuLAK/iFvg1UP1Hw= google.golang.org/genproto v0.0.0-20230306155012-7f2fa6fef1f4/go.mod h1:NWraEVixdDnqcqQ30jipen1STv2r/n24Wb7twVTGR4s= -google.golang.org/genproto v0.0.0-20240903143218-8af14fe29dc1 h1:BulPr26Jqjnd4eYDVe+YvyR7Yc2vJGkO5/0UxD0/jZU= -google.golang.org/genproto v0.0.0-20240903143218-8af14fe29dc1/go.mod h1:hL97c3SYopEHblzpxRL4lSs523++l8DYxGM1FQiYmb4= -google.golang.org/genproto/googleapis/api v0.0.0-20240903143218-8af14fe29dc1 h1:hjSy6tcFQZ171igDaN5QHOw2n6vx40juYbC/x67CEhc= -google.golang.org/genproto/googleapis/api v0.0.0-20240903143218-8af14fe29dc1/go.mod h1:qpvKtACPCQhAdu3PyQgV4l3LMXZEtft7y8QcarRsp9I= -google.golang.org/genproto/googleapis/rpc v0.0.0-20240903143218-8af14fe29dc1 h1:pPJltXNxVzT4pK9yD8vR9X75DaWYYmLGMsEvBfFQZzQ= -google.golang.org/genproto/googleapis/rpc v0.0.0-20240903143218-8af14fe29dc1/go.mod h1:UqMtugtsSgubUsoxbuAoiCXvqvErP7Gf0so0mK9tHxU= +google.golang.org/genproto v0.0.0-20241015192408-796eee8c2d53 h1:Df6WuGvthPzc+JiQ/G+m+sNX24kc0aTBqoDN/0yyykE= +google.golang.org/genproto v0.0.0-20241015192408-796eee8c2d53/go.mod h1:fheguH3Am2dGp1LfXkrvwqC/KlFq8F0nLq3LryOMrrE= +google.golang.org/genproto/googleapis/api v0.0.0-20241007155032-5fefd90f89a9 h1:T6rh4haD3GVYsgEfWExoCZA2o2FmbNyKpTuAxbEFPTg= +google.golang.org/genproto/googleapis/api v0.0.0-20241007155032-5fefd90f89a9/go.mod h1:wp2WsuBYj6j8wUdo3ToZsdxxixbvQNAHqVJrTgi5E5M= +google.golang.org/genproto/googleapis/rpc v0.0.0-20241015192408-796eee8c2d53 h1:X58yt85/IXCx0Y3ZwN6sEIKZzQtDEYaBWrDvErdXrRE= +google.golang.org/genproto/googleapis/rpc v0.0.0-20241015192408-796eee8c2d53/go.mod h1:GX3210XPVPUjJbTUbvwI8f2IpZDMZuPJWDzDuebbviI= google.golang.org/grpc v1.19.0/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c= google.golang.org/grpc v1.20.1/go.mod h1:10oTOabMzJvdu6/UiuZezV6QK5dSlG84ov/aaiqXj38= google.golang.org/grpc v1.21.1/go.mod h1:oYelfM1adQP15Ek0mdvEgi9Df8B9CZIaU1084ijfRaM= @@ -2358,13 +2386,15 @@ google.golang.org/grpc v1.51.0/go.mod h1:wgNDFcnuBGmxLKI/qn4T+m5BtEBYXJPvibbUPsA google.golang.org/grpc v1.52.0/go.mod h1:pu6fVzoFb+NBYNAvQL08ic+lvB2IojljRYuun5vorUY= google.golang.org/grpc v1.53.0/go.mod h1:OnIrk0ipVdj4N5d9IUoFUx72/VlD7+jUsHwZgwSMQpw= google.golang.org/grpc v1.55.0/go.mod h1:iYEXKGkEBhg1PjZQvoYEVPTDkHo1/bjTnfwTeGONTY8= -google.golang.org/grpc v1.66.2 h1:3QdXkuq3Bkh7w+ywLdLvM56cmGvQHUMZpiCzt6Rqaoo= -google.golang.org/grpc v1.66.2/go.mod h1:s3/l6xSSCURdVfAnL+TqCNMyTDAGN6+lZeVxnZR128Y= +google.golang.org/grpc v1.67.1 h1:zWnc1Vrcno+lHZCOofnIMvycFcc0QRGIzm9dhnDX68E= +google.golang.org/grpc v1.67.1/go.mod h1:1gLDyUQU7CTLJI90u3nXZ9ekeghjeM7pTDZlqFNg2AA= google.golang.org/grpc/cmd/protoc-gen-go-grpc v1.1.0/go.mod h1:6Kw0yEErY5E/yWrBtf03jp27GLLJujG4z/JK95pnjjw= google.golang.org/grpc/examples v0.0.0-20201112215255-90f1b3ee835b h1:NuxyvVZoDfHZwYW9LD4GJiF5/nhiSyP4/InTrvw9Ibk= google.golang.org/grpc/examples v0.0.0-20201112215255-90f1b3ee835b/go.mod h1:IBqQ7wSUJ2Ep09a8rMWFsg4fmI2r38zwsq8a0GgxXpM= google.golang.org/grpc/security/advancedtls v1.0.0 h1:/KQ7VP/1bs53/aopk9QhuPyFAp9Dm9Ejix3lzYkCrDA= google.golang.org/grpc/security/advancedtls v1.0.0/go.mod h1:o+s4go+e1PJ2AjuQMY5hU82W7lDlefjJA6FqEHRVHWk= +google.golang.org/grpc/stats/opentelemetry v0.0.0-20240907200651-3ffb98b2c93a h1:UIpYSuWdWHSzjwcAFRLjKcPXFZVVLXGEM23W+NWqipw= +google.golang.org/grpc/stats/opentelemetry v0.0.0-20240907200651-3ffb98b2c93a/go.mod h1:9i1T9n4ZinTUZGgzENMi8MDDgbGC5mqTS75JAv6xN3A= google.golang.org/protobuf v0.0.0-20200109180630-ec00e32a8dfd/go.mod h1:DFci5gLYBciE7Vtevhsrf46CRTquxDuWsQurQQe4oz8= google.golang.org/protobuf v0.0.0-20200221191635-4d8936d0db64/go.mod h1:kwYJMbMJ01Woi6D6+Kah6886xMZcty6N08ah7+eCXa0= google.golang.org/protobuf v0.0.0-20200228230310-ab0ca4ff8a60/go.mod h1:cfTl7dwQJ+fmap5saPgwCLgHXTUD7jkjRqWcaiX5VyM= @@ -2381,8 +2411,8 @@ google.golang.org/protobuf v1.27.1/go.mod h1:9q0QmTI4eRPtz6boOQmLYwt+qCgq0jsYwAQ google.golang.org/protobuf v1.28.0/go.mod h1:HV8QOd/L58Z+nl8r43ehVNZIU/HEI6OcFqwMG9pJV4I= google.golang.org/protobuf v1.28.1/go.mod h1:HV8QOd/L58Z+nl8r43ehVNZIU/HEI6OcFqwMG9pJV4I= google.golang.org/protobuf v1.30.0/go.mod h1:HV8QOd/L58Z+nl8r43ehVNZIU/HEI6OcFqwMG9pJV4I= -google.golang.org/protobuf v1.34.2 h1:6xV6lTsCfpGD21XK49h7MhtcApnLqkfYgPcdHftf6hg= -google.golang.org/protobuf v1.34.2/go.mod h1:qYOHts0dSfpeUzUFpOMr/WGzszTmLH+DiWniOlNbLDw= +google.golang.org/protobuf v1.35.1 h1:m3LfL6/Ca+fqnjnlqQXNpFPABW1UD7mjh8KO2mKFytA= +google.golang.org/protobuf v1.35.1/go.mod h1:9fA7Ob0pmnwhb644+1+CVWFRbNajQ6iRojtC/QF5bRE= gopkg.in/alecthomas/kingpin.v2 v2.2.6/go.mod h1:FMv+mEhP44yOT+4EoQTLFTRgOQ1FBLkstjWtayDeSgw= gopkg.in/check.v1 v0.0.0-20161208181325-20d25e280405/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0= gopkg.in/check.v1 v1.0.0-20180628173108-788fd7840127/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0= @@ -2432,15 +2462,21 @@ modernc.org/b v1.0.0/go.mod h1:uZWcZfRj1BpYzfN9JTerzlNUnnPsV9O2ZA8JsRcubNg= modernc.org/cc/v3 v3.36.0/go.mod h1:NFUHyPn4ekoC/JHeZFfZurN6ixxawE1BnVonP/oahEI= modernc.org/cc/v3 v3.36.2/go.mod h1:NFUHyPn4ekoC/JHeZFfZurN6ixxawE1BnVonP/oahEI= modernc.org/cc/v3 v3.36.3/go.mod h1:NFUHyPn4ekoC/JHeZFfZurN6ixxawE1BnVonP/oahEI= +modernc.org/cc/v4 v4.21.4 h1:3Be/Rdo1fpr8GrQ7IVw9OHtplU4gWbb+wNgeoBMmGLQ= +modernc.org/cc/v4 v4.21.4/go.mod h1:HM7VJTZbUCR3rV8EYBi9wxnJ0ZBRiGE5OeGXNA0IsLQ= modernc.org/ccgo/v3 v3.0.0-20220428102840-41399a37e894/go.mod h1:eI31LL8EwEBKPpNpA4bU1/i+sKOwOrQy8D87zWUcRZc= modernc.org/ccgo/v3 v3.0.0-20220430103911-bc99d88307be/go.mod h1:bwdAnOoaIt8Ax9YdWGjxWsdkPcZyRPHqrOvJxaKAKGw= modernc.org/ccgo/v3 v3.16.4/go.mod h1:tGtX0gE9Jn7hdZFeU88slbTh1UtCYKusWOoCJuvkWsQ= modernc.org/ccgo/v3 v3.16.6/go.mod h1:tGtX0gE9Jn7hdZFeU88slbTh1UtCYKusWOoCJuvkWsQ= modernc.org/ccgo/v3 v3.16.8/go.mod h1:zNjwkizS+fIFDrDjIAgBSCLkWbJuHF+ar3QRn+Z9aws= modernc.org/ccgo/v3 v3.16.9/go.mod h1:zNMzC9A9xeNUepy6KuZBbugn3c0Mc9TeiJO4lgvkJDo= +modernc.org/ccgo/v4 v4.19.2 h1:lwQZgvboKD0jBwdaeVCTouxhxAyN6iawF3STraAal8Y= +modernc.org/ccgo/v4 v4.19.2/go.mod h1:ysS3mxiMV38XGRTTcgo0DQTeTmAO4oCmJl1nX9VFI3s= modernc.org/ccorpus v1.11.6/go.mod h1:2gEUTrWqdpH2pXsmTM1ZkjeSrUWDpjMu2T6m29L/ErQ= modernc.org/fileutil v1.3.0 h1:gQ5SIzK3H9kdfai/5x41oQiKValumqNTDXMvKo62HvE= modernc.org/fileutil v1.3.0/go.mod h1:XatxS8fZi3pS8/hKG2GH/ArUogfxjpEKs3Ku3aK4JyQ= +modernc.org/gc/v2 v2.4.1 h1:9cNzOqPyMJBvrUipmynX0ZohMhcxPtMccYgGOJdOiBw= +modernc.org/gc/v2 v2.4.1/go.mod h1:wzN5dK1AzVGoH6XOzc3YZ+ey/jPgYHLuVckd62P0GYU= modernc.org/gc/v3 v3.0.0-20240107210532-573471604cb6 h1:5D53IMaUuA5InSeMu9eJtlQXS2NxAhyWQvkKEgXZhHI= modernc.org/gc/v3 v3.0.0-20240107210532-573471604cb6/go.mod h1:Qz0X07sNOR1jWYCrJMEnbW/X55x206Q7Vt4mz6/wHp4= modernc.org/httpfs v1.0.6/go.mod h1:7dosgurJGp0sPaRanU53W4xZYKh14wfzX420oZADeHM= @@ -2451,6 +2487,8 @@ modernc.org/libc v1.16.17/go.mod h1:hYIV5VZczAmGZAnG15Vdngn5HSF5cSkbvfz2B7GRuVU= modernc.org/libc v1.16.19/go.mod h1:p7Mg4+koNjc8jkqwcoFBJx7tXkpj00G77X7A72jXPXA= modernc.org/libc v1.17.0/go.mod h1:XsgLldpP4aWlPlsjqKRdHPqCxCjISdHfM/yeWC5GyW0= modernc.org/libc v1.17.1/go.mod h1:FZ23b+8LjxZs7XtFMbSzL/EhPxNbfZbErxEHc7cbD9s= +modernc.org/libc v1.55.3 h1:AzcW1mhlPNrRtjS5sS+eW2ISCgSOLLNyFzRh/V3Qj/U= +modernc.org/libc v1.55.3/go.mod h1:qFXepLhz+JjFThQ4kzwzOjA/y/artDeg+pcYnY+Q83w= modernc.org/mathutil v1.1.1/go.mod h1:mZW8CKdRPY1v87qxC/wUdX5O1qDzXMP5TH3wjfpga6E= modernc.org/mathutil v1.2.2/go.mod h1:mZW8CKdRPY1v87qxC/wUdX5O1qDzXMP5TH3wjfpga6E= modernc.org/mathutil v1.4.1/go.mod h1:mZW8CKdRPY1v87qxC/wUdX5O1qDzXMP5TH3wjfpga6E= @@ -2463,10 +2501,13 @@ modernc.org/memory v1.2.1/go.mod h1:PkUhL0Mugw21sHPeskwZW4D6VscE/GQJOnIpCnW6pSU= modernc.org/memory v1.8.0 h1:IqGTL6eFMaDZZhEWwcREgeMXYwmW83LYW8cROZYkg+E= modernc.org/memory v1.8.0/go.mod h1:XPZ936zp5OMKGWPqbD3JShgd/ZoQ7899TUuQqxY+peU= modernc.org/opt v0.1.1/go.mod h1:WdSiB5evDcignE70guQKxYUl14mgWtbClRi5wmkkTX0= +modernc.org/opt v0.1.3 h1:3XOZf2yznlhC+ibLltsDGzABUGVx8J6pnFMS3E4dcq4= modernc.org/opt v0.1.3/go.mod h1:WdSiB5evDcignE70guQKxYUl14mgWtbClRi5wmkkTX0= +modernc.org/sortutil v1.2.0 h1:jQiD3PfS2REGJNzNCMMaLSp/wdMNieTbKX920Cqdgqc= +modernc.org/sortutil v1.2.0/go.mod h1:TKU2s7kJMf1AE84OoiGppNHJwvB753OYfNl2WRb++Ss= modernc.org/sqlite v1.18.1/go.mod h1:6ho+Gow7oX5V+OiOQ6Tr4xeqbx13UZ6t+Fw9IRUG4d4= -modernc.org/sqlite v1.33.0 h1:WWkA/T2G17okiLGgKAj4/RMIvgyMT19yQ038160IeYk= -modernc.org/sqlite v1.33.0/go.mod h1:9uQ9hF/pCZoYZK73D/ud5Z7cIRIILSZI8NdIemVMTX8= +modernc.org/sqlite v1.33.1 h1:trb6Z3YYoeM9eDL1O8do81kP+0ejv+YzgyFo+Gwy0nM= +modernc.org/sqlite v1.33.1/go.mod h1:pXV2xHxhzXZsgT/RtTFAPY6JJDEvOTcTdwADQCCWD4k= modernc.org/strutil v1.1.0/go.mod h1:lstksw84oURvj9y3tn8lGvRxyRC1S2+g5uuIzNfIOBs= modernc.org/strutil v1.1.1/go.mod h1:DE+MQQ/hjKBZS2zNInV5hhcipt5rLPWkmpbGeW5mmdw= modernc.org/strutil v1.1.3/go.mod h1:MEHNA7PdEnEwLvspRMtWTNnp2nnyvMfkimT1NKNAGbw= diff --git a/k8s/charts/seaweedfs/Chart.yaml b/k8s/charts/seaweedfs/Chart.yaml index 4c0a395ba..24f46ffec 100644 --- a/k8s/charts/seaweedfs/Chart.yaml +++ b/k8s/charts/seaweedfs/Chart.yaml @@ -1,6 +1,6 @@ apiVersion: v1 description: SeaweedFS name: seaweedfs -appVersion: "3.73" +appVersion: "3.79" # Dev note: Trigger a helm chart release by `git tag -a helm-` -version: 4.0.1 +version: 4.0.379 diff --git a/k8s/charts/seaweedfs/templates/filer-cert.yaml b/k8s/charts/seaweedfs/templates/filer-cert.yaml index c17815af2..4cb117ae8 100644 --- a/k8s/charts/seaweedfs/templates/filer-cert.yaml +++ b/k8s/charts/seaweedfs/templates/filer-cert.yaml @@ -10,6 +10,10 @@ metadata: app.kubernetes.io/managed-by: {{ .Release.Service }} app.kubernetes.io/instance: {{ .Release.Name }} app.kubernetes.io/component: filer + {{- if .Values.filer.annotations }} + annotations: + {{- toYaml .Values.filer.annotations | nindent 4 }} + {{- end }} spec: secretName: {{ template "seaweedfs.name" . }}-filer-cert issuerRef: diff --git a/k8s/charts/seaweedfs/templates/filer-service-client.yaml b/k8s/charts/seaweedfs/templates/filer-service-client.yaml index d7618c4cb..1c32de0ba 100644 --- a/k8s/charts/seaweedfs/templates/filer-service-client.yaml +++ b/k8s/charts/seaweedfs/templates/filer-service-client.yaml @@ -13,6 +13,10 @@ metadata: {{- if .Values.filer.metricsPort }} monitoring: "true" {{- end }} +{{- if .Values.filer.annotations }} + annotations: + {{- toYaml .Values.filer.annotations | nindent 4 }} +{{- end }} spec: clusterIP: None ports: diff --git a/k8s/charts/seaweedfs/templates/filer-service.yaml b/k8s/charts/seaweedfs/templates/filer-service.yaml index ab7e98df8..67436972e 100644 --- a/k8s/charts/seaweedfs/templates/filer-service.yaml +++ b/k8s/charts/seaweedfs/templates/filer-service.yaml @@ -12,6 +12,10 @@ metadata: app.kubernetes.io/managed-by: {{ .Release.Service }} app.kubernetes.io/instance: {{ .Release.Name }} app.kubernetes.io/component: filer +{{- if .Values.filer.annotations }} + annotations: + {{- toYaml .Values.filer.annotations | nindent 4 }} +{{- end }} spec: clusterIP: None publishNotReadyAddresses: true diff --git a/k8s/charts/seaweedfs/templates/filer-servicemonitor.yaml b/k8s/charts/seaweedfs/templates/filer-servicemonitor.yaml index 76c981c1a..e26c04b1f 100644 --- a/k8s/charts/seaweedfs/templates/filer-servicemonitor.yaml +++ b/k8s/charts/seaweedfs/templates/filer-servicemonitor.yaml @@ -15,6 +15,10 @@ metadata: {{- with .Values.global.monitoring.additionalLabels }} {{- toYaml . | nindent 4 }} {{- end }} +{{- if .Values.filer.annotations }} + annotations: + {{- toYaml .Values.filer.annotations | nindent 4 }} +{{- end }} spec: endpoints: - interval: 30s diff --git a/k8s/charts/seaweedfs/templates/filer-statefulset.yaml b/k8s/charts/seaweedfs/templates/filer-statefulset.yaml index d02099e50..5ac84bdf7 100644 --- a/k8s/charts/seaweedfs/templates/filer-statefulset.yaml +++ b/k8s/charts/seaweedfs/templates/filer-statefulset.yaml @@ -10,6 +10,10 @@ metadata: app.kubernetes.io/managed-by: {{ .Release.Service }} app.kubernetes.io/instance: {{ .Release.Name }} app.kubernetes.io/component: filer +{{- if .Values.filer.annotations }} + annotations: + {{- toYaml .Values.filer.annotations | nindent 4 }} +{{- end }} spec: serviceName: {{ template "seaweedfs.name" . }}-filer podManagementPolicy: {{ .Values.filer.podManagementPolicy }} @@ -57,6 +61,10 @@ spec: affinity: {{ tpl .Values.filer.affinity . | nindent 8 | trim }} {{- end }} + {{- with .Values.filer.topologySpreadConstraints }} + topologySpreadConstraints: + {{- toYaml . | nindent 8 }} + {{- end }} {{- if .Values.filer.tolerations }} tolerations: {{ tpl .Values.filer.tolerations . | nindent 8 | trim }} @@ -182,6 +190,12 @@ spec: {{- if .Values.filer.filerGroup}} -filerGroup={{ .Values.filer.filerGroup}} \ {{- end }} + {{- if .Values.filer.rack }} + -rack={{ .Values.filer.rack }} \ + {{- end }} + {{- if .Values.filer.dataCenter }} + -dataCenter={{ .Values.filer.dataCenter }} \ + {{- end }} {{- if .Values.filer.s3.enabled }} -s3 \ -s3.port={{ .Values.filer.s3.port }} \ @@ -220,6 +234,12 @@ spec: - name: data-filer mountPath: /data {{- end }} + {{- if .Values.filer.notificationConfig }} + - name: notification-config + readOnly: true + mountPath: /etc/seaweedfs/notification.toml + subPath: notification.toml + {{- end }} {{- if .Values.global.enableSecurity }} - name: security-config readOnly: true @@ -335,6 +355,11 @@ spec: secretName: seaweedfs-s3-secret {{- end }} {{- end }} + {{- if .Values.filer.notificationConfig }} + - name: notification-config + configMap: + name: {{ template "seaweedfs.name" . }}-notification-config + {{- end }} {{- if .Values.global.enableSecurity }} - name: security-config configMap: diff --git a/k8s/charts/seaweedfs/templates/master-cert.yaml b/k8s/charts/seaweedfs/templates/master-cert.yaml index 47dcaacd3..256785254 100644 --- a/k8s/charts/seaweedfs/templates/master-cert.yaml +++ b/k8s/charts/seaweedfs/templates/master-cert.yaml @@ -10,6 +10,10 @@ metadata: app.kubernetes.io/managed-by: {{ .Release.Service }} app.kubernetes.io/instance: {{ .Release.Name }} app.kubernetes.io/component: master +{{- if .Values.master.annotations }} + annotations: + {{- toYaml .Values.master.annotations | nindent 4 }} +{{- end }} spec: secretName: {{ template "seaweedfs.name" . }}-master-cert issuerRef: diff --git a/k8s/charts/seaweedfs/templates/master-configmap.yaml b/k8s/charts/seaweedfs/templates/master-configmap.yaml index 73155e87d..58c676f5e 100644 --- a/k8s/charts/seaweedfs/templates/master-configmap.yaml +++ b/k8s/charts/seaweedfs/templates/master-configmap.yaml @@ -9,6 +9,10 @@ metadata: helm.sh/chart: {{ .Chart.Name }}-{{ .Chart.Version | replace "+" "_" }} app.kubernetes.io/managed-by: {{ .Release.Service }} app.kubernetes.io/instance: {{ .Release.Name }} +{{- if .Values.master.annotations }} + annotations: + {{- toYaml .Values.master.annotations | nindent 4 }} +{{- end }} data: master.toml: |- {{ .Values.master.config | nindent 4 }} diff --git a/k8s/charts/seaweedfs/templates/master-service.yaml b/k8s/charts/seaweedfs/templates/master-service.yaml index 9e69f94e5..0086b84c1 100644 --- a/k8s/charts/seaweedfs/templates/master-service.yaml +++ b/k8s/charts/seaweedfs/templates/master-service.yaml @@ -11,6 +11,9 @@ metadata: app.kubernetes.io/managed-by: {{ .Release.Service }} annotations: service.alpha.kubernetes.io/tolerate-unready-endpoints: "true" +{{- if .Values.master.annotations }} + {{- toYaml .Values.master.annotations | nindent 4 }} +{{- end }} spec: clusterIP: None publishNotReadyAddresses: true diff --git a/k8s/charts/seaweedfs/templates/master-servicemonitor.yaml b/k8s/charts/seaweedfs/templates/master-servicemonitor.yaml index 81cade2ef..7804e84ae 100644 --- a/k8s/charts/seaweedfs/templates/master-servicemonitor.yaml +++ b/k8s/charts/seaweedfs/templates/master-servicemonitor.yaml @@ -15,6 +15,10 @@ metadata: {{- with .Values.global.monitoring.additionalLabels }} {{- toYaml . | nindent 4 }} {{- end }} +{{- if .Values.master.annotations }} + annotations: + {{- toYaml .Values.master.annotations | nindent 4 }} +{{- end }} spec: endpoints: - interval: 30s diff --git a/k8s/charts/seaweedfs/templates/master-statefulset.yaml b/k8s/charts/seaweedfs/templates/master-statefulset.yaml index 73d1f9fb3..c46d37166 100644 --- a/k8s/charts/seaweedfs/templates/master-statefulset.yaml +++ b/k8s/charts/seaweedfs/templates/master-statefulset.yaml @@ -9,6 +9,10 @@ metadata: helm.sh/chart: {{ .Chart.Name }}-{{ .Chart.Version | replace "+" "_" }} app.kubernetes.io/managed-by: {{ .Release.Service }} app.kubernetes.io/instance: {{ .Release.Name }} +{{- if .Values.master.annotations }} + annotations: + {{- toYaml .Values.master.annotations | nindent 4 }} +{{- end }} spec: serviceName: {{ template "seaweedfs.name" . }}-master podManagementPolicy: {{ .Values.master.podManagementPolicy }} @@ -50,6 +54,10 @@ spec: affinity: {{ tpl .Values.master.affinity . | nindent 8 | trim }} {{- end }} + {{- with .Values.master.topologySpreadConstraints }} + topologySpreadConstraints: + {{- toYaml . | nindent 8 }} + {{- end }} {{- if .Values.master.tolerations }} tolerations: {{ tpl .Values.master.tolerations . | nindent 8 | trim }} diff --git a/k8s/charts/seaweedfs/templates/notification-configmap.yaml b/k8s/charts/seaweedfs/templates/notification-configmap.yaml new file mode 100644 index 000000000..c638c8771 --- /dev/null +++ b/k8s/charts/seaweedfs/templates/notification-configmap.yaml @@ -0,0 +1,19 @@ +{{- if and .Values.filer.enabled .Values.filer.notificationConfig }} +apiVersion: v1 +kind: ConfigMap +metadata: + name: {{ template "seaweedfs.name" . }}-notification-config + namespace: {{ .Release.Namespace }} + labels: + app.kubernetes.io/name: {{ template "seaweedfs.name" . }} + helm.sh/chart: {{ .Chart.Name }}-{{ .Chart.Version | replace "+" "_" }} + app.kubernetes.io/managed-by: {{ .Release.Service }} + app.kubernetes.io/instance: {{ .Release.Name }} +{{- if .Values.filer.annotations }} + annotations: + {{- toYaml .Values.filer.annotations | nindent 4 }} +{{- end }} +data: + notification.toml: |- + {{ .Values.filer.notificationConfig | nindent 4 }} +{{- end }} diff --git a/k8s/charts/seaweedfs/templates/s3-deployment.yaml b/k8s/charts/seaweedfs/templates/s3-deployment.yaml index 02c1ed21a..1c989c3fb 100644 --- a/k8s/charts/seaweedfs/templates/s3-deployment.yaml +++ b/k8s/charts/seaweedfs/templates/s3-deployment.yaml @@ -9,12 +9,15 @@ metadata: helm.sh/chart: {{ .Chart.Name }}-{{ .Chart.Version | replace "+" "_" }} app.kubernetes.io/managed-by: {{ .Release.Service }} app.kubernetes.io/instance: {{ .Release.Name }} +{{- if .Values.s3.annotations }} + annotations: + {{- toYaml .Values.s3.annotations | nindent 4 }} +{{- end }} spec: replicas: {{ .Values.s3.replicas }} selector: matchLabels: app.kubernetes.io/name: {{ template "seaweedfs.name" . }} - helm.sh/chart: {{ .Chart.Name }}-{{ .Chart.Version | replace "+" "_" }} app.kubernetes.io/instance: {{ .Release.Name }} app.kubernetes.io/component: s3 template: diff --git a/k8s/charts/seaweedfs/templates/s3-service.yaml b/k8s/charts/seaweedfs/templates/s3-service.yaml index 01d79ad74..8afd48654 100644 --- a/k8s/charts/seaweedfs/templates/s3-service.yaml +++ b/k8s/charts/seaweedfs/templates/s3-service.yaml @@ -9,6 +9,10 @@ metadata: app.kubernetes.io/component: s3 helm.sh/chart: {{ .Chart.Name }}-{{ .Chart.Version | replace "+" "_" }} app.kubernetes.io/managed-by: {{ .Release.Service }} +{{- if .Values.s3.annotations }} + annotations: + {{- toYaml .Values.s3.annotations | nindent 4 }} +{{- end }} spec: internalTrafficPolicy: {{ .Values.s3.internalTrafficPolicy | default "Cluster" }} ports: diff --git a/k8s/charts/seaweedfs/templates/s3-servicemonitor.yaml b/k8s/charts/seaweedfs/templates/s3-servicemonitor.yaml index b47ba8ee6..03d35cd4a 100644 --- a/k8s/charts/seaweedfs/templates/s3-servicemonitor.yaml +++ b/k8s/charts/seaweedfs/templates/s3-servicemonitor.yaml @@ -15,6 +15,10 @@ metadata: {{- with .Values.global.monitoring.additionalLabels }} {{- toYaml . | nindent 4 }} {{- end }} +{{- if .Values.s3.annotations }} + annotations: + {{- toYaml .Values.s3.annotations | nindent 4 }} +{{- end }} spec: endpoints: - interval: 30s diff --git a/k8s/charts/seaweedfs/templates/volume-cert.yaml b/k8s/charts/seaweedfs/templates/volume-cert.yaml index 4df63db2c..bd59a676d 100644 --- a/k8s/charts/seaweedfs/templates/volume-cert.yaml +++ b/k8s/charts/seaweedfs/templates/volume-cert.yaml @@ -10,6 +10,10 @@ metadata: app.kubernetes.io/managed-by: {{ .Release.Service }} app.kubernetes.io/instance: {{ .Release.Name }} app.kubernetes.io/component: volume +{{- if .Values.volume.annotations }} + annotations: + {{- toYaml .Values.volume.annotations | nindent 4 }} +{{- end }} spec: secretName: {{ template "seaweedfs.name" . }}-volume-cert issuerRef: diff --git a/k8s/charts/seaweedfs/templates/volume-service.yaml b/k8s/charts/seaweedfs/templates/volume-service.yaml index 1205f4fad..f881d27f3 100644 --- a/k8s/charts/seaweedfs/templates/volume-service.yaml +++ b/k8s/charts/seaweedfs/templates/volume-service.yaml @@ -9,6 +9,10 @@ metadata: app.kubernetes.io/component: volume helm.sh/chart: {{ .Chart.Name }}-{{ .Chart.Version | replace "+" "_" }} app.kubernetes.io/managed-by: {{ .Release.Service }} +{{- if .Values.volume.annotations }} + annotations: + {{- toYaml .Values.volume.annotations | nindent 4 }} +{{- end }} spec: clusterIP: None internalTrafficPolicy: {{ .Values.volume.internalTrafficPolicy | default "Cluster" }} diff --git a/k8s/charts/seaweedfs/templates/volume-servicemonitor.yaml b/k8s/charts/seaweedfs/templates/volume-servicemonitor.yaml index 4aeacc416..8dfa96c97 100644 --- a/k8s/charts/seaweedfs/templates/volume-servicemonitor.yaml +++ b/k8s/charts/seaweedfs/templates/volume-servicemonitor.yaml @@ -15,6 +15,10 @@ metadata: {{- with .Values.global.monitoring.additionalLabels }} {{- toYaml . | nindent 4 }} {{- end }} +{{- if .Values.volume.annotations }} + annotations: + {{- toYaml .Values.volume.annotations | nindent 4 }} +{{- end }} spec: endpoints: - interval: 30s diff --git a/k8s/charts/seaweedfs/templates/volume-statefulset.yaml b/k8s/charts/seaweedfs/templates/volume-statefulset.yaml index 0a70d8c44..e915593a5 100644 --- a/k8s/charts/seaweedfs/templates/volume-statefulset.yaml +++ b/k8s/charts/seaweedfs/templates/volume-statefulset.yaml @@ -9,6 +9,10 @@ metadata: helm.sh/chart: {{ .Chart.Name }}-{{ .Chart.Version | replace "+" "_" }} app.kubernetes.io/managed-by: {{ .Release.Service }} app.kubernetes.io/instance: {{ .Release.Name }} +{{- if .Values.volume.annotations }} + annotations: + {{- toYaml .Values.volume.annotations | nindent 4 }} +{{- end }} spec: serviceName: {{ template "seaweedfs.name" . }}-volume replicas: {{ .Values.volume.replicas }} @@ -43,6 +47,10 @@ spec: affinity: {{ tpl .Values.volume.affinity . | nindent 8 | trim }} {{- end }} + {{- with .Values.volume.topologySpreadConstraints }} + topologySpreadConstraints: + {{- toYaml . | nindent 8 }} + {{- end }} restartPolicy: {{ default .Values.global.restartPolicy .Values.volume.restartPolicy }} {{- if .Values.volume.tolerations }} tolerations: @@ -146,7 +154,9 @@ spec: {{- if .Values.volume.idx }} -dir.idx=/idx \ {{- end }} - -max {{range $index, $dir := .Values.volume.dataDirs }}{{if ne $index 0}},{{end}}{{$dir.maxVolumes}}{{end}} \ + -max {{range $index, $dir := .Values.volume.dataDirs }}{{if ne $index 0}},{{end}} + {{- if eq ($dir.maxVolumes | toString) "0" }}0{{ else if not $dir.maxVolumes }}7{{ else }}{{$dir.maxVolumes}}{{ end }} + {{- end }} \ {{- if .Values.volume.rack }} -rack={{ .Values.volume.rack }} \ {{- end }} @@ -176,9 +186,11 @@ spec: -mserver={{ if .Values.global.masterServer }}{{.Values.global.masterServer}}{{ else }}{{ range $index := until (.Values.master.replicas | int) }}${SEAWEEDFS_FULLNAME}-master-{{ $index }}.${SEAWEEDFS_FULLNAME}-master.{{ $.Release.Namespace }}:{{ $.Values.master.port }}{{ if lt $index (sub ($.Values.master.replicas | int) 1) }},{{ end }}{{ end }}{{ end }} volumeMounts: {{- range $dir := .Values.volume.dataDirs }} + {{- if not ( eq $dir.type "custom" ) }} - name: {{ $dir.name }} mountPath: "/{{ $dir.name }}/" {{- end }} + {{- end }} {{- if .Values.volume.logs }} - name: logs mountPath: "/logs/" diff --git a/k8s/charts/seaweedfs/values.yaml b/k8s/charts/seaweedfs/values.yaml index c69e03183..2150ed724 100644 --- a/k8s/charts/seaweedfs/values.yaml +++ b/k8s/charts/seaweedfs/values.yaml @@ -140,6 +140,9 @@ master: # Annotations to be added to the master pods podAnnotations: {} + # Annotations to be added to the master resources + annotations: {} + ## Set podManagementPolicy podManagementPolicy: Parallel @@ -166,6 +169,11 @@ master: app.kubernetes.io/component: master topologyKey: kubernetes.io/hostname + # Topology Spread Constraints Settings + # This should map directly to the value of the topologySpreadConstraints + # for a PodSpec. By Default no constraints are set. + topologySpreadConstraints: {} + # Toleration Settings for master pods # This should be a multi-line string matching the Toleration array # in a PodSpec. @@ -301,6 +309,12 @@ volume: # - name: data # type: "emptyDir" # maxVolumes: 0 # If set to zero on non-windows OS, the limit will be auto configured. (default "7") + # + # If these don't meet your needs, you can use "custom" here along with extraVolumes and extraVolumeMounts + # Particularly useful when using more than 1 for the volume server replicas. + # - name: data + # type: "custom" + # maxVolumes: 0 # If set to zero on non-windows OS, the limit will be auto configured. (default "7") dataDirs: - name: data1 @@ -381,6 +395,15 @@ volume: sidecars: [] initContainers: "" + # Example for use when using more than 1 volume server replica + # extraVolumeMounts: | + # - name: drive + # mountPath: /drive + # subPathExpr: $(POD_NAME) + # extraVolumes: | + # - name: drive + # hostPath: + # path: /var/mnt/ extraVolumes: "" extraVolumeMounts: "" @@ -390,6 +413,9 @@ volume: # Annotations to be added to the volume pods podAnnotations: {} + # Annotations to be added to the volume resources + annotations: {} + ## Set podManagementPolicy podManagementPolicy: Parallel @@ -406,6 +432,11 @@ volume: app.kubernetes.io/component: volume topologyKey: kubernetes.io/hostname + # Topology Spread Constraints Settings + # This should map directly to the value of the topologySpreadConstraints + # for a PodSpec. By Default no constraints are set. + topologySpreadConstraints: {} + # Resource requests, limits, etc. for the server cluster placement. This # should map directly to the value of the resources field for a PodSpec, # formatted as a multi-line string. By default no direct resource request @@ -490,6 +521,10 @@ filer: metricsPort: 9327 loggingOverrideLevel: null filerGroup: "" + # prefer to read and write to volumes in this data center (not set by default) + dataCenter: null + # prefer to write to volumes in this rack (not set by default) + rack: null # replication type is XYZ: # X number of replica in other data centers # Y number of replica in other racks in the same data center @@ -511,6 +546,19 @@ filer: # Disable http request, only gRpc operations are allowed disableHttp: false + # Add a custom notification.toml to configure filer notifications + # Example: + # notificationConfig: |- + # [notification.kafka] + # enabled = false + # hosts = [ + # "localhost:9092" + # ] + # topic = "seaweedfs_filer" + # offsetFile = "./last.offset" + # offsetSaveIntervalSeconds = 10 + notificationConfig: "" + # DEPRECATE: enablePVC, storage, storageClass # Consider replacing with filer.data section below instead. @@ -584,6 +632,9 @@ filer: # Annotations to be added to the filer pods podAnnotations: {} + # Annotations to be added to the filer resource + annotations: {} + ## Set podManagementPolicy podManagementPolicy: Parallel @@ -600,6 +651,11 @@ filer: app.kubernetes.io/component: filer topologyKey: kubernetes.io/hostname + # Topology Spread Constraints Settings + # This should map directly to the value of the topologySpreadConstraints + # for a PodSpec. By Default no constraints are set. + topologySpreadConstraints: {} + # updatePartition is used to control a careful rolling update of SeaweedFS # masters. updatePartition: 0 @@ -673,7 +729,7 @@ filer: sub_filter '/seaweedfsstatic' './seaweedfsstatic'; sub_filter_once off; - # extraEnvVars is a list of extra enviroment variables to set with the stateful set. + # extraEnvVars is a list of extra environment variables to set with the stateful set. extraEnvironmentVars: WEED_MYSQL_ENABLED: "false" WEED_MYSQL_HOSTNAME: "mysql-db-host" @@ -798,6 +854,9 @@ s3: # Annotations to be added to the s3 pods podAnnotations: {} + # Annotations to be added to the s3 resources + annotations: {} + # Resource requests, limits, etc. for the server cluster placement. This # should map directly to the value of the resources field for a PodSpec, # formatted as a multi-line string. By default no direct resource request @@ -895,7 +954,7 @@ s3: # For more information, visit: https://container-object-storage-interface.github.io/docs/deployment-guide cosi: enabled: false - image: "ghcr.io/seaweedfs/seaweedfs-cosi-driver:v0.1.1" + image: "ghcr.io/seaweedfs/seaweedfs-cosi-driver:v0.1.2" driverName: "seaweedfs.objectstorage.k8s.io" bucketClassName: "seaweedfs" endpoint: "" diff --git a/other/metrics/grafana_seaweedfs.json b/other/metrics/grafana_seaweedfs.json index f4dc66419..84fd972cd 100644 --- a/other/metrics/grafana_seaweedfs.json +++ b/other/metrics/grafana_seaweedfs.json @@ -105,7 +105,7 @@ "steppedLine": false, "targets": [ { - "expr": "histogram_quantile(0.90, sum(rate(SeaweedFS_filer_request_seconds_bucket[1m])) by (le))", + "expr": "histogram_quantile(0.90, sum(rate(SeaweedFS_filerStore_request_seconds_bucket[1m])) by (le))", "format": "time_series", "hide": false, "intervalFactor": 2, @@ -114,7 +114,7 @@ "step": 60 }, { - "expr": "histogram_quantile(0.90, sum(rate(SeaweedFS_filer_request_seconds_bucket[1m])) by (le, type))", + "expr": "histogram_quantile(0.90, sum(rate(SeaweedFS_filerStore_request_seconds_bucket[1m])) by (le, type))", "format": "time_series", "hide": false, "intervalFactor": 2, @@ -200,7 +200,7 @@ "steppedLine": false, "targets": [ { - "expr": "histogram_quantile(0.95, sum(rate(SeaweedFS_filer_request_seconds_bucket[1m])) by (le))", + "expr": "histogram_quantile(0.95, sum(rate(SeaweedFS_filerStore_request_seconds_bucket[1m])) by (le))", "format": "time_series", "hide": false, "intervalFactor": 2, @@ -209,7 +209,7 @@ "step": 60 }, { - "expr": "histogram_quantile(0.95, sum(rate(SeaweedFS_filer_request_seconds_bucket[1m])) by (le, type))", + "expr": "histogram_quantile(0.95, sum(rate(SeaweedFS_filerStore_request_seconds_bucket[1m])) by (le, type))", "format": "time_series", "hide": false, "intervalFactor": 2, @@ -301,7 +301,7 @@ "steppedLine": false, "targets": [ { - "expr": "histogram_quantile(0.99, sum(rate(SeaweedFS_filer_request_seconds_bucket[1m])) by (le))", + "expr": "histogram_quantile(0.99, sum(rate(SeaweedFS_filerStore_request_seconds_bucket[1m])) by (le))", "format": "time_series", "hide": false, "intervalFactor": 2, @@ -310,7 +310,7 @@ "step": 60 }, { - "expr": "histogram_quantile(0.99, sum(rate(SeaweedFS_filer_request_seconds_bucket[1m])) by (le, type))", + "expr": "histogram_quantile(0.99, sum(rate(SeaweedFS_filerStore_request_seconds_bucket[1m])) by (le, type))", "format": "time_series", "hide": false, "intervalFactor": 2, @@ -415,7 +415,7 @@ "steppedLine": false, "targets": [ { - "expr": "rate(SeaweedFS_filer_request_total[1m])", + "expr": "rate(SeaweedFS_filerStore_request_total[1m])", "format": "time_series", "intervalFactor": 2, "legendFormat": "{{type}}", diff --git a/weed/command/benchmark.go b/weed/command/benchmark.go index bc7ee1292..08db2ef3d 100644 --- a/weed/command/benchmark.go +++ b/weed/command/benchmark.go @@ -21,8 +21,8 @@ import ( "github.com/seaweedfs/seaweedfs/weed/operation" "github.com/seaweedfs/seaweedfs/weed/security" "github.com/seaweedfs/seaweedfs/weed/util" - "github.com/seaweedfs/seaweedfs/weed/wdclient" util_http "github.com/seaweedfs/seaweedfs/weed/util/http" + "github.com/seaweedfs/seaweedfs/weed/wdclient" ) type BenchmarkOptions struct { @@ -242,7 +242,7 @@ func writeFiles(idChan chan int, fileIdLineChan chan string, s *stat) { DiskType: *b.diskType, } if assignResult, err := operation.Assign(b.masterClient.GetMaster, b.grpcDialOption, ar); err == nil { - fp.Server, fp.Fid, fp.Collection = assignResult.Url, assignResult.Fid, *b.collection + fp.Server, fp.Fid, fp.Pref.Collection = assignResult.Url, assignResult.Fid, *b.collection if !isSecure && assignResult.Auth != "" { isSecure = true } diff --git a/weed/command/filer_copy.go b/weed/command/filer_copy.go index 0342aa585..9b195e4e8 100644 --- a/weed/command/filer_copy.go +++ b/weed/command/filer_copy.go @@ -22,7 +22,6 @@ import ( "github.com/seaweedfs/seaweedfs/weed/storage/needle" "github.com/seaweedfs/seaweedfs/weed/util" "github.com/seaweedfs/seaweedfs/weed/util/grace" - "github.com/seaweedfs/seaweedfs/weed/wdclient" ) var ( @@ -37,7 +36,6 @@ type CopyOptions struct { ttl *string diskType *string maxMB *int - masterClient *wdclient.MasterClient concurrentFiles *int concurrentChunks *int grpcDialOption grpc.DialOption diff --git a/weed/command/mount_std.go b/weed/command/mount_std.go index 0ab794bbd..365a65c6d 100644 --- a/weed/command/mount_std.go +++ b/weed/command/mount_std.go @@ -248,6 +248,7 @@ func RunMount(option *MountOptions, umask os.FileMode) bool { Cipher: cipher, UidGidMapper: uidGidMapper, DisableXAttr: *option.disableXAttr, + IsMacOs: runtime.GOOS == "darwin", }) // create mount root diff --git a/weed/command/update_full.go b/weed/command/update_full.go index f2dfb2b85..fcf4364d1 100644 --- a/weed/command/update_full.go +++ b/weed/command/update_full.go @@ -1,5 +1,5 @@ -//go:build elastic && ydb && gocdk && tikv -// +build elastic,ydb,gocdk,tikv +//go:build elastic && gocdk && rclone && sqlite && tikv && ydb +// +build elastic,gocdk,rclone,sqlite,tikv,ydb package command diff --git a/weed/command/upload.go b/weed/command/upload.go index 7135a707a..9f9ac1107 100644 --- a/weed/command/upload.go +++ b/weed/command/upload.go @@ -97,7 +97,14 @@ func runUpload(cmd *Command, args []string) bool { if e != nil { return e } - results, e := operation.SubmitFiles(func(_ context.Context) pb.ServerAddress { return pb.ServerAddress(*upload.master) }, grpcDialOption, parts, *upload.replication, *upload.collection, *upload.dataCenter, *upload.ttl, *upload.diskType, *upload.maxMB, *upload.usePublicUrl) + results, e := operation.SubmitFiles(func(_ context.Context) pb.ServerAddress { return pb.ServerAddress(*upload.master) }, grpcDialOption, parts, operation.StoragePreference{ + Replication: *upload.replication, + Collection: *upload.collection, + DataCenter: *upload.dataCenter, + Ttl: *upload.ttl, + DiskType: *upload.diskType, + MaxMB: *upload.maxMB, + }, *upload.usePublicUrl) bytes, _ := json.Marshal(results) fmt.Println(string(bytes)) if e != nil { @@ -119,7 +126,14 @@ func runUpload(cmd *Command, args []string) bool { fmt.Println(e.Error()) return false } - results, err := operation.SubmitFiles(func(_ context.Context) pb.ServerAddress { return pb.ServerAddress(*upload.master) }, grpcDialOption, parts, *upload.replication, *upload.collection, *upload.dataCenter, *upload.ttl, *upload.diskType, *upload.maxMB, *upload.usePublicUrl) + results, err := operation.SubmitFiles(func(_ context.Context) pb.ServerAddress { return pb.ServerAddress(*upload.master) }, grpcDialOption, parts, operation.StoragePreference{ + Replication: *upload.replication, + Collection: *upload.collection, + DataCenter: *upload.dataCenter, + Ttl: *upload.ttl, + DiskType: *upload.diskType, + MaxMB: *upload.maxMB, + }, *upload.usePublicUrl) if err != nil { fmt.Println(err.Error()) return false diff --git a/weed/filer/filechunk_section.go b/weed/filer/filechunk_section.go index ba591d9ac..75273a1ca 100644 --- a/weed/filer/filechunk_section.go +++ b/weed/filer/filechunk_section.go @@ -1,8 +1,9 @@ package filer import ( - "github.com/seaweedfs/seaweedfs/weed/pb/filer_pb" "sync" + + "github.com/seaweedfs/seaweedfs/weed/pb/filer_pb" ) const SectionSize = 2 * 1024 * 1024 * 32 // 64MiB @@ -62,11 +63,6 @@ func removeGarbageChunks(section *FileChunkSection, garbageFileIds map[string]st } func (section *FileChunkSection) setupForRead(group *ChunkGroup, fileSize int64) { - if section.isPrepared { - section.reader.fileSize = fileSize - return - } - section.lock.Lock() defer section.lock.Unlock() diff --git a/weed/filer/filer_notify_read.go b/weed/filer/filer_notify_read.go index 115a925e9..ac2c763e6 100644 --- a/weed/filer/filer_notify_read.go +++ b/weed/filer/filer_notify_read.go @@ -4,15 +4,16 @@ import ( "container/heap" "context" "fmt" - "github.com/seaweedfs/seaweedfs/weed/pb/filer_pb" - "github.com/seaweedfs/seaweedfs/weed/util/log_buffer" - "github.com/seaweedfs/seaweedfs/weed/wdclient" - "google.golang.org/protobuf/proto" "io" "math" "strings" "time" + "github.com/seaweedfs/seaweedfs/weed/pb/filer_pb" + "github.com/seaweedfs/seaweedfs/weed/util/log_buffer" + "github.com/seaweedfs/seaweedfs/weed/wdclient" + "google.golang.org/protobuf/proto" + "github.com/seaweedfs/seaweedfs/weed/glog" "github.com/seaweedfs/seaweedfs/weed/util" ) @@ -39,6 +40,19 @@ func (f *Filer) collectPersistedLogBuffer(startPosition log_buffer.MessagePositi } +func (f *Filer) HasPersistedLogFiles(startPosition log_buffer.MessagePosition) (bool, error) { + startDate := fmt.Sprintf("%04d-%02d-%02d", startPosition.Year(), startPosition.Month(), startPosition.Day()) + dayEntries, _, listDayErr := f.ListDirectoryEntries(context.Background(), SystemLogDir, startDate, true, 1, "", "", "") + + if listDayErr != nil { + return false, fmt.Errorf("fail to list log by day: %v", listDayErr) + } + if len(dayEntries) == 0 { + return false, nil + } + return true, nil +} + // ---------- type LogEntryItem struct { Entry *filer_pb.LogEntry @@ -103,7 +117,7 @@ func (o *OrderedLogVisitor) GetNext() (logEntry *filer_pb.LogEntry, err error) { if nextErr != nil { if nextErr == io.EOF { // do nothing since the filer has no more log entries - }else { + } else { return nil, fmt.Errorf("failed to get next log entry: %v", nextErr) } } else { @@ -230,7 +244,7 @@ func (c *LogFileEntryCollector) collectMore(v *OrderedLogVisitor) (err error) { if nextErr != nil { if nextErr == io.EOF { // do nothing since the filer has no more log entries - }else { + } else { return fmt.Errorf("failed to get next log entry for %v: %v", entryName, err) } } else { diff --git a/weed/filer/filerstore_wrapper.go b/weed/filer/filerstore_wrapper.go index 9c448edfd..ebaf04065 100644 --- a/weed/filer/filerstore_wrapper.go +++ b/weed/filer/filerstore_wrapper.go @@ -164,6 +164,9 @@ func (fsw *FilerStoreWrapper) FindEntry(ctx context.Context, fp util.FullPath) ( entry, err = actualStore.FindEntry(ctx, fp) // glog.V(4).Infof("FindEntry %s: %v", fp, err) if err != nil { + if fsw.CanDropWholeBucket() && strings.Contains(err.Error(), "Table") && strings.Contains(err.Error(), "doesn't exist") { + err = filer_pb.ErrNotFound + } return nil, err } diff --git a/weed/filer/reader_at.go b/weed/filer/reader_at.go index 24162995e..b87fa0411 100644 --- a/weed/filer/reader_at.go +++ b/weed/filer/reader_at.go @@ -97,6 +97,10 @@ func NewChunkReaderAtFromClient(readerCache *ReaderCache, chunkViews *IntervalLi } } +func (c *ChunkReadAt) Size() int64 { + return c.fileSize +} + func (c *ChunkReadAt) Close() error { c.readerCache.destroy() return nil @@ -169,15 +173,14 @@ func (c *ChunkReadAt) doReadAt(p []byte, offset int64) (n int, ts int64, err err // zero the remaining bytes if a gap exists at the end of the last chunk (or a fully sparse file) if err == nil && remaining > 0 { var delta int64 - if c.fileSize > startOffset { + if c.fileSize >= startOffset { delta = min(remaining, c.fileSize-startOffset) startOffset -= offset - } else { - delta = remaining - startOffset = max(startOffset-offset, startOffset-remaining-offset) } - glog.V(4).Infof("zero2 [%d,%d) of file size %d bytes", startOffset, startOffset+delta, c.fileSize) - n += zero(p, startOffset, delta) + if delta > 0 { + glog.V(4).Infof("zero2 [%d,%d) of file size %d bytes", startOffset, startOffset+delta, c.fileSize) + n += zero(p, startOffset, delta) + } } if err == nil && offset+int64(len(p)) >= c.fileSize { @@ -216,6 +219,9 @@ func (c *ChunkReadAt) readChunkSliceAt(buffer []byte, chunkView *ChunkView, next } func zero(buffer []byte, start, length int64) int { + if length <= 0 { + return 0 + } end := min(start+length, int64(len(buffer))) start = max(start, 0) diff --git a/weed/filer/reader_at_test.go b/weed/filer/reader_at_test.go index 0d95d1aad..6d985a397 100644 --- a/weed/filer/reader_at_test.go +++ b/weed/filer/reader_at_test.go @@ -31,7 +31,7 @@ func (m *mockChunkCache) ReadChunkAt(data []byte, fileId string, offset uint64) func (m *mockChunkCache) SetChunk(fileId string, data []byte) { } -func (m *mockChunkCache) GetMaxFilePartSizeInCache() (uint64) { +func (m *mockChunkCache) GetMaxFilePartSizeInCache() uint64 { return 0 } @@ -81,7 +81,7 @@ func TestReaderAt(t *testing.T) { } testReadAt(t, readerAt, 0, 10, 10, io.EOF, nil, nil) - testReadAt(t, readerAt, 0, 12, 12, io.EOF, nil, nil) + testReadAt(t, readerAt, 0, 12, 10, io.EOF, nil, nil) testReadAt(t, readerAt, 2, 8, 8, io.EOF, nil, nil) testReadAt(t, readerAt, 3, 6, 6, nil, nil, nil) @@ -131,8 +131,8 @@ func TestReaderAt0(t *testing.T) { testReadAt(t, readerAt, 3, 16, 7, io.EOF, nil, nil) testReadAt(t, readerAt, 3, 5, 5, nil, nil, nil) - testReadAt(t, readerAt, 11, 5, 5, io.EOF, nil, nil) - testReadAt(t, readerAt, 10, 5, 5, io.EOF, nil, nil) + testReadAt(t, readerAt, 11, 5, 0, io.EOF, nil, nil) + testReadAt(t, readerAt, 10, 5, 0, io.EOF, nil, nil) } diff --git a/weed/filer/topics.go b/weed/filer/topics.go index 3a2fde8c4..707a4f878 100644 --- a/weed/filer/topics.go +++ b/weed/filer/topics.go @@ -1,6 +1,7 @@ package filer const ( - TopicsDir = "/topics" - SystemLogDir = TopicsDir + "/.system/log" + TopicsDir = "/topics" + SystemLogDir = TopicsDir + "/.system/log" + TopicConfFile = "topic.conf" ) diff --git a/weed/filer_client/filer_client_accessor.go b/weed/filer_client/filer_client_accessor.go index be70f2b82..20646d343 100644 --- a/weed/filer_client/filer_client_accessor.go +++ b/weed/filer_client/filer_client_accessor.go @@ -1,16 +1,12 @@ package filer_client import ( - "bytes" - "fmt" - "github.com/seaweedfs/seaweedfs/weed/filer" "github.com/seaweedfs/seaweedfs/weed/glog" "github.com/seaweedfs/seaweedfs/weed/mq/topic" "github.com/seaweedfs/seaweedfs/weed/pb" "github.com/seaweedfs/seaweedfs/weed/pb/filer_pb" "github.com/seaweedfs/seaweedfs/weed/pb/mq_pb" "google.golang.org/grpc" - jsonpb "google.golang.org/protobuf/encoding/protojson" ) type FilerClientAccessor struct { @@ -22,41 +18,23 @@ func (fca *FilerClientAccessor) WithFilerClient(streamingMode bool, fn func(file return pb.WithFilerClient(streamingMode, 0, fca.GetFiler(), fca.GetGrpcDialOption(), fn) } -func (fca *FilerClientAccessor) SaveTopicConfToFiler(t *mq_pb.Topic, conf *mq_pb.ConfigureTopicResponse) error { +func (fca *FilerClientAccessor) SaveTopicConfToFiler(t topic.Topic, conf *mq_pb.ConfigureTopicResponse) error { glog.V(0).Infof("save conf for topic %v to filer", t) // save the topic configuration on filer - topicDir := fmt.Sprintf("%s/%s/%s", filer.TopicsDir, t.Namespace, t.Name) - if err := fca.WithFilerClient(false, func(client filer_pb.SeaweedFilerClient) error { - var buf bytes.Buffer - filer.ProtoToText(&buf, conf) - return filer.SaveInsideFiler(client, topicDir, "topic.conf", buf.Bytes()) - }); err != nil { - return fmt.Errorf("save topic to %s: %v", topicDir, err) - } - return nil + return fca.WithFilerClient(false, func(client filer_pb.SeaweedFilerClient) error { + return t.WriteConfFile(client, conf) + }) } func (fca *FilerClientAccessor) ReadTopicConfFromFiler(t topic.Topic) (conf *mq_pb.ConfigureTopicResponse, err error) { - glog.V(0).Infof("load conf for topic %v from filer", t) + glog.V(1).Infof("load conf for topic %v from filer", t) - topicDir := fmt.Sprintf("%s/%s/%s", filer.TopicsDir, t.Namespace, t.Name) if err = fca.WithFilerClient(false, func(client filer_pb.SeaweedFilerClient) error { - data, err := filer.ReadInsideFiler(client, topicDir, "topic.conf") - if err == filer_pb.ErrNotFound { - return err - } - if err != nil { - return fmt.Errorf("read topic.conf of %v: %v", t, err) - } - // parse into filer conf object - conf = &mq_pb.ConfigureTopicResponse{} - if err = jsonpb.Unmarshal(data, conf); err != nil { - return fmt.Errorf("unmarshal topic %v conf: %v", t, err) - } - return nil + conf, err = t.ReadConfFile(client) + return err }); err != nil { return nil, err } diff --git a/weed/mount/filehandle_read.go b/weed/mount/filehandle_read.go index faf99952f..a609c97cc 100644 --- a/weed/mount/filehandle_read.go +++ b/weed/mount/filehandle_read.go @@ -47,6 +47,8 @@ func (fh *FileHandle) readFromChunks(buff []byte, offset int64) (int64, int64, e if fileSize == 0 { glog.V(1).Infof("empty fh %v", fileFullPath) return 0, 0, io.EOF + } else if offset == fileSize { + return 0, 0, io.EOF } else if offset >= fileSize { glog.V(1).Infof("invalid read, fileSize %d, offset %d for %s", fileSize, offset, fileFullPath) return 0, 0, io.EOF diff --git a/weed/mount/filer_conf.go b/weed/mount/filer_conf.go index ef8508023..bb5f33ce3 100644 --- a/weed/mount/filer_conf.go +++ b/weed/mount/filer_conf.go @@ -1,20 +1,17 @@ package mount import ( + "errors" "fmt" - "path/filepath" - "sync/atomic" - "time" - "github.com/seaweedfs/seaweedfs/weed/filer" "github.com/seaweedfs/seaweedfs/weed/glog" - "github.com/seaweedfs/seaweedfs/weed/pb" + "github.com/seaweedfs/seaweedfs/weed/mount/meta_cache" "github.com/seaweedfs/seaweedfs/weed/pb/filer_pb" "github.com/seaweedfs/seaweedfs/weed/util" + "path/filepath" ) -func (wfs *WFS) subscribeFilerConfEvents() (func(), error) { - now := time.Now() +func (wfs *WFS) subscribeFilerConfEvents() (*meta_cache.MetadataFollower, error) { confDir := filer.DirectoryEtcSeaweedFS confName := filer.FilerConfName confFullName := filepath.Join(filer.DirectoryEtcSeaweedFS, filer.FilerConfName) @@ -38,7 +35,11 @@ func (wfs *WFS) subscribeFilerConfEvents() (func(), error) { return nil }) if err != nil { - return nil, err + if errors.Is(err, filer_pb.ErrNotFound) { + glog.V(0).Infof("fuse filer conf %s not found", confFullName) + } else { + return nil, err + } } processEventFn := func(resp *filer_pb.SubscribeMetadataResponse) error { @@ -66,41 +67,9 @@ func (wfs *WFS) subscribeFilerConfEvents() (func(), error) { return nil } - - metadataFollowOption := &pb.MetadataFollowOption{ - ClientName: "fuse", - ClientId: wfs.signature, - ClientEpoch: 1, - SelfSignature: 0, - PathPrefix: confFullName, - AdditionalPathPrefixes: nil, - StartTsNs: now.UnixNano(), - StopTsNs: 0, - EventErrorType: pb.FatalOnError, - } - - return func() { - // sync new conf changes - util.RetryUntil("followFilerConfChanges", func() error { - metadataFollowOption.ClientEpoch++ - i := atomic.LoadInt32(&wfs.option.filerIndex) - n := len(wfs.option.FilerAddresses) - err = pb.FollowMetadata(wfs.option.FilerAddresses[i], wfs.option.GrpcDialOption, metadataFollowOption, processEventFn) - if err == nil { - atomic.StoreInt32(&wfs.option.filerIndex, i) - return nil - } - - i++ - if i >= int32(n) { - i = 0 - } - - return err - }, func(err error) bool { - glog.V(0).Infof("fuse follow filer conf changes: %v", err) - return true - }) + return &meta_cache.MetadataFollower{ + PathPrefixToWatch: confFullName, + ProcessEventFn: processEventFn, }, nil } diff --git a/weed/mount/meta_cache/meta_cache_subscribe.go b/weed/mount/meta_cache/meta_cache_subscribe.go index d3bb27d08..9a4553013 100644 --- a/weed/mount/meta_cache/meta_cache_subscribe.go +++ b/weed/mount/meta_cache/meta_cache_subscribe.go @@ -10,7 +10,44 @@ import ( "strings" ) -func SubscribeMetaEvents(mc *MetaCache, selfSignature int32, client filer_pb.FilerClient, dir string, lastTsNs int64) error { +type MetadataFollower struct { + PathPrefixToWatch string + ProcessEventFn func(resp *filer_pb.SubscribeMetadataResponse) error +} + +func mergeProcessors(mainProcessor func(resp *filer_pb.SubscribeMetadataResponse) error, followers ...*MetadataFollower) func(resp *filer_pb.SubscribeMetadataResponse) error { + return func(resp *filer_pb.SubscribeMetadataResponse) error { + + // build the full path + entry := resp.EventNotification.NewEntry + if entry == nil { + entry = resp.EventNotification.OldEntry + } + if entry != nil { + dir := resp.Directory + if resp.EventNotification.NewParentPath != "" { + dir = resp.EventNotification.NewParentPath + } + fp := util.NewFullPath(dir, entry.Name) + + for _, follower := range followers { + if strings.HasPrefix(string(fp), follower.PathPrefixToWatch) { + if err := follower.ProcessEventFn(resp); err != nil { + return err + } + } + } + } + return mainProcessor(resp) + } +} + +func SubscribeMetaEvents(mc *MetaCache, selfSignature int32, client filer_pb.FilerClient, dir string, lastTsNs int64, followers ...*MetadataFollower) error { + + var prefixes []string + for _, follower := range followers { + prefixes = append(prefixes, follower.PathPrefixToWatch) + } processEventFn := func(resp *filer_pb.SubscribeMetadataResponse) error { message := resp.EventNotification @@ -69,7 +106,7 @@ func SubscribeMetaEvents(mc *MetaCache, selfSignature int32, client filer_pb.Fil ClientEpoch: 1, SelfSignature: selfSignature, PathPrefix: prefix, - AdditionalPathPrefixes: nil, + AdditionalPathPrefixes: prefixes, DirectoriesToWatch: nil, StartTsNs: lastTsNs, StopTsNs: 0, @@ -77,7 +114,7 @@ func SubscribeMetaEvents(mc *MetaCache, selfSignature int32, client filer_pb.Fil } util.RetryUntil("followMetaUpdates", func() error { metadataFollowOption.ClientEpoch++ - return pb.WithFilerClientFollowMetadata(client, metadataFollowOption, processEventFn) + return pb.WithFilerClientFollowMetadata(client, metadataFollowOption, mergeProcessors(processEventFn, followers...)) }, func(err error) bool { glog.Errorf("follow metadata updates: %v", err) return true diff --git a/weed/mount/page_writer.go b/weed/mount/page_writer.go index c9470c440..58ae03cda 100644 --- a/weed/mount/page_writer.go +++ b/weed/mount/page_writer.go @@ -51,7 +51,7 @@ func (pw *PageWriter) FlushData() error { } func (pw *PageWriter) ReadDirtyDataAt(data []byte, offset int64, tsNs int64) (maxStop int64) { - glog.V(4).Infof("ReadDirtyDataAt %v [%d, %d)", pw.fh.fh, offset, offset+int64(len(data))) + glog.V(4).Infof("ReadDirtyDataAt %v [%d, %d)", pw.fh.inode, offset, offset+int64(len(data))) chunkIndex := offset / pw.chunkSize for i := chunkIndex; len(data) > 0; i++ { diff --git a/weed/mount/weedfs.go b/weed/mount/weedfs.go index 4f029bba8..728777e32 100644 --- a/weed/mount/weedfs.go +++ b/weed/mount/weedfs.go @@ -46,6 +46,7 @@ type Option struct { Umask os.FileMode Quota int64 DisableXAttr bool + IsMacOs bool MountUid uint32 MountGid uint32 @@ -141,15 +142,13 @@ func NewSeaweedFileSystem(option *Option) *WFS { } func (wfs *WFS) StartBackgroundTasks() error { - fn, err := wfs.subscribeFilerConfEvents() + follower, err := wfs.subscribeFilerConfEvents() if err != nil { return err } - go fn() - startTime := time.Now() - go meta_cache.SubscribeMetaEvents(wfs.metaCache, wfs.signature, wfs, wfs.option.FilerMountRootPath, startTime.UnixNano()) + go meta_cache.SubscribeMetaEvents(wfs.metaCache, wfs.signature, wfs, wfs.option.FilerMountRootPath, startTime.UnixNano(), follower) go wfs.loopCheckQuota() return nil diff --git a/weed/mount/weedfs_attr.go b/weed/mount/weedfs_attr.go index 24da292d6..03a7604ea 100644 --- a/weed/mount/weedfs_attr.go +++ b/weed/mount/weedfs_attr.go @@ -11,6 +11,7 @@ import ( ) func (wfs *WFS) GetAttr(cancel <-chan struct{}, input *fuse.GetAttrIn, out *fuse.AttrOut) (code fuse.Status) { + glog.V(4).Infof("GetAttr %v", input.NodeId) if input.NodeId == 1 { wfs.setRootAttr(out) return fuse.OK diff --git a/weed/mount/weedfs_file_io.go b/weed/mount/weedfs_file_io.go index 50a5c7c85..04fe7f21c 100644 --- a/weed/mount/weedfs_file_io.go +++ b/weed/mount/weedfs_file_io.go @@ -2,6 +2,7 @@ package mount import ( "github.com/hanwen/go-fuse/v2/fuse" + "github.com/seaweedfs/seaweedfs/weed/glog" ) /** @@ -66,6 +67,14 @@ func (wfs *WFS) Open(cancel <-chan struct{}, in *fuse.OpenIn, out *fuse.OpenOut) if status == fuse.OK { out.Fh = uint64(fileHandle.fh) out.OpenFlags = in.Flags + if wfs.option.IsMacOs { + // remove the direct_io flag, as it is not well-supported on macOS + // https://code.google.com/archive/p/macfuse/wikis/OPTIONS.wiki recommended to avoid the direct_io flag + if in.Flags&fuse.FOPEN_DIRECT_IO != 0 { + glog.V(4).Infof("macfuse direct_io mode %v => false\n", in.Flags&fuse.FOPEN_DIRECT_IO != 0) + out.OpenFlags &^= fuse.FOPEN_DIRECT_IO + } + } // TODO https://github.com/libfuse/libfuse/blob/master/include/fuse_common.h#L64 } return status diff --git a/weed/mount/weedfs_rename.go b/weed/mount/weedfs_rename.go index f9fc85b3f..18ab427a2 100644 --- a/weed/mount/weedfs_rename.go +++ b/weed/mount/weedfs_rename.go @@ -3,15 +3,16 @@ package mount import ( "context" "fmt" + "io" + "strings" + "syscall" + "github.com/hanwen/go-fuse/v2/fs" "github.com/hanwen/go-fuse/v2/fuse" "github.com/seaweedfs/seaweedfs/weed/filer" "github.com/seaweedfs/seaweedfs/weed/glog" "github.com/seaweedfs/seaweedfs/weed/pb/filer_pb" "github.com/seaweedfs/seaweedfs/weed/util" - "io" - "strings" - "syscall" ) /** Rename a file @@ -160,6 +161,13 @@ func (wfs *WFS) Rename(cancel <-chan struct{}, in *fuse.RenameIn, oldName string } newPath := newDir.Child(newName) + if wfs.FilerConf != nil { + rule := wfs.FilerConf.MatchStorageRule(string(oldPath)) + if rule.Worm { + return fuse.EPERM + } + } + glog.V(4).Infof("dir Rename %s => %s", oldPath, newPath) // update remote filer diff --git a/weed/mq/broker/broker_grpc_assign.go b/weed/mq/broker/broker_grpc_assign.go index 48ec0d5bd..9a9b34c0b 100644 --- a/weed/mq/broker/broker_grpc_assign.go +++ b/weed/mq/broker/broker_grpc_assign.go @@ -4,6 +4,7 @@ import ( "context" "fmt" "github.com/seaweedfs/seaweedfs/weed/glog" + "github.com/seaweedfs/seaweedfs/weed/mq/logstore" "github.com/seaweedfs/seaweedfs/weed/mq/pub_balancer" "github.com/seaweedfs/seaweedfs/weed/mq/topic" "github.com/seaweedfs/seaweedfs/weed/pb" @@ -26,7 +27,7 @@ func (b *MessageQueueBroker) AssignTopicPartitions(c context.Context, request *m } else { var localPartition *topic.LocalPartition if localPartition = b.localTopicManager.GetLocalPartition(t, partition); localPartition == nil { - localPartition = topic.NewLocalPartition(partition, b.genLogFlushFunc(t, assignment.Partition), b.genLogOnDiskReadFunc(t, assignment.Partition)) + localPartition = topic.NewLocalPartition(partition, b.genLogFlushFunc(t, partition), logstore.GenMergedReadFunc(b, t, partition)) b.localTopicManager.AddLocalPartition(t, localPartition) } } diff --git a/weed/mq/broker/broker_grpc_configure.go b/weed/mq/broker/broker_grpc_configure.go index 7222c8359..361af5c43 100644 --- a/weed/mq/broker/broker_grpc_configure.go +++ b/weed/mq/broker/broker_grpc_configure.go @@ -67,7 +67,7 @@ func (b *MessageQueueBroker) ConfigureTopic(ctx context.Context, request *mq_pb. resp.RecordType = request.RecordType // save the topic configuration on filer - if err := b.fca.SaveTopicConfToFiler(request.Topic, resp); err != nil { + if err := b.fca.SaveTopicConfToFiler(t, resp); err != nil { return nil, fmt.Errorf("configure topic: %v", err) } diff --git a/weed/mq/broker/broker_grpc_pub_follow.go b/weed/mq/broker/broker_grpc_pub_follow.go index 8995b0cc2..291f1ef62 100644 --- a/weed/mq/broker/broker_grpc_pub_follow.go +++ b/weed/mq/broker/broker_grpc_pub_follow.go @@ -2,7 +2,6 @@ package broker import ( "fmt" - "github.com/seaweedfs/seaweedfs/weed/filer" "github.com/seaweedfs/seaweedfs/weed/glog" "github.com/seaweedfs/seaweedfs/weed/mq/topic" "github.com/seaweedfs/seaweedfs/weed/pb/mq_pb" @@ -93,9 +92,7 @@ func (b *MessageQueueBroker) PublishFollowMe(stream mq_pb.SeaweedMessaging_Publi time.Sleep(113 * time.Millisecond) } - topicDir := fmt.Sprintf("%s/%s/%s", filer.TopicsDir, t.Namespace, t.Name) - partitionGeneration := time.Unix(0, p.UnixTimeNs).UTC().Format(topic.TIME_FORMAT) - partitionDir := fmt.Sprintf("%s/%s/%04d-%04d", topicDir, partitionGeneration, p.RangeStart, p.RangeStop) + partitionDir := topic.PartitionDir(t, p) // flush the remaining messages inMemoryBuffers.CloseInput() diff --git a/weed/mq/broker/broker_grpc_sub_follow.go b/weed/mq/broker/broker_grpc_sub_follow.go index f7f4ac7e9..bed906c30 100644 --- a/weed/mq/broker/broker_grpc_sub_follow.go +++ b/weed/mq/broker/broker_grpc_sub_follow.go @@ -9,7 +9,6 @@ import ( "github.com/seaweedfs/seaweedfs/weed/pb/mq_pb" "github.com/seaweedfs/seaweedfs/weed/util" "io" - "time" ) func (b *MessageQueueBroker) SubscribeFollowMe(stream mq_pb.SeaweedMessaging_SubscribeFollowMeServer) (err error) { @@ -65,9 +64,7 @@ func (b *MessageQueueBroker) SubscribeFollowMe(stream mq_pb.SeaweedMessaging_Sub func (b *MessageQueueBroker) readConsumerGroupOffset(initMessage *mq_pb.SubscribeMessageRequest_InitMessage) (offset int64, err error) { t, p := topic.FromPbTopic(initMessage.Topic), topic.FromPbPartition(initMessage.PartitionOffset.Partition) - topicDir := fmt.Sprintf("%s/%s/%s", filer.TopicsDir, t.Namespace, t.Name) - partitionGeneration := time.Unix(0, p.UnixTimeNs).UTC().Format(topic.TIME_FORMAT) - partitionDir := fmt.Sprintf("%s/%s/%04d-%04d", topicDir, partitionGeneration, p.RangeStart, p.RangeStop) + partitionDir := topic.PartitionDir(t, p) offsetFileName := fmt.Sprintf("%s.offset", initMessage.ConsumerGroup) err = b.WithFilerClient(false, func(client filer_pb.SeaweedFilerClient) error { @@ -86,9 +83,7 @@ func (b *MessageQueueBroker) readConsumerGroupOffset(initMessage *mq_pb.Subscrib func (b *MessageQueueBroker) saveConsumerGroupOffset(t topic.Topic, p topic.Partition, consumerGroup string, offset int64) error { - topicDir := fmt.Sprintf("%s/%s/%s", filer.TopicsDir, t.Namespace, t.Name) - partitionGeneration := time.Unix(0, p.UnixTimeNs).UTC().Format(topic.TIME_FORMAT) - partitionDir := fmt.Sprintf("%s/%s/%04d-%04d", topicDir, partitionGeneration, p.RangeStart, p.RangeStop) + partitionDir := topic.PartitionDir(t, p) offsetFileName := fmt.Sprintf("%s.offset", consumerGroup) offsetBytes := make([]byte, 8) diff --git a/weed/mq/broker/broker_topic_conf_read_write.go b/weed/mq/broker/broker_topic_conf_read_write.go index ea5cb71b9..222ff16ba 100644 --- a/weed/mq/broker/broker_topic_conf_read_write.go +++ b/weed/mq/broker/broker_topic_conf_read_write.go @@ -3,6 +3,7 @@ package broker import ( "fmt" "github.com/seaweedfs/seaweedfs/weed/glog" + "github.com/seaweedfs/seaweedfs/weed/mq/logstore" "github.com/seaweedfs/seaweedfs/weed/mq/pub_balancer" "github.com/seaweedfs/seaweedfs/weed/mq/topic" "github.com/seaweedfs/seaweedfs/weed/pb/mq_pb" @@ -40,7 +41,7 @@ func (b *MessageQueueBroker) genLocalPartitionFromFiler(t topic.Topic, partition self := b.option.BrokerAddress() for _, assignment := range conf.BrokerPartitionAssignments { if assignment.LeaderBroker == string(self) && partition.Equals(topic.FromPbPartition(assignment.Partition)) { - localPartition = topic.NewLocalPartition(partition, b.genLogFlushFunc(t, assignment.Partition), b.genLogOnDiskReadFunc(t, assignment.Partition)) + localPartition = topic.NewLocalPartition(partition, b.genLogFlushFunc(t, partition), logstore.GenMergedReadFunc(b, t, partition)) b.localTopicManager.AddLocalPartition(t, localPartition) isGenerated = true break @@ -55,7 +56,7 @@ func (b *MessageQueueBroker) ensureTopicActiveAssignments(t topic.Topic, conf *m hasChanges := pub_balancer.EnsureAssignmentsToActiveBrokers(b.PubBalancer.Brokers, 1, conf.BrokerPartitionAssignments) if hasChanges { glog.V(0).Infof("topic %v partition updated assignments: %v", t, conf.BrokerPartitionAssignments) - if err = b.fca.SaveTopicConfToFiler(t.ToPbTopic(), conf); err != nil { + if err = b.fca.SaveTopicConfToFiler(t, conf); err != nil { return err } } diff --git a/weed/mq/broker/broker_topic_partition_read_write.go b/weed/mq/broker/broker_topic_partition_read_write.go index 4c1b9a1e2..d6513b2a2 100644 --- a/weed/mq/broker/broker_topic_partition_read_write.go +++ b/weed/mq/broker/broker_topic_partition_read_write.go @@ -2,24 +2,15 @@ package broker import ( "fmt" - "github.com/seaweedfs/seaweedfs/weed/filer" "github.com/seaweedfs/seaweedfs/weed/glog" "github.com/seaweedfs/seaweedfs/weed/mq/topic" - "github.com/seaweedfs/seaweedfs/weed/pb/filer_pb" - "github.com/seaweedfs/seaweedfs/weed/pb/mq_pb" - "github.com/seaweedfs/seaweedfs/weed/util" "github.com/seaweedfs/seaweedfs/weed/util/log_buffer" - "google.golang.org/protobuf/proto" - "math" "sync/atomic" "time" - util_http "github.com/seaweedfs/seaweedfs/weed/util/http" ) -func (b *MessageQueueBroker) genLogFlushFunc(t topic.Topic, partition *mq_pb.Partition) log_buffer.LogFlushFuncType { - topicDir := fmt.Sprintf("%s/%s/%s", filer.TopicsDir, t.Namespace, t.Name) - partitionGeneration := time.Unix(0, partition.UnixTimeNs).UTC().Format(topic.TIME_FORMAT) - partitionDir := fmt.Sprintf("%s/%s/%04d-%04d", topicDir, partitionGeneration, partition.RangeStart, partition.RangeStop) +func (b *MessageQueueBroker) genLogFlushFunc(t topic.Topic, p topic.Partition) log_buffer.LogFlushFuncType { + partitionDir := topic.PartitionDir(t, p) return func(logBuffer *log_buffer.LogBuffer, startTime, stopTime time.Time, buf []byte) { if len(buf) == 0 { @@ -45,7 +36,6 @@ func (b *MessageQueueBroker) genLogFlushFunc(t topic.Topic, partition *mq_pb.Par b.accessLock.Lock() defer b.accessLock.Unlock() - p := topic.FromPbPartition(partition) if localPartition := b.localTopicManager.GetLocalPartition(t, p); localPartition != nil { localPartition.NotifyLogFlushed(logBuffer.LastFlushTsNs) } @@ -53,126 +43,3 @@ func (b *MessageQueueBroker) genLogFlushFunc(t topic.Topic, partition *mq_pb.Par glog.V(0).Infof("flushing at %d to %s size %d", logBuffer.LastFlushTsNs, targetFile, len(buf)) } } - -func (b *MessageQueueBroker) genLogOnDiskReadFunc(t topic.Topic, partition *mq_pb.Partition) log_buffer.LogReadFromDiskFuncType { - topicDir := fmt.Sprintf("%s/%s/%s", filer.TopicsDir, t.Namespace, t.Name) - partitionGeneration := time.Unix(0, partition.UnixTimeNs).UTC().Format(topic.TIME_FORMAT) - partitionDir := fmt.Sprintf("%s/%s/%04d-%04d", topicDir, partitionGeneration, partition.RangeStart, partition.RangeStop) - - lookupFileIdFn := func(fileId string) (targetUrls []string, err error) { - return b.MasterClient.LookupFileId(fileId) - } - - eachChunkFn := func(buf []byte, eachLogEntryFn log_buffer.EachLogEntryFuncType, starTsNs, stopTsNs int64) (processedTsNs int64, err error) { - for pos := 0; pos+4 < len(buf); { - - size := util.BytesToUint32(buf[pos : pos+4]) - if pos+4+int(size) > len(buf) { - err = fmt.Errorf("LogOnDiskReadFunc: read [%d,%d) from [0,%d)", pos, pos+int(size)+4, len(buf)) - return - } - entryData := buf[pos+4 : pos+4+int(size)] - - logEntry := &filer_pb.LogEntry{} - if err = proto.Unmarshal(entryData, logEntry); err != nil { - pos += 4 + int(size) - err = fmt.Errorf("unexpected unmarshal mq_pb.Message: %v", err) - return - } - if logEntry.TsNs < starTsNs { - pos += 4 + int(size) - continue - } - if stopTsNs != 0 && logEntry.TsNs > stopTsNs { - println("stopTsNs", stopTsNs, "logEntry.TsNs", logEntry.TsNs) - return - } - - if _, err = eachLogEntryFn(logEntry); err != nil { - err = fmt.Errorf("process log entry %v: %v", logEntry, err) - return - } - - processedTsNs = logEntry.TsNs - - pos += 4 + int(size) - - } - - return - } - - eachFileFn := func(entry *filer_pb.Entry, eachLogEntryFn log_buffer.EachLogEntryFuncType, starTsNs, stopTsNs int64) (processedTsNs int64, err error) { - if len(entry.Content) > 0 { - // skip .offset files - return - } - var urlStrings []string - for _, chunk := range entry.Chunks { - if chunk.Size == 0 { - continue - } - if chunk.IsChunkManifest { - glog.Warningf("this should not happen. unexpected chunk manifest in %s/%s", partitionDir, entry.Name) - return - } - urlStrings, err = lookupFileIdFn(chunk.FileId) - if err != nil { - err = fmt.Errorf("lookup %s: %v", chunk.FileId, err) - return - } - if len(urlStrings) == 0 { - err = fmt.Errorf("no url found for %s", chunk.FileId) - return - } - - // try one of the urlString until util.Get(urlString) succeeds - var processed bool - for _, urlString := range urlStrings { - // TODO optimization opportunity: reuse the buffer - var data []byte - if data, _, err = util_http.Get(urlString); err == nil { - processed = true - if processedTsNs, err = eachChunkFn(data, eachLogEntryFn, starTsNs, stopTsNs); err != nil { - return - } - break - } - } - if !processed { - err = fmt.Errorf("no data processed for %s %s", entry.Name, chunk.FileId) - return - } - - } - return - } - - return func(startPosition log_buffer.MessagePosition, stopTsNs int64, eachLogEntryFn log_buffer.EachLogEntryFuncType) (lastReadPosition log_buffer.MessagePosition, isDone bool, err error) { - startFileName := startPosition.UTC().Format(topic.TIME_FORMAT) - startTsNs := startPosition.Time.UnixNano() - stopTime := time.Unix(0, stopTsNs) - var processedTsNs int64 - err = b.WithFilerClient(false, func(client filer_pb.SeaweedFilerClient) error { - return filer_pb.SeaweedList(client, partitionDir, "", func(entry *filer_pb.Entry, isLast bool) error { - if entry.IsDirectory { - return nil - } - if stopTsNs != 0 && entry.Name > stopTime.UTC().Format(topic.TIME_FORMAT) { - isDone = true - return nil - } - if entry.Name < startPosition.UTC().Format(topic.TIME_FORMAT) { - return nil - } - if processedTsNs, err = eachFileFn(entry, eachLogEntryFn, startTsNs, stopTsNs); err != nil { - return err - } - return nil - - }, startFileName, true, math.MaxInt32) - }) - lastReadPosition = log_buffer.NewMessagePosition(processedTsNs, -2) - return - } -} diff --git a/weed/mq/client/cmd/weed_pub_record/publisher_record.go b/weed/mq/client/cmd/weed_pub_record/publisher_record.go index f340dd1c8..9b28200bc 100644 --- a/weed/mq/client/cmd/weed_pub_record/publisher_record.go +++ b/weed/mq/client/cmd/weed_pub_record/publisher_record.go @@ -7,11 +7,12 @@ import ( "github.com/seaweedfs/seaweedfs/weed/mq/schema" "github.com/seaweedfs/seaweedfs/weed/mq/topic" "github.com/seaweedfs/seaweedfs/weed/pb/schema_pb" + util_http "github.com/seaweedfs/seaweedfs/weed/util/http" "log" "strings" "sync" + "sync/atomic" "time" - util_http "github.com/seaweedfs/seaweedfs/weed/util/http" ) var ( @@ -25,11 +26,17 @@ var ( namespace = flag.String("ns", "test", "namespace") t = flag.String("t", "test", "t") seedBrokers = flag.String("brokers", "localhost:17777", "seed brokers") + + counter int32 ) func doPublish(publisher *pub_client.TopicPublisher, id int) { startTime := time.Now() - for i := 0; i < *messageCount / *concurrency; i++ { + for { + i := atomic.AddInt32(&counter, 1) + if i > int32(*messageCount) { + break + } // Simulate publishing a message myRecord := genMyRecord(int32(i)) if err := publisher.PublishRecord(myRecord.Key, myRecord.ToRecordValue()); err != nil { @@ -38,7 +45,7 @@ func doPublish(publisher *pub_client.TopicPublisher, id int) { } if *messageDelay > 0 { time.Sleep(*messageDelay) - fmt.Printf("sent %+v\n", myRecord) + fmt.Printf("sent %+v\n", string(myRecord.Key)) } } if err := publisher.FinishPublish(); err != nil { diff --git a/weed/mq/client/cmd/weed_sub_record/subscriber_record.go b/weed/mq/client/cmd/weed_sub_record/subscriber_record.go index 00fe83feb..7bdff3715 100644 --- a/weed/mq/client/cmd/weed_sub_record/subscriber_record.go +++ b/weed/mq/client/cmd/weed_sub_record/subscriber_record.go @@ -8,12 +8,12 @@ import ( "github.com/seaweedfs/seaweedfs/weed/mq/topic" "github.com/seaweedfs/seaweedfs/weed/pb/schema_pb" "github.com/seaweedfs/seaweedfs/weed/util" + util_http "github.com/seaweedfs/seaweedfs/weed/util/http" "google.golang.org/grpc" "google.golang.org/grpc/credentials/insecure" "google.golang.org/protobuf/proto" "strings" "time" - util_http "github.com/seaweedfs/seaweedfs/weed/util/http" ) var ( @@ -22,6 +22,7 @@ var ( seedBrokers = flag.String("brokers", "localhost:17777", "seed brokers") maxPartitionCount = flag.Int("maxPartitionCount", 3, "max partition count") perPartitionConcurrency = flag.Int("perPartitionConcurrency", 1, "per partition concurrency") + timeAgo = flag.Duration("timeAgo", 1*time.Hour, "start time before now. \"300ms\", \"1.5h\" or \"2h45m\". Valid time units are \"ns\", \"us\" (or \"µs\"), \"ms\", \"s\", \"m\", \"h\"") clientId = flag.Uint("client_id", uint(util.RandomInt32()), "client id") ) @@ -65,7 +66,7 @@ func main() { contentConfig := &sub_client.ContentConfiguration{ Topic: topic.NewTopic(*namespace, *t), Filter: "", - StartTime: time.Unix(1, 1), + StartTime: time.Now().Add(-*timeAgo), } brokers := strings.Split(*seedBrokers, ",") @@ -75,9 +76,13 @@ func main() { subscriber.SetEachMessageFunc(func(key, value []byte) error { counter++ record := &schema_pb.RecordValue{} - proto.Unmarshal(value, record) - fmt.Printf("record: %v\n", record) - time.Sleep(1300 * time.Millisecond) + err := proto.Unmarshal(value, record) + if err != nil { + fmt.Printf("unmarshal record value: %v\n", err) + } else { + fmt.Printf("%s %d: %v\n", string(key), len(value), record) + } + //time.Sleep(1300 * time.Millisecond) return nil }) diff --git a/weed/mq/client/sub_client/on_each_partition.go b/weed/mq/client/sub_client/on_each_partition.go index 58d87d9ad..56cedb32e 100644 --- a/weed/mq/client/sub_client/on_each_partition.go +++ b/weed/mq/client/sub_client/on_each_partition.go @@ -8,6 +8,7 @@ import ( "github.com/seaweedfs/seaweedfs/weed/pb/mq_pb" "github.com/seaweedfs/seaweedfs/weed/util" "io" + "reflect" ) func (sub *TopicSubscriber) onEachPartition(assigned *mq_pb.BrokerPartitionAssignment, stopCh chan struct{}) error { @@ -24,6 +25,11 @@ func (sub *TopicSubscriber) onEachPartition(assigned *mq_pb.BrokerPartitionAssig perPartitionConcurrency = 1 } + var stopTsNs int64 + if !sub.ContentConfig.StopTime.IsZero() { + stopTsNs = sub.ContentConfig.StopTime.UnixNano() + } + if err = subscribeClient.Send(&mq_pb.SubscribeMessageRequest{ Message: &mq_pb.SubscribeMessageRequest_Init{ Init: &mq_pb.SubscribeMessageRequest_InitMessage{ @@ -32,6 +38,8 @@ func (sub *TopicSubscriber) onEachPartition(assigned *mq_pb.BrokerPartitionAssig Topic: sub.ContentConfig.Topic.ToPbTopic(), PartitionOffset: &mq_pb.PartitionOffset{ Partition: assigned.Partition, + StartTsNs: sub.ContentConfig.StartTime.UnixNano(), + StopTsNs: stopTsNs, StartType: mq_pb.PartitionOffsetStartType_EARLIEST_IN_MEMORY, }, Filter: sub.ContentConfig.Filter, @@ -101,6 +109,10 @@ func (sub *TopicSubscriber) onEachPartition(assigned *mq_pb.BrokerPartitionAssig glog.V(2).Infof("subscriber %s received control from producer:%s isClose:%v", sub.SubscriberConfig.ConsumerGroup, m.Data.Ctrl.PublisherName, m.Data.Ctrl.IsClose) continue } + if len(m.Data.Key) == 0 { + fmt.Printf("empty key %+v, type %v\n", m, reflect.TypeOf(m)) + continue + } executors.Execute(func() { processErr := sub.OnEachMessageFunc(m.Data.Key, m.Data.Value) if processErr == nil { diff --git a/weed/mq/client/sub_client/subscriber.go b/weed/mq/client/sub_client/subscriber.go index 922593b77..3e5316b67 100644 --- a/weed/mq/client/sub_client/subscriber.go +++ b/weed/mq/client/sub_client/subscriber.go @@ -21,6 +21,7 @@ type ContentConfiguration struct { Topic topic.Topic Filter string StartTime time.Time + StopTime time.Time } type OnEachMessageFunc func(key, value []byte) (err error) diff --git a/weed/mq/logstore/log_to_parquet.go b/weed/mq/logstore/log_to_parquet.go new file mode 100644 index 000000000..30cad8cc1 --- /dev/null +++ b/weed/mq/logstore/log_to_parquet.go @@ -0,0 +1,454 @@ +package logstore + +import ( + "encoding/binary" + "fmt" + "github.com/parquet-go/parquet-go" + "github.com/parquet-go/parquet-go/compress/zstd" + "github.com/seaweedfs/seaweedfs/weed/filer" + "github.com/seaweedfs/seaweedfs/weed/mq/schema" + "github.com/seaweedfs/seaweedfs/weed/mq/topic" + "github.com/seaweedfs/seaweedfs/weed/operation" + "github.com/seaweedfs/seaweedfs/weed/pb/filer_pb" + "github.com/seaweedfs/seaweedfs/weed/pb/schema_pb" + "github.com/seaweedfs/seaweedfs/weed/util" + util_http "github.com/seaweedfs/seaweedfs/weed/util/http" + "github.com/seaweedfs/seaweedfs/weed/util/log_buffer" + "google.golang.org/protobuf/proto" + "io" + "os" + "strings" + "time" +) + +const ( + SW_COLUMN_NAME_TS = "_ts_ns" + SW_COLUMN_NAME_KEY = "_key" +) + +func CompactTopicPartitions(filerClient filer_pb.FilerClient, t topic.Topic, timeAgo time.Duration, recordType *schema_pb.RecordType, preference *operation.StoragePreference) error { + // list the topic partition versions + topicVersions, err := collectTopicVersions(filerClient, t, timeAgo) + if err != nil { + return fmt.Errorf("list topic files: %v", err) + } + + // compact the partitions + for _, topicVersion := range topicVersions { + partitions, err := collectTopicVersionsPartitions(filerClient, t, topicVersion) + if err != nil { + return fmt.Errorf("list partitions %s/%s/%s: %v", t.Namespace, t.Name, topicVersion, err) + } + for _, partition := range partitions { + err := compactTopicPartition(filerClient, t, timeAgo, recordType, partition, preference) + if err != nil { + return fmt.Errorf("compact partition %s/%s/%s/%s: %v", t.Namespace, t.Name, topicVersion, partition, err) + } + } + } + return nil +} + +func collectTopicVersions(filerClient filer_pb.FilerClient, t topic.Topic, timeAgo time.Duration) (partitionVersions []time.Time, err error) { + err = filer_pb.ReadDirAllEntries(filerClient, util.FullPath(t.Dir()), "", func(entry *filer_pb.Entry, isLast bool) error { + t, err := topic.ParseTopicVersion(entry.Name) + if err != nil { + // skip non-partition directories + return nil + } + if t.Unix() < time.Now().Unix()-int64(timeAgo/time.Second) { + partitionVersions = append(partitionVersions, t) + } + return nil + }) + return +} + +func collectTopicVersionsPartitions(filerClient filer_pb.FilerClient, t topic.Topic, topicVersion time.Time) (partitions []topic.Partition, err error) { + version := topicVersion.Format(topic.PartitionGenerationFormat) + err = filer_pb.ReadDirAllEntries(filerClient, util.FullPath(t.Dir()).Child(version), "", func(entry *filer_pb.Entry, isLast bool) error { + if !entry.IsDirectory { + return nil + } + start, stop := topic.ParsePartitionBoundary(entry.Name) + if start != stop { + partitions = append(partitions, topic.Partition{ + RangeStart: start, + RangeStop: stop, + RingSize: topic.PartitionCount, + UnixTimeNs: topicVersion.UnixNano(), + }) + } + return nil + }) + return +} + +func compactTopicPartition(filerClient filer_pb.FilerClient, t topic.Topic, timeAgo time.Duration, recordType *schema_pb.RecordType, partition topic.Partition, preference *operation.StoragePreference) error { + partitionDir := topic.PartitionDir(t, partition) + + // compact the partition directory + return compactTopicPartitionDir(filerClient, t.Name, partitionDir, timeAgo, recordType, preference) +} + +func compactTopicPartitionDir(filerClient filer_pb.FilerClient, topicName, partitionDir string, timeAgo time.Duration, recordType *schema_pb.RecordType, preference *operation.StoragePreference) error { + // read all existing parquet files + minTsNs, maxTsNs, err := readAllParquetFiles(filerClient, partitionDir) + if err != nil { + return err + } + + // read all log files + logFiles, err := readAllLogFiles(filerClient, partitionDir, timeAgo, minTsNs, maxTsNs) + if err != nil { + return err + } + if len(logFiles) == 0 { + return nil + } + + // divide log files into groups of 128MB + logFileGroups := groupFilesBySize(logFiles, 128*1024*1024) + + // write to parquet file + parquetLevels, err := schema.ToParquetLevels(recordType) + if err != nil { + return fmt.Errorf("ToParquetLevels failed %+v: %v", recordType, err) + } + + // create a parquet schema + parquetSchema, err := schema.ToParquetSchema(topicName, recordType) + if err != nil { + return fmt.Errorf("ToParquetSchema failed: %v", err) + } + + // TODO parallelize the writing + for _, logFileGroup := range logFileGroups { + if err = writeLogFilesToParquet(filerClient, partitionDir, recordType, logFileGroup, parquetSchema, parquetLevels, preference); err != nil { + return err + } + } + + return nil +} + +func groupFilesBySize(logFiles []*filer_pb.Entry, maxGroupSize int64) (logFileGroups [][]*filer_pb.Entry) { + var logFileGroup []*filer_pb.Entry + var groupSize int64 + for _, logFile := range logFiles { + if groupSize+int64(logFile.Attributes.FileSize) > maxGroupSize { + logFileGroups = append(logFileGroups, logFileGroup) + logFileGroup = nil + groupSize = 0 + } + logFileGroup = append(logFileGroup, logFile) + groupSize += int64(logFile.Attributes.FileSize) + } + if len(logFileGroup) > 0 { + logFileGroups = append(logFileGroups, logFileGroup) + } + return +} + +func readAllLogFiles(filerClient filer_pb.FilerClient, partitionDir string, timeAgo time.Duration, minTsNs, maxTsNs int64) (logFiles []*filer_pb.Entry, err error) { + err = filer_pb.ReadDirAllEntries(filerClient, util.FullPath(partitionDir), "", func(entry *filer_pb.Entry, isLast bool) error { + if strings.HasSuffix(entry.Name, ".parquet") { + return nil + } + if entry.Attributes.Crtime > time.Now().Unix()-int64(timeAgo/time.Second) { + return nil + } + logTime, err := time.Parse(topic.TIME_FORMAT, entry.Name) + if err != nil { + // glog.Warningf("parse log time %s: %v", entry.Name, err) + return nil + } + if maxTsNs > 0 && logTime.UnixNano() <= maxTsNs { + return nil + } + logFiles = append(logFiles, entry) + return nil + }) + return +} + +func readAllParquetFiles(filerClient filer_pb.FilerClient, partitionDir string) (minTsNs, maxTsNs int64, err error) { + err = filer_pb.ReadDirAllEntries(filerClient, util.FullPath(partitionDir), "", func(entry *filer_pb.Entry, isLast bool) error { + if !strings.HasSuffix(entry.Name, ".parquet") { + return nil + } + if len(entry.Extended) == 0 { + return nil + } + + // read min ts + minTsBytes := entry.Extended["min"] + if len(minTsBytes) != 8 { + return nil + } + minTs := int64(binary.BigEndian.Uint64(minTsBytes)) + if minTsNs == 0 || minTs < minTsNs { + minTsNs = minTs + } + + // read max ts + maxTsBytes := entry.Extended["max"] + if len(maxTsBytes) != 8 { + return nil + } + maxTs := int64(binary.BigEndian.Uint64(maxTsBytes)) + if maxTsNs == 0 || maxTs > maxTsNs { + maxTsNs = maxTs + } + return nil + }) + return +} + +func writeLogFilesToParquet(filerClient filer_pb.FilerClient, partitionDir string, recordType *schema_pb.RecordType, logFileGroups []*filer_pb.Entry, parquetSchema *parquet.Schema, parquetLevels *schema.ParquetLevels, preference *operation.StoragePreference) (err error) { + + tempFile, err := os.CreateTemp(".", "t*.parquet") + if err != nil { + return fmt.Errorf("create temp file: %v", err) + } + defer func() { + tempFile.Close() + os.Remove(tempFile.Name()) + }() + + writer := parquet.NewWriter(tempFile, parquetSchema, parquet.Compression(&zstd.Codec{Level: zstd.DefaultLevel})) + rowBuilder := parquet.NewRowBuilder(parquetSchema) + + var startTsNs, stopTsNs int64 + + for _, logFile := range logFileGroups { + fmt.Printf("compact %s/%s ", partitionDir, logFile.Name) + var rows []parquet.Row + if err := iterateLogEntries(filerClient, logFile, func(entry *filer_pb.LogEntry) error { + + if startTsNs == 0 { + startTsNs = entry.TsNs + } + stopTsNs = entry.TsNs + + if len(entry.Key) == 0 { + return nil + } + + // write to parquet file + rowBuilder.Reset() + + record := &schema_pb.RecordValue{} + if err := proto.Unmarshal(entry.Data, record); err != nil { + return fmt.Errorf("unmarshal record value: %v", err) + } + + record.Fields[SW_COLUMN_NAME_TS] = &schema_pb.Value{ + Kind: &schema_pb.Value_Int64Value{ + Int64Value: entry.TsNs, + }, + } + record.Fields[SW_COLUMN_NAME_KEY] = &schema_pb.Value{ + Kind: &schema_pb.Value_BytesValue{ + BytesValue: entry.Key, + }, + } + + if err := schema.AddRecordValue(rowBuilder, recordType, parquetLevels, record); err != nil { + return fmt.Errorf("add record value: %v", err) + } + + rows = append(rows, rowBuilder.Row()) + + return nil + + }); err != nil { + return fmt.Errorf("iterate log entry %v/%v: %v", partitionDir, logFile.Name, err) + } + + fmt.Printf("processed %d rows\n", len(rows)) + + if _, err := writer.WriteRows(rows); err != nil { + return fmt.Errorf("write rows: %v", err) + } + } + + if err := writer.Close(); err != nil { + return fmt.Errorf("close writer: %v", err) + } + + // write to parquet file to partitionDir + parquetFileName := fmt.Sprintf("%s.parquet", time.Unix(0, startTsNs).UTC().Format("2006-01-02-15-04-05")) + if err := saveParquetFileToPartitionDir(filerClient, tempFile, partitionDir, parquetFileName, preference, startTsNs, stopTsNs); err != nil { + return fmt.Errorf("save parquet file %s: %v", parquetFileName, err) + } + + return nil + +} + +func saveParquetFileToPartitionDir(filerClient filer_pb.FilerClient, sourceFile *os.File, partitionDir, parquetFileName string, preference *operation.StoragePreference, startTsNs, stopTsNs int64) error { + uploader, err := operation.NewUploader() + if err != nil { + return fmt.Errorf("new uploader: %v", err) + } + + // get file size + fileInfo, err := sourceFile.Stat() + if err != nil { + return fmt.Errorf("stat source file: %v", err) + } + + // upload file in chunks + chunkSize := int64(4 * 1024 * 1024) + chunkCount := (fileInfo.Size() + chunkSize - 1) / chunkSize + entry := &filer_pb.Entry{ + Name: parquetFileName, + Attributes: &filer_pb.FuseAttributes{ + Crtime: time.Now().Unix(), + Mtime: time.Now().Unix(), + FileMode: uint32(os.FileMode(0644)), + FileSize: uint64(fileInfo.Size()), + Mime: "application/vnd.apache.parquet", + }, + } + entry.Extended = make(map[string][]byte) + minTsBytes := make([]byte, 8) + binary.BigEndian.PutUint64(minTsBytes, uint64(startTsNs)) + entry.Extended["min"] = minTsBytes + maxTsBytes := make([]byte, 8) + binary.BigEndian.PutUint64(maxTsBytes, uint64(stopTsNs)) + entry.Extended["max"] = maxTsBytes + + for i := int64(0); i < chunkCount; i++ { + fileId, uploadResult, err, _ := uploader.UploadWithRetry( + filerClient, + &filer_pb.AssignVolumeRequest{ + Count: 1, + Replication: preference.Replication, + Collection: preference.Collection, + TtlSec: 0, // TODO set ttl + DiskType: preference.DiskType, + Path: partitionDir + "/" + parquetFileName, + }, + &operation.UploadOption{ + Filename: parquetFileName, + Cipher: false, + IsInputCompressed: false, + MimeType: "application/vnd.apache.parquet", + PairMap: nil, + }, + func(host, fileId string) string { + return fmt.Sprintf("http://%s/%s", host, fileId) + }, + io.NewSectionReader(sourceFile, i*chunkSize, chunkSize), + ) + if err != nil { + return fmt.Errorf("upload chunk %d: %v", i, err) + } + if uploadResult.Error != "" { + return fmt.Errorf("upload result: %v", uploadResult.Error) + } + entry.Chunks = append(entry.Chunks, uploadResult.ToPbFileChunk(fileId, i*chunkSize, time.Now().UnixNano())) + } + + // write the entry to partitionDir + if err := filerClient.WithFilerClient(false, func(client filer_pb.SeaweedFilerClient) error { + return filer_pb.CreateEntry(client, &filer_pb.CreateEntryRequest{ + Directory: partitionDir, + Entry: entry, + }) + }); err != nil { + return fmt.Errorf("create entry: %v", err) + } + fmt.Printf("saved to %s/%s\n", partitionDir, parquetFileName) + + return nil +} + +func iterateLogEntries(filerClient filer_pb.FilerClient, logFile *filer_pb.Entry, eachLogEntryFn func(entry *filer_pb.LogEntry) error) error { + lookupFn := filer.LookupFn(filerClient) + _, err := eachFile(logFile, lookupFn, func(logEntry *filer_pb.LogEntry) (isDone bool, err error) { + if err := eachLogEntryFn(logEntry); err != nil { + return true, err + } + return false, nil + }) + return err +} + +func eachFile(entry *filer_pb.Entry, lookupFileIdFn func(fileId string) (targetUrls []string, err error), eachLogEntryFn log_buffer.EachLogEntryFuncType) (processedTsNs int64, err error) { + if len(entry.Content) > 0 { + // skip .offset files + return + } + var urlStrings []string + for _, chunk := range entry.Chunks { + if chunk.Size == 0 { + continue + } + if chunk.IsChunkManifest { + fmt.Printf("this should not happen. unexpected chunk manifest in %s", entry.Name) + return + } + urlStrings, err = lookupFileIdFn(chunk.FileId) + if err != nil { + err = fmt.Errorf("lookup %s: %v", chunk.FileId, err) + return + } + if len(urlStrings) == 0 { + err = fmt.Errorf("no url found for %s", chunk.FileId) + return + } + + // try one of the urlString until util.Get(urlString) succeeds + var processed bool + for _, urlString := range urlStrings { + var data []byte + if data, _, err = util_http.Get(urlString); err == nil { + processed = true + if processedTsNs, err = eachChunk(data, eachLogEntryFn); err != nil { + return + } + break + } + } + if !processed { + err = fmt.Errorf("no data processed for %s %s", entry.Name, chunk.FileId) + return + } + + } + return +} + +func eachChunk(buf []byte, eachLogEntryFn log_buffer.EachLogEntryFuncType) (processedTsNs int64, err error) { + for pos := 0; pos+4 < len(buf); { + + size := util.BytesToUint32(buf[pos : pos+4]) + if pos+4+int(size) > len(buf) { + err = fmt.Errorf("reach each log chunk: read [%d,%d) from [0,%d)", pos, pos+int(size)+4, len(buf)) + return + } + entryData := buf[pos+4 : pos+4+int(size)] + + logEntry := &filer_pb.LogEntry{} + if err = proto.Unmarshal(entryData, logEntry); err != nil { + pos += 4 + int(size) + err = fmt.Errorf("unexpected unmarshal mq_pb.Message: %v", err) + return + } + + if _, err = eachLogEntryFn(logEntry); err != nil { + err = fmt.Errorf("process log entry %v: %v", logEntry, err) + return + } + + processedTsNs = logEntry.TsNs + + pos += 4 + int(size) + + } + + return +} diff --git a/weed/mq/logstore/merged_read.go b/weed/mq/logstore/merged_read.go new file mode 100644 index 000000000..03a47ace4 --- /dev/null +++ b/weed/mq/logstore/merged_read.go @@ -0,0 +1,41 @@ +package logstore + +import ( + "github.com/seaweedfs/seaweedfs/weed/mq/topic" + "github.com/seaweedfs/seaweedfs/weed/pb/filer_pb" + "github.com/seaweedfs/seaweedfs/weed/util/log_buffer" +) + +func GenMergedReadFunc(filerClient filer_pb.FilerClient, t topic.Topic, p topic.Partition) log_buffer.LogReadFromDiskFuncType { + fromParquetFn := GenParquetReadFunc(filerClient, t, p) + readLogDirectFn := GenLogOnDiskReadFunc(filerClient, t, p) + return mergeReadFuncs(fromParquetFn, readLogDirectFn) +} + +func mergeReadFuncs(fromParquetFn, readLogDirectFn log_buffer.LogReadFromDiskFuncType) log_buffer.LogReadFromDiskFuncType { + var exhaustedParquet bool + var lastProcessedPosition log_buffer.MessagePosition + return func(startPosition log_buffer.MessagePosition, stopTsNs int64, eachLogEntryFn log_buffer.EachLogEntryFuncType) (lastReadPosition log_buffer.MessagePosition, isDone bool, err error) { + if !exhaustedParquet { + // glog.V(4).Infof("reading from parquet startPosition: %v\n", startPosition.UTC()) + lastReadPosition, isDone, err = fromParquetFn(startPosition, stopTsNs, eachLogEntryFn) + // glog.V(4).Infof("read from parquet: %v %v %v %v\n", startPosition, lastReadPosition, isDone, err) + if isDone { + isDone = false + } + if err != nil { + return + } + lastProcessedPosition = lastReadPosition + } + exhaustedParquet = true + + if startPosition.Before(lastProcessedPosition.Time) { + startPosition = lastProcessedPosition + } + + // glog.V(4).Infof("reading from direct log startPosition: %v\n", startPosition.UTC()) + lastReadPosition, isDone, err = readLogDirectFn(startPosition, stopTsNs, eachLogEntryFn) + return + } +} diff --git a/weed/mq/logstore/read_log_from_disk.go b/weed/mq/logstore/read_log_from_disk.go new file mode 100644 index 000000000..c3c679b87 --- /dev/null +++ b/weed/mq/logstore/read_log_from_disk.go @@ -0,0 +1,144 @@ +package logstore + +import ( + "fmt" + "github.com/seaweedfs/seaweedfs/weed/filer" + "github.com/seaweedfs/seaweedfs/weed/glog" + "github.com/seaweedfs/seaweedfs/weed/mq/topic" + "github.com/seaweedfs/seaweedfs/weed/pb/filer_pb" + "github.com/seaweedfs/seaweedfs/weed/util" + util_http "github.com/seaweedfs/seaweedfs/weed/util/http" + "github.com/seaweedfs/seaweedfs/weed/util/log_buffer" + "google.golang.org/protobuf/proto" + "math" + "strings" + "time" +) + +func GenLogOnDiskReadFunc(filerClient filer_pb.FilerClient, t topic.Topic, p topic.Partition) log_buffer.LogReadFromDiskFuncType { + partitionDir := topic.PartitionDir(t, p) + + lookupFileIdFn := filer.LookupFn(filerClient) + + eachChunkFn := func(buf []byte, eachLogEntryFn log_buffer.EachLogEntryFuncType, starTsNs, stopTsNs int64) (processedTsNs int64, err error) { + for pos := 0; pos+4 < len(buf); { + + size := util.BytesToUint32(buf[pos : pos+4]) + if pos+4+int(size) > len(buf) { + err = fmt.Errorf("GenLogOnDiskReadFunc: read [%d,%d) from [0,%d)", pos, pos+int(size)+4, len(buf)) + return + } + entryData := buf[pos+4 : pos+4+int(size)] + + logEntry := &filer_pb.LogEntry{} + if err = proto.Unmarshal(entryData, logEntry); err != nil { + pos += 4 + int(size) + err = fmt.Errorf("unexpected unmarshal mq_pb.Message: %v", err) + return + } + if logEntry.TsNs < starTsNs { + pos += 4 + int(size) + continue + } + if stopTsNs != 0 && logEntry.TsNs > stopTsNs { + println("stopTsNs", stopTsNs, "logEntry.TsNs", logEntry.TsNs) + return + } + + // fmt.Printf(" read logEntry: %v, ts %v\n", string(logEntry.Key), time.Unix(0, logEntry.TsNs).UTC()) + if _, err = eachLogEntryFn(logEntry); err != nil { + err = fmt.Errorf("process log entry %v: %v", logEntry, err) + return + } + + processedTsNs = logEntry.TsNs + + pos += 4 + int(size) + + } + + return + } + + eachFileFn := func(entry *filer_pb.Entry, eachLogEntryFn log_buffer.EachLogEntryFuncType, starTsNs, stopTsNs int64) (processedTsNs int64, err error) { + if len(entry.Content) > 0 { + // skip .offset files + return + } + var urlStrings []string + for _, chunk := range entry.Chunks { + if chunk.Size == 0 { + continue + } + if chunk.IsChunkManifest { + glog.Warningf("this should not happen. unexpected chunk manifest in %s/%s", partitionDir, entry.Name) + return + } + urlStrings, err = lookupFileIdFn(chunk.FileId) + if err != nil { + err = fmt.Errorf("lookup %s: %v", chunk.FileId, err) + return + } + if len(urlStrings) == 0 { + err = fmt.Errorf("no url found for %s", chunk.FileId) + return + } + + // try one of the urlString until util.Get(urlString) succeeds + var processed bool + for _, urlString := range urlStrings { + // TODO optimization opportunity: reuse the buffer + var data []byte + // fmt.Printf("reading %s/%s %s\n", partitionDir, entry.Name, urlString) + if data, _, err = util_http.Get(urlString); err == nil { + processed = true + if processedTsNs, err = eachChunkFn(data, eachLogEntryFn, starTsNs, stopTsNs); err != nil { + return + } + break + } + } + if !processed { + err = fmt.Errorf("no data processed for %s %s", entry.Name, chunk.FileId) + return + } + + } + return + } + + return func(startPosition log_buffer.MessagePosition, stopTsNs int64, eachLogEntryFn log_buffer.EachLogEntryFuncType) (lastReadPosition log_buffer.MessagePosition, isDone bool, err error) { + startFileName := startPosition.UTC().Format(topic.TIME_FORMAT) + startTsNs := startPosition.Time.UnixNano() + stopTime := time.Unix(0, stopTsNs) + var processedTsNs int64 + err = filerClient.WithFilerClient(false, func(client filer_pb.SeaweedFilerClient) error { + return filer_pb.SeaweedList(client, partitionDir, "", func(entry *filer_pb.Entry, isLast bool) error { + if entry.IsDirectory { + return nil + } + if strings.HasSuffix(entry.Name, ".parquet") { + return nil + } + // FIXME: this is a hack to skip the .offset files + if strings.HasSuffix(entry.Name, ".offset") { + return nil + } + if stopTsNs != 0 && entry.Name > stopTime.UTC().Format(topic.TIME_FORMAT) { + isDone = true + return nil + } + if entry.Name < startPosition.UTC().Format(topic.TIME_FORMAT) { + return nil + } + if processedTsNs, err = eachFileFn(entry, eachLogEntryFn, startTsNs, stopTsNs); err != nil { + return err + } + return nil + + }, startFileName, true, math.MaxInt32) + }) + lastReadPosition = log_buffer.NewMessagePosition(processedTsNs, -2) + return + } +} diff --git a/weed/mq/logstore/read_parquet_to_log.go b/weed/mq/logstore/read_parquet_to_log.go new file mode 100644 index 000000000..f55d5e3b7 --- /dev/null +++ b/weed/mq/logstore/read_parquet_to_log.go @@ -0,0 +1,162 @@ +package logstore + +import ( + "encoding/binary" + "fmt" + "github.com/parquet-go/parquet-go" + "github.com/seaweedfs/seaweedfs/weed/filer" + "github.com/seaweedfs/seaweedfs/weed/mq/schema" + "github.com/seaweedfs/seaweedfs/weed/mq/topic" + "github.com/seaweedfs/seaweedfs/weed/pb/filer_pb" + "github.com/seaweedfs/seaweedfs/weed/pb/mq_pb" + "github.com/seaweedfs/seaweedfs/weed/util/chunk_cache" + "github.com/seaweedfs/seaweedfs/weed/util/log_buffer" + "google.golang.org/protobuf/proto" + "io" + "math" + "strings" +) + +var ( + chunkCache = chunk_cache.NewChunkCacheInMemory(256) // 256 entries, 8MB max per entry +) + +func GenParquetReadFunc(filerClient filer_pb.FilerClient, t topic.Topic, p topic.Partition) log_buffer.LogReadFromDiskFuncType { + partitionDir := topic.PartitionDir(t, p) + + lookupFileIdFn := filer.LookupFn(filerClient) + + // read topic conf from filer + var topicConf *mq_pb.ConfigureTopicResponse + var err error + if err := filerClient.WithFilerClient(false, func(client filer_pb.SeaweedFilerClient) error { + topicConf, err = t.ReadConfFile(client) + return err + }); err != nil { + return nil + } + recordType := topicConf.GetRecordType() + recordType = schema.NewRecordTypeBuilder(recordType). + WithField(SW_COLUMN_NAME_TS, schema.TypeInt64). + WithField(SW_COLUMN_NAME_KEY, schema.TypeBytes). + RecordTypeEnd() + + parquetSchema, err := schema.ToParquetSchema(t.Name, recordType) + if err != nil { + return nil + } + parquetLevels, err := schema.ToParquetLevels(recordType) + if err != nil { + return nil + } + + // eachFileFn reads a parquet file and calls eachLogEntryFn for each log entry + eachFileFn := func(entry *filer_pb.Entry, eachLogEntryFn log_buffer.EachLogEntryFuncType, starTsNs, stopTsNs int64) (processedTsNs int64, err error) { + // create readerAt for the parquet file + fileSize := filer.FileSize(entry) + visibleIntervals, _ := filer.NonOverlappingVisibleIntervals(lookupFileIdFn, entry.Chunks, 0, int64(fileSize)) + chunkViews := filer.ViewFromVisibleIntervals(visibleIntervals, 0, int64(fileSize)) + readerCache := filer.NewReaderCache(32, chunkCache, lookupFileIdFn) + readerAt := filer.NewChunkReaderAtFromClient(readerCache, chunkViews, int64(fileSize)) + + // create parquet reader + parquetReader := parquet.NewReader(readerAt, parquetSchema) + rows := make([]parquet.Row, 128) + for { + rowCount, readErr := parquetReader.ReadRows(rows) + + for i := 0; i < rowCount; i++ { + row := rows[i] + // convert parquet row to schema_pb.RecordValue + recordValue, err := schema.ToRecordValue(recordType, parquetLevels, row) + if err != nil { + return processedTsNs, fmt.Errorf("ToRecordValue failed: %v", err) + } + processedTsNs = recordValue.Fields[SW_COLUMN_NAME_TS].GetInt64Value() + if processedTsNs < starTsNs { + continue + } + if stopTsNs != 0 && processedTsNs >= stopTsNs { + return processedTsNs, nil + } + + data, marshalErr := proto.Marshal(recordValue) + if marshalErr != nil { + return processedTsNs, fmt.Errorf("marshal record value: %v", marshalErr) + } + + logEntry := &filer_pb.LogEntry{ + Key: recordValue.Fields[SW_COLUMN_NAME_KEY].GetBytesValue(), + TsNs: processedTsNs, + Data: data, + } + + // fmt.Printf(" parquet entry %s ts %v\n", string(logEntry.Key), time.Unix(0, logEntry.TsNs).UTC()) + + if _, err = eachLogEntryFn(logEntry); err != nil { + return processedTsNs, fmt.Errorf("process log entry %v: %v", logEntry, err) + } + } + + if readErr != nil { + if readErr == io.EOF { + return processedTsNs, nil + } + return processedTsNs, readErr + } + } + return + } + + return func(startPosition log_buffer.MessagePosition, stopTsNs int64, eachLogEntryFn log_buffer.EachLogEntryFuncType) (lastReadPosition log_buffer.MessagePosition, isDone bool, err error) { + startFileName := startPosition.UTC().Format(topic.TIME_FORMAT) + startTsNs := startPosition.Time.UnixNano() + var processedTsNs int64 + + err = filerClient.WithFilerClient(false, func(client filer_pb.SeaweedFilerClient) error { + + return filer_pb.SeaweedList(client, partitionDir, "", func(entry *filer_pb.Entry, isLast bool) error { + if entry.IsDirectory { + return nil + } + if !strings.HasSuffix(entry.Name, ".parquet") { + return nil + } + if len(entry.Extended) == 0 { + return nil + } + + // read minTs from the parquet file + minTsBytes := entry.Extended["min"] + if len(minTsBytes) != 8 { + return nil + } + minTsNs := int64(binary.BigEndian.Uint64(minTsBytes)) + + // read max ts + maxTsBytes := entry.Extended["max"] + if len(maxTsBytes) != 8 { + return nil + } + maxTsNs := int64(binary.BigEndian.Uint64(maxTsBytes)) + + if stopTsNs != 0 && stopTsNs <= minTsNs { + isDone = true + return nil + } + + if maxTsNs < startTsNs { + return nil + } + + if processedTsNs, err = eachFileFn(entry, eachLogEntryFn, startTsNs, stopTsNs); err != nil { + return err + } + return nil + + }, startFileName, true, math.MaxInt32) + }) + lastReadPosition = log_buffer.NewMessagePosition(processedTsNs, -2) + return + } +} diff --git a/weed/mq/pub_balancer/broker_stats.go b/weed/mq/pub_balancer/broker_stats.go index c579c275e..e72703d5f 100644 --- a/weed/mq/pub_balancer/broker_stats.go +++ b/weed/mq/pub_balancer/broker_stats.go @@ -53,7 +53,7 @@ func (bs *BrokerStats) UpdateStats(stats *mq_pb.BrokerStats) { } publisherCount += topicPartitionStats.PublisherCount subscriberCount += topicPartitionStats.SubscriberCount - key := tps.TopicPartition.String() + key := tps.TopicPartition.TopicPartitionId() bs.TopicPartitionStats.Set(key, tps) delete(currentTopicPartitions, key) } @@ -79,7 +79,7 @@ func (bs *BrokerStats) RegisterAssignment(t *mq_pb.Topic, partition *mq_pb.Parti PublisherCount: 0, SubscriberCount: 0, } - key := tps.TopicPartition.String() + key := tps.TopicPartition.TopicPartitionId() if isAdd { bs.TopicPartitionStats.SetIfAbsent(key, tps) } else { diff --git a/weed/mq/schema/schema.go b/weed/mq/schema/schema.go index 5fadf2cc2..ca31ce534 100644 --- a/weed/mq/schema/schema.go +++ b/weed/mq/schema/schema.go @@ -24,3 +24,30 @@ func (s *Schema) GetField(name string) (*schema_pb.Field, bool) { field, ok := s.fieldMap[name] return field, ok } + +func TypeToString(t *schema_pb.Type) string { + switch t.Kind.(type) { + case *schema_pb.Type_ScalarType: + switch t.GetScalarType() { + case schema_pb.ScalarType_BOOL: + return "bool" + case schema_pb.ScalarType_INT32: + return "int32" + case schema_pb.ScalarType_INT64: + return "int64" + case schema_pb.ScalarType_FLOAT: + return "float" + case schema_pb.ScalarType_DOUBLE: + return "double" + case schema_pb.ScalarType_BYTES: + return "bytes" + case schema_pb.ScalarType_STRING: + return "string" + } + case *schema_pb.Type_ListType: + return "list" + case *schema_pb.Type_RecordType: + return "record" + } + return "unknown" +} diff --git a/weed/mq/schema/schema_builder.go b/weed/mq/schema/schema_builder.go index db89ce34c..35272af47 100644 --- a/weed/mq/schema/schema_builder.go +++ b/weed/mq/schema/schema_builder.go @@ -19,10 +19,12 @@ type RecordTypeBuilder struct { recordType *schema_pb.RecordType } +// RecordTypeBegin creates a new RecordTypeBuilder, it should be followed by a series of WithField methods and RecordTypeEnd func RecordTypeBegin() *RecordTypeBuilder { return &RecordTypeBuilder{recordType: &schema_pb.RecordType{}} } +// RecordTypeEnd finishes the building of a RecordValue func (rtb *RecordTypeBuilder) RecordTypeEnd() *schema_pb.RecordType { // be consistent with parquet.node.go `func (g Group) Fields() []Field` sort.Slice(rtb.recordType.Fields, func(i, j int) bool { @@ -31,6 +33,11 @@ func (rtb *RecordTypeBuilder) RecordTypeEnd() *schema_pb.RecordType { return rtb.recordType } +// NewRecordTypeBuilder creates a new RecordTypeBuilder from an existing RecordType, it should be followed by a series of WithField methods and RecordTypeEnd +func NewRecordTypeBuilder(recordType *schema_pb.RecordType) (rtb *RecordTypeBuilder) { + return &RecordTypeBuilder{recordType: recordType} +} + func (rtb *RecordTypeBuilder) WithField(name string, scalarType *schema_pb.Type) *RecordTypeBuilder { rtb.recordType.Fields = append(rtb.recordType.Fields, &schema_pb.Field{ Name: name, diff --git a/weed/mq/sub_coordinator/partition_consumer_mapping.go b/weed/mq/sub_coordinator/partition_consumer_mapping.go index 5d1cf158a..e900e4a33 100644 --- a/weed/mq/sub_coordinator/partition_consumer_mapping.go +++ b/weed/mq/sub_coordinator/partition_consumer_mapping.go @@ -11,13 +11,6 @@ type PartitionConsumerMapping struct { prevMappings []*PartitionSlotToConsumerInstanceList } -func NewPartitionConsumerMapping(ringSize int32) *PartitionConsumerMapping { - newVersion := time.Now().UnixNano() - return &PartitionConsumerMapping{ - currentMapping: NewPartitionSlotToConsumerInstanceList(ringSize, newVersion), - } -} - // Balance goal: // 1. max processing power utilization // 2. allow one consumer instance to be down unexpectedly @@ -27,8 +20,7 @@ func (pcm *PartitionConsumerMapping) BalanceToConsumerInstances(partitionSlotToB if len(partitionSlotToBrokerList.PartitionSlots) == 0 || len(consumerInstances) == 0 { return } - newVersion := time.Now().UnixNano() - newMapping := NewPartitionSlotToConsumerInstanceList(partitionSlotToBrokerList.RingSize, newVersion) + newMapping := NewPartitionSlotToConsumerInstanceList(partitionSlotToBrokerList.RingSize, time.Now()) var prevMapping *PartitionSlotToConsumerInstanceList if len(pcm.prevMappings) > 0 { prevMapping = pcm.prevMappings[len(pcm.prevMappings)-1] diff --git a/weed/mq/sub_coordinator/partition_list.go b/weed/mq/sub_coordinator/partition_list.go index 384c1b875..16bf1ff0c 100644 --- a/weed/mq/sub_coordinator/partition_list.go +++ b/weed/mq/sub_coordinator/partition_list.go @@ -1,6 +1,6 @@ package sub_coordinator -import "github.com/seaweedfs/seaweedfs/weed/mq/topic" +import "time" type PartitionSlotToConsumerInstance struct { RangeStart int32 @@ -17,17 +17,9 @@ type PartitionSlotToConsumerInstanceList struct { Version int64 } -func NewPartitionSlotToConsumerInstanceList(ringSize int32, version int64) *PartitionSlotToConsumerInstanceList { +func NewPartitionSlotToConsumerInstanceList(ringSize int32, version time.Time) *PartitionSlotToConsumerInstanceList { return &PartitionSlotToConsumerInstanceList{ RingSize: ringSize, - Version: version, + Version: version.UnixNano(), } } - -func ToPartitions(ringSize int32, slots []*PartitionSlotToConsumerInstance) []*topic.Partition { - partitions := make([]*topic.Partition, 0, len(slots)) - for _, slot := range slots { - partitions = append(partitions, topic.NewPartition(slot.RangeStart, slot.RangeStop, ringSize, slot.UnixTimeNs)) - } - return partitions -} diff --git a/weed/mq/topic/local_manager.go b/weed/mq/topic/local_manager.go index d87eff911..9f273723d 100644 --- a/weed/mq/topic/local_manager.go +++ b/weed/mq/topic/local_manager.go @@ -88,7 +88,7 @@ func (manager *LocalTopicManager) CollectStats(duration time.Duration) *mq_pb.Br Topic: Topic{Namespace: localTopic.Namespace, Name: localTopic.Name}, Partition: localPartition.Partition, } - stats.Stats[topicPartition.String()] = &mq_pb.TopicPartitionStats{ + stats.Stats[topicPartition.TopicPartitionId()] = &mq_pb.TopicPartitionStats{ Topic: &mq_pb.Topic{ Namespace: string(localTopic.Namespace), Name: localTopic.Name, diff --git a/weed/mq/topic/local_partition.go b/weed/mq/topic/local_partition.go index 8911c1841..e32fc2398 100644 --- a/weed/mq/topic/local_partition.go +++ b/weed/mq/topic/local_partition.go @@ -34,6 +34,7 @@ type LocalPartition struct { } var TIME_FORMAT = "2006-01-02-15-04-05" +var PartitionGenerationFormat = "v2006-01-02-15-04-05" func NewLocalPartition(partition Partition, logFlushFn log_buffer.LogFlushFuncType, readFromDiskFn log_buffer.LogReadFromDiskFuncType) *LocalPartition { lp := &LocalPartition{ diff --git a/weed/mq/topic/partition.go b/weed/mq/topic/partition.go index ba1accce1..7edf979b5 100644 --- a/weed/mq/topic/partition.go +++ b/weed/mq/topic/partition.go @@ -1,6 +1,10 @@ package topic -import "github.com/seaweedfs/seaweedfs/weed/pb/mq_pb" +import ( + "fmt" + "github.com/seaweedfs/seaweedfs/weed/pb/mq_pb" + "time" +) const PartitionCount = 4096 @@ -81,3 +85,24 @@ func (partition Partition) Overlaps(partition2 Partition) bool { } return true } + +func (partition Partition) String() string { + return fmt.Sprintf("%04d-%04d", partition.RangeStart, partition.RangeStop) +} + +func ParseTopicVersion(name string) (t time.Time, err error) { + return time.Parse(PartitionGenerationFormat, name) +} + +func ParsePartitionBoundary(name string) (start, stop int32) { + _, err := fmt.Sscanf(name, "%04d-%04d", &start, &stop) + if err != nil { + return 0, 0 + } + return start, stop +} + +func PartitionDir(t Topic, p Partition) string { + partitionGeneration := time.Unix(0, p.UnixTimeNs).UTC().Format(PartitionGenerationFormat) + return fmt.Sprintf("%s/%s/%04d-%04d", t.Dir(), partitionGeneration, p.RangeStart, p.RangeStop) +} diff --git a/weed/mq/topic/topic.go b/weed/mq/topic/topic.go index 6932fcb56..5e9012e70 100644 --- a/weed/mq/topic/topic.go +++ b/weed/mq/topic/topic.go @@ -1,8 +1,13 @@ package topic import ( + "bytes" + "errors" "fmt" + "github.com/seaweedfs/seaweedfs/weed/filer" + "github.com/seaweedfs/seaweedfs/weed/pb/filer_pb" "github.com/seaweedfs/seaweedfs/weed/pb/mq_pb" + jsonpb "google.golang.org/protobuf/encoding/protojson" ) type Topic struct { @@ -23,13 +28,42 @@ func FromPbTopic(topic *mq_pb.Topic) Topic { } } -func (tp Topic) ToPbTopic() *mq_pb.Topic { +func (t Topic) ToPbTopic() *mq_pb.Topic { return &mq_pb.Topic{ - Namespace: tp.Namespace, - Name: tp.Name, + Namespace: t.Namespace, + Name: t.Name, } } -func (tp Topic) String() string { - return fmt.Sprintf("%s.%s", tp.Namespace, tp.Name) +func (t Topic) String() string { + return fmt.Sprintf("%s.%s", t.Namespace, t.Name) +} + +func (t Topic) Dir() string { + return fmt.Sprintf("%s/%s/%s", filer.TopicsDir, t.Namespace, t.Name) +} + +func (t Topic) ReadConfFile(client filer_pb.SeaweedFilerClient) (*mq_pb.ConfigureTopicResponse, error) { + data, err := filer.ReadInsideFiler(client, t.Dir(), filer.TopicConfFile) + if errors.Is(err, filer_pb.ErrNotFound) { + return nil, err + } + if err != nil { + return nil, fmt.Errorf("read topic.conf of %v: %v", t, err) + } + // parse into filer conf object + conf := &mq_pb.ConfigureTopicResponse{} + if err = jsonpb.Unmarshal(data, conf); err != nil { + return nil, fmt.Errorf("unmarshal topic %v conf: %v", t, err) + } + return conf, nil +} + +func (t Topic) WriteConfFile(client filer_pb.SeaweedFilerClient, conf *mq_pb.ConfigureTopicResponse) error { + var buf bytes.Buffer + filer.ProtoToText(&buf, conf) + if err := filer.SaveInsideFiler(client, t.Dir(), filer.TopicConfFile, buf.Bytes()); err != nil { + return fmt.Errorf("save topic %v conf: %v", t, err) + } + return nil } diff --git a/weed/mq/topic/topic_partition.go b/weed/mq/topic/topic_partition.go index 20b33a7e4..b14bc9c46 100644 --- a/weed/mq/topic/topic_partition.go +++ b/weed/mq/topic/topic_partition.go @@ -7,6 +7,6 @@ type TopicPartition struct { Partition } -func (tp *TopicPartition) String() string { +func (tp *TopicPartition) TopicPartitionId() string { return fmt.Sprintf("%v.%v-%04d-%04d", tp.Namespace, tp.Topic, tp.RangeStart, tp.RangeStop) } diff --git a/weed/operation/submit.go b/weed/operation/submit.go index 73e50cc48..9470afced 100644 --- a/weed/operation/submit.go +++ b/weed/operation/submit.go @@ -19,19 +19,15 @@ import ( ) type FilePart struct { - Reader io.Reader - FileName string - FileSize int64 - MimeType string - ModTime int64 //in seconds - Replication string - Collection string - DataCenter string - Ttl string - DiskType string - Server string //this comes from assign result - Fid string //this comes from assign result, but customizable - Fsync bool + Reader io.Reader + FileName string + FileSize int64 + MimeType string + ModTime int64 //in seconds + Pref StoragePreference + Server string //this comes from assign result + Fid string //this comes from assign result, but customizable + Fsync bool } type SubmitResult struct { @@ -42,20 +38,29 @@ type SubmitResult struct { Error string `json:"error,omitempty"` } +type StoragePreference struct { + Replication string + Collection string + DataCenter string + Ttl string + DiskType string + MaxMB int +} + type GetMasterFn func(ctx context.Context) pb.ServerAddress -func SubmitFiles(masterFn GetMasterFn, grpcDialOption grpc.DialOption, files []FilePart, replication string, collection string, dataCenter string, ttl string, diskType string, maxMB int, usePublicUrl bool) ([]SubmitResult, error) { +func SubmitFiles(masterFn GetMasterFn, grpcDialOption grpc.DialOption, files []*FilePart, pref StoragePreference, usePublicUrl bool) ([]SubmitResult, error) { results := make([]SubmitResult, len(files)) for index, file := range files { results[index].FileName = file.FileName } ar := &VolumeAssignRequest{ Count: uint64(len(files)), - Replication: replication, - Collection: collection, - DataCenter: dataCenter, - Ttl: ttl, - DiskType: diskType, + Replication: pref.Replication, + Collection: pref.Collection, + DataCenter: pref.DataCenter, + Ttl: pref.Ttl, + DiskType: pref.DiskType, } ret, err := Assign(masterFn, grpcDialOption, ar) if err != nil { @@ -73,12 +78,8 @@ func SubmitFiles(masterFn GetMasterFn, grpcDialOption grpc.DialOption, files []F if usePublicUrl { file.Server = ret.PublicUrl } - file.Replication = replication - file.Collection = collection - file.DataCenter = dataCenter - file.Ttl = ttl - file.DiskType = diskType - results[index].Size, err = file.Upload(maxMB, masterFn, usePublicUrl, ret.Auth, grpcDialOption) + file.Pref = pref + results[index].Size, err = file.Upload(pref.MaxMB, masterFn, usePublicUrl, ret.Auth, grpcDialOption) if err != nil { results[index].Error = err.Error() } @@ -88,8 +89,8 @@ func SubmitFiles(masterFn GetMasterFn, grpcDialOption grpc.DialOption, files []F return results, nil } -func NewFileParts(fullPathFilenames []string) (ret []FilePart, err error) { - ret = make([]FilePart, len(fullPathFilenames)) +func NewFileParts(fullPathFilenames []string) (ret []*FilePart, err error) { + ret = make([]*FilePart, len(fullPathFilenames)) for index, file := range fullPathFilenames { if ret[index], err = newFilePart(file); err != nil { return @@ -97,7 +98,8 @@ func NewFileParts(fullPathFilenames []string) (ret []FilePart, err error) { } return } -func newFilePart(fullPathFilename string) (ret FilePart, err error) { +func newFilePart(fullPathFilename string) (ret *FilePart, err error) { + ret = &FilePart{} fh, openErr := os.Open(fullPathFilename) if openErr != nil { glog.V(0).Info("Failed to open file: ", fullPathFilename) @@ -121,7 +123,7 @@ func newFilePart(fullPathFilename string) (ret FilePart, err error) { return ret, nil } -func (fi FilePart) Upload(maxMB int, masterFn GetMasterFn, usePublicUrl bool, jwt security.EncodedJwt, grpcDialOption grpc.DialOption) (retSize uint32, err error) { +func (fi *FilePart) Upload(maxMB int, masterFn GetMasterFn, usePublicUrl bool, jwt security.EncodedJwt, grpcDialOption grpc.DialOption) (retSize uint32, err error) { fileUrl := "http://" + fi.Server + "/" + fi.Fid if fi.ModTime != 0 { fileUrl += "?ts=" + strconv.Itoa(int(fi.ModTime)) @@ -145,13 +147,13 @@ func (fi FilePart) Upload(maxMB int, masterFn GetMasterFn, usePublicUrl bool, jw var ret *AssignResult var id string - if fi.DataCenter != "" { + if fi.Pref.DataCenter != "" { ar := &VolumeAssignRequest{ Count: uint64(chunks), - Replication: fi.Replication, - Collection: fi.Collection, - Ttl: fi.Ttl, - DiskType: fi.DiskType, + Replication: fi.Pref.Replication, + Collection: fi.Pref.Collection, + Ttl: fi.Pref.Ttl, + DiskType: fi.Pref.DiskType, } ret, err = Assign(masterFn, grpcDialOption, ar) if err != nil { @@ -159,13 +161,13 @@ func (fi FilePart) Upload(maxMB int, masterFn GetMasterFn, usePublicUrl bool, jw } } for i := int64(0); i < chunks; i++ { - if fi.DataCenter == "" { + if fi.Pref.DataCenter == "" { ar := &VolumeAssignRequest{ Count: 1, - Replication: fi.Replication, - Collection: fi.Collection, - Ttl: fi.Ttl, - DiskType: fi.DiskType, + Replication: fi.Pref.Replication, + Collection: fi.Pref.Collection, + Ttl: fi.Pref.Ttl, + DiskType: fi.Pref.DiskType, } ret, err = Assign(masterFn, grpcDialOption, ar) if err != nil { diff --git a/weed/pb/filer_pb/filer.pb.go b/weed/pb/filer_pb/filer.pb.go index e6a043af3..bdede73e7 100644 --- a/weed/pb/filer_pb/filer.pb.go +++ b/weed/pb/filer_pb/filer.pb.go @@ -1,7 +1,7 @@ // Code generated by protoc-gen-go. DO NOT EDIT. // versions: -// protoc-gen-go v1.32.0 -// protoc v4.25.3 +// protoc-gen-go v1.34.2 +// protoc v5.28.1 // source: filer.proto package filer_pb @@ -5216,7 +5216,7 @@ func file_filer_proto_rawDescGZIP() []byte { } var file_filer_proto_msgTypes = make([]protoimpl.MessageInfo, 70) -var file_filer_proto_goTypes = []interface{}{ +var file_filer_proto_goTypes = []any{ (*LookupDirectoryEntryRequest)(nil), // 0: filer_pb.LookupDirectoryEntryRequest (*LookupDirectoryEntryResponse)(nil), // 1: filer_pb.LookupDirectoryEntryResponse (*ListEntriesRequest)(nil), // 2: filer_pb.ListEntriesRequest @@ -5379,7 +5379,7 @@ func file_filer_proto_init() { return } if !protoimpl.UnsafeEnabled { - file_filer_proto_msgTypes[0].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[0].Exporter = func(v any, i int) any { switch v := v.(*LookupDirectoryEntryRequest); i { case 0: return &v.state @@ -5391,7 +5391,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[1].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[1].Exporter = func(v any, i int) any { switch v := v.(*LookupDirectoryEntryResponse); i { case 0: return &v.state @@ -5403,7 +5403,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[2].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[2].Exporter = func(v any, i int) any { switch v := v.(*ListEntriesRequest); i { case 0: return &v.state @@ -5415,7 +5415,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[3].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[3].Exporter = func(v any, i int) any { switch v := v.(*ListEntriesResponse); i { case 0: return &v.state @@ -5427,7 +5427,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[4].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[4].Exporter = func(v any, i int) any { switch v := v.(*RemoteEntry); i { case 0: return &v.state @@ -5439,7 +5439,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[5].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[5].Exporter = func(v any, i int) any { switch v := v.(*Entry); i { case 0: return &v.state @@ -5451,7 +5451,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[6].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[6].Exporter = func(v any, i int) any { switch v := v.(*FullEntry); i { case 0: return &v.state @@ -5463,7 +5463,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[7].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[7].Exporter = func(v any, i int) any { switch v := v.(*EventNotification); i { case 0: return &v.state @@ -5475,7 +5475,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[8].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[8].Exporter = func(v any, i int) any { switch v := v.(*FileChunk); i { case 0: return &v.state @@ -5487,7 +5487,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[9].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[9].Exporter = func(v any, i int) any { switch v := v.(*FileChunkManifest); i { case 0: return &v.state @@ -5499,7 +5499,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[10].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[10].Exporter = func(v any, i int) any { switch v := v.(*FileId); i { case 0: return &v.state @@ -5511,7 +5511,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[11].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[11].Exporter = func(v any, i int) any { switch v := v.(*FuseAttributes); i { case 0: return &v.state @@ -5523,7 +5523,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[12].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[12].Exporter = func(v any, i int) any { switch v := v.(*CreateEntryRequest); i { case 0: return &v.state @@ -5535,7 +5535,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[13].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[13].Exporter = func(v any, i int) any { switch v := v.(*CreateEntryResponse); i { case 0: return &v.state @@ -5547,7 +5547,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[14].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[14].Exporter = func(v any, i int) any { switch v := v.(*UpdateEntryRequest); i { case 0: return &v.state @@ -5559,7 +5559,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[15].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[15].Exporter = func(v any, i int) any { switch v := v.(*UpdateEntryResponse); i { case 0: return &v.state @@ -5571,7 +5571,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[16].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[16].Exporter = func(v any, i int) any { switch v := v.(*AppendToEntryRequest); i { case 0: return &v.state @@ -5583,7 +5583,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[17].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[17].Exporter = func(v any, i int) any { switch v := v.(*AppendToEntryResponse); i { case 0: return &v.state @@ -5595,7 +5595,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[18].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[18].Exporter = func(v any, i int) any { switch v := v.(*DeleteEntryRequest); i { case 0: return &v.state @@ -5607,7 +5607,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[19].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[19].Exporter = func(v any, i int) any { switch v := v.(*DeleteEntryResponse); i { case 0: return &v.state @@ -5619,7 +5619,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[20].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[20].Exporter = func(v any, i int) any { switch v := v.(*AtomicRenameEntryRequest); i { case 0: return &v.state @@ -5631,7 +5631,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[21].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[21].Exporter = func(v any, i int) any { switch v := v.(*AtomicRenameEntryResponse); i { case 0: return &v.state @@ -5643,7 +5643,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[22].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[22].Exporter = func(v any, i int) any { switch v := v.(*StreamRenameEntryRequest); i { case 0: return &v.state @@ -5655,7 +5655,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[23].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[23].Exporter = func(v any, i int) any { switch v := v.(*StreamRenameEntryResponse); i { case 0: return &v.state @@ -5667,7 +5667,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[24].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[24].Exporter = func(v any, i int) any { switch v := v.(*AssignVolumeRequest); i { case 0: return &v.state @@ -5679,7 +5679,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[25].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[25].Exporter = func(v any, i int) any { switch v := v.(*AssignVolumeResponse); i { case 0: return &v.state @@ -5691,7 +5691,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[26].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[26].Exporter = func(v any, i int) any { switch v := v.(*LookupVolumeRequest); i { case 0: return &v.state @@ -5703,7 +5703,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[27].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[27].Exporter = func(v any, i int) any { switch v := v.(*Locations); i { case 0: return &v.state @@ -5715,7 +5715,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[28].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[28].Exporter = func(v any, i int) any { switch v := v.(*Location); i { case 0: return &v.state @@ -5727,7 +5727,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[29].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[29].Exporter = func(v any, i int) any { switch v := v.(*LookupVolumeResponse); i { case 0: return &v.state @@ -5739,7 +5739,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[30].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[30].Exporter = func(v any, i int) any { switch v := v.(*Collection); i { case 0: return &v.state @@ -5751,7 +5751,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[31].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[31].Exporter = func(v any, i int) any { switch v := v.(*CollectionListRequest); i { case 0: return &v.state @@ -5763,7 +5763,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[32].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[32].Exporter = func(v any, i int) any { switch v := v.(*CollectionListResponse); i { case 0: return &v.state @@ -5775,7 +5775,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[33].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[33].Exporter = func(v any, i int) any { switch v := v.(*DeleteCollectionRequest); i { case 0: return &v.state @@ -5787,7 +5787,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[34].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[34].Exporter = func(v any, i int) any { switch v := v.(*DeleteCollectionResponse); i { case 0: return &v.state @@ -5799,7 +5799,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[35].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[35].Exporter = func(v any, i int) any { switch v := v.(*StatisticsRequest); i { case 0: return &v.state @@ -5811,7 +5811,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[36].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[36].Exporter = func(v any, i int) any { switch v := v.(*StatisticsResponse); i { case 0: return &v.state @@ -5823,7 +5823,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[37].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[37].Exporter = func(v any, i int) any { switch v := v.(*PingRequest); i { case 0: return &v.state @@ -5835,7 +5835,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[38].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[38].Exporter = func(v any, i int) any { switch v := v.(*PingResponse); i { case 0: return &v.state @@ -5847,7 +5847,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[39].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[39].Exporter = func(v any, i int) any { switch v := v.(*GetFilerConfigurationRequest); i { case 0: return &v.state @@ -5859,7 +5859,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[40].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[40].Exporter = func(v any, i int) any { switch v := v.(*GetFilerConfigurationResponse); i { case 0: return &v.state @@ -5871,7 +5871,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[41].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[41].Exporter = func(v any, i int) any { switch v := v.(*SubscribeMetadataRequest); i { case 0: return &v.state @@ -5883,7 +5883,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[42].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[42].Exporter = func(v any, i int) any { switch v := v.(*SubscribeMetadataResponse); i { case 0: return &v.state @@ -5895,7 +5895,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[43].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[43].Exporter = func(v any, i int) any { switch v := v.(*TraverseBfsMetadataRequest); i { case 0: return &v.state @@ -5907,7 +5907,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[44].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[44].Exporter = func(v any, i int) any { switch v := v.(*TraverseBfsMetadataResponse); i { case 0: return &v.state @@ -5919,7 +5919,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[45].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[45].Exporter = func(v any, i int) any { switch v := v.(*LogEntry); i { case 0: return &v.state @@ -5931,7 +5931,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[46].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[46].Exporter = func(v any, i int) any { switch v := v.(*KeepConnectedRequest); i { case 0: return &v.state @@ -5943,7 +5943,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[47].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[47].Exporter = func(v any, i int) any { switch v := v.(*KeepConnectedResponse); i { case 0: return &v.state @@ -5955,7 +5955,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[48].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[48].Exporter = func(v any, i int) any { switch v := v.(*LocateBrokerRequest); i { case 0: return &v.state @@ -5967,7 +5967,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[49].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[49].Exporter = func(v any, i int) any { switch v := v.(*LocateBrokerResponse); i { case 0: return &v.state @@ -5979,7 +5979,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[50].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[50].Exporter = func(v any, i int) any { switch v := v.(*KvGetRequest); i { case 0: return &v.state @@ -5991,7 +5991,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[51].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[51].Exporter = func(v any, i int) any { switch v := v.(*KvGetResponse); i { case 0: return &v.state @@ -6003,7 +6003,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[52].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[52].Exporter = func(v any, i int) any { switch v := v.(*KvPutRequest); i { case 0: return &v.state @@ -6015,7 +6015,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[53].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[53].Exporter = func(v any, i int) any { switch v := v.(*KvPutResponse); i { case 0: return &v.state @@ -6027,7 +6027,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[54].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[54].Exporter = func(v any, i int) any { switch v := v.(*FilerConf); i { case 0: return &v.state @@ -6039,7 +6039,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[55].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[55].Exporter = func(v any, i int) any { switch v := v.(*CacheRemoteObjectToLocalClusterRequest); i { case 0: return &v.state @@ -6051,7 +6051,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[56].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[56].Exporter = func(v any, i int) any { switch v := v.(*CacheRemoteObjectToLocalClusterResponse); i { case 0: return &v.state @@ -6063,7 +6063,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[57].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[57].Exporter = func(v any, i int) any { switch v := v.(*LockRequest); i { case 0: return &v.state @@ -6075,7 +6075,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[58].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[58].Exporter = func(v any, i int) any { switch v := v.(*LockResponse); i { case 0: return &v.state @@ -6087,7 +6087,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[59].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[59].Exporter = func(v any, i int) any { switch v := v.(*UnlockRequest); i { case 0: return &v.state @@ -6099,7 +6099,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[60].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[60].Exporter = func(v any, i int) any { switch v := v.(*UnlockResponse); i { case 0: return &v.state @@ -6111,7 +6111,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[61].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[61].Exporter = func(v any, i int) any { switch v := v.(*FindLockOwnerRequest); i { case 0: return &v.state @@ -6123,7 +6123,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[62].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[62].Exporter = func(v any, i int) any { switch v := v.(*FindLockOwnerResponse); i { case 0: return &v.state @@ -6135,7 +6135,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[63].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[63].Exporter = func(v any, i int) any { switch v := v.(*Lock); i { case 0: return &v.state @@ -6147,7 +6147,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[64].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[64].Exporter = func(v any, i int) any { switch v := v.(*TransferLocksRequest); i { case 0: return &v.state @@ -6159,7 +6159,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[65].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[65].Exporter = func(v any, i int) any { switch v := v.(*TransferLocksResponse); i { case 0: return &v.state @@ -6171,7 +6171,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[68].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[68].Exporter = func(v any, i int) any { switch v := v.(*LocateBrokerResponse_Resource); i { case 0: return &v.state @@ -6183,7 +6183,7 @@ func file_filer_proto_init() { return nil } } - file_filer_proto_msgTypes[69].Exporter = func(v interface{}, i int) interface{} { + file_filer_proto_msgTypes[69].Exporter = func(v any, i int) any { switch v := v.(*FilerConf_PathConf); i { case 0: return &v.state diff --git a/weed/pb/filer_pb/filer_grpc.pb.go b/weed/pb/filer_pb/filer_grpc.pb.go index 87b8de33d..88bad1619 100644 --- a/weed/pb/filer_pb/filer_grpc.pb.go +++ b/weed/pb/filer_pb/filer_grpc.pb.go @@ -1,7 +1,7 @@ // Code generated by protoc-gen-go-grpc. DO NOT EDIT. // versions: -// - protoc-gen-go-grpc v1.3.0 -// - protoc v4.25.3 +// - protoc-gen-go-grpc v1.5.1 +// - protoc v5.28.1 // source: filer.proto package filer_pb @@ -15,8 +15,8 @@ import ( // This is a compile-time assertion to ensure that this generated file // is compatible with the grpc package it is being compiled against. -// Requires gRPC-Go v1.32.0 or later. -const _ = grpc.SupportPackageIsVersion7 +// Requires gRPC-Go v1.64.0 or later. +const _ = grpc.SupportPackageIsVersion9 const ( SeaweedFiler_LookupDirectoryEntry_FullMethodName = "/filer_pb.SeaweedFiler/LookupDirectoryEntry" @@ -51,13 +51,13 @@ const ( // For semantics around ctx use and closing/ending streaming RPCs, please refer to https://pkg.go.dev/google.golang.org/grpc/?tab=doc#ClientConn.NewStream. type SeaweedFilerClient interface { LookupDirectoryEntry(ctx context.Context, in *LookupDirectoryEntryRequest, opts ...grpc.CallOption) (*LookupDirectoryEntryResponse, error) - ListEntries(ctx context.Context, in *ListEntriesRequest, opts ...grpc.CallOption) (SeaweedFiler_ListEntriesClient, error) + ListEntries(ctx context.Context, in *ListEntriesRequest, opts ...grpc.CallOption) (grpc.ServerStreamingClient[ListEntriesResponse], error) CreateEntry(ctx context.Context, in *CreateEntryRequest, opts ...grpc.CallOption) (*CreateEntryResponse, error) UpdateEntry(ctx context.Context, in *UpdateEntryRequest, opts ...grpc.CallOption) (*UpdateEntryResponse, error) AppendToEntry(ctx context.Context, in *AppendToEntryRequest, opts ...grpc.CallOption) (*AppendToEntryResponse, error) DeleteEntry(ctx context.Context, in *DeleteEntryRequest, opts ...grpc.CallOption) (*DeleteEntryResponse, error) AtomicRenameEntry(ctx context.Context, in *AtomicRenameEntryRequest, opts ...grpc.CallOption) (*AtomicRenameEntryResponse, error) - StreamRenameEntry(ctx context.Context, in *StreamRenameEntryRequest, opts ...grpc.CallOption) (SeaweedFiler_StreamRenameEntryClient, error) + StreamRenameEntry(ctx context.Context, in *StreamRenameEntryRequest, opts ...grpc.CallOption) (grpc.ServerStreamingClient[StreamRenameEntryResponse], error) AssignVolume(ctx context.Context, in *AssignVolumeRequest, opts ...grpc.CallOption) (*AssignVolumeResponse, error) LookupVolume(ctx context.Context, in *LookupVolumeRequest, opts ...grpc.CallOption) (*LookupVolumeResponse, error) CollectionList(ctx context.Context, in *CollectionListRequest, opts ...grpc.CallOption) (*CollectionListResponse, error) @@ -65,9 +65,9 @@ type SeaweedFilerClient interface { Statistics(ctx context.Context, in *StatisticsRequest, opts ...grpc.CallOption) (*StatisticsResponse, error) Ping(ctx context.Context, in *PingRequest, opts ...grpc.CallOption) (*PingResponse, error) GetFilerConfiguration(ctx context.Context, in *GetFilerConfigurationRequest, opts ...grpc.CallOption) (*GetFilerConfigurationResponse, error) - TraverseBfsMetadata(ctx context.Context, in *TraverseBfsMetadataRequest, opts ...grpc.CallOption) (SeaweedFiler_TraverseBfsMetadataClient, error) - SubscribeMetadata(ctx context.Context, in *SubscribeMetadataRequest, opts ...grpc.CallOption) (SeaweedFiler_SubscribeMetadataClient, error) - SubscribeLocalMetadata(ctx context.Context, in *SubscribeMetadataRequest, opts ...grpc.CallOption) (SeaweedFiler_SubscribeLocalMetadataClient, error) + TraverseBfsMetadata(ctx context.Context, in *TraverseBfsMetadataRequest, opts ...grpc.CallOption) (grpc.ServerStreamingClient[TraverseBfsMetadataResponse], error) + SubscribeMetadata(ctx context.Context, in *SubscribeMetadataRequest, opts ...grpc.CallOption) (grpc.ServerStreamingClient[SubscribeMetadataResponse], error) + SubscribeLocalMetadata(ctx context.Context, in *SubscribeMetadataRequest, opts ...grpc.CallOption) (grpc.ServerStreamingClient[SubscribeMetadataResponse], error) KvGet(ctx context.Context, in *KvGetRequest, opts ...grpc.CallOption) (*KvGetResponse, error) KvPut(ctx context.Context, in *KvPutRequest, opts ...grpc.CallOption) (*KvPutResponse, error) CacheRemoteObjectToLocalCluster(ctx context.Context, in *CacheRemoteObjectToLocalClusterRequest, opts ...grpc.CallOption) (*CacheRemoteObjectToLocalClusterResponse, error) @@ -87,20 +87,22 @@ func NewSeaweedFilerClient(cc grpc.ClientConnInterface) SeaweedFilerClient { } func (c *seaweedFilerClient) LookupDirectoryEntry(ctx context.Context, in *LookupDirectoryEntryRequest, opts ...grpc.CallOption) (*LookupDirectoryEntryResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(LookupDirectoryEntryResponse) - err := c.cc.Invoke(ctx, SeaweedFiler_LookupDirectoryEntry_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, SeaweedFiler_LookupDirectoryEntry_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } return out, nil } -func (c *seaweedFilerClient) ListEntries(ctx context.Context, in *ListEntriesRequest, opts ...grpc.CallOption) (SeaweedFiler_ListEntriesClient, error) { - stream, err := c.cc.NewStream(ctx, &SeaweedFiler_ServiceDesc.Streams[0], SeaweedFiler_ListEntries_FullMethodName, opts...) +func (c *seaweedFilerClient) ListEntries(ctx context.Context, in *ListEntriesRequest, opts ...grpc.CallOption) (grpc.ServerStreamingClient[ListEntriesResponse], error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) + stream, err := c.cc.NewStream(ctx, &SeaweedFiler_ServiceDesc.Streams[0], SeaweedFiler_ListEntries_FullMethodName, cOpts...) if err != nil { return nil, err } - x := &seaweedFilerListEntriesClient{stream} + x := &grpc.GenericClientStream[ListEntriesRequest, ListEntriesResponse]{ClientStream: stream} if err := x.ClientStream.SendMsg(in); err != nil { return nil, err } @@ -110,26 +112,13 @@ func (c *seaweedFilerClient) ListEntries(ctx context.Context, in *ListEntriesReq return x, nil } -type SeaweedFiler_ListEntriesClient interface { - Recv() (*ListEntriesResponse, error) - grpc.ClientStream -} - -type seaweedFilerListEntriesClient struct { - grpc.ClientStream -} - -func (x *seaweedFilerListEntriesClient) Recv() (*ListEntriesResponse, error) { - m := new(ListEntriesResponse) - if err := x.ClientStream.RecvMsg(m); err != nil { - return nil, err - } - return m, nil -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type SeaweedFiler_ListEntriesClient = grpc.ServerStreamingClient[ListEntriesResponse] func (c *seaweedFilerClient) CreateEntry(ctx context.Context, in *CreateEntryRequest, opts ...grpc.CallOption) (*CreateEntryResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(CreateEntryResponse) - err := c.cc.Invoke(ctx, SeaweedFiler_CreateEntry_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, SeaweedFiler_CreateEntry_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -137,8 +126,9 @@ func (c *seaweedFilerClient) CreateEntry(ctx context.Context, in *CreateEntryReq } func (c *seaweedFilerClient) UpdateEntry(ctx context.Context, in *UpdateEntryRequest, opts ...grpc.CallOption) (*UpdateEntryResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(UpdateEntryResponse) - err := c.cc.Invoke(ctx, SeaweedFiler_UpdateEntry_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, SeaweedFiler_UpdateEntry_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -146,8 +136,9 @@ func (c *seaweedFilerClient) UpdateEntry(ctx context.Context, in *UpdateEntryReq } func (c *seaweedFilerClient) AppendToEntry(ctx context.Context, in *AppendToEntryRequest, opts ...grpc.CallOption) (*AppendToEntryResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(AppendToEntryResponse) - err := c.cc.Invoke(ctx, SeaweedFiler_AppendToEntry_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, SeaweedFiler_AppendToEntry_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -155,8 +146,9 @@ func (c *seaweedFilerClient) AppendToEntry(ctx context.Context, in *AppendToEntr } func (c *seaweedFilerClient) DeleteEntry(ctx context.Context, in *DeleteEntryRequest, opts ...grpc.CallOption) (*DeleteEntryResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(DeleteEntryResponse) - err := c.cc.Invoke(ctx, SeaweedFiler_DeleteEntry_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, SeaweedFiler_DeleteEntry_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -164,20 +156,22 @@ func (c *seaweedFilerClient) DeleteEntry(ctx context.Context, in *DeleteEntryReq } func (c *seaweedFilerClient) AtomicRenameEntry(ctx context.Context, in *AtomicRenameEntryRequest, opts ...grpc.CallOption) (*AtomicRenameEntryResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(AtomicRenameEntryResponse) - err := c.cc.Invoke(ctx, SeaweedFiler_AtomicRenameEntry_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, SeaweedFiler_AtomicRenameEntry_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } return out, nil } -func (c *seaweedFilerClient) StreamRenameEntry(ctx context.Context, in *StreamRenameEntryRequest, opts ...grpc.CallOption) (SeaweedFiler_StreamRenameEntryClient, error) { - stream, err := c.cc.NewStream(ctx, &SeaweedFiler_ServiceDesc.Streams[1], SeaweedFiler_StreamRenameEntry_FullMethodName, opts...) +func (c *seaweedFilerClient) StreamRenameEntry(ctx context.Context, in *StreamRenameEntryRequest, opts ...grpc.CallOption) (grpc.ServerStreamingClient[StreamRenameEntryResponse], error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) + stream, err := c.cc.NewStream(ctx, &SeaweedFiler_ServiceDesc.Streams[1], SeaweedFiler_StreamRenameEntry_FullMethodName, cOpts...) if err != nil { return nil, err } - x := &seaweedFilerStreamRenameEntryClient{stream} + x := &grpc.GenericClientStream[StreamRenameEntryRequest, StreamRenameEntryResponse]{ClientStream: stream} if err := x.ClientStream.SendMsg(in); err != nil { return nil, err } @@ -187,26 +181,13 @@ func (c *seaweedFilerClient) StreamRenameEntry(ctx context.Context, in *StreamRe return x, nil } -type SeaweedFiler_StreamRenameEntryClient interface { - Recv() (*StreamRenameEntryResponse, error) - grpc.ClientStream -} - -type seaweedFilerStreamRenameEntryClient struct { - grpc.ClientStream -} - -func (x *seaweedFilerStreamRenameEntryClient) Recv() (*StreamRenameEntryResponse, error) { - m := new(StreamRenameEntryResponse) - if err := x.ClientStream.RecvMsg(m); err != nil { - return nil, err - } - return m, nil -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type SeaweedFiler_StreamRenameEntryClient = grpc.ServerStreamingClient[StreamRenameEntryResponse] func (c *seaweedFilerClient) AssignVolume(ctx context.Context, in *AssignVolumeRequest, opts ...grpc.CallOption) (*AssignVolumeResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(AssignVolumeResponse) - err := c.cc.Invoke(ctx, SeaweedFiler_AssignVolume_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, SeaweedFiler_AssignVolume_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -214,8 +195,9 @@ func (c *seaweedFilerClient) AssignVolume(ctx context.Context, in *AssignVolumeR } func (c *seaweedFilerClient) LookupVolume(ctx context.Context, in *LookupVolumeRequest, opts ...grpc.CallOption) (*LookupVolumeResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(LookupVolumeResponse) - err := c.cc.Invoke(ctx, SeaweedFiler_LookupVolume_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, SeaweedFiler_LookupVolume_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -223,8 +205,9 @@ func (c *seaweedFilerClient) LookupVolume(ctx context.Context, in *LookupVolumeR } func (c *seaweedFilerClient) CollectionList(ctx context.Context, in *CollectionListRequest, opts ...grpc.CallOption) (*CollectionListResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(CollectionListResponse) - err := c.cc.Invoke(ctx, SeaweedFiler_CollectionList_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, SeaweedFiler_CollectionList_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -232,8 +215,9 @@ func (c *seaweedFilerClient) CollectionList(ctx context.Context, in *CollectionL } func (c *seaweedFilerClient) DeleteCollection(ctx context.Context, in *DeleteCollectionRequest, opts ...grpc.CallOption) (*DeleteCollectionResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(DeleteCollectionResponse) - err := c.cc.Invoke(ctx, SeaweedFiler_DeleteCollection_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, SeaweedFiler_DeleteCollection_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -241,8 +225,9 @@ func (c *seaweedFilerClient) DeleteCollection(ctx context.Context, in *DeleteCol } func (c *seaweedFilerClient) Statistics(ctx context.Context, in *StatisticsRequest, opts ...grpc.CallOption) (*StatisticsResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(StatisticsResponse) - err := c.cc.Invoke(ctx, SeaweedFiler_Statistics_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, SeaweedFiler_Statistics_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -250,8 +235,9 @@ func (c *seaweedFilerClient) Statistics(ctx context.Context, in *StatisticsReque } func (c *seaweedFilerClient) Ping(ctx context.Context, in *PingRequest, opts ...grpc.CallOption) (*PingResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(PingResponse) - err := c.cc.Invoke(ctx, SeaweedFiler_Ping_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, SeaweedFiler_Ping_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -259,20 +245,22 @@ func (c *seaweedFilerClient) Ping(ctx context.Context, in *PingRequest, opts ... } func (c *seaweedFilerClient) GetFilerConfiguration(ctx context.Context, in *GetFilerConfigurationRequest, opts ...grpc.CallOption) (*GetFilerConfigurationResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(GetFilerConfigurationResponse) - err := c.cc.Invoke(ctx, SeaweedFiler_GetFilerConfiguration_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, SeaweedFiler_GetFilerConfiguration_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } return out, nil } -func (c *seaweedFilerClient) TraverseBfsMetadata(ctx context.Context, in *TraverseBfsMetadataRequest, opts ...grpc.CallOption) (SeaweedFiler_TraverseBfsMetadataClient, error) { - stream, err := c.cc.NewStream(ctx, &SeaweedFiler_ServiceDesc.Streams[2], SeaweedFiler_TraverseBfsMetadata_FullMethodName, opts...) +func (c *seaweedFilerClient) TraverseBfsMetadata(ctx context.Context, in *TraverseBfsMetadataRequest, opts ...grpc.CallOption) (grpc.ServerStreamingClient[TraverseBfsMetadataResponse], error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) + stream, err := c.cc.NewStream(ctx, &SeaweedFiler_ServiceDesc.Streams[2], SeaweedFiler_TraverseBfsMetadata_FullMethodName, cOpts...) if err != nil { return nil, err } - x := &seaweedFilerTraverseBfsMetadataClient{stream} + x := &grpc.GenericClientStream[TraverseBfsMetadataRequest, TraverseBfsMetadataResponse]{ClientStream: stream} if err := x.ClientStream.SendMsg(in); err != nil { return nil, err } @@ -282,29 +270,16 @@ func (c *seaweedFilerClient) TraverseBfsMetadata(ctx context.Context, in *Traver return x, nil } -type SeaweedFiler_TraverseBfsMetadataClient interface { - Recv() (*TraverseBfsMetadataResponse, error) - grpc.ClientStream -} - -type seaweedFilerTraverseBfsMetadataClient struct { - grpc.ClientStream -} - -func (x *seaweedFilerTraverseBfsMetadataClient) Recv() (*TraverseBfsMetadataResponse, error) { - m := new(TraverseBfsMetadataResponse) - if err := x.ClientStream.RecvMsg(m); err != nil { - return nil, err - } - return m, nil -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type SeaweedFiler_TraverseBfsMetadataClient = grpc.ServerStreamingClient[TraverseBfsMetadataResponse] -func (c *seaweedFilerClient) SubscribeMetadata(ctx context.Context, in *SubscribeMetadataRequest, opts ...grpc.CallOption) (SeaweedFiler_SubscribeMetadataClient, error) { - stream, err := c.cc.NewStream(ctx, &SeaweedFiler_ServiceDesc.Streams[3], SeaweedFiler_SubscribeMetadata_FullMethodName, opts...) +func (c *seaweedFilerClient) SubscribeMetadata(ctx context.Context, in *SubscribeMetadataRequest, opts ...grpc.CallOption) (grpc.ServerStreamingClient[SubscribeMetadataResponse], error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) + stream, err := c.cc.NewStream(ctx, &SeaweedFiler_ServiceDesc.Streams[3], SeaweedFiler_SubscribeMetadata_FullMethodName, cOpts...) if err != nil { return nil, err } - x := &seaweedFilerSubscribeMetadataClient{stream} + x := &grpc.GenericClientStream[SubscribeMetadataRequest, SubscribeMetadataResponse]{ClientStream: stream} if err := x.ClientStream.SendMsg(in); err != nil { return nil, err } @@ -314,29 +289,16 @@ func (c *seaweedFilerClient) SubscribeMetadata(ctx context.Context, in *Subscrib return x, nil } -type SeaweedFiler_SubscribeMetadataClient interface { - Recv() (*SubscribeMetadataResponse, error) - grpc.ClientStream -} - -type seaweedFilerSubscribeMetadataClient struct { - grpc.ClientStream -} - -func (x *seaweedFilerSubscribeMetadataClient) Recv() (*SubscribeMetadataResponse, error) { - m := new(SubscribeMetadataResponse) - if err := x.ClientStream.RecvMsg(m); err != nil { - return nil, err - } - return m, nil -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type SeaweedFiler_SubscribeMetadataClient = grpc.ServerStreamingClient[SubscribeMetadataResponse] -func (c *seaweedFilerClient) SubscribeLocalMetadata(ctx context.Context, in *SubscribeMetadataRequest, opts ...grpc.CallOption) (SeaweedFiler_SubscribeLocalMetadataClient, error) { - stream, err := c.cc.NewStream(ctx, &SeaweedFiler_ServiceDesc.Streams[4], SeaweedFiler_SubscribeLocalMetadata_FullMethodName, opts...) +func (c *seaweedFilerClient) SubscribeLocalMetadata(ctx context.Context, in *SubscribeMetadataRequest, opts ...grpc.CallOption) (grpc.ServerStreamingClient[SubscribeMetadataResponse], error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) + stream, err := c.cc.NewStream(ctx, &SeaweedFiler_ServiceDesc.Streams[4], SeaweedFiler_SubscribeLocalMetadata_FullMethodName, cOpts...) if err != nil { return nil, err } - x := &seaweedFilerSubscribeLocalMetadataClient{stream} + x := &grpc.GenericClientStream[SubscribeMetadataRequest, SubscribeMetadataResponse]{ClientStream: stream} if err := x.ClientStream.SendMsg(in); err != nil { return nil, err } @@ -346,26 +308,13 @@ func (c *seaweedFilerClient) SubscribeLocalMetadata(ctx context.Context, in *Sub return x, nil } -type SeaweedFiler_SubscribeLocalMetadataClient interface { - Recv() (*SubscribeMetadataResponse, error) - grpc.ClientStream -} - -type seaweedFilerSubscribeLocalMetadataClient struct { - grpc.ClientStream -} - -func (x *seaweedFilerSubscribeLocalMetadataClient) Recv() (*SubscribeMetadataResponse, error) { - m := new(SubscribeMetadataResponse) - if err := x.ClientStream.RecvMsg(m); err != nil { - return nil, err - } - return m, nil -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type SeaweedFiler_SubscribeLocalMetadataClient = grpc.ServerStreamingClient[SubscribeMetadataResponse] func (c *seaweedFilerClient) KvGet(ctx context.Context, in *KvGetRequest, opts ...grpc.CallOption) (*KvGetResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(KvGetResponse) - err := c.cc.Invoke(ctx, SeaweedFiler_KvGet_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, SeaweedFiler_KvGet_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -373,8 +322,9 @@ func (c *seaweedFilerClient) KvGet(ctx context.Context, in *KvGetRequest, opts . } func (c *seaweedFilerClient) KvPut(ctx context.Context, in *KvPutRequest, opts ...grpc.CallOption) (*KvPutResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(KvPutResponse) - err := c.cc.Invoke(ctx, SeaweedFiler_KvPut_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, SeaweedFiler_KvPut_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -382,8 +332,9 @@ func (c *seaweedFilerClient) KvPut(ctx context.Context, in *KvPutRequest, opts . } func (c *seaweedFilerClient) CacheRemoteObjectToLocalCluster(ctx context.Context, in *CacheRemoteObjectToLocalClusterRequest, opts ...grpc.CallOption) (*CacheRemoteObjectToLocalClusterResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(CacheRemoteObjectToLocalClusterResponse) - err := c.cc.Invoke(ctx, SeaweedFiler_CacheRemoteObjectToLocalCluster_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, SeaweedFiler_CacheRemoteObjectToLocalCluster_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -391,8 +342,9 @@ func (c *seaweedFilerClient) CacheRemoteObjectToLocalCluster(ctx context.Context } func (c *seaweedFilerClient) DistributedLock(ctx context.Context, in *LockRequest, opts ...grpc.CallOption) (*LockResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(LockResponse) - err := c.cc.Invoke(ctx, SeaweedFiler_DistributedLock_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, SeaweedFiler_DistributedLock_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -400,8 +352,9 @@ func (c *seaweedFilerClient) DistributedLock(ctx context.Context, in *LockReques } func (c *seaweedFilerClient) DistributedUnlock(ctx context.Context, in *UnlockRequest, opts ...grpc.CallOption) (*UnlockResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(UnlockResponse) - err := c.cc.Invoke(ctx, SeaweedFiler_DistributedUnlock_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, SeaweedFiler_DistributedUnlock_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -409,8 +362,9 @@ func (c *seaweedFilerClient) DistributedUnlock(ctx context.Context, in *UnlockRe } func (c *seaweedFilerClient) FindLockOwner(ctx context.Context, in *FindLockOwnerRequest, opts ...grpc.CallOption) (*FindLockOwnerResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(FindLockOwnerResponse) - err := c.cc.Invoke(ctx, SeaweedFiler_FindLockOwner_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, SeaweedFiler_FindLockOwner_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -418,8 +372,9 @@ func (c *seaweedFilerClient) FindLockOwner(ctx context.Context, in *FindLockOwne } func (c *seaweedFilerClient) TransferLocks(ctx context.Context, in *TransferLocksRequest, opts ...grpc.CallOption) (*TransferLocksResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(TransferLocksResponse) - err := c.cc.Invoke(ctx, SeaweedFiler_TransferLocks_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, SeaweedFiler_TransferLocks_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -428,16 +383,16 @@ func (c *seaweedFilerClient) TransferLocks(ctx context.Context, in *TransferLock // SeaweedFilerServer is the server API for SeaweedFiler service. // All implementations must embed UnimplementedSeaweedFilerServer -// for forward compatibility +// for forward compatibility. type SeaweedFilerServer interface { LookupDirectoryEntry(context.Context, *LookupDirectoryEntryRequest) (*LookupDirectoryEntryResponse, error) - ListEntries(*ListEntriesRequest, SeaweedFiler_ListEntriesServer) error + ListEntries(*ListEntriesRequest, grpc.ServerStreamingServer[ListEntriesResponse]) error CreateEntry(context.Context, *CreateEntryRequest) (*CreateEntryResponse, error) UpdateEntry(context.Context, *UpdateEntryRequest) (*UpdateEntryResponse, error) AppendToEntry(context.Context, *AppendToEntryRequest) (*AppendToEntryResponse, error) DeleteEntry(context.Context, *DeleteEntryRequest) (*DeleteEntryResponse, error) AtomicRenameEntry(context.Context, *AtomicRenameEntryRequest) (*AtomicRenameEntryResponse, error) - StreamRenameEntry(*StreamRenameEntryRequest, SeaweedFiler_StreamRenameEntryServer) error + StreamRenameEntry(*StreamRenameEntryRequest, grpc.ServerStreamingServer[StreamRenameEntryResponse]) error AssignVolume(context.Context, *AssignVolumeRequest) (*AssignVolumeResponse, error) LookupVolume(context.Context, *LookupVolumeRequest) (*LookupVolumeResponse, error) CollectionList(context.Context, *CollectionListRequest) (*CollectionListResponse, error) @@ -445,9 +400,9 @@ type SeaweedFilerServer interface { Statistics(context.Context, *StatisticsRequest) (*StatisticsResponse, error) Ping(context.Context, *PingRequest) (*PingResponse, error) GetFilerConfiguration(context.Context, *GetFilerConfigurationRequest) (*GetFilerConfigurationResponse, error) - TraverseBfsMetadata(*TraverseBfsMetadataRequest, SeaweedFiler_TraverseBfsMetadataServer) error - SubscribeMetadata(*SubscribeMetadataRequest, SeaweedFiler_SubscribeMetadataServer) error - SubscribeLocalMetadata(*SubscribeMetadataRequest, SeaweedFiler_SubscribeLocalMetadataServer) error + TraverseBfsMetadata(*TraverseBfsMetadataRequest, grpc.ServerStreamingServer[TraverseBfsMetadataResponse]) error + SubscribeMetadata(*SubscribeMetadataRequest, grpc.ServerStreamingServer[SubscribeMetadataResponse]) error + SubscribeLocalMetadata(*SubscribeMetadataRequest, grpc.ServerStreamingServer[SubscribeMetadataResponse]) error KvGet(context.Context, *KvGetRequest) (*KvGetResponse, error) KvPut(context.Context, *KvPutRequest) (*KvPutResponse, error) CacheRemoteObjectToLocalCluster(context.Context, *CacheRemoteObjectToLocalClusterRequest) (*CacheRemoteObjectToLocalClusterResponse, error) @@ -459,14 +414,17 @@ type SeaweedFilerServer interface { mustEmbedUnimplementedSeaweedFilerServer() } -// UnimplementedSeaweedFilerServer must be embedded to have forward compatible implementations. -type UnimplementedSeaweedFilerServer struct { -} +// UnimplementedSeaweedFilerServer must be embedded to have +// forward compatible implementations. +// +// NOTE: this should be embedded by value instead of pointer to avoid a nil +// pointer dereference when methods are called. +type UnimplementedSeaweedFilerServer struct{} func (UnimplementedSeaweedFilerServer) LookupDirectoryEntry(context.Context, *LookupDirectoryEntryRequest) (*LookupDirectoryEntryResponse, error) { return nil, status.Errorf(codes.Unimplemented, "method LookupDirectoryEntry not implemented") } -func (UnimplementedSeaweedFilerServer) ListEntries(*ListEntriesRequest, SeaweedFiler_ListEntriesServer) error { +func (UnimplementedSeaweedFilerServer) ListEntries(*ListEntriesRequest, grpc.ServerStreamingServer[ListEntriesResponse]) error { return status.Errorf(codes.Unimplemented, "method ListEntries not implemented") } func (UnimplementedSeaweedFilerServer) CreateEntry(context.Context, *CreateEntryRequest) (*CreateEntryResponse, error) { @@ -484,7 +442,7 @@ func (UnimplementedSeaweedFilerServer) DeleteEntry(context.Context, *DeleteEntry func (UnimplementedSeaweedFilerServer) AtomicRenameEntry(context.Context, *AtomicRenameEntryRequest) (*AtomicRenameEntryResponse, error) { return nil, status.Errorf(codes.Unimplemented, "method AtomicRenameEntry not implemented") } -func (UnimplementedSeaweedFilerServer) StreamRenameEntry(*StreamRenameEntryRequest, SeaweedFiler_StreamRenameEntryServer) error { +func (UnimplementedSeaweedFilerServer) StreamRenameEntry(*StreamRenameEntryRequest, grpc.ServerStreamingServer[StreamRenameEntryResponse]) error { return status.Errorf(codes.Unimplemented, "method StreamRenameEntry not implemented") } func (UnimplementedSeaweedFilerServer) AssignVolume(context.Context, *AssignVolumeRequest) (*AssignVolumeResponse, error) { @@ -508,13 +466,13 @@ func (UnimplementedSeaweedFilerServer) Ping(context.Context, *PingRequest) (*Pin func (UnimplementedSeaweedFilerServer) GetFilerConfiguration(context.Context, *GetFilerConfigurationRequest) (*GetFilerConfigurationResponse, error) { return nil, status.Errorf(codes.Unimplemented, "method GetFilerConfiguration not implemented") } -func (UnimplementedSeaweedFilerServer) TraverseBfsMetadata(*TraverseBfsMetadataRequest, SeaweedFiler_TraverseBfsMetadataServer) error { +func (UnimplementedSeaweedFilerServer) TraverseBfsMetadata(*TraverseBfsMetadataRequest, grpc.ServerStreamingServer[TraverseBfsMetadataResponse]) error { return status.Errorf(codes.Unimplemented, "method TraverseBfsMetadata not implemented") } -func (UnimplementedSeaweedFilerServer) SubscribeMetadata(*SubscribeMetadataRequest, SeaweedFiler_SubscribeMetadataServer) error { +func (UnimplementedSeaweedFilerServer) SubscribeMetadata(*SubscribeMetadataRequest, grpc.ServerStreamingServer[SubscribeMetadataResponse]) error { return status.Errorf(codes.Unimplemented, "method SubscribeMetadata not implemented") } -func (UnimplementedSeaweedFilerServer) SubscribeLocalMetadata(*SubscribeMetadataRequest, SeaweedFiler_SubscribeLocalMetadataServer) error { +func (UnimplementedSeaweedFilerServer) SubscribeLocalMetadata(*SubscribeMetadataRequest, grpc.ServerStreamingServer[SubscribeMetadataResponse]) error { return status.Errorf(codes.Unimplemented, "method SubscribeLocalMetadata not implemented") } func (UnimplementedSeaweedFilerServer) KvGet(context.Context, *KvGetRequest) (*KvGetResponse, error) { @@ -539,6 +497,7 @@ func (UnimplementedSeaweedFilerServer) TransferLocks(context.Context, *TransferL return nil, status.Errorf(codes.Unimplemented, "method TransferLocks not implemented") } func (UnimplementedSeaweedFilerServer) mustEmbedUnimplementedSeaweedFilerServer() {} +func (UnimplementedSeaweedFilerServer) testEmbeddedByValue() {} // UnsafeSeaweedFilerServer may be embedded to opt out of forward compatibility for this service. // Use of this interface is not recommended, as added methods to SeaweedFilerServer will @@ -548,6 +507,13 @@ type UnsafeSeaweedFilerServer interface { } func RegisterSeaweedFilerServer(s grpc.ServiceRegistrar, srv SeaweedFilerServer) { + // If the following call pancis, it indicates UnimplementedSeaweedFilerServer was + // embedded by pointer and is nil. This will cause panics if an + // unimplemented method is ever invoked, so we test this at initialization + // time to prevent it from happening at runtime later due to I/O. + if t, ok := srv.(interface{ testEmbeddedByValue() }); ok { + t.testEmbeddedByValue() + } s.RegisterService(&SeaweedFiler_ServiceDesc, srv) } @@ -574,21 +540,11 @@ func _SeaweedFiler_ListEntries_Handler(srv interface{}, stream grpc.ServerStream if err := stream.RecvMsg(m); err != nil { return err } - return srv.(SeaweedFilerServer).ListEntries(m, &seaweedFilerListEntriesServer{stream}) -} - -type SeaweedFiler_ListEntriesServer interface { - Send(*ListEntriesResponse) error - grpc.ServerStream + return srv.(SeaweedFilerServer).ListEntries(m, &grpc.GenericServerStream[ListEntriesRequest, ListEntriesResponse]{ServerStream: stream}) } -type seaweedFilerListEntriesServer struct { - grpc.ServerStream -} - -func (x *seaweedFilerListEntriesServer) Send(m *ListEntriesResponse) error { - return x.ServerStream.SendMsg(m) -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type SeaweedFiler_ListEntriesServer = grpc.ServerStreamingServer[ListEntriesResponse] func _SeaweedFiler_CreateEntry_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) { in := new(CreateEntryRequest) @@ -685,21 +641,11 @@ func _SeaweedFiler_StreamRenameEntry_Handler(srv interface{}, stream grpc.Server if err := stream.RecvMsg(m); err != nil { return err } - return srv.(SeaweedFilerServer).StreamRenameEntry(m, &seaweedFilerStreamRenameEntryServer{stream}) -} - -type SeaweedFiler_StreamRenameEntryServer interface { - Send(*StreamRenameEntryResponse) error - grpc.ServerStream -} - -type seaweedFilerStreamRenameEntryServer struct { - grpc.ServerStream + return srv.(SeaweedFilerServer).StreamRenameEntry(m, &grpc.GenericServerStream[StreamRenameEntryRequest, StreamRenameEntryResponse]{ServerStream: stream}) } -func (x *seaweedFilerStreamRenameEntryServer) Send(m *StreamRenameEntryResponse) error { - return x.ServerStream.SendMsg(m) -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type SeaweedFiler_StreamRenameEntryServer = grpc.ServerStreamingServer[StreamRenameEntryResponse] func _SeaweedFiler_AssignVolume_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) { in := new(AssignVolumeRequest) @@ -832,63 +778,33 @@ func _SeaweedFiler_TraverseBfsMetadata_Handler(srv interface{}, stream grpc.Serv if err := stream.RecvMsg(m); err != nil { return err } - return srv.(SeaweedFilerServer).TraverseBfsMetadata(m, &seaweedFilerTraverseBfsMetadataServer{stream}) + return srv.(SeaweedFilerServer).TraverseBfsMetadata(m, &grpc.GenericServerStream[TraverseBfsMetadataRequest, TraverseBfsMetadataResponse]{ServerStream: stream}) } -type SeaweedFiler_TraverseBfsMetadataServer interface { - Send(*TraverseBfsMetadataResponse) error - grpc.ServerStream -} - -type seaweedFilerTraverseBfsMetadataServer struct { - grpc.ServerStream -} - -func (x *seaweedFilerTraverseBfsMetadataServer) Send(m *TraverseBfsMetadataResponse) error { - return x.ServerStream.SendMsg(m) -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type SeaweedFiler_TraverseBfsMetadataServer = grpc.ServerStreamingServer[TraverseBfsMetadataResponse] func _SeaweedFiler_SubscribeMetadata_Handler(srv interface{}, stream grpc.ServerStream) error { m := new(SubscribeMetadataRequest) if err := stream.RecvMsg(m); err != nil { return err } - return srv.(SeaweedFilerServer).SubscribeMetadata(m, &seaweedFilerSubscribeMetadataServer{stream}) -} - -type SeaweedFiler_SubscribeMetadataServer interface { - Send(*SubscribeMetadataResponse) error - grpc.ServerStream + return srv.(SeaweedFilerServer).SubscribeMetadata(m, &grpc.GenericServerStream[SubscribeMetadataRequest, SubscribeMetadataResponse]{ServerStream: stream}) } -type seaweedFilerSubscribeMetadataServer struct { - grpc.ServerStream -} - -func (x *seaweedFilerSubscribeMetadataServer) Send(m *SubscribeMetadataResponse) error { - return x.ServerStream.SendMsg(m) -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type SeaweedFiler_SubscribeMetadataServer = grpc.ServerStreamingServer[SubscribeMetadataResponse] func _SeaweedFiler_SubscribeLocalMetadata_Handler(srv interface{}, stream grpc.ServerStream) error { m := new(SubscribeMetadataRequest) if err := stream.RecvMsg(m); err != nil { return err } - return srv.(SeaweedFilerServer).SubscribeLocalMetadata(m, &seaweedFilerSubscribeLocalMetadataServer{stream}) -} - -type SeaweedFiler_SubscribeLocalMetadataServer interface { - Send(*SubscribeMetadataResponse) error - grpc.ServerStream + return srv.(SeaweedFilerServer).SubscribeLocalMetadata(m, &grpc.GenericServerStream[SubscribeMetadataRequest, SubscribeMetadataResponse]{ServerStream: stream}) } -type seaweedFilerSubscribeLocalMetadataServer struct { - grpc.ServerStream -} - -func (x *seaweedFilerSubscribeLocalMetadataServer) Send(m *SubscribeMetadataResponse) error { - return x.ServerStream.SendMsg(m) -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type SeaweedFiler_SubscribeLocalMetadataServer = grpc.ServerStreamingServer[SubscribeMetadataResponse] func _SeaweedFiler_KvGet_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) { in := new(KvGetRequest) diff --git a/weed/pb/iam_pb/iam.pb.go b/weed/pb/iam_pb/iam.pb.go index 8918daa39..f7ee48166 100644 --- a/weed/pb/iam_pb/iam.pb.go +++ b/weed/pb/iam_pb/iam.pb.go @@ -1,7 +1,7 @@ // Code generated by protoc-gen-go. DO NOT EDIT. // versions: -// protoc-gen-go v1.32.0 -// protoc v4.25.3 +// protoc-gen-go v1.34.2 +// protoc v5.28.1 // source: iam.proto package iam_pb @@ -319,7 +319,7 @@ func file_iam_proto_rawDescGZIP() []byte { } var file_iam_proto_msgTypes = make([]protoimpl.MessageInfo, 4) -var file_iam_proto_goTypes = []interface{}{ +var file_iam_proto_goTypes = []any{ (*S3ApiConfiguration)(nil), // 0: iam_pb.S3ApiConfiguration (*Identity)(nil), // 1: iam_pb.Identity (*Credential)(nil), // 2: iam_pb.Credential @@ -343,7 +343,7 @@ func file_iam_proto_init() { return } if !protoimpl.UnsafeEnabled { - file_iam_proto_msgTypes[0].Exporter = func(v interface{}, i int) interface{} { + file_iam_proto_msgTypes[0].Exporter = func(v any, i int) any { switch v := v.(*S3ApiConfiguration); i { case 0: return &v.state @@ -355,7 +355,7 @@ func file_iam_proto_init() { return nil } } - file_iam_proto_msgTypes[1].Exporter = func(v interface{}, i int) interface{} { + file_iam_proto_msgTypes[1].Exporter = func(v any, i int) any { switch v := v.(*Identity); i { case 0: return &v.state @@ -367,7 +367,7 @@ func file_iam_proto_init() { return nil } } - file_iam_proto_msgTypes[2].Exporter = func(v interface{}, i int) interface{} { + file_iam_proto_msgTypes[2].Exporter = func(v any, i int) any { switch v := v.(*Credential); i { case 0: return &v.state @@ -379,7 +379,7 @@ func file_iam_proto_init() { return nil } } - file_iam_proto_msgTypes[3].Exporter = func(v interface{}, i int) interface{} { + file_iam_proto_msgTypes[3].Exporter = func(v any, i int) any { switch v := v.(*Account); i { case 0: return &v.state diff --git a/weed/pb/iam_pb/iam_grpc.pb.go b/weed/pb/iam_pb/iam_grpc.pb.go index 3c2a10a90..47c201f06 100644 --- a/weed/pb/iam_pb/iam_grpc.pb.go +++ b/weed/pb/iam_pb/iam_grpc.pb.go @@ -1,7 +1,7 @@ // Code generated by protoc-gen-go-grpc. DO NOT EDIT. // versions: -// - protoc-gen-go-grpc v1.3.0 -// - protoc v4.25.3 +// - protoc-gen-go-grpc v1.5.1 +// - protoc v5.28.1 // source: iam.proto package iam_pb @@ -12,10 +12,8 @@ import ( // This is a compile-time assertion to ensure that this generated file // is compatible with the grpc package it is being compiled against. -// Requires gRPC-Go v1.32.0 or later. -const _ = grpc.SupportPackageIsVersion7 - -const () +// Requires gRPC-Go v1.64.0 or later. +const _ = grpc.SupportPackageIsVersion9 // SeaweedIdentityAccessManagementClient is the client API for SeaweedIdentityAccessManagement service. // @@ -33,17 +31,21 @@ func NewSeaweedIdentityAccessManagementClient(cc grpc.ClientConnInterface) Seawe // SeaweedIdentityAccessManagementServer is the server API for SeaweedIdentityAccessManagement service. // All implementations must embed UnimplementedSeaweedIdentityAccessManagementServer -// for forward compatibility +// for forward compatibility. type SeaweedIdentityAccessManagementServer interface { mustEmbedUnimplementedSeaweedIdentityAccessManagementServer() } -// UnimplementedSeaweedIdentityAccessManagementServer must be embedded to have forward compatible implementations. -type UnimplementedSeaweedIdentityAccessManagementServer struct { -} +// UnimplementedSeaweedIdentityAccessManagementServer must be embedded to have +// forward compatible implementations. +// +// NOTE: this should be embedded by value instead of pointer to avoid a nil +// pointer dereference when methods are called. +type UnimplementedSeaweedIdentityAccessManagementServer struct{} func (UnimplementedSeaweedIdentityAccessManagementServer) mustEmbedUnimplementedSeaweedIdentityAccessManagementServer() { } +func (UnimplementedSeaweedIdentityAccessManagementServer) testEmbeddedByValue() {} // UnsafeSeaweedIdentityAccessManagementServer may be embedded to opt out of forward compatibility for this service. // Use of this interface is not recommended, as added methods to SeaweedIdentityAccessManagementServer will @@ -53,6 +55,13 @@ type UnsafeSeaweedIdentityAccessManagementServer interface { } func RegisterSeaweedIdentityAccessManagementServer(s grpc.ServiceRegistrar, srv SeaweedIdentityAccessManagementServer) { + // If the following call pancis, it indicates UnimplementedSeaweedIdentityAccessManagementServer was + // embedded by pointer and is nil. This will cause panics if an + // unimplemented method is ever invoked, so we test this at initialization + // time to prevent it from happening at runtime later due to I/O. + if t, ok := srv.(interface{ testEmbeddedByValue() }); ok { + t.testEmbeddedByValue() + } s.RegisterService(&SeaweedIdentityAccessManagement_ServiceDesc, srv) } diff --git a/weed/pb/master.proto b/weed/pb/master.proto index c1fa6067f..f5d03ad9d 100644 --- a/weed/pb/master.proto +++ b/weed/pb/master.proto @@ -125,7 +125,7 @@ message VolumeEcShardInformationMessage { string collection = 2; uint32 ec_index_bits = 3; string disk_type = 4; - uint64 destroy_time = 5; // used to record the destruction time of ec volume + uint64 expire_at_sec = 5; // used to record the destruction time of ec volume } message StorageBackend { diff --git a/weed/pb/master_pb/master.pb.go b/weed/pb/master_pb/master.pb.go index dc53f4709..5f87a0281 100644 --- a/weed/pb/master_pb/master.pb.go +++ b/weed/pb/master_pb/master.pb.go @@ -1,7 +1,7 @@ // Code generated by protoc-gen-go. DO NOT EDIT. // versions: -// protoc-gen-go v1.32.0 -// protoc v4.25.3 +// protoc-gen-go v1.34.2 +// protoc v5.28.1 // source: master.proto package master_pb @@ -556,7 +556,7 @@ type VolumeEcShardInformationMessage struct { Collection string `protobuf:"bytes,2,opt,name=collection,proto3" json:"collection,omitempty"` EcIndexBits uint32 `protobuf:"varint,3,opt,name=ec_index_bits,json=ecIndexBits,proto3" json:"ec_index_bits,omitempty"` DiskType string `protobuf:"bytes,4,opt,name=disk_type,json=diskType,proto3" json:"disk_type,omitempty"` - DestroyTime uint64 `protobuf:"varint,5,opt,name=destroy_time,json=destroyTime,proto3" json:"destroy_time,omitempty"` // used to record the destruction time of ec volume + ExpireAtSec uint64 `protobuf:"varint,5,opt,name=expire_at_sec,json=expireAtSec,proto3" json:"expire_at_sec,omitempty"` // used to record the destruction time of ec volume } func (x *VolumeEcShardInformationMessage) Reset() { @@ -619,9 +619,9 @@ func (x *VolumeEcShardInformationMessage) GetDiskType() string { return "" } -func (x *VolumeEcShardInformationMessage) GetDestroyTime() uint64 { +func (x *VolumeEcShardInformationMessage) GetExpireAtSec() uint64 { if x != nil { - return x.DestroyTime + return x.ExpireAtSec } return 0 } @@ -4302,7 +4302,7 @@ var file_master_proto_rawDesc = []byte{ 0x12, 0x10, 0x0a, 0x03, 0x74, 0x74, 0x6c, 0x18, 0x0a, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x03, 0x74, 0x74, 0x6c, 0x12, 0x1b, 0x0a, 0x09, 0x64, 0x69, 0x73, 0x6b, 0x5f, 0x74, 0x79, 0x70, 0x65, 0x18, 0x0f, 0x20, 0x01, 0x28, 0x09, 0x52, 0x08, 0x64, 0x69, 0x73, 0x6b, 0x54, 0x79, 0x70, 0x65, 0x22, - 0xb5, 0x01, 0x0a, 0x1f, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, 0x53, 0x68, 0x61, 0x72, + 0xb6, 0x01, 0x0a, 0x1f, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, 0x53, 0x68, 0x61, 0x72, 0x64, 0x49, 0x6e, 0x66, 0x6f, 0x72, 0x6d, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x4d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65, 0x12, 0x0e, 0x0a, 0x02, 0x69, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x02, 0x69, 0x64, 0x12, 0x1e, 0x0a, 0x0a, 0x63, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, @@ -4311,284 +4311,268 @@ var file_master_proto_rawDesc = []byte{ 0x62, 0x69, 0x74, 0x73, 0x18, 0x03, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x0b, 0x65, 0x63, 0x49, 0x6e, 0x64, 0x65, 0x78, 0x42, 0x69, 0x74, 0x73, 0x12, 0x1b, 0x0a, 0x09, 0x64, 0x69, 0x73, 0x6b, 0x5f, 0x74, 0x79, 0x70, 0x65, 0x18, 0x04, 0x20, 0x01, 0x28, 0x09, 0x52, 0x08, 0x64, 0x69, 0x73, 0x6b, - 0x54, 0x79, 0x70, 0x65, 0x12, 0x21, 0x0a, 0x0c, 0x64, 0x65, 0x73, 0x74, 0x72, 0x6f, 0x79, 0x5f, - 0x74, 0x69, 0x6d, 0x65, 0x18, 0x05, 0x20, 0x01, 0x28, 0x04, 0x52, 0x0b, 0x64, 0x65, 0x73, 0x74, - 0x72, 0x6f, 0x79, 0x54, 0x69, 0x6d, 0x65, 0x22, 0xbe, 0x01, 0x0a, 0x0e, 0x53, 0x74, 0x6f, 0x72, - 0x61, 0x67, 0x65, 0x42, 0x61, 0x63, 0x6b, 0x65, 0x6e, 0x64, 0x12, 0x12, 0x0a, 0x04, 0x74, 0x79, - 0x70, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x04, 0x74, 0x79, 0x70, 0x65, 0x12, 0x0e, - 0x0a, 0x02, 0x69, 0x64, 0x18, 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x02, 0x69, 0x64, 0x12, 0x49, - 0x0a, 0x0a, 0x70, 0x72, 0x6f, 0x70, 0x65, 0x72, 0x74, 0x69, 0x65, 0x73, 0x18, 0x03, 0x20, 0x03, - 0x28, 0x0b, 0x32, 0x29, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x53, - 0x74, 0x6f, 0x72, 0x61, 0x67, 0x65, 0x42, 0x61, 0x63, 0x6b, 0x65, 0x6e, 0x64, 0x2e, 0x50, 0x72, - 0x6f, 0x70, 0x65, 0x72, 0x74, 0x69, 0x65, 0x73, 0x45, 0x6e, 0x74, 0x72, 0x79, 0x52, 0x0a, 0x70, - 0x72, 0x6f, 0x70, 0x65, 0x72, 0x74, 0x69, 0x65, 0x73, 0x1a, 0x3d, 0x0a, 0x0f, 0x50, 0x72, 0x6f, - 0x70, 0x65, 0x72, 0x74, 0x69, 0x65, 0x73, 0x45, 0x6e, 0x74, 0x72, 0x79, 0x12, 0x10, 0x0a, 0x03, - 0x6b, 0x65, 0x79, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, 0x6b, 0x65, 0x79, 0x12, 0x14, - 0x0a, 0x05, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x05, 0x76, - 0x61, 0x6c, 0x75, 0x65, 0x3a, 0x02, 0x38, 0x01, 0x22, 0x07, 0x0a, 0x05, 0x45, 0x6d, 0x70, 0x74, - 0x79, 0x22, 0xbe, 0x01, 0x0a, 0x0f, 0x53, 0x75, 0x70, 0x65, 0x72, 0x42, 0x6c, 0x6f, 0x63, 0x6b, - 0x45, 0x78, 0x74, 0x72, 0x61, 0x12, 0x4f, 0x0a, 0x0e, 0x65, 0x72, 0x61, 0x73, 0x75, 0x72, 0x65, - 0x5f, 0x63, 0x6f, 0x64, 0x69, 0x6e, 0x67, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x28, 0x2e, - 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x53, 0x75, 0x70, 0x65, 0x72, 0x42, - 0x6c, 0x6f, 0x63, 0x6b, 0x45, 0x78, 0x74, 0x72, 0x61, 0x2e, 0x45, 0x72, 0x61, 0x73, 0x75, 0x72, - 0x65, 0x43, 0x6f, 0x64, 0x69, 0x6e, 0x67, 0x52, 0x0d, 0x65, 0x72, 0x61, 0x73, 0x75, 0x72, 0x65, - 0x43, 0x6f, 0x64, 0x69, 0x6e, 0x67, 0x1a, 0x5a, 0x0a, 0x0d, 0x45, 0x72, 0x61, 0x73, 0x75, 0x72, - 0x65, 0x43, 0x6f, 0x64, 0x69, 0x6e, 0x67, 0x12, 0x12, 0x0a, 0x04, 0x64, 0x61, 0x74, 0x61, 0x18, - 0x01, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x04, 0x64, 0x61, 0x74, 0x61, 0x12, 0x16, 0x0a, 0x06, 0x70, - 0x61, 0x72, 0x69, 0x74, 0x79, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x06, 0x70, 0x61, 0x72, - 0x69, 0x74, 0x79, 0x12, 0x1d, 0x0a, 0x0a, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x69, 0x64, - 0x73, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0d, 0x52, 0x09, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x49, - 0x64, 0x73, 0x22, 0xce, 0x01, 0x0a, 0x14, 0x4b, 0x65, 0x65, 0x70, 0x43, 0x6f, 0x6e, 0x6e, 0x65, - 0x63, 0x74, 0x65, 0x64, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x12, 0x1f, 0x0a, 0x0b, 0x63, - 0x6c, 0x69, 0x65, 0x6e, 0x74, 0x5f, 0x74, 0x79, 0x70, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, - 0x52, 0x0a, 0x63, 0x6c, 0x69, 0x65, 0x6e, 0x74, 0x54, 0x79, 0x70, 0x65, 0x12, 0x25, 0x0a, 0x0e, - 0x63, 0x6c, 0x69, 0x65, 0x6e, 0x74, 0x5f, 0x61, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x18, 0x03, - 0x20, 0x01, 0x28, 0x09, 0x52, 0x0d, 0x63, 0x6c, 0x69, 0x65, 0x6e, 0x74, 0x41, 0x64, 0x64, 0x72, - 0x65, 0x73, 0x73, 0x12, 0x18, 0x0a, 0x07, 0x76, 0x65, 0x72, 0x73, 0x69, 0x6f, 0x6e, 0x18, 0x04, - 0x20, 0x01, 0x28, 0x09, 0x52, 0x07, 0x76, 0x65, 0x72, 0x73, 0x69, 0x6f, 0x6e, 0x12, 0x1f, 0x0a, - 0x0b, 0x66, 0x69, 0x6c, 0x65, 0x72, 0x5f, 0x67, 0x72, 0x6f, 0x75, 0x70, 0x18, 0x05, 0x20, 0x01, - 0x28, 0x09, 0x52, 0x0a, 0x66, 0x69, 0x6c, 0x65, 0x72, 0x47, 0x72, 0x6f, 0x75, 0x70, 0x12, 0x1f, + 0x54, 0x79, 0x70, 0x65, 0x12, 0x22, 0x0a, 0x0d, 0x65, 0x78, 0x70, 0x69, 0x72, 0x65, 0x5f, 0x61, + 0x74, 0x5f, 0x73, 0x65, 0x63, 0x18, 0x05, 0x20, 0x01, 0x28, 0x04, 0x52, 0x0b, 0x65, 0x78, 0x70, + 0x69, 0x72, 0x65, 0x41, 0x74, 0x53, 0x65, 0x63, 0x22, 0xbe, 0x01, 0x0a, 0x0e, 0x53, 0x74, 0x6f, + 0x72, 0x61, 0x67, 0x65, 0x42, 0x61, 0x63, 0x6b, 0x65, 0x6e, 0x64, 0x12, 0x12, 0x0a, 0x04, 0x74, + 0x79, 0x70, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x04, 0x74, 0x79, 0x70, 0x65, 0x12, + 0x0e, 0x0a, 0x02, 0x69, 0x64, 0x18, 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x02, 0x69, 0x64, 0x12, + 0x49, 0x0a, 0x0a, 0x70, 0x72, 0x6f, 0x70, 0x65, 0x72, 0x74, 0x69, 0x65, 0x73, 0x18, 0x03, 0x20, + 0x03, 0x28, 0x0b, 0x32, 0x29, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, + 0x53, 0x74, 0x6f, 0x72, 0x61, 0x67, 0x65, 0x42, 0x61, 0x63, 0x6b, 0x65, 0x6e, 0x64, 0x2e, 0x50, + 0x72, 0x6f, 0x70, 0x65, 0x72, 0x74, 0x69, 0x65, 0x73, 0x45, 0x6e, 0x74, 0x72, 0x79, 0x52, 0x0a, + 0x70, 0x72, 0x6f, 0x70, 0x65, 0x72, 0x74, 0x69, 0x65, 0x73, 0x1a, 0x3d, 0x0a, 0x0f, 0x50, 0x72, + 0x6f, 0x70, 0x65, 0x72, 0x74, 0x69, 0x65, 0x73, 0x45, 0x6e, 0x74, 0x72, 0x79, 0x12, 0x10, 0x0a, + 0x03, 0x6b, 0x65, 0x79, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, 0x6b, 0x65, 0x79, 0x12, + 0x14, 0x0a, 0x05, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x05, + 0x76, 0x61, 0x6c, 0x75, 0x65, 0x3a, 0x02, 0x38, 0x01, 0x22, 0x07, 0x0a, 0x05, 0x45, 0x6d, 0x70, + 0x74, 0x79, 0x22, 0xbe, 0x01, 0x0a, 0x0f, 0x53, 0x75, 0x70, 0x65, 0x72, 0x42, 0x6c, 0x6f, 0x63, + 0x6b, 0x45, 0x78, 0x74, 0x72, 0x61, 0x12, 0x4f, 0x0a, 0x0e, 0x65, 0x72, 0x61, 0x73, 0x75, 0x72, + 0x65, 0x5f, 0x63, 0x6f, 0x64, 0x69, 0x6e, 0x67, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x28, + 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x53, 0x75, 0x70, 0x65, 0x72, + 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x45, 0x78, 0x74, 0x72, 0x61, 0x2e, 0x45, 0x72, 0x61, 0x73, 0x75, + 0x72, 0x65, 0x43, 0x6f, 0x64, 0x69, 0x6e, 0x67, 0x52, 0x0d, 0x65, 0x72, 0x61, 0x73, 0x75, 0x72, + 0x65, 0x43, 0x6f, 0x64, 0x69, 0x6e, 0x67, 0x1a, 0x5a, 0x0a, 0x0d, 0x45, 0x72, 0x61, 0x73, 0x75, + 0x72, 0x65, 0x43, 0x6f, 0x64, 0x69, 0x6e, 0x67, 0x12, 0x12, 0x0a, 0x04, 0x64, 0x61, 0x74, 0x61, + 0x18, 0x01, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x04, 0x64, 0x61, 0x74, 0x61, 0x12, 0x16, 0x0a, 0x06, + 0x70, 0x61, 0x72, 0x69, 0x74, 0x79, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x06, 0x70, 0x61, + 0x72, 0x69, 0x74, 0x79, 0x12, 0x1d, 0x0a, 0x0a, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x69, + 0x64, 0x73, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0d, 0x52, 0x09, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, + 0x49, 0x64, 0x73, 0x22, 0xce, 0x01, 0x0a, 0x14, 0x4b, 0x65, 0x65, 0x70, 0x43, 0x6f, 0x6e, 0x6e, + 0x65, 0x63, 0x74, 0x65, 0x64, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x12, 0x1f, 0x0a, 0x0b, + 0x63, 0x6c, 0x69, 0x65, 0x6e, 0x74, 0x5f, 0x74, 0x79, 0x70, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, + 0x09, 0x52, 0x0a, 0x63, 0x6c, 0x69, 0x65, 0x6e, 0x74, 0x54, 0x79, 0x70, 0x65, 0x12, 0x25, 0x0a, + 0x0e, 0x63, 0x6c, 0x69, 0x65, 0x6e, 0x74, 0x5f, 0x61, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x18, + 0x03, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0d, 0x63, 0x6c, 0x69, 0x65, 0x6e, 0x74, 0x41, 0x64, 0x64, + 0x72, 0x65, 0x73, 0x73, 0x12, 0x18, 0x0a, 0x07, 0x76, 0x65, 0x72, 0x73, 0x69, 0x6f, 0x6e, 0x18, + 0x04, 0x20, 0x01, 0x28, 0x09, 0x52, 0x07, 0x76, 0x65, 0x72, 0x73, 0x69, 0x6f, 0x6e, 0x12, 0x1f, + 0x0a, 0x0b, 0x66, 0x69, 0x6c, 0x65, 0x72, 0x5f, 0x67, 0x72, 0x6f, 0x75, 0x70, 0x18, 0x05, 0x20, + 0x01, 0x28, 0x09, 0x52, 0x0a, 0x66, 0x69, 0x6c, 0x65, 0x72, 0x47, 0x72, 0x6f, 0x75, 0x70, 0x12, + 0x1f, 0x0a, 0x0b, 0x64, 0x61, 0x74, 0x61, 0x5f, 0x63, 0x65, 0x6e, 0x74, 0x65, 0x72, 0x18, 0x06, + 0x20, 0x01, 0x28, 0x09, 0x52, 0x0a, 0x64, 0x61, 0x74, 0x61, 0x43, 0x65, 0x6e, 0x74, 0x65, 0x72, + 0x12, 0x12, 0x0a, 0x04, 0x72, 0x61, 0x63, 0x6b, 0x18, 0x07, 0x20, 0x01, 0x28, 0x09, 0x52, 0x04, + 0x72, 0x61, 0x63, 0x6b, 0x22, 0x9d, 0x02, 0x0a, 0x0e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x4c, + 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x12, 0x10, 0x0a, 0x03, 0x75, 0x72, 0x6c, 0x18, 0x01, + 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, 0x75, 0x72, 0x6c, 0x12, 0x1d, 0x0a, 0x0a, 0x70, 0x75, 0x62, + 0x6c, 0x69, 0x63, 0x5f, 0x75, 0x72, 0x6c, 0x18, 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x09, 0x70, + 0x75, 0x62, 0x6c, 0x69, 0x63, 0x55, 0x72, 0x6c, 0x12, 0x19, 0x0a, 0x08, 0x6e, 0x65, 0x77, 0x5f, + 0x76, 0x69, 0x64, 0x73, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0d, 0x52, 0x07, 0x6e, 0x65, 0x77, 0x56, + 0x69, 0x64, 0x73, 0x12, 0x21, 0x0a, 0x0c, 0x64, 0x65, 0x6c, 0x65, 0x74, 0x65, 0x64, 0x5f, 0x76, + 0x69, 0x64, 0x73, 0x18, 0x04, 0x20, 0x03, 0x28, 0x0d, 0x52, 0x0b, 0x64, 0x65, 0x6c, 0x65, 0x74, + 0x65, 0x64, 0x56, 0x69, 0x64, 0x73, 0x12, 0x16, 0x0a, 0x06, 0x6c, 0x65, 0x61, 0x64, 0x65, 0x72, + 0x18, 0x05, 0x20, 0x01, 0x28, 0x09, 0x52, 0x06, 0x6c, 0x65, 0x61, 0x64, 0x65, 0x72, 0x12, 0x1f, 0x0a, 0x0b, 0x64, 0x61, 0x74, 0x61, 0x5f, 0x63, 0x65, 0x6e, 0x74, 0x65, 0x72, 0x18, 0x06, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0a, 0x64, 0x61, 0x74, 0x61, 0x43, 0x65, 0x6e, 0x74, 0x65, 0x72, 0x12, - 0x12, 0x0a, 0x04, 0x72, 0x61, 0x63, 0x6b, 0x18, 0x07, 0x20, 0x01, 0x28, 0x09, 0x52, 0x04, 0x72, - 0x61, 0x63, 0x6b, 0x22, 0x9d, 0x02, 0x0a, 0x0e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x4c, 0x6f, - 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x12, 0x10, 0x0a, 0x03, 0x75, 0x72, 0x6c, 0x18, 0x01, 0x20, - 0x01, 0x28, 0x09, 0x52, 0x03, 0x75, 0x72, 0x6c, 0x12, 0x1d, 0x0a, 0x0a, 0x70, 0x75, 0x62, 0x6c, - 0x69, 0x63, 0x5f, 0x75, 0x72, 0x6c, 0x18, 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x09, 0x70, 0x75, - 0x62, 0x6c, 0x69, 0x63, 0x55, 0x72, 0x6c, 0x12, 0x19, 0x0a, 0x08, 0x6e, 0x65, 0x77, 0x5f, 0x76, - 0x69, 0x64, 0x73, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0d, 0x52, 0x07, 0x6e, 0x65, 0x77, 0x56, 0x69, - 0x64, 0x73, 0x12, 0x21, 0x0a, 0x0c, 0x64, 0x65, 0x6c, 0x65, 0x74, 0x65, 0x64, 0x5f, 0x76, 0x69, - 0x64, 0x73, 0x18, 0x04, 0x20, 0x03, 0x28, 0x0d, 0x52, 0x0b, 0x64, 0x65, 0x6c, 0x65, 0x74, 0x65, - 0x64, 0x56, 0x69, 0x64, 0x73, 0x12, 0x16, 0x0a, 0x06, 0x6c, 0x65, 0x61, 0x64, 0x65, 0x72, 0x18, - 0x05, 0x20, 0x01, 0x28, 0x09, 0x52, 0x06, 0x6c, 0x65, 0x61, 0x64, 0x65, 0x72, 0x12, 0x1f, 0x0a, - 0x0b, 0x64, 0x61, 0x74, 0x61, 0x5f, 0x63, 0x65, 0x6e, 0x74, 0x65, 0x72, 0x18, 0x06, 0x20, 0x01, - 0x28, 0x09, 0x52, 0x0a, 0x64, 0x61, 0x74, 0x61, 0x43, 0x65, 0x6e, 0x74, 0x65, 0x72, 0x12, 0x1b, - 0x0a, 0x09, 0x67, 0x72, 0x70, 0x63, 0x5f, 0x70, 0x6f, 0x72, 0x74, 0x18, 0x07, 0x20, 0x01, 0x28, - 0x0d, 0x52, 0x08, 0x67, 0x72, 0x70, 0x63, 0x50, 0x6f, 0x72, 0x74, 0x12, 0x1e, 0x0a, 0x0b, 0x6e, - 0x65, 0x77, 0x5f, 0x65, 0x63, 0x5f, 0x76, 0x69, 0x64, 0x73, 0x18, 0x08, 0x20, 0x03, 0x28, 0x0d, - 0x52, 0x09, 0x6e, 0x65, 0x77, 0x45, 0x63, 0x56, 0x69, 0x64, 0x73, 0x12, 0x26, 0x0a, 0x0f, 0x64, - 0x65, 0x6c, 0x65, 0x74, 0x65, 0x64, 0x5f, 0x65, 0x63, 0x5f, 0x76, 0x69, 0x64, 0x73, 0x18, 0x09, - 0x20, 0x03, 0x28, 0x0d, 0x52, 0x0d, 0x64, 0x65, 0x6c, 0x65, 0x74, 0x65, 0x64, 0x45, 0x63, 0x56, - 0x69, 0x64, 0x73, 0x22, 0xa6, 0x01, 0x0a, 0x11, 0x43, 0x6c, 0x75, 0x73, 0x74, 0x65, 0x72, 0x4e, - 0x6f, 0x64, 0x65, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x12, 0x1b, 0x0a, 0x09, 0x6e, 0x6f, 0x64, - 0x65, 0x5f, 0x74, 0x79, 0x70, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x08, 0x6e, 0x6f, - 0x64, 0x65, 0x54, 0x79, 0x70, 0x65, 0x12, 0x18, 0x0a, 0x07, 0x61, 0x64, 0x64, 0x72, 0x65, 0x73, - 0x73, 0x18, 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x07, 0x61, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, - 0x12, 0x15, 0x0a, 0x06, 0x69, 0x73, 0x5f, 0x61, 0x64, 0x64, 0x18, 0x04, 0x20, 0x01, 0x28, 0x08, - 0x52, 0x05, 0x69, 0x73, 0x41, 0x64, 0x64, 0x12, 0x1f, 0x0a, 0x0b, 0x66, 0x69, 0x6c, 0x65, 0x72, - 0x5f, 0x67, 0x72, 0x6f, 0x75, 0x70, 0x18, 0x05, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0a, 0x66, 0x69, - 0x6c, 0x65, 0x72, 0x47, 0x72, 0x6f, 0x75, 0x70, 0x12, 0x22, 0x0a, 0x0d, 0x63, 0x72, 0x65, 0x61, - 0x74, 0x65, 0x64, 0x5f, 0x61, 0x74, 0x5f, 0x6e, 0x73, 0x18, 0x06, 0x20, 0x01, 0x28, 0x03, 0x52, - 0x0b, 0x63, 0x72, 0x65, 0x61, 0x74, 0x65, 0x64, 0x41, 0x74, 0x4e, 0x73, 0x22, 0xa9, 0x01, 0x0a, - 0x15, 0x4b, 0x65, 0x65, 0x70, 0x43, 0x6f, 0x6e, 0x6e, 0x65, 0x63, 0x74, 0x65, 0x64, 0x52, 0x65, - 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x12, 0x42, 0x0a, 0x0f, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, - 0x5f, 0x6c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, - 0x19, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, - 0x6d, 0x65, 0x4c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x52, 0x0e, 0x76, 0x6f, 0x6c, 0x75, - 0x6d, 0x65, 0x4c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x12, 0x4c, 0x0a, 0x13, 0x63, 0x6c, - 0x75, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x6e, 0x6f, 0x64, 0x65, 0x5f, 0x75, 0x70, 0x64, 0x61, 0x74, - 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1c, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, - 0x5f, 0x70, 0x62, 0x2e, 0x43, 0x6c, 0x75, 0x73, 0x74, 0x65, 0x72, 0x4e, 0x6f, 0x64, 0x65, 0x55, - 0x70, 0x64, 0x61, 0x74, 0x65, 0x52, 0x11, 0x63, 0x6c, 0x75, 0x73, 0x74, 0x65, 0x72, 0x4e, 0x6f, - 0x64, 0x65, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x22, 0x62, 0x0a, 0x13, 0x4c, 0x6f, 0x6f, 0x6b, - 0x75, 0x70, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x12, - 0x2b, 0x0a, 0x12, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x6f, 0x72, 0x5f, 0x66, 0x69, 0x6c, - 0x65, 0x5f, 0x69, 0x64, 0x73, 0x18, 0x01, 0x20, 0x03, 0x28, 0x09, 0x52, 0x0f, 0x76, 0x6f, 0x6c, - 0x75, 0x6d, 0x65, 0x4f, 0x72, 0x46, 0x69, 0x6c, 0x65, 0x49, 0x64, 0x73, 0x12, 0x1e, 0x0a, 0x0a, - 0x63, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x18, 0x02, 0x20, 0x01, 0x28, 0x09, - 0x52, 0x0a, 0x63, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x22, 0x95, 0x02, 0x0a, - 0x14, 0x4c, 0x6f, 0x6f, 0x6b, 0x75, 0x70, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x52, 0x65, 0x73, - 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x12, 0x60, 0x0a, 0x13, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, - 0x69, 0x64, 0x5f, 0x6c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x18, 0x01, 0x20, 0x03, - 0x28, 0x0b, 0x32, 0x30, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x4c, - 0x6f, 0x6f, 0x6b, 0x75, 0x70, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x52, 0x65, 0x73, 0x70, 0x6f, - 0x6e, 0x73, 0x65, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x49, 0x64, 0x4c, 0x6f, 0x63, 0x61, - 0x74, 0x69, 0x6f, 0x6e, 0x52, 0x11, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x49, 0x64, 0x4c, 0x6f, - 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x1a, 0x9a, 0x01, 0x0a, 0x10, 0x56, 0x6f, 0x6c, 0x75, - 0x6d, 0x65, 0x49, 0x64, 0x4c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x12, 0x29, 0x0a, 0x11, - 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x6f, 0x72, 0x5f, 0x66, 0x69, 0x6c, 0x65, 0x5f, 0x69, - 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x4f, - 0x72, 0x46, 0x69, 0x6c, 0x65, 0x49, 0x64, 0x12, 0x31, 0x0a, 0x09, 0x6c, 0x6f, 0x63, 0x61, 0x74, - 0x69, 0x6f, 0x6e, 0x73, 0x18, 0x02, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x13, 0x2e, 0x6d, 0x61, 0x73, - 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x4c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x52, - 0x09, 0x6c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x12, 0x14, 0x0a, 0x05, 0x65, 0x72, - 0x72, 0x6f, 0x72, 0x18, 0x03, 0x20, 0x01, 0x28, 0x09, 0x52, 0x05, 0x65, 0x72, 0x72, 0x6f, 0x72, - 0x12, 0x12, 0x0a, 0x04, 0x61, 0x75, 0x74, 0x68, 0x18, 0x04, 0x20, 0x01, 0x28, 0x09, 0x52, 0x04, - 0x61, 0x75, 0x74, 0x68, 0x22, 0x79, 0x0a, 0x08, 0x4c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, - 0x12, 0x10, 0x0a, 0x03, 0x75, 0x72, 0x6c, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, 0x75, - 0x72, 0x6c, 0x12, 0x1d, 0x0a, 0x0a, 0x70, 0x75, 0x62, 0x6c, 0x69, 0x63, 0x5f, 0x75, 0x72, 0x6c, - 0x18, 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x09, 0x70, 0x75, 0x62, 0x6c, 0x69, 0x63, 0x55, 0x72, - 0x6c, 0x12, 0x1b, 0x0a, 0x09, 0x67, 0x72, 0x70, 0x63, 0x5f, 0x70, 0x6f, 0x72, 0x74, 0x18, 0x03, - 0x20, 0x01, 0x28, 0x0d, 0x52, 0x08, 0x67, 0x72, 0x70, 0x63, 0x50, 0x6f, 0x72, 0x74, 0x12, 0x1f, - 0x0a, 0x0b, 0x64, 0x61, 0x74, 0x61, 0x5f, 0x63, 0x65, 0x6e, 0x74, 0x65, 0x72, 0x18, 0x04, 0x20, - 0x01, 0x28, 0x09, 0x52, 0x0a, 0x64, 0x61, 0x74, 0x61, 0x43, 0x65, 0x6e, 0x74, 0x65, 0x72, 0x22, - 0xd0, 0x02, 0x0a, 0x0d, 0x41, 0x73, 0x73, 0x69, 0x67, 0x6e, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, - 0x74, 0x12, 0x14, 0x0a, 0x05, 0x63, 0x6f, 0x75, 0x6e, 0x74, 0x18, 0x01, 0x20, 0x01, 0x28, 0x04, - 0x52, 0x05, 0x63, 0x6f, 0x75, 0x6e, 0x74, 0x12, 0x20, 0x0a, 0x0b, 0x72, 0x65, 0x70, 0x6c, 0x69, - 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x18, 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0b, 0x72, 0x65, - 0x70, 0x6c, 0x69, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x12, 0x1e, 0x0a, 0x0a, 0x63, 0x6f, 0x6c, - 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x18, 0x03, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0a, 0x63, - 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x12, 0x10, 0x0a, 0x03, 0x74, 0x74, 0x6c, - 0x18, 0x04, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, 0x74, 0x74, 0x6c, 0x12, 0x1f, 0x0a, 0x0b, 0x64, - 0x61, 0x74, 0x61, 0x5f, 0x63, 0x65, 0x6e, 0x74, 0x65, 0x72, 0x18, 0x05, 0x20, 0x01, 0x28, 0x09, - 0x52, 0x0a, 0x64, 0x61, 0x74, 0x61, 0x43, 0x65, 0x6e, 0x74, 0x65, 0x72, 0x12, 0x12, 0x0a, 0x04, - 0x72, 0x61, 0x63, 0x6b, 0x18, 0x06, 0x20, 0x01, 0x28, 0x09, 0x52, 0x04, 0x72, 0x61, 0x63, 0x6b, - 0x12, 0x1b, 0x0a, 0x09, 0x64, 0x61, 0x74, 0x61, 0x5f, 0x6e, 0x6f, 0x64, 0x65, 0x18, 0x07, 0x20, - 0x01, 0x28, 0x09, 0x52, 0x08, 0x64, 0x61, 0x74, 0x61, 0x4e, 0x6f, 0x64, 0x65, 0x12, 0x32, 0x0a, - 0x16, 0x6d, 0x65, 0x6d, 0x6f, 0x72, 0x79, 0x5f, 0x6d, 0x61, 0x70, 0x5f, 0x6d, 0x61, 0x78, 0x5f, - 0x73, 0x69, 0x7a, 0x65, 0x5f, 0x6d, 0x62, 0x18, 0x08, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x12, 0x6d, - 0x65, 0x6d, 0x6f, 0x72, 0x79, 0x4d, 0x61, 0x70, 0x4d, 0x61, 0x78, 0x53, 0x69, 0x7a, 0x65, 0x4d, - 0x62, 0x12, 0x32, 0x0a, 0x15, 0x77, 0x72, 0x69, 0x74, 0x61, 0x62, 0x6c, 0x65, 0x5f, 0x76, 0x6f, - 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x63, 0x6f, 0x75, 0x6e, 0x74, 0x18, 0x09, 0x20, 0x01, 0x28, 0x0d, - 0x52, 0x13, 0x77, 0x72, 0x69, 0x74, 0x61, 0x62, 0x6c, 0x65, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, - 0x43, 0x6f, 0x75, 0x6e, 0x74, 0x12, 0x1b, 0x0a, 0x09, 0x64, 0x69, 0x73, 0x6b, 0x5f, 0x74, 0x79, - 0x70, 0x65, 0x18, 0x0a, 0x20, 0x01, 0x28, 0x09, 0x52, 0x08, 0x64, 0x69, 0x73, 0x6b, 0x54, 0x79, - 0x70, 0x65, 0x22, 0xbe, 0x02, 0x0a, 0x11, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x47, 0x72, 0x6f, - 0x77, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x12, 0x32, 0x0a, 0x15, 0x77, 0x72, 0x69, 0x74, - 0x61, 0x62, 0x6c, 0x65, 0x5f, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x63, 0x6f, 0x75, 0x6e, - 0x74, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x13, 0x77, 0x72, 0x69, 0x74, 0x61, 0x62, 0x6c, - 0x65, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x43, 0x6f, 0x75, 0x6e, 0x74, 0x12, 0x20, 0x0a, 0x0b, - 0x72, 0x65, 0x70, 0x6c, 0x69, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x18, 0x02, 0x20, 0x01, 0x28, - 0x09, 0x52, 0x0b, 0x72, 0x65, 0x70, 0x6c, 0x69, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x12, 0x1e, - 0x0a, 0x0a, 0x63, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x18, 0x03, 0x20, 0x01, - 0x28, 0x09, 0x52, 0x0a, 0x63, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x12, 0x10, - 0x0a, 0x03, 0x74, 0x74, 0x6c, 0x18, 0x04, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, 0x74, 0x74, 0x6c, - 0x12, 0x1f, 0x0a, 0x0b, 0x64, 0x61, 0x74, 0x61, 0x5f, 0x63, 0x65, 0x6e, 0x74, 0x65, 0x72, 0x18, - 0x05, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0a, 0x64, 0x61, 0x74, 0x61, 0x43, 0x65, 0x6e, 0x74, 0x65, - 0x72, 0x12, 0x12, 0x0a, 0x04, 0x72, 0x61, 0x63, 0x6b, 0x18, 0x06, 0x20, 0x01, 0x28, 0x09, 0x52, - 0x04, 0x72, 0x61, 0x63, 0x6b, 0x12, 0x1b, 0x0a, 0x09, 0x64, 0x61, 0x74, 0x61, 0x5f, 0x6e, 0x6f, - 0x64, 0x65, 0x18, 0x07, 0x20, 0x01, 0x28, 0x09, 0x52, 0x08, 0x64, 0x61, 0x74, 0x61, 0x4e, 0x6f, - 0x64, 0x65, 0x12, 0x32, 0x0a, 0x16, 0x6d, 0x65, 0x6d, 0x6f, 0x72, 0x79, 0x5f, 0x6d, 0x61, 0x70, - 0x5f, 0x6d, 0x61, 0x78, 0x5f, 0x73, 0x69, 0x7a, 0x65, 0x5f, 0x6d, 0x62, 0x18, 0x08, 0x20, 0x01, - 0x28, 0x0d, 0x52, 0x12, 0x6d, 0x65, 0x6d, 0x6f, 0x72, 0x79, 0x4d, 0x61, 0x70, 0x4d, 0x61, 0x78, - 0x53, 0x69, 0x7a, 0x65, 0x4d, 0x62, 0x12, 0x1b, 0x0a, 0x09, 0x64, 0x69, 0x73, 0x6b, 0x5f, 0x74, - 0x79, 0x70, 0x65, 0x18, 0x09, 0x20, 0x01, 0x28, 0x09, 0x52, 0x08, 0x64, 0x69, 0x73, 0x6b, 0x54, - 0x79, 0x70, 0x65, 0x22, 0xc4, 0x01, 0x0a, 0x0e, 0x41, 0x73, 0x73, 0x69, 0x67, 0x6e, 0x52, 0x65, - 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x12, 0x10, 0x0a, 0x03, 0x66, 0x69, 0x64, 0x18, 0x01, 0x20, - 0x01, 0x28, 0x09, 0x52, 0x03, 0x66, 0x69, 0x64, 0x12, 0x14, 0x0a, 0x05, 0x63, 0x6f, 0x75, 0x6e, - 0x74, 0x18, 0x04, 0x20, 0x01, 0x28, 0x04, 0x52, 0x05, 0x63, 0x6f, 0x75, 0x6e, 0x74, 0x12, 0x14, - 0x0a, 0x05, 0x65, 0x72, 0x72, 0x6f, 0x72, 0x18, 0x05, 0x20, 0x01, 0x28, 0x09, 0x52, 0x05, 0x65, - 0x72, 0x72, 0x6f, 0x72, 0x12, 0x12, 0x0a, 0x04, 0x61, 0x75, 0x74, 0x68, 0x18, 0x06, 0x20, 0x01, - 0x28, 0x09, 0x52, 0x04, 0x61, 0x75, 0x74, 0x68, 0x12, 0x2f, 0x0a, 0x08, 0x72, 0x65, 0x70, 0x6c, - 0x69, 0x63, 0x61, 0x73, 0x18, 0x07, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x13, 0x2e, 0x6d, 0x61, 0x73, - 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x4c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x52, - 0x08, 0x72, 0x65, 0x70, 0x6c, 0x69, 0x63, 0x61, 0x73, 0x12, 0x2f, 0x0a, 0x08, 0x6c, 0x6f, 0x63, - 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x18, 0x08, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x13, 0x2e, 0x6d, 0x61, + 0x1b, 0x0a, 0x09, 0x67, 0x72, 0x70, 0x63, 0x5f, 0x70, 0x6f, 0x72, 0x74, 0x18, 0x07, 0x20, 0x01, + 0x28, 0x0d, 0x52, 0x08, 0x67, 0x72, 0x70, 0x63, 0x50, 0x6f, 0x72, 0x74, 0x12, 0x1e, 0x0a, 0x0b, + 0x6e, 0x65, 0x77, 0x5f, 0x65, 0x63, 0x5f, 0x76, 0x69, 0x64, 0x73, 0x18, 0x08, 0x20, 0x03, 0x28, + 0x0d, 0x52, 0x09, 0x6e, 0x65, 0x77, 0x45, 0x63, 0x56, 0x69, 0x64, 0x73, 0x12, 0x26, 0x0a, 0x0f, + 0x64, 0x65, 0x6c, 0x65, 0x74, 0x65, 0x64, 0x5f, 0x65, 0x63, 0x5f, 0x76, 0x69, 0x64, 0x73, 0x18, + 0x09, 0x20, 0x03, 0x28, 0x0d, 0x52, 0x0d, 0x64, 0x65, 0x6c, 0x65, 0x74, 0x65, 0x64, 0x45, 0x63, + 0x56, 0x69, 0x64, 0x73, 0x22, 0xa6, 0x01, 0x0a, 0x11, 0x43, 0x6c, 0x75, 0x73, 0x74, 0x65, 0x72, + 0x4e, 0x6f, 0x64, 0x65, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x12, 0x1b, 0x0a, 0x09, 0x6e, 0x6f, + 0x64, 0x65, 0x5f, 0x74, 0x79, 0x70, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x08, 0x6e, + 0x6f, 0x64, 0x65, 0x54, 0x79, 0x70, 0x65, 0x12, 0x18, 0x0a, 0x07, 0x61, 0x64, 0x64, 0x72, 0x65, + 0x73, 0x73, 0x18, 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x07, 0x61, 0x64, 0x64, 0x72, 0x65, 0x73, + 0x73, 0x12, 0x15, 0x0a, 0x06, 0x69, 0x73, 0x5f, 0x61, 0x64, 0x64, 0x18, 0x04, 0x20, 0x01, 0x28, + 0x08, 0x52, 0x05, 0x69, 0x73, 0x41, 0x64, 0x64, 0x12, 0x1f, 0x0a, 0x0b, 0x66, 0x69, 0x6c, 0x65, + 0x72, 0x5f, 0x67, 0x72, 0x6f, 0x75, 0x70, 0x18, 0x05, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0a, 0x66, + 0x69, 0x6c, 0x65, 0x72, 0x47, 0x72, 0x6f, 0x75, 0x70, 0x12, 0x22, 0x0a, 0x0d, 0x63, 0x72, 0x65, + 0x61, 0x74, 0x65, 0x64, 0x5f, 0x61, 0x74, 0x5f, 0x6e, 0x73, 0x18, 0x06, 0x20, 0x01, 0x28, 0x03, + 0x52, 0x0b, 0x63, 0x72, 0x65, 0x61, 0x74, 0x65, 0x64, 0x41, 0x74, 0x4e, 0x73, 0x22, 0xa9, 0x01, + 0x0a, 0x15, 0x4b, 0x65, 0x65, 0x70, 0x43, 0x6f, 0x6e, 0x6e, 0x65, 0x63, 0x74, 0x65, 0x64, 0x52, + 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x12, 0x42, 0x0a, 0x0f, 0x76, 0x6f, 0x6c, 0x75, 0x6d, + 0x65, 0x5f, 0x6c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, + 0x32, 0x19, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, + 0x75, 0x6d, 0x65, 0x4c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x52, 0x0e, 0x76, 0x6f, 0x6c, + 0x75, 0x6d, 0x65, 0x4c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x12, 0x4c, 0x0a, 0x13, 0x63, + 0x6c, 0x75, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x6e, 0x6f, 0x64, 0x65, 0x5f, 0x75, 0x70, 0x64, 0x61, + 0x74, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1c, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, + 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x43, 0x6c, 0x75, 0x73, 0x74, 0x65, 0x72, 0x4e, 0x6f, 0x64, 0x65, + 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x52, 0x11, 0x63, 0x6c, 0x75, 0x73, 0x74, 0x65, 0x72, 0x4e, + 0x6f, 0x64, 0x65, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x22, 0x62, 0x0a, 0x13, 0x4c, 0x6f, 0x6f, + 0x6b, 0x75, 0x70, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, + 0x12, 0x2b, 0x0a, 0x12, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x6f, 0x72, 0x5f, 0x66, 0x69, + 0x6c, 0x65, 0x5f, 0x69, 0x64, 0x73, 0x18, 0x01, 0x20, 0x03, 0x28, 0x09, 0x52, 0x0f, 0x76, 0x6f, + 0x6c, 0x75, 0x6d, 0x65, 0x4f, 0x72, 0x46, 0x69, 0x6c, 0x65, 0x49, 0x64, 0x73, 0x12, 0x1e, 0x0a, + 0x0a, 0x63, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x18, 0x02, 0x20, 0x01, 0x28, + 0x09, 0x52, 0x0a, 0x63, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x22, 0x95, 0x02, + 0x0a, 0x14, 0x4c, 0x6f, 0x6f, 0x6b, 0x75, 0x70, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x52, 0x65, + 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x12, 0x60, 0x0a, 0x13, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, + 0x5f, 0x69, 0x64, 0x5f, 0x6c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x18, 0x01, 0x20, + 0x03, 0x28, 0x0b, 0x32, 0x30, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, + 0x4c, 0x6f, 0x6f, 0x6b, 0x75, 0x70, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x52, 0x65, 0x73, 0x70, + 0x6f, 0x6e, 0x73, 0x65, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x49, 0x64, 0x4c, 0x6f, 0x63, + 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x52, 0x11, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x49, 0x64, 0x4c, + 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x1a, 0x9a, 0x01, 0x0a, 0x10, 0x56, 0x6f, 0x6c, + 0x75, 0x6d, 0x65, 0x49, 0x64, 0x4c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x12, 0x29, 0x0a, + 0x11, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x6f, 0x72, 0x5f, 0x66, 0x69, 0x6c, 0x65, 0x5f, + 0x69, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, + 0x4f, 0x72, 0x46, 0x69, 0x6c, 0x65, 0x49, 0x64, 0x12, 0x31, 0x0a, 0x09, 0x6c, 0x6f, 0x63, 0x61, + 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x18, 0x02, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x13, 0x2e, 0x6d, 0x61, + 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x4c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, + 0x52, 0x09, 0x6c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x12, 0x14, 0x0a, 0x05, 0x65, + 0x72, 0x72, 0x6f, 0x72, 0x18, 0x03, 0x20, 0x01, 0x28, 0x09, 0x52, 0x05, 0x65, 0x72, 0x72, 0x6f, + 0x72, 0x12, 0x12, 0x0a, 0x04, 0x61, 0x75, 0x74, 0x68, 0x18, 0x04, 0x20, 0x01, 0x28, 0x09, 0x52, + 0x04, 0x61, 0x75, 0x74, 0x68, 0x22, 0x79, 0x0a, 0x08, 0x4c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, + 0x6e, 0x12, 0x10, 0x0a, 0x03, 0x75, 0x72, 0x6c, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, + 0x75, 0x72, 0x6c, 0x12, 0x1d, 0x0a, 0x0a, 0x70, 0x75, 0x62, 0x6c, 0x69, 0x63, 0x5f, 0x75, 0x72, + 0x6c, 0x18, 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x09, 0x70, 0x75, 0x62, 0x6c, 0x69, 0x63, 0x55, + 0x72, 0x6c, 0x12, 0x1b, 0x0a, 0x09, 0x67, 0x72, 0x70, 0x63, 0x5f, 0x70, 0x6f, 0x72, 0x74, 0x18, + 0x03, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x08, 0x67, 0x72, 0x70, 0x63, 0x50, 0x6f, 0x72, 0x74, 0x12, + 0x1f, 0x0a, 0x0b, 0x64, 0x61, 0x74, 0x61, 0x5f, 0x63, 0x65, 0x6e, 0x74, 0x65, 0x72, 0x18, 0x04, + 0x20, 0x01, 0x28, 0x09, 0x52, 0x0a, 0x64, 0x61, 0x74, 0x61, 0x43, 0x65, 0x6e, 0x74, 0x65, 0x72, + 0x22, 0xd0, 0x02, 0x0a, 0x0d, 0x41, 0x73, 0x73, 0x69, 0x67, 0x6e, 0x52, 0x65, 0x71, 0x75, 0x65, + 0x73, 0x74, 0x12, 0x14, 0x0a, 0x05, 0x63, 0x6f, 0x75, 0x6e, 0x74, 0x18, 0x01, 0x20, 0x01, 0x28, + 0x04, 0x52, 0x05, 0x63, 0x6f, 0x75, 0x6e, 0x74, 0x12, 0x20, 0x0a, 0x0b, 0x72, 0x65, 0x70, 0x6c, + 0x69, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x18, 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0b, 0x72, + 0x65, 0x70, 0x6c, 0x69, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x12, 0x1e, 0x0a, 0x0a, 0x63, 0x6f, + 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x18, 0x03, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0a, + 0x63, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x12, 0x10, 0x0a, 0x03, 0x74, 0x74, + 0x6c, 0x18, 0x04, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, 0x74, 0x74, 0x6c, 0x12, 0x1f, 0x0a, 0x0b, + 0x64, 0x61, 0x74, 0x61, 0x5f, 0x63, 0x65, 0x6e, 0x74, 0x65, 0x72, 0x18, 0x05, 0x20, 0x01, 0x28, + 0x09, 0x52, 0x0a, 0x64, 0x61, 0x74, 0x61, 0x43, 0x65, 0x6e, 0x74, 0x65, 0x72, 0x12, 0x12, 0x0a, + 0x04, 0x72, 0x61, 0x63, 0x6b, 0x18, 0x06, 0x20, 0x01, 0x28, 0x09, 0x52, 0x04, 0x72, 0x61, 0x63, + 0x6b, 0x12, 0x1b, 0x0a, 0x09, 0x64, 0x61, 0x74, 0x61, 0x5f, 0x6e, 0x6f, 0x64, 0x65, 0x18, 0x07, + 0x20, 0x01, 0x28, 0x09, 0x52, 0x08, 0x64, 0x61, 0x74, 0x61, 0x4e, 0x6f, 0x64, 0x65, 0x12, 0x32, + 0x0a, 0x16, 0x6d, 0x65, 0x6d, 0x6f, 0x72, 0x79, 0x5f, 0x6d, 0x61, 0x70, 0x5f, 0x6d, 0x61, 0x78, + 0x5f, 0x73, 0x69, 0x7a, 0x65, 0x5f, 0x6d, 0x62, 0x18, 0x08, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x12, + 0x6d, 0x65, 0x6d, 0x6f, 0x72, 0x79, 0x4d, 0x61, 0x70, 0x4d, 0x61, 0x78, 0x53, 0x69, 0x7a, 0x65, + 0x4d, 0x62, 0x12, 0x32, 0x0a, 0x15, 0x77, 0x72, 0x69, 0x74, 0x61, 0x62, 0x6c, 0x65, 0x5f, 0x76, + 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x63, 0x6f, 0x75, 0x6e, 0x74, 0x18, 0x09, 0x20, 0x01, 0x28, + 0x0d, 0x52, 0x13, 0x77, 0x72, 0x69, 0x74, 0x61, 0x62, 0x6c, 0x65, 0x56, 0x6f, 0x6c, 0x75, 0x6d, + 0x65, 0x43, 0x6f, 0x75, 0x6e, 0x74, 0x12, 0x1b, 0x0a, 0x09, 0x64, 0x69, 0x73, 0x6b, 0x5f, 0x74, + 0x79, 0x70, 0x65, 0x18, 0x0a, 0x20, 0x01, 0x28, 0x09, 0x52, 0x08, 0x64, 0x69, 0x73, 0x6b, 0x54, + 0x79, 0x70, 0x65, 0x22, 0xbe, 0x02, 0x0a, 0x11, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x47, 0x72, + 0x6f, 0x77, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x12, 0x32, 0x0a, 0x15, 0x77, 0x72, 0x69, + 0x74, 0x61, 0x62, 0x6c, 0x65, 0x5f, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x63, 0x6f, 0x75, + 0x6e, 0x74, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x13, 0x77, 0x72, 0x69, 0x74, 0x61, 0x62, + 0x6c, 0x65, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x43, 0x6f, 0x75, 0x6e, 0x74, 0x12, 0x20, 0x0a, + 0x0b, 0x72, 0x65, 0x70, 0x6c, 0x69, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x18, 0x02, 0x20, 0x01, + 0x28, 0x09, 0x52, 0x0b, 0x72, 0x65, 0x70, 0x6c, 0x69, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x12, + 0x1e, 0x0a, 0x0a, 0x63, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x18, 0x03, 0x20, + 0x01, 0x28, 0x09, 0x52, 0x0a, 0x63, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x12, + 0x10, 0x0a, 0x03, 0x74, 0x74, 0x6c, 0x18, 0x04, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, 0x74, 0x74, + 0x6c, 0x12, 0x1f, 0x0a, 0x0b, 0x64, 0x61, 0x74, 0x61, 0x5f, 0x63, 0x65, 0x6e, 0x74, 0x65, 0x72, + 0x18, 0x05, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0a, 0x64, 0x61, 0x74, 0x61, 0x43, 0x65, 0x6e, 0x74, + 0x65, 0x72, 0x12, 0x12, 0x0a, 0x04, 0x72, 0x61, 0x63, 0x6b, 0x18, 0x06, 0x20, 0x01, 0x28, 0x09, + 0x52, 0x04, 0x72, 0x61, 0x63, 0x6b, 0x12, 0x1b, 0x0a, 0x09, 0x64, 0x61, 0x74, 0x61, 0x5f, 0x6e, + 0x6f, 0x64, 0x65, 0x18, 0x07, 0x20, 0x01, 0x28, 0x09, 0x52, 0x08, 0x64, 0x61, 0x74, 0x61, 0x4e, + 0x6f, 0x64, 0x65, 0x12, 0x32, 0x0a, 0x16, 0x6d, 0x65, 0x6d, 0x6f, 0x72, 0x79, 0x5f, 0x6d, 0x61, + 0x70, 0x5f, 0x6d, 0x61, 0x78, 0x5f, 0x73, 0x69, 0x7a, 0x65, 0x5f, 0x6d, 0x62, 0x18, 0x08, 0x20, + 0x01, 0x28, 0x0d, 0x52, 0x12, 0x6d, 0x65, 0x6d, 0x6f, 0x72, 0x79, 0x4d, 0x61, 0x70, 0x4d, 0x61, + 0x78, 0x53, 0x69, 0x7a, 0x65, 0x4d, 0x62, 0x12, 0x1b, 0x0a, 0x09, 0x64, 0x69, 0x73, 0x6b, 0x5f, + 0x74, 0x79, 0x70, 0x65, 0x18, 0x09, 0x20, 0x01, 0x28, 0x09, 0x52, 0x08, 0x64, 0x69, 0x73, 0x6b, + 0x54, 0x79, 0x70, 0x65, 0x22, 0xc4, 0x01, 0x0a, 0x0e, 0x41, 0x73, 0x73, 0x69, 0x67, 0x6e, 0x52, + 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x12, 0x10, 0x0a, 0x03, 0x66, 0x69, 0x64, 0x18, 0x01, + 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, 0x66, 0x69, 0x64, 0x12, 0x14, 0x0a, 0x05, 0x63, 0x6f, 0x75, + 0x6e, 0x74, 0x18, 0x04, 0x20, 0x01, 0x28, 0x04, 0x52, 0x05, 0x63, 0x6f, 0x75, 0x6e, 0x74, 0x12, + 0x14, 0x0a, 0x05, 0x65, 0x72, 0x72, 0x6f, 0x72, 0x18, 0x05, 0x20, 0x01, 0x28, 0x09, 0x52, 0x05, + 0x65, 0x72, 0x72, 0x6f, 0x72, 0x12, 0x12, 0x0a, 0x04, 0x61, 0x75, 0x74, 0x68, 0x18, 0x06, 0x20, + 0x01, 0x28, 0x09, 0x52, 0x04, 0x61, 0x75, 0x74, 0x68, 0x12, 0x2f, 0x0a, 0x08, 0x72, 0x65, 0x70, + 0x6c, 0x69, 0x63, 0x61, 0x73, 0x18, 0x07, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x13, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x4c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, - 0x52, 0x08, 0x6c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x22, 0x84, 0x01, 0x0a, 0x11, 0x53, - 0x74, 0x61, 0x74, 0x69, 0x73, 0x74, 0x69, 0x63, 0x73, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, - 0x12, 0x20, 0x0a, 0x0b, 0x72, 0x65, 0x70, 0x6c, 0x69, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x18, - 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0b, 0x72, 0x65, 0x70, 0x6c, 0x69, 0x63, 0x61, 0x74, 0x69, - 0x6f, 0x6e, 0x12, 0x1e, 0x0a, 0x0a, 0x63, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, - 0x18, 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0a, 0x63, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, - 0x6f, 0x6e, 0x12, 0x10, 0x0a, 0x03, 0x74, 0x74, 0x6c, 0x18, 0x03, 0x20, 0x01, 0x28, 0x09, 0x52, - 0x03, 0x74, 0x74, 0x6c, 0x12, 0x1b, 0x0a, 0x09, 0x64, 0x69, 0x73, 0x6b, 0x5f, 0x74, 0x79, 0x70, - 0x65, 0x18, 0x04, 0x20, 0x01, 0x28, 0x09, 0x52, 0x08, 0x64, 0x69, 0x73, 0x6b, 0x54, 0x79, 0x70, - 0x65, 0x22, 0x6f, 0x0a, 0x12, 0x53, 0x74, 0x61, 0x74, 0x69, 0x73, 0x74, 0x69, 0x63, 0x73, 0x52, - 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x12, 0x1d, 0x0a, 0x0a, 0x74, 0x6f, 0x74, 0x61, 0x6c, - 0x5f, 0x73, 0x69, 0x7a, 0x65, 0x18, 0x04, 0x20, 0x01, 0x28, 0x04, 0x52, 0x09, 0x74, 0x6f, 0x74, - 0x61, 0x6c, 0x53, 0x69, 0x7a, 0x65, 0x12, 0x1b, 0x0a, 0x09, 0x75, 0x73, 0x65, 0x64, 0x5f, 0x73, - 0x69, 0x7a, 0x65, 0x18, 0x05, 0x20, 0x01, 0x28, 0x04, 0x52, 0x08, 0x75, 0x73, 0x65, 0x64, 0x53, - 0x69, 0x7a, 0x65, 0x12, 0x1d, 0x0a, 0x0a, 0x66, 0x69, 0x6c, 0x65, 0x5f, 0x63, 0x6f, 0x75, 0x6e, - 0x74, 0x18, 0x06, 0x20, 0x01, 0x28, 0x04, 0x52, 0x09, 0x66, 0x69, 0x6c, 0x65, 0x43, 0x6f, 0x75, - 0x6e, 0x74, 0x22, 0x20, 0x0a, 0x0a, 0x43, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, + 0x52, 0x08, 0x72, 0x65, 0x70, 0x6c, 0x69, 0x63, 0x61, 0x73, 0x12, 0x2f, 0x0a, 0x08, 0x6c, 0x6f, + 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x18, 0x08, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x13, 0x2e, 0x6d, + 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x4c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, + 0x6e, 0x52, 0x08, 0x6c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x22, 0x84, 0x01, 0x0a, 0x11, + 0x53, 0x74, 0x61, 0x74, 0x69, 0x73, 0x74, 0x69, 0x63, 0x73, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, + 0x74, 0x12, 0x20, 0x0a, 0x0b, 0x72, 0x65, 0x70, 0x6c, 0x69, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, + 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0b, 0x72, 0x65, 0x70, 0x6c, 0x69, 0x63, 0x61, 0x74, + 0x69, 0x6f, 0x6e, 0x12, 0x1e, 0x0a, 0x0a, 0x63, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, + 0x6e, 0x18, 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0a, 0x63, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, + 0x69, 0x6f, 0x6e, 0x12, 0x10, 0x0a, 0x03, 0x74, 0x74, 0x6c, 0x18, 0x03, 0x20, 0x01, 0x28, 0x09, + 0x52, 0x03, 0x74, 0x74, 0x6c, 0x12, 0x1b, 0x0a, 0x09, 0x64, 0x69, 0x73, 0x6b, 0x5f, 0x74, 0x79, + 0x70, 0x65, 0x18, 0x04, 0x20, 0x01, 0x28, 0x09, 0x52, 0x08, 0x64, 0x69, 0x73, 0x6b, 0x54, 0x79, + 0x70, 0x65, 0x22, 0x6f, 0x0a, 0x12, 0x53, 0x74, 0x61, 0x74, 0x69, 0x73, 0x74, 0x69, 0x63, 0x73, + 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x12, 0x1d, 0x0a, 0x0a, 0x74, 0x6f, 0x74, 0x61, + 0x6c, 0x5f, 0x73, 0x69, 0x7a, 0x65, 0x18, 0x04, 0x20, 0x01, 0x28, 0x04, 0x52, 0x09, 0x74, 0x6f, + 0x74, 0x61, 0x6c, 0x53, 0x69, 0x7a, 0x65, 0x12, 0x1b, 0x0a, 0x09, 0x75, 0x73, 0x65, 0x64, 0x5f, + 0x73, 0x69, 0x7a, 0x65, 0x18, 0x05, 0x20, 0x01, 0x28, 0x04, 0x52, 0x08, 0x75, 0x73, 0x65, 0x64, + 0x53, 0x69, 0x7a, 0x65, 0x12, 0x1d, 0x0a, 0x0a, 0x66, 0x69, 0x6c, 0x65, 0x5f, 0x63, 0x6f, 0x75, + 0x6e, 0x74, 0x18, 0x06, 0x20, 0x01, 0x28, 0x04, 0x52, 0x09, 0x66, 0x69, 0x6c, 0x65, 0x43, 0x6f, + 0x75, 0x6e, 0x74, 0x22, 0x20, 0x0a, 0x0a, 0x43, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, + 0x6e, 0x12, 0x12, 0x0a, 0x04, 0x6e, 0x61, 0x6d, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, + 0x04, 0x6e, 0x61, 0x6d, 0x65, 0x22, 0x7b, 0x0a, 0x15, 0x43, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, + 0x69, 0x6f, 0x6e, 0x4c, 0x69, 0x73, 0x74, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x12, 0x34, + 0x0a, 0x16, 0x69, 0x6e, 0x63, 0x6c, 0x75, 0x64, 0x65, 0x5f, 0x6e, 0x6f, 0x72, 0x6d, 0x61, 0x6c, + 0x5f, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x73, 0x18, 0x01, 0x20, 0x01, 0x28, 0x08, 0x52, 0x14, + 0x69, 0x6e, 0x63, 0x6c, 0x75, 0x64, 0x65, 0x4e, 0x6f, 0x72, 0x6d, 0x61, 0x6c, 0x56, 0x6f, 0x6c, + 0x75, 0x6d, 0x65, 0x73, 0x12, 0x2c, 0x0a, 0x12, 0x69, 0x6e, 0x63, 0x6c, 0x75, 0x64, 0x65, 0x5f, + 0x65, 0x63, 0x5f, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x73, 0x18, 0x02, 0x20, 0x01, 0x28, 0x08, + 0x52, 0x10, 0x69, 0x6e, 0x63, 0x6c, 0x75, 0x64, 0x65, 0x45, 0x63, 0x56, 0x6f, 0x6c, 0x75, 0x6d, + 0x65, 0x73, 0x22, 0x51, 0x0a, 0x16, 0x43, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, + 0x4c, 0x69, 0x73, 0x74, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x12, 0x37, 0x0a, 0x0b, + 0x63, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x18, 0x01, 0x20, 0x03, 0x28, + 0x0b, 0x32, 0x15, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x43, 0x6f, + 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x52, 0x0b, 0x63, 0x6f, 0x6c, 0x6c, 0x65, 0x63, + 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x22, 0x2d, 0x0a, 0x17, 0x43, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, + 0x69, 0x6f, 0x6e, 0x44, 0x65, 0x6c, 0x65, 0x74, 0x65, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x12, 0x12, 0x0a, 0x04, 0x6e, 0x61, 0x6d, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x04, - 0x6e, 0x61, 0x6d, 0x65, 0x22, 0x7b, 0x0a, 0x15, 0x43, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, - 0x6f, 0x6e, 0x4c, 0x69, 0x73, 0x74, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x12, 0x34, 0x0a, - 0x16, 0x69, 0x6e, 0x63, 0x6c, 0x75, 0x64, 0x65, 0x5f, 0x6e, 0x6f, 0x72, 0x6d, 0x61, 0x6c, 0x5f, - 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x73, 0x18, 0x01, 0x20, 0x01, 0x28, 0x08, 0x52, 0x14, 0x69, - 0x6e, 0x63, 0x6c, 0x75, 0x64, 0x65, 0x4e, 0x6f, 0x72, 0x6d, 0x61, 0x6c, 0x56, 0x6f, 0x6c, 0x75, - 0x6d, 0x65, 0x73, 0x12, 0x2c, 0x0a, 0x12, 0x69, 0x6e, 0x63, 0x6c, 0x75, 0x64, 0x65, 0x5f, 0x65, - 0x63, 0x5f, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x73, 0x18, 0x02, 0x20, 0x01, 0x28, 0x08, 0x52, - 0x10, 0x69, 0x6e, 0x63, 0x6c, 0x75, 0x64, 0x65, 0x45, 0x63, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, - 0x73, 0x22, 0x51, 0x0a, 0x16, 0x43, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x4c, - 0x69, 0x73, 0x74, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x12, 0x37, 0x0a, 0x0b, 0x63, - 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x18, 0x01, 0x20, 0x03, 0x28, 0x0b, - 0x32, 0x15, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x43, 0x6f, 0x6c, - 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x52, 0x0b, 0x63, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, - 0x69, 0x6f, 0x6e, 0x73, 0x22, 0x2d, 0x0a, 0x17, 0x43, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, - 0x6f, 0x6e, 0x44, 0x65, 0x6c, 0x65, 0x74, 0x65, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x12, - 0x12, 0x0a, 0x04, 0x6e, 0x61, 0x6d, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x04, 0x6e, - 0x61, 0x6d, 0x65, 0x22, 0x1a, 0x0a, 0x18, 0x43, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, - 0x6e, 0x44, 0x65, 0x6c, 0x65, 0x74, 0x65, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, - 0x91, 0x03, 0x0a, 0x08, 0x44, 0x69, 0x73, 0x6b, 0x49, 0x6e, 0x66, 0x6f, 0x12, 0x12, 0x0a, 0x04, - 0x74, 0x79, 0x70, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x04, 0x74, 0x79, 0x70, 0x65, - 0x12, 0x21, 0x0a, 0x0c, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x63, 0x6f, 0x75, 0x6e, 0x74, - 0x18, 0x02, 0x20, 0x01, 0x28, 0x03, 0x52, 0x0b, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x43, 0x6f, - 0x75, 0x6e, 0x74, 0x12, 0x28, 0x0a, 0x10, 0x6d, 0x61, 0x78, 0x5f, 0x76, 0x6f, 0x6c, 0x75, 0x6d, - 0x65, 0x5f, 0x63, 0x6f, 0x75, 0x6e, 0x74, 0x18, 0x03, 0x20, 0x01, 0x28, 0x03, 0x52, 0x0e, 0x6d, - 0x61, 0x78, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x43, 0x6f, 0x75, 0x6e, 0x74, 0x12, 0x2a, 0x0a, - 0x11, 0x66, 0x72, 0x65, 0x65, 0x5f, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x63, 0x6f, 0x75, - 0x6e, 0x74, 0x18, 0x04, 0x20, 0x01, 0x28, 0x03, 0x52, 0x0f, 0x66, 0x72, 0x65, 0x65, 0x56, 0x6f, - 0x6c, 0x75, 0x6d, 0x65, 0x43, 0x6f, 0x75, 0x6e, 0x74, 0x12, 0x2e, 0x0a, 0x13, 0x61, 0x63, 0x74, - 0x69, 0x76, 0x65, 0x5f, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x63, 0x6f, 0x75, 0x6e, 0x74, - 0x18, 0x05, 0x20, 0x01, 0x28, 0x03, 0x52, 0x11, 0x61, 0x63, 0x74, 0x69, 0x76, 0x65, 0x56, 0x6f, - 0x6c, 0x75, 0x6d, 0x65, 0x43, 0x6f, 0x75, 0x6e, 0x74, 0x12, 0x46, 0x0a, 0x0c, 0x76, 0x6f, 0x6c, - 0x75, 0x6d, 0x65, 0x5f, 0x69, 0x6e, 0x66, 0x6f, 0x73, 0x18, 0x06, 0x20, 0x03, 0x28, 0x0b, 0x32, - 0x23, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, - 0x6d, 0x65, 0x49, 0x6e, 0x66, 0x6f, 0x72, 0x6d, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x4d, 0x65, 0x73, - 0x73, 0x61, 0x67, 0x65, 0x52, 0x0b, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x49, 0x6e, 0x66, 0x6f, - 0x73, 0x12, 0x50, 0x0a, 0x0e, 0x65, 0x63, 0x5f, 0x73, 0x68, 0x61, 0x72, 0x64, 0x5f, 0x69, 0x6e, - 0x66, 0x6f, 0x73, 0x18, 0x07, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x2a, 0x2e, 0x6d, 0x61, 0x73, 0x74, - 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, 0x53, 0x68, - 0x61, 0x72, 0x64, 0x49, 0x6e, 0x66, 0x6f, 0x72, 0x6d, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x4d, 0x65, - 0x73, 0x73, 0x61, 0x67, 0x65, 0x52, 0x0c, 0x65, 0x63, 0x53, 0x68, 0x61, 0x72, 0x64, 0x49, 0x6e, - 0x66, 0x6f, 0x73, 0x12, 0x2e, 0x0a, 0x13, 0x72, 0x65, 0x6d, 0x6f, 0x74, 0x65, 0x5f, 0x76, 0x6f, - 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x63, 0x6f, 0x75, 0x6e, 0x74, 0x18, 0x08, 0x20, 0x01, 0x28, 0x03, - 0x52, 0x11, 0x72, 0x65, 0x6d, 0x6f, 0x74, 0x65, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x43, 0x6f, - 0x75, 0x6e, 0x74, 0x22, 0xd4, 0x01, 0x0a, 0x0c, 0x44, 0x61, 0x74, 0x61, 0x4e, 0x6f, 0x64, 0x65, - 0x49, 0x6e, 0x66, 0x6f, 0x12, 0x0e, 0x0a, 0x02, 0x69, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, - 0x52, 0x02, 0x69, 0x64, 0x12, 0x44, 0x0a, 0x09, 0x64, 0x69, 0x73, 0x6b, 0x49, 0x6e, 0x66, 0x6f, - 0x73, 0x18, 0x02, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x26, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, - 0x5f, 0x70, 0x62, 0x2e, 0x44, 0x61, 0x74, 0x61, 0x4e, 0x6f, 0x64, 0x65, 0x49, 0x6e, 0x66, 0x6f, - 0x2e, 0x44, 0x69, 0x73, 0x6b, 0x49, 0x6e, 0x66, 0x6f, 0x73, 0x45, 0x6e, 0x74, 0x72, 0x79, 0x52, - 0x09, 0x64, 0x69, 0x73, 0x6b, 0x49, 0x6e, 0x66, 0x6f, 0x73, 0x12, 0x1b, 0x0a, 0x09, 0x67, 0x72, - 0x70, 0x63, 0x5f, 0x70, 0x6f, 0x72, 0x74, 0x18, 0x03, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x08, 0x67, - 0x72, 0x70, 0x63, 0x50, 0x6f, 0x72, 0x74, 0x1a, 0x51, 0x0a, 0x0e, 0x44, 0x69, 0x73, 0x6b, 0x49, - 0x6e, 0x66, 0x6f, 0x73, 0x45, 0x6e, 0x74, 0x72, 0x79, 0x12, 0x10, 0x0a, 0x03, 0x6b, 0x65, 0x79, - 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, 0x6b, 0x65, 0x79, 0x12, 0x29, 0x0a, 0x05, 0x76, - 0x61, 0x6c, 0x75, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x13, 0x2e, 0x6d, 0x61, 0x73, - 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x44, 0x69, 0x73, 0x6b, 0x49, 0x6e, 0x66, 0x6f, 0x52, - 0x05, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x3a, 0x02, 0x38, 0x01, 0x22, 0xf0, 0x01, 0x0a, 0x08, 0x52, - 0x61, 0x63, 0x6b, 0x49, 0x6e, 0x66, 0x6f, 0x12, 0x0e, 0x0a, 0x02, 0x69, 0x64, 0x18, 0x01, 0x20, - 0x01, 0x28, 0x09, 0x52, 0x02, 0x69, 0x64, 0x12, 0x3f, 0x0a, 0x0f, 0x64, 0x61, 0x74, 0x61, 0x5f, - 0x6e, 0x6f, 0x64, 0x65, 0x5f, 0x69, 0x6e, 0x66, 0x6f, 0x73, 0x18, 0x02, 0x20, 0x03, 0x28, 0x0b, - 0x32, 0x17, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x44, 0x61, 0x74, - 0x61, 0x4e, 0x6f, 0x64, 0x65, 0x49, 0x6e, 0x66, 0x6f, 0x52, 0x0d, 0x64, 0x61, 0x74, 0x61, 0x4e, - 0x6f, 0x64, 0x65, 0x49, 0x6e, 0x66, 0x6f, 0x73, 0x12, 0x40, 0x0a, 0x09, 0x64, 0x69, 0x73, 0x6b, - 0x49, 0x6e, 0x66, 0x6f, 0x73, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x22, 0x2e, 0x6d, 0x61, - 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x52, 0x61, 0x63, 0x6b, 0x49, 0x6e, 0x66, 0x6f, - 0x2e, 0x44, 0x69, 0x73, 0x6b, 0x49, 0x6e, 0x66, 0x6f, 0x73, 0x45, 0x6e, 0x74, 0x72, 0x79, 0x52, - 0x09, 0x64, 0x69, 0x73, 0x6b, 0x49, 0x6e, 0x66, 0x6f, 0x73, 0x1a, 0x51, 0x0a, 0x0e, 0x44, 0x69, - 0x73, 0x6b, 0x49, 0x6e, 0x66, 0x6f, 0x73, 0x45, 0x6e, 0x74, 0x72, 0x79, 0x12, 0x10, 0x0a, 0x03, - 0x6b, 0x65, 0x79, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, 0x6b, 0x65, 0x79, 0x12, 0x29, - 0x0a, 0x05, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x13, 0x2e, - 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x44, 0x69, 0x73, 0x6b, 0x49, 0x6e, - 0x66, 0x6f, 0x52, 0x05, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x3a, 0x02, 0x38, 0x01, 0x22, 0xef, 0x01, - 0x0a, 0x0e, 0x44, 0x61, 0x74, 0x61, 0x43, 0x65, 0x6e, 0x74, 0x65, 0x72, 0x49, 0x6e, 0x66, 0x6f, - 0x12, 0x0e, 0x0a, 0x02, 0x69, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x02, 0x69, 0x64, - 0x12, 0x32, 0x0a, 0x0a, 0x72, 0x61, 0x63, 0x6b, 0x5f, 0x69, 0x6e, 0x66, 0x6f, 0x73, 0x18, 0x02, - 0x20, 0x03, 0x28, 0x0b, 0x32, 0x13, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, - 0x2e, 0x52, 0x61, 0x63, 0x6b, 0x49, 0x6e, 0x66, 0x6f, 0x52, 0x09, 0x72, 0x61, 0x63, 0x6b, 0x49, - 0x6e, 0x66, 0x6f, 0x73, 0x12, 0x46, 0x0a, 0x09, 0x64, 0x69, 0x73, 0x6b, 0x49, 0x6e, 0x66, 0x6f, - 0x73, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x28, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, - 0x5f, 0x70, 0x62, 0x2e, 0x44, 0x61, 0x74, 0x61, 0x43, 0x65, 0x6e, 0x74, 0x65, 0x72, 0x49, 0x6e, - 0x66, 0x6f, 0x2e, 0x44, 0x69, 0x73, 0x6b, 0x49, 0x6e, 0x66, 0x6f, 0x73, 0x45, 0x6e, 0x74, 0x72, - 0x79, 0x52, 0x09, 0x64, 0x69, 0x73, 0x6b, 0x49, 0x6e, 0x66, 0x6f, 0x73, 0x1a, 0x51, 0x0a, 0x0e, - 0x44, 0x69, 0x73, 0x6b, 0x49, 0x6e, 0x66, 0x6f, 0x73, 0x45, 0x6e, 0x74, 0x72, 0x79, 0x12, 0x10, - 0x0a, 0x03, 0x6b, 0x65, 0x79, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, 0x6b, 0x65, 0x79, - 0x12, 0x29, 0x0a, 0x05, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, - 0x13, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x44, 0x69, 0x73, 0x6b, - 0x49, 0x6e, 0x66, 0x6f, 0x52, 0x05, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x3a, 0x02, 0x38, 0x01, 0x22, - 0xfe, 0x01, 0x0a, 0x0c, 0x54, 0x6f, 0x70, 0x6f, 0x6c, 0x6f, 0x67, 0x79, 0x49, 0x6e, 0x66, 0x6f, - 0x12, 0x0e, 0x0a, 0x02, 0x69, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x02, 0x69, 0x64, - 0x12, 0x45, 0x0a, 0x11, 0x64, 0x61, 0x74, 0x61, 0x5f, 0x63, 0x65, 0x6e, 0x74, 0x65, 0x72, 0x5f, - 0x69, 0x6e, 0x66, 0x6f, 0x73, 0x18, 0x02, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x19, 0x2e, 0x6d, 0x61, - 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x44, 0x61, 0x74, 0x61, 0x43, 0x65, 0x6e, 0x74, - 0x65, 0x72, 0x49, 0x6e, 0x66, 0x6f, 0x52, 0x0f, 0x64, 0x61, 0x74, 0x61, 0x43, 0x65, 0x6e, 0x74, - 0x65, 0x72, 0x49, 0x6e, 0x66, 0x6f, 0x73, 0x12, 0x44, 0x0a, 0x09, 0x64, 0x69, 0x73, 0x6b, 0x49, - 0x6e, 0x66, 0x6f, 0x73, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x26, 0x2e, 0x6d, 0x61, 0x73, - 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x54, 0x6f, 0x70, 0x6f, 0x6c, 0x6f, 0x67, 0x79, 0x49, + 0x6e, 0x61, 0x6d, 0x65, 0x22, 0x1a, 0x0a, 0x18, 0x43, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, + 0x6f, 0x6e, 0x44, 0x65, 0x6c, 0x65, 0x74, 0x65, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, + 0x22, 0x91, 0x03, 0x0a, 0x08, 0x44, 0x69, 0x73, 0x6b, 0x49, 0x6e, 0x66, 0x6f, 0x12, 0x12, 0x0a, + 0x04, 0x74, 0x79, 0x70, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x04, 0x74, 0x79, 0x70, + 0x65, 0x12, 0x21, 0x0a, 0x0c, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x63, 0x6f, 0x75, 0x6e, + 0x74, 0x18, 0x02, 0x20, 0x01, 0x28, 0x03, 0x52, 0x0b, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x43, + 0x6f, 0x75, 0x6e, 0x74, 0x12, 0x28, 0x0a, 0x10, 0x6d, 0x61, 0x78, 0x5f, 0x76, 0x6f, 0x6c, 0x75, + 0x6d, 0x65, 0x5f, 0x63, 0x6f, 0x75, 0x6e, 0x74, 0x18, 0x03, 0x20, 0x01, 0x28, 0x03, 0x52, 0x0e, + 0x6d, 0x61, 0x78, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x43, 0x6f, 0x75, 0x6e, 0x74, 0x12, 0x2a, + 0x0a, 0x11, 0x66, 0x72, 0x65, 0x65, 0x5f, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x63, 0x6f, + 0x75, 0x6e, 0x74, 0x18, 0x04, 0x20, 0x01, 0x28, 0x03, 0x52, 0x0f, 0x66, 0x72, 0x65, 0x65, 0x56, + 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x43, 0x6f, 0x75, 0x6e, 0x74, 0x12, 0x2e, 0x0a, 0x13, 0x61, 0x63, + 0x74, 0x69, 0x76, 0x65, 0x5f, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x63, 0x6f, 0x75, 0x6e, + 0x74, 0x18, 0x05, 0x20, 0x01, 0x28, 0x03, 0x52, 0x11, 0x61, 0x63, 0x74, 0x69, 0x76, 0x65, 0x56, + 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x43, 0x6f, 0x75, 0x6e, 0x74, 0x12, 0x46, 0x0a, 0x0c, 0x76, 0x6f, + 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x69, 0x6e, 0x66, 0x6f, 0x73, 0x18, 0x06, 0x20, 0x03, 0x28, 0x0b, + 0x32, 0x23, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, + 0x75, 0x6d, 0x65, 0x49, 0x6e, 0x66, 0x6f, 0x72, 0x6d, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x4d, 0x65, + 0x73, 0x73, 0x61, 0x67, 0x65, 0x52, 0x0b, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x49, 0x6e, 0x66, + 0x6f, 0x73, 0x12, 0x50, 0x0a, 0x0e, 0x65, 0x63, 0x5f, 0x73, 0x68, 0x61, 0x72, 0x64, 0x5f, 0x69, + 0x6e, 0x66, 0x6f, 0x73, 0x18, 0x07, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x2a, 0x2e, 0x6d, 0x61, 0x73, + 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, 0x53, + 0x68, 0x61, 0x72, 0x64, 0x49, 0x6e, 0x66, 0x6f, 0x72, 0x6d, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x4d, + 0x65, 0x73, 0x73, 0x61, 0x67, 0x65, 0x52, 0x0c, 0x65, 0x63, 0x53, 0x68, 0x61, 0x72, 0x64, 0x49, + 0x6e, 0x66, 0x6f, 0x73, 0x12, 0x2e, 0x0a, 0x13, 0x72, 0x65, 0x6d, 0x6f, 0x74, 0x65, 0x5f, 0x76, + 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x63, 0x6f, 0x75, 0x6e, 0x74, 0x18, 0x08, 0x20, 0x01, 0x28, + 0x03, 0x52, 0x11, 0x72, 0x65, 0x6d, 0x6f, 0x74, 0x65, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x43, + 0x6f, 0x75, 0x6e, 0x74, 0x22, 0xd4, 0x01, 0x0a, 0x0c, 0x44, 0x61, 0x74, 0x61, 0x4e, 0x6f, 0x64, + 0x65, 0x49, 0x6e, 0x66, 0x6f, 0x12, 0x0e, 0x0a, 0x02, 0x69, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, + 0x09, 0x52, 0x02, 0x69, 0x64, 0x12, 0x44, 0x0a, 0x09, 0x64, 0x69, 0x73, 0x6b, 0x49, 0x6e, 0x66, + 0x6f, 0x73, 0x18, 0x02, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x26, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, + 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x44, 0x61, 0x74, 0x61, 0x4e, 0x6f, 0x64, 0x65, 0x49, 0x6e, 0x66, + 0x6f, 0x2e, 0x44, 0x69, 0x73, 0x6b, 0x49, 0x6e, 0x66, 0x6f, 0x73, 0x45, 0x6e, 0x74, 0x72, 0x79, + 0x52, 0x09, 0x64, 0x69, 0x73, 0x6b, 0x49, 0x6e, 0x66, 0x6f, 0x73, 0x12, 0x1b, 0x0a, 0x09, 0x67, + 0x72, 0x70, 0x63, 0x5f, 0x70, 0x6f, 0x72, 0x74, 0x18, 0x03, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x08, + 0x67, 0x72, 0x70, 0x63, 0x50, 0x6f, 0x72, 0x74, 0x1a, 0x51, 0x0a, 0x0e, 0x44, 0x69, 0x73, 0x6b, + 0x49, 0x6e, 0x66, 0x6f, 0x73, 0x45, 0x6e, 0x74, 0x72, 0x79, 0x12, 0x10, 0x0a, 0x03, 0x6b, 0x65, + 0x79, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, 0x6b, 0x65, 0x79, 0x12, 0x29, 0x0a, 0x05, + 0x76, 0x61, 0x6c, 0x75, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x13, 0x2e, 0x6d, 0x61, + 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x44, 0x69, 0x73, 0x6b, 0x49, 0x6e, 0x66, 0x6f, + 0x52, 0x05, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x3a, 0x02, 0x38, 0x01, 0x22, 0xf0, 0x01, 0x0a, 0x08, + 0x52, 0x61, 0x63, 0x6b, 0x49, 0x6e, 0x66, 0x6f, 0x12, 0x0e, 0x0a, 0x02, 0x69, 0x64, 0x18, 0x01, + 0x20, 0x01, 0x28, 0x09, 0x52, 0x02, 0x69, 0x64, 0x12, 0x3f, 0x0a, 0x0f, 0x64, 0x61, 0x74, 0x61, + 0x5f, 0x6e, 0x6f, 0x64, 0x65, 0x5f, 0x69, 0x6e, 0x66, 0x6f, 0x73, 0x18, 0x02, 0x20, 0x03, 0x28, + 0x0b, 0x32, 0x17, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x44, 0x61, + 0x74, 0x61, 0x4e, 0x6f, 0x64, 0x65, 0x49, 0x6e, 0x66, 0x6f, 0x52, 0x0d, 0x64, 0x61, 0x74, 0x61, + 0x4e, 0x6f, 0x64, 0x65, 0x49, 0x6e, 0x66, 0x6f, 0x73, 0x12, 0x40, 0x0a, 0x09, 0x64, 0x69, 0x73, + 0x6b, 0x49, 0x6e, 0x66, 0x6f, 0x73, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x22, 0x2e, 0x6d, + 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x52, 0x61, 0x63, 0x6b, 0x49, 0x6e, 0x66, + 0x6f, 0x2e, 0x44, 0x69, 0x73, 0x6b, 0x49, 0x6e, 0x66, 0x6f, 0x73, 0x45, 0x6e, 0x74, 0x72, 0x79, + 0x52, 0x09, 0x64, 0x69, 0x73, 0x6b, 0x49, 0x6e, 0x66, 0x6f, 0x73, 0x1a, 0x51, 0x0a, 0x0e, 0x44, + 0x69, 0x73, 0x6b, 0x49, 0x6e, 0x66, 0x6f, 0x73, 0x45, 0x6e, 0x74, 0x72, 0x79, 0x12, 0x10, 0x0a, + 0x03, 0x6b, 0x65, 0x79, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, 0x6b, 0x65, 0x79, 0x12, + 0x29, 0x0a, 0x05, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x13, + 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x44, 0x69, 0x73, 0x6b, 0x49, + 0x6e, 0x66, 0x6f, 0x52, 0x05, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x3a, 0x02, 0x38, 0x01, 0x22, 0xef, + 0x01, 0x0a, 0x0e, 0x44, 0x61, 0x74, 0x61, 0x43, 0x65, 0x6e, 0x74, 0x65, 0x72, 0x49, 0x6e, 0x66, + 0x6f, 0x12, 0x0e, 0x0a, 0x02, 0x69, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x02, 0x69, + 0x64, 0x12, 0x32, 0x0a, 0x0a, 0x72, 0x61, 0x63, 0x6b, 0x5f, 0x69, 0x6e, 0x66, 0x6f, 0x73, 0x18, + 0x02, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x13, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, + 0x62, 0x2e, 0x52, 0x61, 0x63, 0x6b, 0x49, 0x6e, 0x66, 0x6f, 0x52, 0x09, 0x72, 0x61, 0x63, 0x6b, + 0x49, 0x6e, 0x66, 0x6f, 0x73, 0x12, 0x46, 0x0a, 0x09, 0x64, 0x69, 0x73, 0x6b, 0x49, 0x6e, 0x66, + 0x6f, 0x73, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x28, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, + 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x44, 0x61, 0x74, 0x61, 0x43, 0x65, 0x6e, 0x74, 0x65, 0x72, 0x49, 0x6e, 0x66, 0x6f, 0x2e, 0x44, 0x69, 0x73, 0x6b, 0x49, 0x6e, 0x66, 0x6f, 0x73, 0x45, 0x6e, 0x74, 0x72, 0x79, 0x52, 0x09, 0x64, 0x69, 0x73, 0x6b, 0x49, 0x6e, 0x66, 0x6f, 0x73, 0x1a, 0x51, 0x0a, 0x0e, 0x44, 0x69, 0x73, 0x6b, 0x49, 0x6e, 0x66, 0x6f, 0x73, 0x45, 0x6e, 0x74, 0x72, 0x79, 0x12, @@ -4596,321 +4580,338 @@ var file_master_proto_rawDesc = []byte{ 0x79, 0x12, 0x29, 0x0a, 0x05, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x13, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x44, 0x69, 0x73, 0x6b, 0x49, 0x6e, 0x66, 0x6f, 0x52, 0x05, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x3a, 0x02, 0x38, 0x01, - 0x22, 0x13, 0x0a, 0x11, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x4c, 0x69, 0x73, 0x74, 0x52, 0x65, - 0x71, 0x75, 0x65, 0x73, 0x74, 0x22, 0x83, 0x01, 0x0a, 0x12, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, - 0x4c, 0x69, 0x73, 0x74, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x12, 0x3c, 0x0a, 0x0d, - 0x74, 0x6f, 0x70, 0x6f, 0x6c, 0x6f, 0x67, 0x79, 0x5f, 0x69, 0x6e, 0x66, 0x6f, 0x18, 0x01, 0x20, - 0x01, 0x28, 0x0b, 0x32, 0x17, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, - 0x54, 0x6f, 0x70, 0x6f, 0x6c, 0x6f, 0x67, 0x79, 0x49, 0x6e, 0x66, 0x6f, 0x52, 0x0c, 0x74, 0x6f, - 0x70, 0x6f, 0x6c, 0x6f, 0x67, 0x79, 0x49, 0x6e, 0x66, 0x6f, 0x12, 0x2f, 0x0a, 0x14, 0x76, 0x6f, - 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x69, 0x7a, 0x65, 0x5f, 0x6c, 0x69, 0x6d, 0x69, 0x74, 0x5f, - 0x6d, 0x62, 0x18, 0x02, 0x20, 0x01, 0x28, 0x04, 0x52, 0x11, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, - 0x53, 0x69, 0x7a, 0x65, 0x4c, 0x69, 0x6d, 0x69, 0x74, 0x4d, 0x62, 0x22, 0x34, 0x0a, 0x15, 0x4c, - 0x6f, 0x6f, 0x6b, 0x75, 0x70, 0x45, 0x63, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x52, 0x65, 0x71, - 0x75, 0x65, 0x73, 0x74, 0x12, 0x1b, 0x0a, 0x09, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x69, - 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x08, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x49, - 0x64, 0x22, 0xfb, 0x01, 0x0a, 0x16, 0x4c, 0x6f, 0x6f, 0x6b, 0x75, 0x70, 0x45, 0x63, 0x56, 0x6f, - 0x6c, 0x75, 0x6d, 0x65, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x12, 0x1b, 0x0a, 0x09, - 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x69, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0d, 0x52, - 0x08, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x49, 0x64, 0x12, 0x61, 0x0a, 0x12, 0x73, 0x68, 0x61, - 0x72, 0x64, 0x5f, 0x69, 0x64, 0x5f, 0x6c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x18, - 0x02, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x33, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, - 0x62, 0x2e, 0x4c, 0x6f, 0x6f, 0x6b, 0x75, 0x70, 0x45, 0x63, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, - 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x2e, 0x45, 0x63, 0x53, 0x68, 0x61, 0x72, 0x64, - 0x49, 0x64, 0x4c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x52, 0x10, 0x73, 0x68, 0x61, 0x72, - 0x64, 0x49, 0x64, 0x4c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x1a, 0x61, 0x0a, 0x11, - 0x45, 0x63, 0x53, 0x68, 0x61, 0x72, 0x64, 0x49, 0x64, 0x4c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, - 0x6e, 0x12, 0x19, 0x0a, 0x08, 0x73, 0x68, 0x61, 0x72, 0x64, 0x5f, 0x69, 0x64, 0x18, 0x01, 0x20, - 0x01, 0x28, 0x0d, 0x52, 0x07, 0x73, 0x68, 0x61, 0x72, 0x64, 0x49, 0x64, 0x12, 0x31, 0x0a, 0x09, - 0x6c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x18, 0x02, 0x20, 0x03, 0x28, 0x0b, 0x32, - 0x13, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x4c, 0x6f, 0x63, 0x61, - 0x74, 0x69, 0x6f, 0x6e, 0x52, 0x09, 0x6c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x22, - 0x7f, 0x0a, 0x13, 0x56, 0x61, 0x63, 0x75, 0x75, 0x6d, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x52, - 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x12, 0x2b, 0x0a, 0x11, 0x67, 0x61, 0x72, 0x62, 0x61, 0x67, - 0x65, 0x5f, 0x74, 0x68, 0x72, 0x65, 0x73, 0x68, 0x6f, 0x6c, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, - 0x02, 0x52, 0x10, 0x67, 0x61, 0x72, 0x62, 0x61, 0x67, 0x65, 0x54, 0x68, 0x72, 0x65, 0x73, 0x68, - 0x6f, 0x6c, 0x64, 0x12, 0x1b, 0x0a, 0x09, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x69, 0x64, - 0x18, 0x02, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x08, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x49, 0x64, - 0x12, 0x1e, 0x0a, 0x0a, 0x63, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x18, 0x03, - 0x20, 0x01, 0x28, 0x09, 0x52, 0x0a, 0x63, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, - 0x22, 0x16, 0x0a, 0x14, 0x56, 0x61, 0x63, 0x75, 0x75, 0x6d, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, - 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x16, 0x0a, 0x14, 0x44, 0x69, 0x73, 0x61, - 0x62, 0x6c, 0x65, 0x56, 0x61, 0x63, 0x75, 0x75, 0x6d, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, - 0x22, 0x17, 0x0a, 0x15, 0x44, 0x69, 0x73, 0x61, 0x62, 0x6c, 0x65, 0x56, 0x61, 0x63, 0x75, 0x75, - 0x6d, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x15, 0x0a, 0x13, 0x45, 0x6e, 0x61, - 0x62, 0x6c, 0x65, 0x56, 0x61, 0x63, 0x75, 0x75, 0x6d, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, - 0x22, 0x16, 0x0a, 0x14, 0x45, 0x6e, 0x61, 0x62, 0x6c, 0x65, 0x56, 0x61, 0x63, 0x75, 0x75, 0x6d, - 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x93, 0x02, 0x0a, 0x19, 0x56, 0x6f, 0x6c, - 0x75, 0x6d, 0x65, 0x4d, 0x61, 0x72, 0x6b, 0x52, 0x65, 0x61, 0x64, 0x6f, 0x6e, 0x6c, 0x79, 0x52, - 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x12, 0x0e, 0x0a, 0x02, 0x69, 0x70, 0x18, 0x01, 0x20, 0x01, - 0x28, 0x09, 0x52, 0x02, 0x69, 0x70, 0x12, 0x12, 0x0a, 0x04, 0x70, 0x6f, 0x72, 0x74, 0x18, 0x02, - 0x20, 0x01, 0x28, 0x0d, 0x52, 0x04, 0x70, 0x6f, 0x72, 0x74, 0x12, 0x1b, 0x0a, 0x09, 0x76, 0x6f, - 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x69, 0x64, 0x18, 0x04, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x08, 0x76, - 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x49, 0x64, 0x12, 0x1e, 0x0a, 0x0a, 0x63, 0x6f, 0x6c, 0x6c, 0x65, - 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x18, 0x05, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0a, 0x63, 0x6f, 0x6c, - 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x12, 0x2b, 0x0a, 0x11, 0x72, 0x65, 0x70, 0x6c, 0x69, - 0x63, 0x61, 0x5f, 0x70, 0x6c, 0x61, 0x63, 0x65, 0x6d, 0x65, 0x6e, 0x74, 0x18, 0x06, 0x20, 0x01, - 0x28, 0x0d, 0x52, 0x10, 0x72, 0x65, 0x70, 0x6c, 0x69, 0x63, 0x61, 0x50, 0x6c, 0x61, 0x63, 0x65, - 0x6d, 0x65, 0x6e, 0x74, 0x12, 0x18, 0x0a, 0x07, 0x76, 0x65, 0x72, 0x73, 0x69, 0x6f, 0x6e, 0x18, - 0x07, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x07, 0x76, 0x65, 0x72, 0x73, 0x69, 0x6f, 0x6e, 0x12, 0x10, - 0x0a, 0x03, 0x74, 0x74, 0x6c, 0x18, 0x08, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x03, 0x74, 0x74, 0x6c, - 0x12, 0x1b, 0x0a, 0x09, 0x64, 0x69, 0x73, 0x6b, 0x5f, 0x74, 0x79, 0x70, 0x65, 0x18, 0x09, 0x20, - 0x01, 0x28, 0x09, 0x52, 0x08, 0x64, 0x69, 0x73, 0x6b, 0x54, 0x79, 0x70, 0x65, 0x12, 0x1f, 0x0a, - 0x0b, 0x69, 0x73, 0x5f, 0x72, 0x65, 0x61, 0x64, 0x6f, 0x6e, 0x6c, 0x79, 0x18, 0x0a, 0x20, 0x01, - 0x28, 0x08, 0x52, 0x0a, 0x69, 0x73, 0x52, 0x65, 0x61, 0x64, 0x6f, 0x6e, 0x6c, 0x79, 0x22, 0x1c, - 0x0a, 0x1a, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x4d, 0x61, 0x72, 0x6b, 0x52, 0x65, 0x61, 0x64, - 0x6f, 0x6e, 0x6c, 0x79, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x1f, 0x0a, 0x1d, - 0x47, 0x65, 0x74, 0x4d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x75, - 0x72, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x22, 0xf3, 0x02, - 0x0a, 0x1e, 0x47, 0x65, 0x74, 0x4d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x43, 0x6f, 0x6e, 0x66, 0x69, - 0x67, 0x75, 0x72, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, - 0x12, 0x27, 0x0a, 0x0f, 0x6d, 0x65, 0x74, 0x72, 0x69, 0x63, 0x73, 0x5f, 0x61, 0x64, 0x64, 0x72, - 0x65, 0x73, 0x73, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0e, 0x6d, 0x65, 0x74, 0x72, 0x69, - 0x63, 0x73, 0x41, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x12, 0x38, 0x0a, 0x18, 0x6d, 0x65, 0x74, - 0x72, 0x69, 0x63, 0x73, 0x5f, 0x69, 0x6e, 0x74, 0x65, 0x72, 0x76, 0x61, 0x6c, 0x5f, 0x73, 0x65, - 0x63, 0x6f, 0x6e, 0x64, 0x73, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x16, 0x6d, 0x65, 0x74, - 0x72, 0x69, 0x63, 0x73, 0x49, 0x6e, 0x74, 0x65, 0x72, 0x76, 0x61, 0x6c, 0x53, 0x65, 0x63, 0x6f, - 0x6e, 0x64, 0x73, 0x12, 0x44, 0x0a, 0x10, 0x73, 0x74, 0x6f, 0x72, 0x61, 0x67, 0x65, 0x5f, 0x62, - 0x61, 0x63, 0x6b, 0x65, 0x6e, 0x64, 0x73, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x19, 0x2e, - 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x53, 0x74, 0x6f, 0x72, 0x61, 0x67, - 0x65, 0x42, 0x61, 0x63, 0x6b, 0x65, 0x6e, 0x64, 0x52, 0x0f, 0x73, 0x74, 0x6f, 0x72, 0x61, 0x67, - 0x65, 0x42, 0x61, 0x63, 0x6b, 0x65, 0x6e, 0x64, 0x73, 0x12, 0x2f, 0x0a, 0x13, 0x64, 0x65, 0x66, - 0x61, 0x75, 0x6c, 0x74, 0x5f, 0x72, 0x65, 0x70, 0x6c, 0x69, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, - 0x18, 0x04, 0x20, 0x01, 0x28, 0x09, 0x52, 0x12, 0x64, 0x65, 0x66, 0x61, 0x75, 0x6c, 0x74, 0x52, - 0x65, 0x70, 0x6c, 0x69, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x12, 0x16, 0x0a, 0x06, 0x6c, 0x65, - 0x61, 0x64, 0x65, 0x72, 0x18, 0x05, 0x20, 0x01, 0x28, 0x09, 0x52, 0x06, 0x6c, 0x65, 0x61, 0x64, - 0x65, 0x72, 0x12, 0x30, 0x0a, 0x15, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x69, 0x7a, - 0x65, 0x5f, 0x6c, 0x69, 0x6d, 0x69, 0x74, 0x5f, 0x6d, 0x5f, 0x62, 0x18, 0x06, 0x20, 0x01, 0x28, - 0x0d, 0x52, 0x11, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x53, 0x69, 0x7a, 0x65, 0x4c, 0x69, 0x6d, - 0x69, 0x74, 0x4d, 0x42, 0x12, 0x2d, 0x0a, 0x12, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x70, - 0x72, 0x65, 0x61, 0x6c, 0x6c, 0x6f, 0x63, 0x61, 0x74, 0x65, 0x18, 0x07, 0x20, 0x01, 0x28, 0x08, - 0x52, 0x11, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x50, 0x72, 0x65, 0x61, 0x6c, 0x6c, 0x6f, 0x63, - 0x61, 0x74, 0x65, 0x22, 0x71, 0x0a, 0x17, 0x4c, 0x69, 0x73, 0x74, 0x43, 0x6c, 0x75, 0x73, 0x74, - 0x65, 0x72, 0x4e, 0x6f, 0x64, 0x65, 0x73, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x12, 0x1f, - 0x0a, 0x0b, 0x63, 0x6c, 0x69, 0x65, 0x6e, 0x74, 0x5f, 0x74, 0x79, 0x70, 0x65, 0x18, 0x01, 0x20, - 0x01, 0x28, 0x09, 0x52, 0x0a, 0x63, 0x6c, 0x69, 0x65, 0x6e, 0x74, 0x54, 0x79, 0x70, 0x65, 0x12, - 0x1f, 0x0a, 0x0b, 0x66, 0x69, 0x6c, 0x65, 0x72, 0x5f, 0x67, 0x72, 0x6f, 0x75, 0x70, 0x18, 0x02, - 0x20, 0x01, 0x28, 0x09, 0x52, 0x0a, 0x66, 0x69, 0x6c, 0x65, 0x72, 0x47, 0x72, 0x6f, 0x75, 0x70, - 0x12, 0x14, 0x0a, 0x05, 0x6c, 0x69, 0x6d, 0x69, 0x74, 0x18, 0x04, 0x20, 0x01, 0x28, 0x05, 0x52, - 0x05, 0x6c, 0x69, 0x6d, 0x69, 0x74, 0x22, 0x8d, 0x02, 0x0a, 0x18, 0x4c, 0x69, 0x73, 0x74, 0x43, - 0x6c, 0x75, 0x73, 0x74, 0x65, 0x72, 0x4e, 0x6f, 0x64, 0x65, 0x73, 0x52, 0x65, 0x73, 0x70, 0x6f, - 0x6e, 0x73, 0x65, 0x12, 0x54, 0x0a, 0x0d, 0x63, 0x6c, 0x75, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x6e, - 0x6f, 0x64, 0x65, 0x73, 0x18, 0x01, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x2f, 0x2e, 0x6d, 0x61, 0x73, - 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x4c, 0x69, 0x73, 0x74, 0x43, 0x6c, 0x75, 0x73, 0x74, - 0x65, 0x72, 0x4e, 0x6f, 0x64, 0x65, 0x73, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x2e, - 0x43, 0x6c, 0x75, 0x73, 0x74, 0x65, 0x72, 0x4e, 0x6f, 0x64, 0x65, 0x52, 0x0c, 0x63, 0x6c, 0x75, - 0x73, 0x74, 0x65, 0x72, 0x4e, 0x6f, 0x64, 0x65, 0x73, 0x1a, 0x9a, 0x01, 0x0a, 0x0b, 0x43, 0x6c, - 0x75, 0x73, 0x74, 0x65, 0x72, 0x4e, 0x6f, 0x64, 0x65, 0x12, 0x18, 0x0a, 0x07, 0x61, 0x64, 0x64, - 0x72, 0x65, 0x73, 0x73, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x07, 0x61, 0x64, 0x64, 0x72, - 0x65, 0x73, 0x73, 0x12, 0x18, 0x0a, 0x07, 0x76, 0x65, 0x72, 0x73, 0x69, 0x6f, 0x6e, 0x18, 0x02, - 0x20, 0x01, 0x28, 0x09, 0x52, 0x07, 0x76, 0x65, 0x72, 0x73, 0x69, 0x6f, 0x6e, 0x12, 0x22, 0x0a, - 0x0d, 0x63, 0x72, 0x65, 0x61, 0x74, 0x65, 0x64, 0x5f, 0x61, 0x74, 0x5f, 0x6e, 0x73, 0x18, 0x04, - 0x20, 0x01, 0x28, 0x03, 0x52, 0x0b, 0x63, 0x72, 0x65, 0x61, 0x74, 0x65, 0x64, 0x41, 0x74, 0x4e, - 0x73, 0x12, 0x1f, 0x0a, 0x0b, 0x64, 0x61, 0x74, 0x61, 0x5f, 0x63, 0x65, 0x6e, 0x74, 0x65, 0x72, - 0x18, 0x05, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0a, 0x64, 0x61, 0x74, 0x61, 0x43, 0x65, 0x6e, 0x74, - 0x65, 0x72, 0x12, 0x12, 0x0a, 0x04, 0x72, 0x61, 0x63, 0x6b, 0x18, 0x06, 0x20, 0x01, 0x28, 0x09, - 0x52, 0x04, 0x72, 0x61, 0x63, 0x6b, 0x22, 0xc5, 0x01, 0x0a, 0x16, 0x4c, 0x65, 0x61, 0x73, 0x65, - 0x41, 0x64, 0x6d, 0x69, 0x6e, 0x54, 0x6f, 0x6b, 0x65, 0x6e, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, - 0x74, 0x12, 0x25, 0x0a, 0x0e, 0x70, 0x72, 0x65, 0x76, 0x69, 0x6f, 0x75, 0x73, 0x5f, 0x74, 0x6f, - 0x6b, 0x65, 0x6e, 0x18, 0x01, 0x20, 0x01, 0x28, 0x03, 0x52, 0x0d, 0x70, 0x72, 0x65, 0x76, 0x69, - 0x6f, 0x75, 0x73, 0x54, 0x6f, 0x6b, 0x65, 0x6e, 0x12, 0x2c, 0x0a, 0x12, 0x70, 0x72, 0x65, 0x76, - 0x69, 0x6f, 0x75, 0x73, 0x5f, 0x6c, 0x6f, 0x63, 0x6b, 0x5f, 0x74, 0x69, 0x6d, 0x65, 0x18, 0x02, - 0x20, 0x01, 0x28, 0x03, 0x52, 0x10, 0x70, 0x72, 0x65, 0x76, 0x69, 0x6f, 0x75, 0x73, 0x4c, 0x6f, - 0x63, 0x6b, 0x54, 0x69, 0x6d, 0x65, 0x12, 0x1b, 0x0a, 0x09, 0x6c, 0x6f, 0x63, 0x6b, 0x5f, 0x6e, - 0x61, 0x6d, 0x65, 0x18, 0x03, 0x20, 0x01, 0x28, 0x09, 0x52, 0x08, 0x6c, 0x6f, 0x63, 0x6b, 0x4e, - 0x61, 0x6d, 0x65, 0x12, 0x1f, 0x0a, 0x0b, 0x63, 0x6c, 0x69, 0x65, 0x6e, 0x74, 0x5f, 0x6e, 0x61, - 0x6d, 0x65, 0x18, 0x04, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0a, 0x63, 0x6c, 0x69, 0x65, 0x6e, 0x74, - 0x4e, 0x61, 0x6d, 0x65, 0x12, 0x18, 0x0a, 0x07, 0x6d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65, 0x18, - 0x05, 0x20, 0x01, 0x28, 0x09, 0x52, 0x07, 0x6d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65, 0x22, 0x4d, - 0x0a, 0x17, 0x4c, 0x65, 0x61, 0x73, 0x65, 0x41, 0x64, 0x6d, 0x69, 0x6e, 0x54, 0x6f, 0x6b, 0x65, - 0x6e, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x12, 0x14, 0x0a, 0x05, 0x74, 0x6f, 0x6b, - 0x65, 0x6e, 0x18, 0x01, 0x20, 0x01, 0x28, 0x03, 0x52, 0x05, 0x74, 0x6f, 0x6b, 0x65, 0x6e, 0x12, - 0x1c, 0x0a, 0x0a, 0x6c, 0x6f, 0x63, 0x6b, 0x5f, 0x74, 0x73, 0x5f, 0x6e, 0x73, 0x18, 0x02, 0x20, - 0x01, 0x28, 0x03, 0x52, 0x08, 0x6c, 0x6f, 0x63, 0x6b, 0x54, 0x73, 0x4e, 0x73, 0x22, 0x8c, 0x01, - 0x0a, 0x18, 0x52, 0x65, 0x6c, 0x65, 0x61, 0x73, 0x65, 0x41, 0x64, 0x6d, 0x69, 0x6e, 0x54, 0x6f, - 0x6b, 0x65, 0x6e, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x12, 0x25, 0x0a, 0x0e, 0x70, 0x72, - 0x65, 0x76, 0x69, 0x6f, 0x75, 0x73, 0x5f, 0x74, 0x6f, 0x6b, 0x65, 0x6e, 0x18, 0x01, 0x20, 0x01, - 0x28, 0x03, 0x52, 0x0d, 0x70, 0x72, 0x65, 0x76, 0x69, 0x6f, 0x75, 0x73, 0x54, 0x6f, 0x6b, 0x65, - 0x6e, 0x12, 0x2c, 0x0a, 0x12, 0x70, 0x72, 0x65, 0x76, 0x69, 0x6f, 0x75, 0x73, 0x5f, 0x6c, 0x6f, - 0x63, 0x6b, 0x5f, 0x74, 0x69, 0x6d, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x03, 0x52, 0x10, 0x70, - 0x72, 0x65, 0x76, 0x69, 0x6f, 0x75, 0x73, 0x4c, 0x6f, 0x63, 0x6b, 0x54, 0x69, 0x6d, 0x65, 0x12, - 0x1b, 0x0a, 0x09, 0x6c, 0x6f, 0x63, 0x6b, 0x5f, 0x6e, 0x61, 0x6d, 0x65, 0x18, 0x03, 0x20, 0x01, - 0x28, 0x09, 0x52, 0x08, 0x6c, 0x6f, 0x63, 0x6b, 0x4e, 0x61, 0x6d, 0x65, 0x22, 0x1b, 0x0a, 0x19, - 0x52, 0x65, 0x6c, 0x65, 0x61, 0x73, 0x65, 0x41, 0x64, 0x6d, 0x69, 0x6e, 0x54, 0x6f, 0x6b, 0x65, - 0x6e, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x46, 0x0a, 0x0b, 0x50, 0x69, 0x6e, - 0x67, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x12, 0x16, 0x0a, 0x06, 0x74, 0x61, 0x72, 0x67, - 0x65, 0x74, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x06, 0x74, 0x61, 0x72, 0x67, 0x65, 0x74, - 0x12, 0x1f, 0x0a, 0x0b, 0x74, 0x61, 0x72, 0x67, 0x65, 0x74, 0x5f, 0x74, 0x79, 0x70, 0x65, 0x18, - 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0a, 0x74, 0x61, 0x72, 0x67, 0x65, 0x74, 0x54, 0x79, 0x70, - 0x65, 0x22, 0x7a, 0x0a, 0x0c, 0x50, 0x69, 0x6e, 0x67, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, - 0x65, 0x12, 0x22, 0x0a, 0x0d, 0x73, 0x74, 0x61, 0x72, 0x74, 0x5f, 0x74, 0x69, 0x6d, 0x65, 0x5f, - 0x6e, 0x73, 0x18, 0x01, 0x20, 0x01, 0x28, 0x03, 0x52, 0x0b, 0x73, 0x74, 0x61, 0x72, 0x74, 0x54, - 0x69, 0x6d, 0x65, 0x4e, 0x73, 0x12, 0x24, 0x0a, 0x0e, 0x72, 0x65, 0x6d, 0x6f, 0x74, 0x65, 0x5f, - 0x74, 0x69, 0x6d, 0x65, 0x5f, 0x6e, 0x73, 0x18, 0x02, 0x20, 0x01, 0x28, 0x03, 0x52, 0x0c, 0x72, - 0x65, 0x6d, 0x6f, 0x74, 0x65, 0x54, 0x69, 0x6d, 0x65, 0x4e, 0x73, 0x12, 0x20, 0x0a, 0x0c, 0x73, - 0x74, 0x6f, 0x70, 0x5f, 0x74, 0x69, 0x6d, 0x65, 0x5f, 0x6e, 0x73, 0x18, 0x03, 0x20, 0x01, 0x28, - 0x03, 0x52, 0x0a, 0x73, 0x74, 0x6f, 0x70, 0x54, 0x69, 0x6d, 0x65, 0x4e, 0x73, 0x22, 0x56, 0x0a, - 0x14, 0x52, 0x61, 0x66, 0x74, 0x41, 0x64, 0x64, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x52, 0x65, - 0x71, 0x75, 0x65, 0x73, 0x74, 0x12, 0x0e, 0x0a, 0x02, 0x69, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, + 0x22, 0xfe, 0x01, 0x0a, 0x0c, 0x54, 0x6f, 0x70, 0x6f, 0x6c, 0x6f, 0x67, 0x79, 0x49, 0x6e, 0x66, + 0x6f, 0x12, 0x0e, 0x0a, 0x02, 0x69, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x02, 0x69, + 0x64, 0x12, 0x45, 0x0a, 0x11, 0x64, 0x61, 0x74, 0x61, 0x5f, 0x63, 0x65, 0x6e, 0x74, 0x65, 0x72, + 0x5f, 0x69, 0x6e, 0x66, 0x6f, 0x73, 0x18, 0x02, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x19, 0x2e, 0x6d, + 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x44, 0x61, 0x74, 0x61, 0x43, 0x65, 0x6e, + 0x74, 0x65, 0x72, 0x49, 0x6e, 0x66, 0x6f, 0x52, 0x0f, 0x64, 0x61, 0x74, 0x61, 0x43, 0x65, 0x6e, + 0x74, 0x65, 0x72, 0x49, 0x6e, 0x66, 0x6f, 0x73, 0x12, 0x44, 0x0a, 0x09, 0x64, 0x69, 0x73, 0x6b, + 0x49, 0x6e, 0x66, 0x6f, 0x73, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x26, 0x2e, 0x6d, 0x61, + 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x54, 0x6f, 0x70, 0x6f, 0x6c, 0x6f, 0x67, 0x79, + 0x49, 0x6e, 0x66, 0x6f, 0x2e, 0x44, 0x69, 0x73, 0x6b, 0x49, 0x6e, 0x66, 0x6f, 0x73, 0x45, 0x6e, + 0x74, 0x72, 0x79, 0x52, 0x09, 0x64, 0x69, 0x73, 0x6b, 0x49, 0x6e, 0x66, 0x6f, 0x73, 0x1a, 0x51, + 0x0a, 0x0e, 0x44, 0x69, 0x73, 0x6b, 0x49, 0x6e, 0x66, 0x6f, 0x73, 0x45, 0x6e, 0x74, 0x72, 0x79, + 0x12, 0x10, 0x0a, 0x03, 0x6b, 0x65, 0x79, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, 0x6b, + 0x65, 0x79, 0x12, 0x29, 0x0a, 0x05, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, + 0x0b, 0x32, 0x13, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x44, 0x69, + 0x73, 0x6b, 0x49, 0x6e, 0x66, 0x6f, 0x52, 0x05, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x3a, 0x02, 0x38, + 0x01, 0x22, 0x13, 0x0a, 0x11, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x4c, 0x69, 0x73, 0x74, 0x52, + 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x22, 0x83, 0x01, 0x0a, 0x12, 0x56, 0x6f, 0x6c, 0x75, 0x6d, + 0x65, 0x4c, 0x69, 0x73, 0x74, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x12, 0x3c, 0x0a, + 0x0d, 0x74, 0x6f, 0x70, 0x6f, 0x6c, 0x6f, 0x67, 0x79, 0x5f, 0x69, 0x6e, 0x66, 0x6f, 0x18, 0x01, + 0x20, 0x01, 0x28, 0x0b, 0x32, 0x17, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, + 0x2e, 0x54, 0x6f, 0x70, 0x6f, 0x6c, 0x6f, 0x67, 0x79, 0x49, 0x6e, 0x66, 0x6f, 0x52, 0x0c, 0x74, + 0x6f, 0x70, 0x6f, 0x6c, 0x6f, 0x67, 0x79, 0x49, 0x6e, 0x66, 0x6f, 0x12, 0x2f, 0x0a, 0x14, 0x76, + 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x69, 0x7a, 0x65, 0x5f, 0x6c, 0x69, 0x6d, 0x69, 0x74, + 0x5f, 0x6d, 0x62, 0x18, 0x02, 0x20, 0x01, 0x28, 0x04, 0x52, 0x11, 0x76, 0x6f, 0x6c, 0x75, 0x6d, + 0x65, 0x53, 0x69, 0x7a, 0x65, 0x4c, 0x69, 0x6d, 0x69, 0x74, 0x4d, 0x62, 0x22, 0x34, 0x0a, 0x15, + 0x4c, 0x6f, 0x6f, 0x6b, 0x75, 0x70, 0x45, 0x63, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x52, 0x65, + 0x71, 0x75, 0x65, 0x73, 0x74, 0x12, 0x1b, 0x0a, 0x09, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, + 0x69, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x08, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, + 0x49, 0x64, 0x22, 0xfb, 0x01, 0x0a, 0x16, 0x4c, 0x6f, 0x6f, 0x6b, 0x75, 0x70, 0x45, 0x63, 0x56, + 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x12, 0x1b, 0x0a, + 0x09, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x69, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0d, + 0x52, 0x08, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x49, 0x64, 0x12, 0x61, 0x0a, 0x12, 0x73, 0x68, + 0x61, 0x72, 0x64, 0x5f, 0x69, 0x64, 0x5f, 0x6c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x73, + 0x18, 0x02, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x33, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, + 0x70, 0x62, 0x2e, 0x4c, 0x6f, 0x6f, 0x6b, 0x75, 0x70, 0x45, 0x63, 0x56, 0x6f, 0x6c, 0x75, 0x6d, + 0x65, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x2e, 0x45, 0x63, 0x53, 0x68, 0x61, 0x72, + 0x64, 0x49, 0x64, 0x4c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x52, 0x10, 0x73, 0x68, 0x61, + 0x72, 0x64, 0x49, 0x64, 0x4c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x1a, 0x61, 0x0a, + 0x11, 0x45, 0x63, 0x53, 0x68, 0x61, 0x72, 0x64, 0x49, 0x64, 0x4c, 0x6f, 0x63, 0x61, 0x74, 0x69, + 0x6f, 0x6e, 0x12, 0x19, 0x0a, 0x08, 0x73, 0x68, 0x61, 0x72, 0x64, 0x5f, 0x69, 0x64, 0x18, 0x01, + 0x20, 0x01, 0x28, 0x0d, 0x52, 0x07, 0x73, 0x68, 0x61, 0x72, 0x64, 0x49, 0x64, 0x12, 0x31, 0x0a, + 0x09, 0x6c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x18, 0x02, 0x20, 0x03, 0x28, 0x0b, + 0x32, 0x13, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x4c, 0x6f, 0x63, + 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x52, 0x09, 0x6c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x73, + 0x22, 0x7f, 0x0a, 0x13, 0x56, 0x61, 0x63, 0x75, 0x75, 0x6d, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, + 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x12, 0x2b, 0x0a, 0x11, 0x67, 0x61, 0x72, 0x62, 0x61, + 0x67, 0x65, 0x5f, 0x74, 0x68, 0x72, 0x65, 0x73, 0x68, 0x6f, 0x6c, 0x64, 0x18, 0x01, 0x20, 0x01, + 0x28, 0x02, 0x52, 0x10, 0x67, 0x61, 0x72, 0x62, 0x61, 0x67, 0x65, 0x54, 0x68, 0x72, 0x65, 0x73, + 0x68, 0x6f, 0x6c, 0x64, 0x12, 0x1b, 0x0a, 0x09, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x69, + 0x64, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x08, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x49, + 0x64, 0x12, 0x1e, 0x0a, 0x0a, 0x63, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x18, + 0x03, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0a, 0x63, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, + 0x6e, 0x22, 0x16, 0x0a, 0x14, 0x56, 0x61, 0x63, 0x75, 0x75, 0x6d, 0x56, 0x6f, 0x6c, 0x75, 0x6d, + 0x65, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x16, 0x0a, 0x14, 0x44, 0x69, 0x73, + 0x61, 0x62, 0x6c, 0x65, 0x56, 0x61, 0x63, 0x75, 0x75, 0x6d, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, + 0x74, 0x22, 0x17, 0x0a, 0x15, 0x44, 0x69, 0x73, 0x61, 0x62, 0x6c, 0x65, 0x56, 0x61, 0x63, 0x75, + 0x75, 0x6d, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x15, 0x0a, 0x13, 0x45, 0x6e, + 0x61, 0x62, 0x6c, 0x65, 0x56, 0x61, 0x63, 0x75, 0x75, 0x6d, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, + 0x74, 0x22, 0x16, 0x0a, 0x14, 0x45, 0x6e, 0x61, 0x62, 0x6c, 0x65, 0x56, 0x61, 0x63, 0x75, 0x75, + 0x6d, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x93, 0x02, 0x0a, 0x19, 0x56, 0x6f, + 0x6c, 0x75, 0x6d, 0x65, 0x4d, 0x61, 0x72, 0x6b, 0x52, 0x65, 0x61, 0x64, 0x6f, 0x6e, 0x6c, 0x79, + 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x12, 0x0e, 0x0a, 0x02, 0x69, 0x70, 0x18, 0x01, 0x20, + 0x01, 0x28, 0x09, 0x52, 0x02, 0x69, 0x70, 0x12, 0x12, 0x0a, 0x04, 0x70, 0x6f, 0x72, 0x74, 0x18, + 0x02, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x04, 0x70, 0x6f, 0x72, 0x74, 0x12, 0x1b, 0x0a, 0x09, 0x76, + 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x69, 0x64, 0x18, 0x04, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x08, + 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x49, 0x64, 0x12, 0x1e, 0x0a, 0x0a, 0x63, 0x6f, 0x6c, 0x6c, + 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x18, 0x05, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0a, 0x63, 0x6f, + 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x12, 0x2b, 0x0a, 0x11, 0x72, 0x65, 0x70, 0x6c, + 0x69, 0x63, 0x61, 0x5f, 0x70, 0x6c, 0x61, 0x63, 0x65, 0x6d, 0x65, 0x6e, 0x74, 0x18, 0x06, 0x20, + 0x01, 0x28, 0x0d, 0x52, 0x10, 0x72, 0x65, 0x70, 0x6c, 0x69, 0x63, 0x61, 0x50, 0x6c, 0x61, 0x63, + 0x65, 0x6d, 0x65, 0x6e, 0x74, 0x12, 0x18, 0x0a, 0x07, 0x76, 0x65, 0x72, 0x73, 0x69, 0x6f, 0x6e, + 0x18, 0x07, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x07, 0x76, 0x65, 0x72, 0x73, 0x69, 0x6f, 0x6e, 0x12, + 0x10, 0x0a, 0x03, 0x74, 0x74, 0x6c, 0x18, 0x08, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x03, 0x74, 0x74, + 0x6c, 0x12, 0x1b, 0x0a, 0x09, 0x64, 0x69, 0x73, 0x6b, 0x5f, 0x74, 0x79, 0x70, 0x65, 0x18, 0x09, + 0x20, 0x01, 0x28, 0x09, 0x52, 0x08, 0x64, 0x69, 0x73, 0x6b, 0x54, 0x79, 0x70, 0x65, 0x12, 0x1f, + 0x0a, 0x0b, 0x69, 0x73, 0x5f, 0x72, 0x65, 0x61, 0x64, 0x6f, 0x6e, 0x6c, 0x79, 0x18, 0x0a, 0x20, + 0x01, 0x28, 0x08, 0x52, 0x0a, 0x69, 0x73, 0x52, 0x65, 0x61, 0x64, 0x6f, 0x6e, 0x6c, 0x79, 0x22, + 0x1c, 0x0a, 0x1a, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x4d, 0x61, 0x72, 0x6b, 0x52, 0x65, 0x61, + 0x64, 0x6f, 0x6e, 0x6c, 0x79, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x1f, 0x0a, + 0x1d, 0x47, 0x65, 0x74, 0x4d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, + 0x75, 0x72, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x22, 0xf3, + 0x02, 0x0a, 0x1e, 0x47, 0x65, 0x74, 0x4d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x43, 0x6f, 0x6e, 0x66, + 0x69, 0x67, 0x75, 0x72, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, + 0x65, 0x12, 0x27, 0x0a, 0x0f, 0x6d, 0x65, 0x74, 0x72, 0x69, 0x63, 0x73, 0x5f, 0x61, 0x64, 0x64, + 0x72, 0x65, 0x73, 0x73, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0e, 0x6d, 0x65, 0x74, 0x72, + 0x69, 0x63, 0x73, 0x41, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x12, 0x38, 0x0a, 0x18, 0x6d, 0x65, + 0x74, 0x72, 0x69, 0x63, 0x73, 0x5f, 0x69, 0x6e, 0x74, 0x65, 0x72, 0x76, 0x61, 0x6c, 0x5f, 0x73, + 0x65, 0x63, 0x6f, 0x6e, 0x64, 0x73, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x16, 0x6d, 0x65, + 0x74, 0x72, 0x69, 0x63, 0x73, 0x49, 0x6e, 0x74, 0x65, 0x72, 0x76, 0x61, 0x6c, 0x53, 0x65, 0x63, + 0x6f, 0x6e, 0x64, 0x73, 0x12, 0x44, 0x0a, 0x10, 0x73, 0x74, 0x6f, 0x72, 0x61, 0x67, 0x65, 0x5f, + 0x62, 0x61, 0x63, 0x6b, 0x65, 0x6e, 0x64, 0x73, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x19, + 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x53, 0x74, 0x6f, 0x72, 0x61, + 0x67, 0x65, 0x42, 0x61, 0x63, 0x6b, 0x65, 0x6e, 0x64, 0x52, 0x0f, 0x73, 0x74, 0x6f, 0x72, 0x61, + 0x67, 0x65, 0x42, 0x61, 0x63, 0x6b, 0x65, 0x6e, 0x64, 0x73, 0x12, 0x2f, 0x0a, 0x13, 0x64, 0x65, + 0x66, 0x61, 0x75, 0x6c, 0x74, 0x5f, 0x72, 0x65, 0x70, 0x6c, 0x69, 0x63, 0x61, 0x74, 0x69, 0x6f, + 0x6e, 0x18, 0x04, 0x20, 0x01, 0x28, 0x09, 0x52, 0x12, 0x64, 0x65, 0x66, 0x61, 0x75, 0x6c, 0x74, + 0x52, 0x65, 0x70, 0x6c, 0x69, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x12, 0x16, 0x0a, 0x06, 0x6c, + 0x65, 0x61, 0x64, 0x65, 0x72, 0x18, 0x05, 0x20, 0x01, 0x28, 0x09, 0x52, 0x06, 0x6c, 0x65, 0x61, + 0x64, 0x65, 0x72, 0x12, 0x30, 0x0a, 0x15, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x69, + 0x7a, 0x65, 0x5f, 0x6c, 0x69, 0x6d, 0x69, 0x74, 0x5f, 0x6d, 0x5f, 0x62, 0x18, 0x06, 0x20, 0x01, + 0x28, 0x0d, 0x52, 0x11, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x53, 0x69, 0x7a, 0x65, 0x4c, 0x69, + 0x6d, 0x69, 0x74, 0x4d, 0x42, 0x12, 0x2d, 0x0a, 0x12, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, + 0x70, 0x72, 0x65, 0x61, 0x6c, 0x6c, 0x6f, 0x63, 0x61, 0x74, 0x65, 0x18, 0x07, 0x20, 0x01, 0x28, + 0x08, 0x52, 0x11, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x50, 0x72, 0x65, 0x61, 0x6c, 0x6c, 0x6f, + 0x63, 0x61, 0x74, 0x65, 0x22, 0x71, 0x0a, 0x17, 0x4c, 0x69, 0x73, 0x74, 0x43, 0x6c, 0x75, 0x73, + 0x74, 0x65, 0x72, 0x4e, 0x6f, 0x64, 0x65, 0x73, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x12, + 0x1f, 0x0a, 0x0b, 0x63, 0x6c, 0x69, 0x65, 0x6e, 0x74, 0x5f, 0x74, 0x79, 0x70, 0x65, 0x18, 0x01, + 0x20, 0x01, 0x28, 0x09, 0x52, 0x0a, 0x63, 0x6c, 0x69, 0x65, 0x6e, 0x74, 0x54, 0x79, 0x70, 0x65, + 0x12, 0x1f, 0x0a, 0x0b, 0x66, 0x69, 0x6c, 0x65, 0x72, 0x5f, 0x67, 0x72, 0x6f, 0x75, 0x70, 0x18, + 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0a, 0x66, 0x69, 0x6c, 0x65, 0x72, 0x47, 0x72, 0x6f, 0x75, + 0x70, 0x12, 0x14, 0x0a, 0x05, 0x6c, 0x69, 0x6d, 0x69, 0x74, 0x18, 0x04, 0x20, 0x01, 0x28, 0x05, + 0x52, 0x05, 0x6c, 0x69, 0x6d, 0x69, 0x74, 0x22, 0x8d, 0x02, 0x0a, 0x18, 0x4c, 0x69, 0x73, 0x74, + 0x43, 0x6c, 0x75, 0x73, 0x74, 0x65, 0x72, 0x4e, 0x6f, 0x64, 0x65, 0x73, 0x52, 0x65, 0x73, 0x70, + 0x6f, 0x6e, 0x73, 0x65, 0x12, 0x54, 0x0a, 0x0d, 0x63, 0x6c, 0x75, 0x73, 0x74, 0x65, 0x72, 0x5f, + 0x6e, 0x6f, 0x64, 0x65, 0x73, 0x18, 0x01, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x2f, 0x2e, 0x6d, 0x61, + 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x4c, 0x69, 0x73, 0x74, 0x43, 0x6c, 0x75, 0x73, + 0x74, 0x65, 0x72, 0x4e, 0x6f, 0x64, 0x65, 0x73, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, + 0x2e, 0x43, 0x6c, 0x75, 0x73, 0x74, 0x65, 0x72, 0x4e, 0x6f, 0x64, 0x65, 0x52, 0x0c, 0x63, 0x6c, + 0x75, 0x73, 0x74, 0x65, 0x72, 0x4e, 0x6f, 0x64, 0x65, 0x73, 0x1a, 0x9a, 0x01, 0x0a, 0x0b, 0x43, + 0x6c, 0x75, 0x73, 0x74, 0x65, 0x72, 0x4e, 0x6f, 0x64, 0x65, 0x12, 0x18, 0x0a, 0x07, 0x61, 0x64, + 0x64, 0x72, 0x65, 0x73, 0x73, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x07, 0x61, 0x64, 0x64, + 0x72, 0x65, 0x73, 0x73, 0x12, 0x18, 0x0a, 0x07, 0x76, 0x65, 0x72, 0x73, 0x69, 0x6f, 0x6e, 0x18, + 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x07, 0x76, 0x65, 0x72, 0x73, 0x69, 0x6f, 0x6e, 0x12, 0x22, + 0x0a, 0x0d, 0x63, 0x72, 0x65, 0x61, 0x74, 0x65, 0x64, 0x5f, 0x61, 0x74, 0x5f, 0x6e, 0x73, 0x18, + 0x04, 0x20, 0x01, 0x28, 0x03, 0x52, 0x0b, 0x63, 0x72, 0x65, 0x61, 0x74, 0x65, 0x64, 0x41, 0x74, + 0x4e, 0x73, 0x12, 0x1f, 0x0a, 0x0b, 0x64, 0x61, 0x74, 0x61, 0x5f, 0x63, 0x65, 0x6e, 0x74, 0x65, + 0x72, 0x18, 0x05, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0a, 0x64, 0x61, 0x74, 0x61, 0x43, 0x65, 0x6e, + 0x74, 0x65, 0x72, 0x12, 0x12, 0x0a, 0x04, 0x72, 0x61, 0x63, 0x6b, 0x18, 0x06, 0x20, 0x01, 0x28, + 0x09, 0x52, 0x04, 0x72, 0x61, 0x63, 0x6b, 0x22, 0xc5, 0x01, 0x0a, 0x16, 0x4c, 0x65, 0x61, 0x73, + 0x65, 0x41, 0x64, 0x6d, 0x69, 0x6e, 0x54, 0x6f, 0x6b, 0x65, 0x6e, 0x52, 0x65, 0x71, 0x75, 0x65, + 0x73, 0x74, 0x12, 0x25, 0x0a, 0x0e, 0x70, 0x72, 0x65, 0x76, 0x69, 0x6f, 0x75, 0x73, 0x5f, 0x74, + 0x6f, 0x6b, 0x65, 0x6e, 0x18, 0x01, 0x20, 0x01, 0x28, 0x03, 0x52, 0x0d, 0x70, 0x72, 0x65, 0x76, + 0x69, 0x6f, 0x75, 0x73, 0x54, 0x6f, 0x6b, 0x65, 0x6e, 0x12, 0x2c, 0x0a, 0x12, 0x70, 0x72, 0x65, + 0x76, 0x69, 0x6f, 0x75, 0x73, 0x5f, 0x6c, 0x6f, 0x63, 0x6b, 0x5f, 0x74, 0x69, 0x6d, 0x65, 0x18, + 0x02, 0x20, 0x01, 0x28, 0x03, 0x52, 0x10, 0x70, 0x72, 0x65, 0x76, 0x69, 0x6f, 0x75, 0x73, 0x4c, + 0x6f, 0x63, 0x6b, 0x54, 0x69, 0x6d, 0x65, 0x12, 0x1b, 0x0a, 0x09, 0x6c, 0x6f, 0x63, 0x6b, 0x5f, + 0x6e, 0x61, 0x6d, 0x65, 0x18, 0x03, 0x20, 0x01, 0x28, 0x09, 0x52, 0x08, 0x6c, 0x6f, 0x63, 0x6b, + 0x4e, 0x61, 0x6d, 0x65, 0x12, 0x1f, 0x0a, 0x0b, 0x63, 0x6c, 0x69, 0x65, 0x6e, 0x74, 0x5f, 0x6e, + 0x61, 0x6d, 0x65, 0x18, 0x04, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0a, 0x63, 0x6c, 0x69, 0x65, 0x6e, + 0x74, 0x4e, 0x61, 0x6d, 0x65, 0x12, 0x18, 0x0a, 0x07, 0x6d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65, + 0x18, 0x05, 0x20, 0x01, 0x28, 0x09, 0x52, 0x07, 0x6d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65, 0x22, + 0x4d, 0x0a, 0x17, 0x4c, 0x65, 0x61, 0x73, 0x65, 0x41, 0x64, 0x6d, 0x69, 0x6e, 0x54, 0x6f, 0x6b, + 0x65, 0x6e, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x12, 0x14, 0x0a, 0x05, 0x74, 0x6f, + 0x6b, 0x65, 0x6e, 0x18, 0x01, 0x20, 0x01, 0x28, 0x03, 0x52, 0x05, 0x74, 0x6f, 0x6b, 0x65, 0x6e, + 0x12, 0x1c, 0x0a, 0x0a, 0x6c, 0x6f, 0x63, 0x6b, 0x5f, 0x74, 0x73, 0x5f, 0x6e, 0x73, 0x18, 0x02, + 0x20, 0x01, 0x28, 0x03, 0x52, 0x08, 0x6c, 0x6f, 0x63, 0x6b, 0x54, 0x73, 0x4e, 0x73, 0x22, 0x8c, + 0x01, 0x0a, 0x18, 0x52, 0x65, 0x6c, 0x65, 0x61, 0x73, 0x65, 0x41, 0x64, 0x6d, 0x69, 0x6e, 0x54, + 0x6f, 0x6b, 0x65, 0x6e, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x12, 0x25, 0x0a, 0x0e, 0x70, + 0x72, 0x65, 0x76, 0x69, 0x6f, 0x75, 0x73, 0x5f, 0x74, 0x6f, 0x6b, 0x65, 0x6e, 0x18, 0x01, 0x20, + 0x01, 0x28, 0x03, 0x52, 0x0d, 0x70, 0x72, 0x65, 0x76, 0x69, 0x6f, 0x75, 0x73, 0x54, 0x6f, 0x6b, + 0x65, 0x6e, 0x12, 0x2c, 0x0a, 0x12, 0x70, 0x72, 0x65, 0x76, 0x69, 0x6f, 0x75, 0x73, 0x5f, 0x6c, + 0x6f, 0x63, 0x6b, 0x5f, 0x74, 0x69, 0x6d, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x03, 0x52, 0x10, + 0x70, 0x72, 0x65, 0x76, 0x69, 0x6f, 0x75, 0x73, 0x4c, 0x6f, 0x63, 0x6b, 0x54, 0x69, 0x6d, 0x65, + 0x12, 0x1b, 0x0a, 0x09, 0x6c, 0x6f, 0x63, 0x6b, 0x5f, 0x6e, 0x61, 0x6d, 0x65, 0x18, 0x03, 0x20, + 0x01, 0x28, 0x09, 0x52, 0x08, 0x6c, 0x6f, 0x63, 0x6b, 0x4e, 0x61, 0x6d, 0x65, 0x22, 0x1b, 0x0a, + 0x19, 0x52, 0x65, 0x6c, 0x65, 0x61, 0x73, 0x65, 0x41, 0x64, 0x6d, 0x69, 0x6e, 0x54, 0x6f, 0x6b, + 0x65, 0x6e, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x46, 0x0a, 0x0b, 0x50, 0x69, + 0x6e, 0x67, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x12, 0x16, 0x0a, 0x06, 0x74, 0x61, 0x72, + 0x67, 0x65, 0x74, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x06, 0x74, 0x61, 0x72, 0x67, 0x65, + 0x74, 0x12, 0x1f, 0x0a, 0x0b, 0x74, 0x61, 0x72, 0x67, 0x65, 0x74, 0x5f, 0x74, 0x79, 0x70, 0x65, + 0x18, 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0a, 0x74, 0x61, 0x72, 0x67, 0x65, 0x74, 0x54, 0x79, + 0x70, 0x65, 0x22, 0x7a, 0x0a, 0x0c, 0x50, 0x69, 0x6e, 0x67, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, + 0x73, 0x65, 0x12, 0x22, 0x0a, 0x0d, 0x73, 0x74, 0x61, 0x72, 0x74, 0x5f, 0x74, 0x69, 0x6d, 0x65, + 0x5f, 0x6e, 0x73, 0x18, 0x01, 0x20, 0x01, 0x28, 0x03, 0x52, 0x0b, 0x73, 0x74, 0x61, 0x72, 0x74, + 0x54, 0x69, 0x6d, 0x65, 0x4e, 0x73, 0x12, 0x24, 0x0a, 0x0e, 0x72, 0x65, 0x6d, 0x6f, 0x74, 0x65, + 0x5f, 0x74, 0x69, 0x6d, 0x65, 0x5f, 0x6e, 0x73, 0x18, 0x02, 0x20, 0x01, 0x28, 0x03, 0x52, 0x0c, + 0x72, 0x65, 0x6d, 0x6f, 0x74, 0x65, 0x54, 0x69, 0x6d, 0x65, 0x4e, 0x73, 0x12, 0x20, 0x0a, 0x0c, + 0x73, 0x74, 0x6f, 0x70, 0x5f, 0x74, 0x69, 0x6d, 0x65, 0x5f, 0x6e, 0x73, 0x18, 0x03, 0x20, 0x01, + 0x28, 0x03, 0x52, 0x0a, 0x73, 0x74, 0x6f, 0x70, 0x54, 0x69, 0x6d, 0x65, 0x4e, 0x73, 0x22, 0x56, + 0x0a, 0x14, 0x52, 0x61, 0x66, 0x74, 0x41, 0x64, 0x64, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x52, + 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x12, 0x0e, 0x0a, 0x02, 0x69, 0x64, 0x18, 0x01, 0x20, 0x01, + 0x28, 0x09, 0x52, 0x02, 0x69, 0x64, 0x12, 0x18, 0x0a, 0x07, 0x61, 0x64, 0x64, 0x72, 0x65, 0x73, + 0x73, 0x18, 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x07, 0x61, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, + 0x12, 0x14, 0x0a, 0x05, 0x76, 0x6f, 0x74, 0x65, 0x72, 0x18, 0x03, 0x20, 0x01, 0x28, 0x08, 0x52, + 0x05, 0x76, 0x6f, 0x74, 0x65, 0x72, 0x22, 0x17, 0x0a, 0x15, 0x52, 0x61, 0x66, 0x74, 0x41, 0x64, + 0x64, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, + 0x3f, 0x0a, 0x17, 0x52, 0x61, 0x66, 0x74, 0x52, 0x65, 0x6d, 0x6f, 0x76, 0x65, 0x53, 0x65, 0x72, + 0x76, 0x65, 0x72, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x12, 0x0e, 0x0a, 0x02, 0x69, 0x64, + 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x02, 0x69, 0x64, 0x12, 0x14, 0x0a, 0x05, 0x66, 0x6f, + 0x72, 0x63, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x08, 0x52, 0x05, 0x66, 0x6f, 0x72, 0x63, 0x65, + 0x22, 0x1a, 0x0a, 0x18, 0x52, 0x61, 0x66, 0x74, 0x52, 0x65, 0x6d, 0x6f, 0x76, 0x65, 0x53, 0x65, + 0x72, 0x76, 0x65, 0x72, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x1f, 0x0a, 0x1d, + 0x52, 0x61, 0x66, 0x74, 0x4c, 0x69, 0x73, 0x74, 0x43, 0x6c, 0x75, 0x73, 0x74, 0x65, 0x72, 0x53, + 0x65, 0x72, 0x76, 0x65, 0x72, 0x73, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x22, 0xf7, 0x01, + 0x0a, 0x1e, 0x52, 0x61, 0x66, 0x74, 0x4c, 0x69, 0x73, 0x74, 0x43, 0x6c, 0x75, 0x73, 0x74, 0x65, + 0x72, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x73, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, + 0x12, 0x61, 0x0a, 0x0f, 0x63, 0x6c, 0x75, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x73, 0x65, 0x72, 0x76, + 0x65, 0x72, 0x73, 0x18, 0x01, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x38, 0x2e, 0x6d, 0x61, 0x73, 0x74, + 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x52, 0x61, 0x66, 0x74, 0x4c, 0x69, 0x73, 0x74, 0x43, 0x6c, + 0x75, 0x73, 0x74, 0x65, 0x72, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x73, 0x52, 0x65, 0x73, 0x70, + 0x6f, 0x6e, 0x73, 0x65, 0x2e, 0x43, 0x6c, 0x75, 0x73, 0x74, 0x65, 0x72, 0x53, 0x65, 0x72, 0x76, + 0x65, 0x72, 0x73, 0x52, 0x0e, 0x63, 0x6c, 0x75, 0x73, 0x74, 0x65, 0x72, 0x53, 0x65, 0x72, 0x76, + 0x65, 0x72, 0x73, 0x1a, 0x72, 0x0a, 0x0e, 0x43, 0x6c, 0x75, 0x73, 0x74, 0x65, 0x72, 0x53, 0x65, + 0x72, 0x76, 0x65, 0x72, 0x73, 0x12, 0x0e, 0x0a, 0x02, 0x69, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x02, 0x69, 0x64, 0x12, 0x18, 0x0a, 0x07, 0x61, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x18, 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x07, 0x61, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x12, - 0x14, 0x0a, 0x05, 0x76, 0x6f, 0x74, 0x65, 0x72, 0x18, 0x03, 0x20, 0x01, 0x28, 0x08, 0x52, 0x05, - 0x76, 0x6f, 0x74, 0x65, 0x72, 0x22, 0x17, 0x0a, 0x15, 0x52, 0x61, 0x66, 0x74, 0x41, 0x64, 0x64, - 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x3f, - 0x0a, 0x17, 0x52, 0x61, 0x66, 0x74, 0x52, 0x65, 0x6d, 0x6f, 0x76, 0x65, 0x53, 0x65, 0x72, 0x76, - 0x65, 0x72, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x12, 0x0e, 0x0a, 0x02, 0x69, 0x64, 0x18, - 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x02, 0x69, 0x64, 0x12, 0x14, 0x0a, 0x05, 0x66, 0x6f, 0x72, - 0x63, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x08, 0x52, 0x05, 0x66, 0x6f, 0x72, 0x63, 0x65, 0x22, - 0x1a, 0x0a, 0x18, 0x52, 0x61, 0x66, 0x74, 0x52, 0x65, 0x6d, 0x6f, 0x76, 0x65, 0x53, 0x65, 0x72, - 0x76, 0x65, 0x72, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x1f, 0x0a, 0x1d, 0x52, - 0x61, 0x66, 0x74, 0x4c, 0x69, 0x73, 0x74, 0x43, 0x6c, 0x75, 0x73, 0x74, 0x65, 0x72, 0x53, 0x65, - 0x72, 0x76, 0x65, 0x72, 0x73, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x22, 0xf7, 0x01, 0x0a, - 0x1e, 0x52, 0x61, 0x66, 0x74, 0x4c, 0x69, 0x73, 0x74, 0x43, 0x6c, 0x75, 0x73, 0x74, 0x65, 0x72, - 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x73, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x12, - 0x61, 0x0a, 0x0f, 0x63, 0x6c, 0x75, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, - 0x72, 0x73, 0x18, 0x01, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x38, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, - 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x52, 0x61, 0x66, 0x74, 0x4c, 0x69, 0x73, 0x74, 0x43, 0x6c, 0x75, - 0x73, 0x74, 0x65, 0x72, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x73, 0x52, 0x65, 0x73, 0x70, 0x6f, - 0x6e, 0x73, 0x65, 0x2e, 0x43, 0x6c, 0x75, 0x73, 0x74, 0x65, 0x72, 0x53, 0x65, 0x72, 0x76, 0x65, - 0x72, 0x73, 0x52, 0x0e, 0x63, 0x6c, 0x75, 0x73, 0x74, 0x65, 0x72, 0x53, 0x65, 0x72, 0x76, 0x65, - 0x72, 0x73, 0x1a, 0x72, 0x0a, 0x0e, 0x43, 0x6c, 0x75, 0x73, 0x74, 0x65, 0x72, 0x53, 0x65, 0x72, - 0x76, 0x65, 0x72, 0x73, 0x12, 0x0e, 0x0a, 0x02, 0x69, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, - 0x52, 0x02, 0x69, 0x64, 0x12, 0x18, 0x0a, 0x07, 0x61, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x18, - 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x07, 0x61, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x12, 0x1a, - 0x0a, 0x08, 0x73, 0x75, 0x66, 0x66, 0x72, 0x61, 0x67, 0x65, 0x18, 0x03, 0x20, 0x01, 0x28, 0x09, - 0x52, 0x08, 0x73, 0x75, 0x66, 0x66, 0x72, 0x61, 0x67, 0x65, 0x12, 0x1a, 0x0a, 0x08, 0x69, 0x73, - 0x4c, 0x65, 0x61, 0x64, 0x65, 0x72, 0x18, 0x04, 0x20, 0x01, 0x28, 0x08, 0x52, 0x08, 0x69, 0x73, - 0x4c, 0x65, 0x61, 0x64, 0x65, 0x72, 0x22, 0x14, 0x0a, 0x12, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, - 0x47, 0x72, 0x6f, 0x77, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x32, 0xd5, 0x0f, 0x0a, - 0x07, 0x53, 0x65, 0x61, 0x77, 0x65, 0x65, 0x64, 0x12, 0x49, 0x0a, 0x0d, 0x53, 0x65, 0x6e, 0x64, - 0x48, 0x65, 0x61, 0x72, 0x74, 0x62, 0x65, 0x61, 0x74, 0x12, 0x14, 0x2e, 0x6d, 0x61, 0x73, 0x74, - 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x48, 0x65, 0x61, 0x72, 0x74, 0x62, 0x65, 0x61, 0x74, 0x1a, - 0x1c, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x48, 0x65, 0x61, 0x72, - 0x74, 0x62, 0x65, 0x61, 0x74, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x28, - 0x01, 0x30, 0x01, 0x12, 0x58, 0x0a, 0x0d, 0x4b, 0x65, 0x65, 0x70, 0x43, 0x6f, 0x6e, 0x6e, 0x65, - 0x63, 0x74, 0x65, 0x64, 0x12, 0x1f, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, - 0x2e, 0x4b, 0x65, 0x65, 0x70, 0x43, 0x6f, 0x6e, 0x6e, 0x65, 0x63, 0x74, 0x65, 0x64, 0x52, 0x65, - 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x20, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, + 0x1a, 0x0a, 0x08, 0x73, 0x75, 0x66, 0x66, 0x72, 0x61, 0x67, 0x65, 0x18, 0x03, 0x20, 0x01, 0x28, + 0x09, 0x52, 0x08, 0x73, 0x75, 0x66, 0x66, 0x72, 0x61, 0x67, 0x65, 0x12, 0x1a, 0x0a, 0x08, 0x69, + 0x73, 0x4c, 0x65, 0x61, 0x64, 0x65, 0x72, 0x18, 0x04, 0x20, 0x01, 0x28, 0x08, 0x52, 0x08, 0x69, + 0x73, 0x4c, 0x65, 0x61, 0x64, 0x65, 0x72, 0x22, 0x14, 0x0a, 0x12, 0x56, 0x6f, 0x6c, 0x75, 0x6d, + 0x65, 0x47, 0x72, 0x6f, 0x77, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x32, 0xd5, 0x0f, + 0x0a, 0x07, 0x53, 0x65, 0x61, 0x77, 0x65, 0x65, 0x64, 0x12, 0x49, 0x0a, 0x0d, 0x53, 0x65, 0x6e, + 0x64, 0x48, 0x65, 0x61, 0x72, 0x74, 0x62, 0x65, 0x61, 0x74, 0x12, 0x14, 0x2e, 0x6d, 0x61, 0x73, + 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x48, 0x65, 0x61, 0x72, 0x74, 0x62, 0x65, 0x61, 0x74, + 0x1a, 0x1c, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x48, 0x65, 0x61, + 0x72, 0x74, 0x62, 0x65, 0x61, 0x74, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, + 0x28, 0x01, 0x30, 0x01, 0x12, 0x58, 0x0a, 0x0d, 0x4b, 0x65, 0x65, 0x70, 0x43, 0x6f, 0x6e, 0x6e, + 0x65, 0x63, 0x74, 0x65, 0x64, 0x12, 0x1f, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x4b, 0x65, 0x65, 0x70, 0x43, 0x6f, 0x6e, 0x6e, 0x65, 0x63, 0x74, 0x65, 0x64, 0x52, - 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x28, 0x01, 0x30, 0x01, 0x12, 0x51, 0x0a, - 0x0c, 0x4c, 0x6f, 0x6f, 0x6b, 0x75, 0x70, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x12, 0x1e, 0x2e, - 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x4c, 0x6f, 0x6f, 0x6b, 0x75, 0x70, - 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x1f, 0x2e, - 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x4c, 0x6f, 0x6f, 0x6b, 0x75, 0x70, - 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, - 0x12, 0x3f, 0x0a, 0x06, 0x41, 0x73, 0x73, 0x69, 0x67, 0x6e, 0x12, 0x18, 0x2e, 0x6d, 0x61, 0x73, - 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x41, 0x73, 0x73, 0x69, 0x67, 0x6e, 0x52, 0x65, 0x71, - 0x75, 0x65, 0x73, 0x74, 0x1a, 0x19, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, - 0x2e, 0x41, 0x73, 0x73, 0x69, 0x67, 0x6e, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, - 0x00, 0x12, 0x49, 0x0a, 0x0c, 0x53, 0x74, 0x72, 0x65, 0x61, 0x6d, 0x41, 0x73, 0x73, 0x69, 0x67, - 0x6e, 0x12, 0x18, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x41, 0x73, - 0x73, 0x69, 0x67, 0x6e, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x19, 0x2e, 0x6d, 0x61, + 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x20, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, + 0x70, 0x62, 0x2e, 0x4b, 0x65, 0x65, 0x70, 0x43, 0x6f, 0x6e, 0x6e, 0x65, 0x63, 0x74, 0x65, 0x64, + 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x28, 0x01, 0x30, 0x01, 0x12, 0x51, + 0x0a, 0x0c, 0x4c, 0x6f, 0x6f, 0x6b, 0x75, 0x70, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x12, 0x1e, + 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x4c, 0x6f, 0x6f, 0x6b, 0x75, + 0x70, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x1f, + 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x4c, 0x6f, 0x6f, 0x6b, 0x75, + 0x70, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, + 0x00, 0x12, 0x3f, 0x0a, 0x06, 0x41, 0x73, 0x73, 0x69, 0x67, 0x6e, 0x12, 0x18, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x41, 0x73, 0x73, 0x69, 0x67, 0x6e, 0x52, 0x65, - 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x28, 0x01, 0x30, 0x01, 0x12, 0x4b, 0x0a, 0x0a, - 0x53, 0x74, 0x61, 0x74, 0x69, 0x73, 0x74, 0x69, 0x63, 0x73, 0x12, 0x1c, 0x2e, 0x6d, 0x61, 0x73, - 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x53, 0x74, 0x61, 0x74, 0x69, 0x73, 0x74, 0x69, 0x63, - 0x73, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x1d, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, - 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x53, 0x74, 0x61, 0x74, 0x69, 0x73, 0x74, 0x69, 0x63, 0x73, 0x52, - 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x57, 0x0a, 0x0e, 0x43, 0x6f, 0x6c, - 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x4c, 0x69, 0x73, 0x74, 0x12, 0x20, 0x2e, 0x6d, 0x61, + 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x19, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, + 0x62, 0x2e, 0x41, 0x73, 0x73, 0x69, 0x67, 0x6e, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, + 0x22, 0x00, 0x12, 0x49, 0x0a, 0x0c, 0x53, 0x74, 0x72, 0x65, 0x61, 0x6d, 0x41, 0x73, 0x73, 0x69, + 0x67, 0x6e, 0x12, 0x18, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x41, + 0x73, 0x73, 0x69, 0x67, 0x6e, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x19, 0x2e, 0x6d, + 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x41, 0x73, 0x73, 0x69, 0x67, 0x6e, 0x52, + 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x28, 0x01, 0x30, 0x01, 0x12, 0x4b, 0x0a, + 0x0a, 0x53, 0x74, 0x61, 0x74, 0x69, 0x73, 0x74, 0x69, 0x63, 0x73, 0x12, 0x1c, 0x2e, 0x6d, 0x61, + 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x53, 0x74, 0x61, 0x74, 0x69, 0x73, 0x74, 0x69, + 0x63, 0x73, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x1d, 0x2e, 0x6d, 0x61, 0x73, 0x74, + 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x53, 0x74, 0x61, 0x74, 0x69, 0x73, 0x74, 0x69, 0x63, 0x73, + 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x57, 0x0a, 0x0e, 0x43, 0x6f, + 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x4c, 0x69, 0x73, 0x74, 0x12, 0x20, 0x2e, 0x6d, + 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x43, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, + 0x69, 0x6f, 0x6e, 0x4c, 0x69, 0x73, 0x74, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x21, + 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x43, 0x6f, 0x6c, 0x6c, 0x65, + 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x4c, 0x69, 0x73, 0x74, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, + 0x65, 0x22, 0x00, 0x12, 0x5d, 0x0a, 0x10, 0x43, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, + 0x6e, 0x44, 0x65, 0x6c, 0x65, 0x74, 0x65, 0x12, 0x22, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, + 0x5f, 0x70, 0x62, 0x2e, 0x43, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x44, 0x65, + 0x6c, 0x65, 0x74, 0x65, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x23, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x43, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, - 0x6f, 0x6e, 0x4c, 0x69, 0x73, 0x74, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x21, 0x2e, - 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x43, 0x6f, 0x6c, 0x6c, 0x65, 0x63, - 0x74, 0x69, 0x6f, 0x6e, 0x4c, 0x69, 0x73, 0x74, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, - 0x22, 0x00, 0x12, 0x5d, 0x0a, 0x10, 0x43, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, - 0x44, 0x65, 0x6c, 0x65, 0x74, 0x65, 0x12, 0x22, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, - 0x70, 0x62, 0x2e, 0x43, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x44, 0x65, 0x6c, - 0x65, 0x74, 0x65, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x23, 0x2e, 0x6d, 0x61, 0x73, - 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x43, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, - 0x6e, 0x44, 0x65, 0x6c, 0x65, 0x74, 0x65, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, - 0x00, 0x12, 0x4b, 0x0a, 0x0a, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x4c, 0x69, 0x73, 0x74, 0x12, - 0x1c, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, - 0x6d, 0x65, 0x4c, 0x69, 0x73, 0x74, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x1d, 0x2e, - 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, - 0x4c, 0x69, 0x73, 0x74, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x57, - 0x0a, 0x0e, 0x4c, 0x6f, 0x6f, 0x6b, 0x75, 0x70, 0x45, 0x63, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, - 0x12, 0x20, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x4c, 0x6f, 0x6f, - 0x6b, 0x75, 0x70, 0x45, 0x63, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x52, 0x65, 0x71, 0x75, 0x65, - 0x73, 0x74, 0x1a, 0x21, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x4c, - 0x6f, 0x6f, 0x6b, 0x75, 0x70, 0x45, 0x63, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x52, 0x65, 0x73, - 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x51, 0x0a, 0x0c, 0x56, 0x61, 0x63, 0x75, 0x75, - 0x6d, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x12, 0x1e, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, - 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x61, 0x63, 0x75, 0x75, 0x6d, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, - 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x1f, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, - 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x61, 0x63, 0x75, 0x75, 0x6d, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, - 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x54, 0x0a, 0x0d, 0x44, 0x69, - 0x73, 0x61, 0x62, 0x6c, 0x65, 0x56, 0x61, 0x63, 0x75, 0x75, 0x6d, 0x12, 0x1f, 0x2e, 0x6d, 0x61, - 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x44, 0x69, 0x73, 0x61, 0x62, 0x6c, 0x65, 0x56, - 0x61, 0x63, 0x75, 0x75, 0x6d, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x20, 0x2e, 0x6d, + 0x6f, 0x6e, 0x44, 0x65, 0x6c, 0x65, 0x74, 0x65, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, + 0x22, 0x00, 0x12, 0x4b, 0x0a, 0x0a, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x4c, 0x69, 0x73, 0x74, + 0x12, 0x1c, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, + 0x75, 0x6d, 0x65, 0x4c, 0x69, 0x73, 0x74, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x1d, + 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, + 0x65, 0x4c, 0x69, 0x73, 0x74, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, + 0x57, 0x0a, 0x0e, 0x4c, 0x6f, 0x6f, 0x6b, 0x75, 0x70, 0x45, 0x63, 0x56, 0x6f, 0x6c, 0x75, 0x6d, + 0x65, 0x12, 0x20, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x4c, 0x6f, + 0x6f, 0x6b, 0x75, 0x70, 0x45, 0x63, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x52, 0x65, 0x71, 0x75, + 0x65, 0x73, 0x74, 0x1a, 0x21, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, + 0x4c, 0x6f, 0x6f, 0x6b, 0x75, 0x70, 0x45, 0x63, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x52, 0x65, + 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x51, 0x0a, 0x0c, 0x56, 0x61, 0x63, 0x75, + 0x75, 0x6d, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x12, 0x1e, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, + 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x61, 0x63, 0x75, 0x75, 0x6d, 0x56, 0x6f, 0x6c, 0x75, 0x6d, + 0x65, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x1f, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, + 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x61, 0x63, 0x75, 0x75, 0x6d, 0x56, 0x6f, 0x6c, 0x75, 0x6d, + 0x65, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x54, 0x0a, 0x0d, 0x44, + 0x69, 0x73, 0x61, 0x62, 0x6c, 0x65, 0x56, 0x61, 0x63, 0x75, 0x75, 0x6d, 0x12, 0x1f, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x44, 0x69, 0x73, 0x61, 0x62, 0x6c, 0x65, - 0x56, 0x61, 0x63, 0x75, 0x75, 0x6d, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, - 0x12, 0x51, 0x0a, 0x0c, 0x45, 0x6e, 0x61, 0x62, 0x6c, 0x65, 0x56, 0x61, 0x63, 0x75, 0x75, 0x6d, - 0x12, 0x1e, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x45, 0x6e, 0x61, - 0x62, 0x6c, 0x65, 0x56, 0x61, 0x63, 0x75, 0x75, 0x6d, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, - 0x1a, 0x1f, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x45, 0x6e, 0x61, - 0x62, 0x6c, 0x65, 0x56, 0x61, 0x63, 0x75, 0x75, 0x6d, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, - 0x65, 0x22, 0x00, 0x12, 0x63, 0x0a, 0x12, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x4d, 0x61, 0x72, - 0x6b, 0x52, 0x65, 0x61, 0x64, 0x6f, 0x6e, 0x6c, 0x79, 0x12, 0x24, 0x2e, 0x6d, 0x61, 0x73, 0x74, - 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x4d, 0x61, 0x72, 0x6b, - 0x52, 0x65, 0x61, 0x64, 0x6f, 0x6e, 0x6c, 0x79, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, - 0x25, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, - 0x6d, 0x65, 0x4d, 0x61, 0x72, 0x6b, 0x52, 0x65, 0x61, 0x64, 0x6f, 0x6e, 0x6c, 0x79, 0x52, 0x65, - 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x6f, 0x0a, 0x16, 0x47, 0x65, 0x74, 0x4d, - 0x61, 0x73, 0x74, 0x65, 0x72, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x75, 0x72, 0x61, 0x74, 0x69, - 0x6f, 0x6e, 0x12, 0x28, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x47, - 0x65, 0x74, 0x4d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x75, 0x72, - 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x29, 0x2e, 0x6d, - 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x47, 0x65, 0x74, 0x4d, 0x61, 0x73, 0x74, - 0x65, 0x72, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x75, 0x72, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x52, - 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x5d, 0x0a, 0x10, 0x4c, 0x69, 0x73, - 0x74, 0x43, 0x6c, 0x75, 0x73, 0x74, 0x65, 0x72, 0x4e, 0x6f, 0x64, 0x65, 0x73, 0x12, 0x22, 0x2e, - 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x4c, 0x69, 0x73, 0x74, 0x43, 0x6c, - 0x75, 0x73, 0x74, 0x65, 0x72, 0x4e, 0x6f, 0x64, 0x65, 0x73, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, - 0x74, 0x1a, 0x23, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x4c, 0x69, - 0x73, 0x74, 0x43, 0x6c, 0x75, 0x73, 0x74, 0x65, 0x72, 0x4e, 0x6f, 0x64, 0x65, 0x73, 0x52, 0x65, - 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x5a, 0x0a, 0x0f, 0x4c, 0x65, 0x61, 0x73, - 0x65, 0x41, 0x64, 0x6d, 0x69, 0x6e, 0x54, 0x6f, 0x6b, 0x65, 0x6e, 0x12, 0x21, 0x2e, 0x6d, 0x61, - 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x4c, 0x65, 0x61, 0x73, 0x65, 0x41, 0x64, 0x6d, - 0x69, 0x6e, 0x54, 0x6f, 0x6b, 0x65, 0x6e, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x22, - 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x4c, 0x65, 0x61, 0x73, 0x65, - 0x41, 0x64, 0x6d, 0x69, 0x6e, 0x54, 0x6f, 0x6b, 0x65, 0x6e, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, - 0x73, 0x65, 0x22, 0x00, 0x12, 0x60, 0x0a, 0x11, 0x52, 0x65, 0x6c, 0x65, 0x61, 0x73, 0x65, 0x41, - 0x64, 0x6d, 0x69, 0x6e, 0x54, 0x6f, 0x6b, 0x65, 0x6e, 0x12, 0x23, 0x2e, 0x6d, 0x61, 0x73, 0x74, - 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x52, 0x65, 0x6c, 0x65, 0x61, 0x73, 0x65, 0x41, 0x64, 0x6d, - 0x69, 0x6e, 0x54, 0x6f, 0x6b, 0x65, 0x6e, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x24, - 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x52, 0x65, 0x6c, 0x65, 0x61, - 0x73, 0x65, 0x41, 0x64, 0x6d, 0x69, 0x6e, 0x54, 0x6f, 0x6b, 0x65, 0x6e, 0x52, 0x65, 0x73, 0x70, - 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x39, 0x0a, 0x04, 0x50, 0x69, 0x6e, 0x67, 0x12, 0x16, - 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x50, 0x69, 0x6e, 0x67, 0x52, - 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x17, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, - 0x70, 0x62, 0x2e, 0x50, 0x69, 0x6e, 0x67, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, - 0x00, 0x12, 0x6f, 0x0a, 0x16, 0x52, 0x61, 0x66, 0x74, 0x4c, 0x69, 0x73, 0x74, 0x43, 0x6c, 0x75, - 0x73, 0x74, 0x65, 0x72, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x73, 0x12, 0x28, 0x2e, 0x6d, 0x61, - 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x52, 0x61, 0x66, 0x74, 0x4c, 0x69, 0x73, 0x74, - 0x43, 0x6c, 0x75, 0x73, 0x74, 0x65, 0x72, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x73, 0x52, 0x65, - 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x29, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, - 0x62, 0x2e, 0x52, 0x61, 0x66, 0x74, 0x4c, 0x69, 0x73, 0x74, 0x43, 0x6c, 0x75, 0x73, 0x74, 0x65, - 0x72, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x73, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, - 0x22, 0x00, 0x12, 0x54, 0x0a, 0x0d, 0x52, 0x61, 0x66, 0x74, 0x41, 0x64, 0x64, 0x53, 0x65, 0x72, - 0x76, 0x65, 0x72, 0x12, 0x1f, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, - 0x52, 0x61, 0x66, 0x74, 0x41, 0x64, 0x64, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x52, 0x65, 0x71, - 0x75, 0x65, 0x73, 0x74, 0x1a, 0x20, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, + 0x56, 0x61, 0x63, 0x75, 0x75, 0x6d, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x20, 0x2e, + 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x44, 0x69, 0x73, 0x61, 0x62, 0x6c, + 0x65, 0x56, 0x61, 0x63, 0x75, 0x75, 0x6d, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, + 0x00, 0x12, 0x51, 0x0a, 0x0c, 0x45, 0x6e, 0x61, 0x62, 0x6c, 0x65, 0x56, 0x61, 0x63, 0x75, 0x75, + 0x6d, 0x12, 0x1e, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x45, 0x6e, + 0x61, 0x62, 0x6c, 0x65, 0x56, 0x61, 0x63, 0x75, 0x75, 0x6d, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, + 0x74, 0x1a, 0x1f, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x45, 0x6e, + 0x61, 0x62, 0x6c, 0x65, 0x56, 0x61, 0x63, 0x75, 0x75, 0x6d, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, + 0x73, 0x65, 0x22, 0x00, 0x12, 0x63, 0x0a, 0x12, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x4d, 0x61, + 0x72, 0x6b, 0x52, 0x65, 0x61, 0x64, 0x6f, 0x6e, 0x6c, 0x79, 0x12, 0x24, 0x2e, 0x6d, 0x61, 0x73, + 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x4d, 0x61, 0x72, + 0x6b, 0x52, 0x65, 0x61, 0x64, 0x6f, 0x6e, 0x6c, 0x79, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, + 0x1a, 0x25, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, + 0x75, 0x6d, 0x65, 0x4d, 0x61, 0x72, 0x6b, 0x52, 0x65, 0x61, 0x64, 0x6f, 0x6e, 0x6c, 0x79, 0x52, + 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x6f, 0x0a, 0x16, 0x47, 0x65, 0x74, + 0x4d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x75, 0x72, 0x61, 0x74, + 0x69, 0x6f, 0x6e, 0x12, 0x28, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, + 0x47, 0x65, 0x74, 0x4d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x75, + 0x72, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x29, 0x2e, + 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x47, 0x65, 0x74, 0x4d, 0x61, 0x73, + 0x74, 0x65, 0x72, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x75, 0x72, 0x61, 0x74, 0x69, 0x6f, 0x6e, + 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x5d, 0x0a, 0x10, 0x4c, 0x69, + 0x73, 0x74, 0x43, 0x6c, 0x75, 0x73, 0x74, 0x65, 0x72, 0x4e, 0x6f, 0x64, 0x65, 0x73, 0x12, 0x22, + 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x4c, 0x69, 0x73, 0x74, 0x43, + 0x6c, 0x75, 0x73, 0x74, 0x65, 0x72, 0x4e, 0x6f, 0x64, 0x65, 0x73, 0x52, 0x65, 0x71, 0x75, 0x65, + 0x73, 0x74, 0x1a, 0x23, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x4c, + 0x69, 0x73, 0x74, 0x43, 0x6c, 0x75, 0x73, 0x74, 0x65, 0x72, 0x4e, 0x6f, 0x64, 0x65, 0x73, 0x52, + 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x5a, 0x0a, 0x0f, 0x4c, 0x65, 0x61, + 0x73, 0x65, 0x41, 0x64, 0x6d, 0x69, 0x6e, 0x54, 0x6f, 0x6b, 0x65, 0x6e, 0x12, 0x21, 0x2e, 0x6d, + 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x4c, 0x65, 0x61, 0x73, 0x65, 0x41, 0x64, + 0x6d, 0x69, 0x6e, 0x54, 0x6f, 0x6b, 0x65, 0x6e, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, + 0x22, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x4c, 0x65, 0x61, 0x73, + 0x65, 0x41, 0x64, 0x6d, 0x69, 0x6e, 0x54, 0x6f, 0x6b, 0x65, 0x6e, 0x52, 0x65, 0x73, 0x70, 0x6f, + 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x60, 0x0a, 0x11, 0x52, 0x65, 0x6c, 0x65, 0x61, 0x73, 0x65, + 0x41, 0x64, 0x6d, 0x69, 0x6e, 0x54, 0x6f, 0x6b, 0x65, 0x6e, 0x12, 0x23, 0x2e, 0x6d, 0x61, 0x73, + 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x52, 0x65, 0x6c, 0x65, 0x61, 0x73, 0x65, 0x41, 0x64, + 0x6d, 0x69, 0x6e, 0x54, 0x6f, 0x6b, 0x65, 0x6e, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, + 0x24, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x52, 0x65, 0x6c, 0x65, + 0x61, 0x73, 0x65, 0x41, 0x64, 0x6d, 0x69, 0x6e, 0x54, 0x6f, 0x6b, 0x65, 0x6e, 0x52, 0x65, 0x73, + 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x39, 0x0a, 0x04, 0x50, 0x69, 0x6e, 0x67, 0x12, + 0x16, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x50, 0x69, 0x6e, 0x67, + 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x17, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, + 0x5f, 0x70, 0x62, 0x2e, 0x50, 0x69, 0x6e, 0x67, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, + 0x22, 0x00, 0x12, 0x6f, 0x0a, 0x16, 0x52, 0x61, 0x66, 0x74, 0x4c, 0x69, 0x73, 0x74, 0x43, 0x6c, + 0x75, 0x73, 0x74, 0x65, 0x72, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x73, 0x12, 0x28, 0x2e, 0x6d, + 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x52, 0x61, 0x66, 0x74, 0x4c, 0x69, 0x73, + 0x74, 0x43, 0x6c, 0x75, 0x73, 0x74, 0x65, 0x72, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x73, 0x52, + 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x29, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, + 0x70, 0x62, 0x2e, 0x52, 0x61, 0x66, 0x74, 0x4c, 0x69, 0x73, 0x74, 0x43, 0x6c, 0x75, 0x73, 0x74, + 0x65, 0x72, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x73, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, + 0x65, 0x22, 0x00, 0x12, 0x54, 0x0a, 0x0d, 0x52, 0x61, 0x66, 0x74, 0x41, 0x64, 0x64, 0x53, 0x65, + 0x72, 0x76, 0x65, 0x72, 0x12, 0x1f, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x52, 0x61, 0x66, 0x74, 0x41, 0x64, 0x64, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x52, 0x65, - 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x5d, 0x0a, 0x10, 0x52, 0x61, 0x66, 0x74, - 0x52, 0x65, 0x6d, 0x6f, 0x76, 0x65, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x12, 0x22, 0x2e, 0x6d, - 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x52, 0x61, 0x66, 0x74, 0x52, 0x65, 0x6d, - 0x6f, 0x76, 0x65, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, - 0x1a, 0x23, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x52, 0x61, 0x66, - 0x74, 0x52, 0x65, 0x6d, 0x6f, 0x76, 0x65, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x52, 0x65, 0x73, - 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x4b, 0x0a, 0x0a, 0x56, 0x6f, 0x6c, 0x75, 0x6d, - 0x65, 0x47, 0x72, 0x6f, 0x77, 0x12, 0x1c, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, - 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x47, 0x72, 0x6f, 0x77, 0x52, 0x65, 0x71, 0x75, - 0x65, 0x73, 0x74, 0x1a, 0x1d, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, - 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x47, 0x72, 0x6f, 0x77, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, - 0x73, 0x65, 0x22, 0x00, 0x42, 0x32, 0x5a, 0x30, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, - 0x6f, 0x6d, 0x2f, 0x73, 0x65, 0x61, 0x77, 0x65, 0x65, 0x64, 0x66, 0x73, 0x2f, 0x73, 0x65, 0x61, - 0x77, 0x65, 0x65, 0x64, 0x66, 0x73, 0x2f, 0x77, 0x65, 0x65, 0x64, 0x2f, 0x70, 0x62, 0x2f, 0x6d, - 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33, + 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x20, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, + 0x62, 0x2e, 0x52, 0x61, 0x66, 0x74, 0x41, 0x64, 0x64, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x52, + 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x5d, 0x0a, 0x10, 0x52, 0x61, 0x66, + 0x74, 0x52, 0x65, 0x6d, 0x6f, 0x76, 0x65, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x12, 0x22, 0x2e, + 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x52, 0x61, 0x66, 0x74, 0x52, 0x65, + 0x6d, 0x6f, 0x76, 0x65, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, + 0x74, 0x1a, 0x23, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x52, 0x61, + 0x66, 0x74, 0x52, 0x65, 0x6d, 0x6f, 0x76, 0x65, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x52, 0x65, + 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x4b, 0x0a, 0x0a, 0x56, 0x6f, 0x6c, 0x75, + 0x6d, 0x65, 0x47, 0x72, 0x6f, 0x77, 0x12, 0x1c, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, + 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x47, 0x72, 0x6f, 0x77, 0x52, 0x65, 0x71, + 0x75, 0x65, 0x73, 0x74, 0x1a, 0x1d, 0x2e, 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, + 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x47, 0x72, 0x6f, 0x77, 0x52, 0x65, 0x73, 0x70, 0x6f, + 0x6e, 0x73, 0x65, 0x22, 0x00, 0x42, 0x32, 0x5a, 0x30, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, + 0x63, 0x6f, 0x6d, 0x2f, 0x73, 0x65, 0x61, 0x77, 0x65, 0x65, 0x64, 0x66, 0x73, 0x2f, 0x73, 0x65, + 0x61, 0x77, 0x65, 0x65, 0x64, 0x66, 0x73, 0x2f, 0x77, 0x65, 0x65, 0x64, 0x2f, 0x70, 0x62, 0x2f, + 0x6d, 0x61, 0x73, 0x74, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, + 0x33, } var ( @@ -4926,7 +4927,7 @@ func file_master_proto_rawDescGZIP() []byte { } var file_master_proto_msgTypes = make([]protoimpl.MessageInfo, 70) -var file_master_proto_goTypes = []interface{}{ +var file_master_proto_goTypes = []any{ (*Heartbeat)(nil), // 0: master_pb.Heartbeat (*HeartbeatResponse)(nil), // 1: master_pb.HeartbeatResponse (*VolumeInformationMessage)(nil), // 2: master_pb.VolumeInformationMessage @@ -5094,7 +5095,7 @@ func file_master_proto_init() { return } if !protoimpl.UnsafeEnabled { - file_master_proto_msgTypes[0].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[0].Exporter = func(v any, i int) any { switch v := v.(*Heartbeat); i { case 0: return &v.state @@ -5106,7 +5107,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[1].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[1].Exporter = func(v any, i int) any { switch v := v.(*HeartbeatResponse); i { case 0: return &v.state @@ -5118,7 +5119,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[2].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[2].Exporter = func(v any, i int) any { switch v := v.(*VolumeInformationMessage); i { case 0: return &v.state @@ -5130,7 +5131,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[3].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[3].Exporter = func(v any, i int) any { switch v := v.(*VolumeShortInformationMessage); i { case 0: return &v.state @@ -5142,7 +5143,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[4].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[4].Exporter = func(v any, i int) any { switch v := v.(*VolumeEcShardInformationMessage); i { case 0: return &v.state @@ -5154,7 +5155,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[5].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[5].Exporter = func(v any, i int) any { switch v := v.(*StorageBackend); i { case 0: return &v.state @@ -5166,7 +5167,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[6].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[6].Exporter = func(v any, i int) any { switch v := v.(*Empty); i { case 0: return &v.state @@ -5178,7 +5179,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[7].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[7].Exporter = func(v any, i int) any { switch v := v.(*SuperBlockExtra); i { case 0: return &v.state @@ -5190,7 +5191,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[8].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[8].Exporter = func(v any, i int) any { switch v := v.(*KeepConnectedRequest); i { case 0: return &v.state @@ -5202,7 +5203,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[9].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[9].Exporter = func(v any, i int) any { switch v := v.(*VolumeLocation); i { case 0: return &v.state @@ -5214,7 +5215,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[10].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[10].Exporter = func(v any, i int) any { switch v := v.(*ClusterNodeUpdate); i { case 0: return &v.state @@ -5226,7 +5227,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[11].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[11].Exporter = func(v any, i int) any { switch v := v.(*KeepConnectedResponse); i { case 0: return &v.state @@ -5238,7 +5239,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[12].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[12].Exporter = func(v any, i int) any { switch v := v.(*LookupVolumeRequest); i { case 0: return &v.state @@ -5250,7 +5251,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[13].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[13].Exporter = func(v any, i int) any { switch v := v.(*LookupVolumeResponse); i { case 0: return &v.state @@ -5262,7 +5263,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[14].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[14].Exporter = func(v any, i int) any { switch v := v.(*Location); i { case 0: return &v.state @@ -5274,7 +5275,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[15].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[15].Exporter = func(v any, i int) any { switch v := v.(*AssignRequest); i { case 0: return &v.state @@ -5286,7 +5287,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[16].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[16].Exporter = func(v any, i int) any { switch v := v.(*VolumeGrowRequest); i { case 0: return &v.state @@ -5298,7 +5299,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[17].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[17].Exporter = func(v any, i int) any { switch v := v.(*AssignResponse); i { case 0: return &v.state @@ -5310,7 +5311,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[18].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[18].Exporter = func(v any, i int) any { switch v := v.(*StatisticsRequest); i { case 0: return &v.state @@ -5322,7 +5323,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[19].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[19].Exporter = func(v any, i int) any { switch v := v.(*StatisticsResponse); i { case 0: return &v.state @@ -5334,7 +5335,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[20].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[20].Exporter = func(v any, i int) any { switch v := v.(*Collection); i { case 0: return &v.state @@ -5346,7 +5347,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[21].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[21].Exporter = func(v any, i int) any { switch v := v.(*CollectionListRequest); i { case 0: return &v.state @@ -5358,7 +5359,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[22].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[22].Exporter = func(v any, i int) any { switch v := v.(*CollectionListResponse); i { case 0: return &v.state @@ -5370,7 +5371,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[23].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[23].Exporter = func(v any, i int) any { switch v := v.(*CollectionDeleteRequest); i { case 0: return &v.state @@ -5382,7 +5383,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[24].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[24].Exporter = func(v any, i int) any { switch v := v.(*CollectionDeleteResponse); i { case 0: return &v.state @@ -5394,7 +5395,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[25].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[25].Exporter = func(v any, i int) any { switch v := v.(*DiskInfo); i { case 0: return &v.state @@ -5406,7 +5407,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[26].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[26].Exporter = func(v any, i int) any { switch v := v.(*DataNodeInfo); i { case 0: return &v.state @@ -5418,7 +5419,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[27].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[27].Exporter = func(v any, i int) any { switch v := v.(*RackInfo); i { case 0: return &v.state @@ -5430,7 +5431,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[28].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[28].Exporter = func(v any, i int) any { switch v := v.(*DataCenterInfo); i { case 0: return &v.state @@ -5442,7 +5443,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[29].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[29].Exporter = func(v any, i int) any { switch v := v.(*TopologyInfo); i { case 0: return &v.state @@ -5454,7 +5455,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[30].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[30].Exporter = func(v any, i int) any { switch v := v.(*VolumeListRequest); i { case 0: return &v.state @@ -5466,7 +5467,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[31].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[31].Exporter = func(v any, i int) any { switch v := v.(*VolumeListResponse); i { case 0: return &v.state @@ -5478,7 +5479,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[32].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[32].Exporter = func(v any, i int) any { switch v := v.(*LookupEcVolumeRequest); i { case 0: return &v.state @@ -5490,7 +5491,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[33].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[33].Exporter = func(v any, i int) any { switch v := v.(*LookupEcVolumeResponse); i { case 0: return &v.state @@ -5502,7 +5503,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[34].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[34].Exporter = func(v any, i int) any { switch v := v.(*VacuumVolumeRequest); i { case 0: return &v.state @@ -5514,7 +5515,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[35].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[35].Exporter = func(v any, i int) any { switch v := v.(*VacuumVolumeResponse); i { case 0: return &v.state @@ -5526,7 +5527,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[36].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[36].Exporter = func(v any, i int) any { switch v := v.(*DisableVacuumRequest); i { case 0: return &v.state @@ -5538,7 +5539,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[37].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[37].Exporter = func(v any, i int) any { switch v := v.(*DisableVacuumResponse); i { case 0: return &v.state @@ -5550,7 +5551,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[38].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[38].Exporter = func(v any, i int) any { switch v := v.(*EnableVacuumRequest); i { case 0: return &v.state @@ -5562,7 +5563,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[39].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[39].Exporter = func(v any, i int) any { switch v := v.(*EnableVacuumResponse); i { case 0: return &v.state @@ -5574,7 +5575,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[40].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[40].Exporter = func(v any, i int) any { switch v := v.(*VolumeMarkReadonlyRequest); i { case 0: return &v.state @@ -5586,7 +5587,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[41].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[41].Exporter = func(v any, i int) any { switch v := v.(*VolumeMarkReadonlyResponse); i { case 0: return &v.state @@ -5598,7 +5599,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[42].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[42].Exporter = func(v any, i int) any { switch v := v.(*GetMasterConfigurationRequest); i { case 0: return &v.state @@ -5610,7 +5611,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[43].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[43].Exporter = func(v any, i int) any { switch v := v.(*GetMasterConfigurationResponse); i { case 0: return &v.state @@ -5622,7 +5623,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[44].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[44].Exporter = func(v any, i int) any { switch v := v.(*ListClusterNodesRequest); i { case 0: return &v.state @@ -5634,7 +5635,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[45].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[45].Exporter = func(v any, i int) any { switch v := v.(*ListClusterNodesResponse); i { case 0: return &v.state @@ -5646,7 +5647,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[46].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[46].Exporter = func(v any, i int) any { switch v := v.(*LeaseAdminTokenRequest); i { case 0: return &v.state @@ -5658,7 +5659,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[47].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[47].Exporter = func(v any, i int) any { switch v := v.(*LeaseAdminTokenResponse); i { case 0: return &v.state @@ -5670,7 +5671,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[48].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[48].Exporter = func(v any, i int) any { switch v := v.(*ReleaseAdminTokenRequest); i { case 0: return &v.state @@ -5682,7 +5683,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[49].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[49].Exporter = func(v any, i int) any { switch v := v.(*ReleaseAdminTokenResponse); i { case 0: return &v.state @@ -5694,7 +5695,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[50].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[50].Exporter = func(v any, i int) any { switch v := v.(*PingRequest); i { case 0: return &v.state @@ -5706,7 +5707,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[51].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[51].Exporter = func(v any, i int) any { switch v := v.(*PingResponse); i { case 0: return &v.state @@ -5718,7 +5719,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[52].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[52].Exporter = func(v any, i int) any { switch v := v.(*RaftAddServerRequest); i { case 0: return &v.state @@ -5730,7 +5731,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[53].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[53].Exporter = func(v any, i int) any { switch v := v.(*RaftAddServerResponse); i { case 0: return &v.state @@ -5742,7 +5743,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[54].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[54].Exporter = func(v any, i int) any { switch v := v.(*RaftRemoveServerRequest); i { case 0: return &v.state @@ -5754,7 +5755,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[55].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[55].Exporter = func(v any, i int) any { switch v := v.(*RaftRemoveServerResponse); i { case 0: return &v.state @@ -5766,7 +5767,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[56].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[56].Exporter = func(v any, i int) any { switch v := v.(*RaftListClusterServersRequest); i { case 0: return &v.state @@ -5778,7 +5779,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[57].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[57].Exporter = func(v any, i int) any { switch v := v.(*RaftListClusterServersResponse); i { case 0: return &v.state @@ -5790,7 +5791,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[58].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[58].Exporter = func(v any, i int) any { switch v := v.(*VolumeGrowResponse); i { case 0: return &v.state @@ -5802,7 +5803,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[61].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[61].Exporter = func(v any, i int) any { switch v := v.(*SuperBlockExtra_ErasureCoding); i { case 0: return &v.state @@ -5814,7 +5815,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[62].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[62].Exporter = func(v any, i int) any { switch v := v.(*LookupVolumeResponse_VolumeIdLocation); i { case 0: return &v.state @@ -5826,7 +5827,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[67].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[67].Exporter = func(v any, i int) any { switch v := v.(*LookupEcVolumeResponse_EcShardIdLocation); i { case 0: return &v.state @@ -5838,7 +5839,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[68].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[68].Exporter = func(v any, i int) any { switch v := v.(*ListClusterNodesResponse_ClusterNode); i { case 0: return &v.state @@ -5850,7 +5851,7 @@ func file_master_proto_init() { return nil } } - file_master_proto_msgTypes[69].Exporter = func(v interface{}, i int) interface{} { + file_master_proto_msgTypes[69].Exporter = func(v any, i int) any { switch v := v.(*RaftListClusterServersResponse_ClusterServers); i { case 0: return &v.state diff --git a/weed/pb/master_pb/master_grpc.pb.go b/weed/pb/master_pb/master_grpc.pb.go index 44fd76a3d..f49429950 100644 --- a/weed/pb/master_pb/master_grpc.pb.go +++ b/weed/pb/master_pb/master_grpc.pb.go @@ -1,7 +1,7 @@ // Code generated by protoc-gen-go-grpc. DO NOT EDIT. // versions: -// - protoc-gen-go-grpc v1.3.0 -// - protoc v4.25.3 +// - protoc-gen-go-grpc v1.5.1 +// - protoc v5.28.1 // source: master.proto package master_pb @@ -15,8 +15,8 @@ import ( // This is a compile-time assertion to ensure that this generated file // is compatible with the grpc package it is being compiled against. -// Requires gRPC-Go v1.32.0 or later. -const _ = grpc.SupportPackageIsVersion7 +// Requires gRPC-Go v1.64.0 or later. +const _ = grpc.SupportPackageIsVersion9 const ( Seaweed_SendHeartbeat_FullMethodName = "/master_pb.Seaweed/SendHeartbeat" @@ -48,11 +48,11 @@ const ( // // For semantics around ctx use and closing/ending streaming RPCs, please refer to https://pkg.go.dev/google.golang.org/grpc/?tab=doc#ClientConn.NewStream. type SeaweedClient interface { - SendHeartbeat(ctx context.Context, opts ...grpc.CallOption) (Seaweed_SendHeartbeatClient, error) - KeepConnected(ctx context.Context, opts ...grpc.CallOption) (Seaweed_KeepConnectedClient, error) + SendHeartbeat(ctx context.Context, opts ...grpc.CallOption) (grpc.BidiStreamingClient[Heartbeat, HeartbeatResponse], error) + KeepConnected(ctx context.Context, opts ...grpc.CallOption) (grpc.BidiStreamingClient[KeepConnectedRequest, KeepConnectedResponse], error) LookupVolume(ctx context.Context, in *LookupVolumeRequest, opts ...grpc.CallOption) (*LookupVolumeResponse, error) Assign(ctx context.Context, in *AssignRequest, opts ...grpc.CallOption) (*AssignResponse, error) - StreamAssign(ctx context.Context, opts ...grpc.CallOption) (Seaweed_StreamAssignClient, error) + StreamAssign(ctx context.Context, opts ...grpc.CallOption) (grpc.BidiStreamingClient[AssignRequest, AssignResponse], error) Statistics(ctx context.Context, in *StatisticsRequest, opts ...grpc.CallOption) (*StatisticsResponse, error) CollectionList(ctx context.Context, in *CollectionListRequest, opts ...grpc.CallOption) (*CollectionListResponse, error) CollectionDelete(ctx context.Context, in *CollectionDeleteRequest, opts ...grpc.CallOption) (*CollectionDeleteResponse, error) @@ -81,71 +81,36 @@ func NewSeaweedClient(cc grpc.ClientConnInterface) SeaweedClient { return &seaweedClient{cc} } -func (c *seaweedClient) SendHeartbeat(ctx context.Context, opts ...grpc.CallOption) (Seaweed_SendHeartbeatClient, error) { - stream, err := c.cc.NewStream(ctx, &Seaweed_ServiceDesc.Streams[0], Seaweed_SendHeartbeat_FullMethodName, opts...) +func (c *seaweedClient) SendHeartbeat(ctx context.Context, opts ...grpc.CallOption) (grpc.BidiStreamingClient[Heartbeat, HeartbeatResponse], error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) + stream, err := c.cc.NewStream(ctx, &Seaweed_ServiceDesc.Streams[0], Seaweed_SendHeartbeat_FullMethodName, cOpts...) if err != nil { return nil, err } - x := &seaweedSendHeartbeatClient{stream} + x := &grpc.GenericClientStream[Heartbeat, HeartbeatResponse]{ClientStream: stream} return x, nil } -type Seaweed_SendHeartbeatClient interface { - Send(*Heartbeat) error - Recv() (*HeartbeatResponse, error) - grpc.ClientStream -} - -type seaweedSendHeartbeatClient struct { - grpc.ClientStream -} - -func (x *seaweedSendHeartbeatClient) Send(m *Heartbeat) error { - return x.ClientStream.SendMsg(m) -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type Seaweed_SendHeartbeatClient = grpc.BidiStreamingClient[Heartbeat, HeartbeatResponse] -func (x *seaweedSendHeartbeatClient) Recv() (*HeartbeatResponse, error) { - m := new(HeartbeatResponse) - if err := x.ClientStream.RecvMsg(m); err != nil { - return nil, err - } - return m, nil -} - -func (c *seaweedClient) KeepConnected(ctx context.Context, opts ...grpc.CallOption) (Seaweed_KeepConnectedClient, error) { - stream, err := c.cc.NewStream(ctx, &Seaweed_ServiceDesc.Streams[1], Seaweed_KeepConnected_FullMethodName, opts...) +func (c *seaweedClient) KeepConnected(ctx context.Context, opts ...grpc.CallOption) (grpc.BidiStreamingClient[KeepConnectedRequest, KeepConnectedResponse], error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) + stream, err := c.cc.NewStream(ctx, &Seaweed_ServiceDesc.Streams[1], Seaweed_KeepConnected_FullMethodName, cOpts...) if err != nil { return nil, err } - x := &seaweedKeepConnectedClient{stream} + x := &grpc.GenericClientStream[KeepConnectedRequest, KeepConnectedResponse]{ClientStream: stream} return x, nil } -type Seaweed_KeepConnectedClient interface { - Send(*KeepConnectedRequest) error - Recv() (*KeepConnectedResponse, error) - grpc.ClientStream -} - -type seaweedKeepConnectedClient struct { - grpc.ClientStream -} - -func (x *seaweedKeepConnectedClient) Send(m *KeepConnectedRequest) error { - return x.ClientStream.SendMsg(m) -} - -func (x *seaweedKeepConnectedClient) Recv() (*KeepConnectedResponse, error) { - m := new(KeepConnectedResponse) - if err := x.ClientStream.RecvMsg(m); err != nil { - return nil, err - } - return m, nil -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type Seaweed_KeepConnectedClient = grpc.BidiStreamingClient[KeepConnectedRequest, KeepConnectedResponse] func (c *seaweedClient) LookupVolume(ctx context.Context, in *LookupVolumeRequest, opts ...grpc.CallOption) (*LookupVolumeResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(LookupVolumeResponse) - err := c.cc.Invoke(ctx, Seaweed_LookupVolume_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, Seaweed_LookupVolume_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -153,48 +118,32 @@ func (c *seaweedClient) LookupVolume(ctx context.Context, in *LookupVolumeReques } func (c *seaweedClient) Assign(ctx context.Context, in *AssignRequest, opts ...grpc.CallOption) (*AssignResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(AssignResponse) - err := c.cc.Invoke(ctx, Seaweed_Assign_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, Seaweed_Assign_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } return out, nil } -func (c *seaweedClient) StreamAssign(ctx context.Context, opts ...grpc.CallOption) (Seaweed_StreamAssignClient, error) { - stream, err := c.cc.NewStream(ctx, &Seaweed_ServiceDesc.Streams[2], Seaweed_StreamAssign_FullMethodName, opts...) +func (c *seaweedClient) StreamAssign(ctx context.Context, opts ...grpc.CallOption) (grpc.BidiStreamingClient[AssignRequest, AssignResponse], error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) + stream, err := c.cc.NewStream(ctx, &Seaweed_ServiceDesc.Streams[2], Seaweed_StreamAssign_FullMethodName, cOpts...) if err != nil { return nil, err } - x := &seaweedStreamAssignClient{stream} + x := &grpc.GenericClientStream[AssignRequest, AssignResponse]{ClientStream: stream} return x, nil } -type Seaweed_StreamAssignClient interface { - Send(*AssignRequest) error - Recv() (*AssignResponse, error) - grpc.ClientStream -} - -type seaweedStreamAssignClient struct { - grpc.ClientStream -} - -func (x *seaweedStreamAssignClient) Send(m *AssignRequest) error { - return x.ClientStream.SendMsg(m) -} - -func (x *seaweedStreamAssignClient) Recv() (*AssignResponse, error) { - m := new(AssignResponse) - if err := x.ClientStream.RecvMsg(m); err != nil { - return nil, err - } - return m, nil -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type Seaweed_StreamAssignClient = grpc.BidiStreamingClient[AssignRequest, AssignResponse] func (c *seaweedClient) Statistics(ctx context.Context, in *StatisticsRequest, opts ...grpc.CallOption) (*StatisticsResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(StatisticsResponse) - err := c.cc.Invoke(ctx, Seaweed_Statistics_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, Seaweed_Statistics_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -202,8 +151,9 @@ func (c *seaweedClient) Statistics(ctx context.Context, in *StatisticsRequest, o } func (c *seaweedClient) CollectionList(ctx context.Context, in *CollectionListRequest, opts ...grpc.CallOption) (*CollectionListResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(CollectionListResponse) - err := c.cc.Invoke(ctx, Seaweed_CollectionList_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, Seaweed_CollectionList_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -211,8 +161,9 @@ func (c *seaweedClient) CollectionList(ctx context.Context, in *CollectionListRe } func (c *seaweedClient) CollectionDelete(ctx context.Context, in *CollectionDeleteRequest, opts ...grpc.CallOption) (*CollectionDeleteResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(CollectionDeleteResponse) - err := c.cc.Invoke(ctx, Seaweed_CollectionDelete_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, Seaweed_CollectionDelete_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -220,8 +171,9 @@ func (c *seaweedClient) CollectionDelete(ctx context.Context, in *CollectionDele } func (c *seaweedClient) VolumeList(ctx context.Context, in *VolumeListRequest, opts ...grpc.CallOption) (*VolumeListResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(VolumeListResponse) - err := c.cc.Invoke(ctx, Seaweed_VolumeList_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, Seaweed_VolumeList_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -229,8 +181,9 @@ func (c *seaweedClient) VolumeList(ctx context.Context, in *VolumeListRequest, o } func (c *seaweedClient) LookupEcVolume(ctx context.Context, in *LookupEcVolumeRequest, opts ...grpc.CallOption) (*LookupEcVolumeResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(LookupEcVolumeResponse) - err := c.cc.Invoke(ctx, Seaweed_LookupEcVolume_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, Seaweed_LookupEcVolume_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -238,8 +191,9 @@ func (c *seaweedClient) LookupEcVolume(ctx context.Context, in *LookupEcVolumeRe } func (c *seaweedClient) VacuumVolume(ctx context.Context, in *VacuumVolumeRequest, opts ...grpc.CallOption) (*VacuumVolumeResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(VacuumVolumeResponse) - err := c.cc.Invoke(ctx, Seaweed_VacuumVolume_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, Seaweed_VacuumVolume_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -247,8 +201,9 @@ func (c *seaweedClient) VacuumVolume(ctx context.Context, in *VacuumVolumeReques } func (c *seaweedClient) DisableVacuum(ctx context.Context, in *DisableVacuumRequest, opts ...grpc.CallOption) (*DisableVacuumResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(DisableVacuumResponse) - err := c.cc.Invoke(ctx, Seaweed_DisableVacuum_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, Seaweed_DisableVacuum_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -256,8 +211,9 @@ func (c *seaweedClient) DisableVacuum(ctx context.Context, in *DisableVacuumRequ } func (c *seaweedClient) EnableVacuum(ctx context.Context, in *EnableVacuumRequest, opts ...grpc.CallOption) (*EnableVacuumResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(EnableVacuumResponse) - err := c.cc.Invoke(ctx, Seaweed_EnableVacuum_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, Seaweed_EnableVacuum_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -265,8 +221,9 @@ func (c *seaweedClient) EnableVacuum(ctx context.Context, in *EnableVacuumReques } func (c *seaweedClient) VolumeMarkReadonly(ctx context.Context, in *VolumeMarkReadonlyRequest, opts ...grpc.CallOption) (*VolumeMarkReadonlyResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(VolumeMarkReadonlyResponse) - err := c.cc.Invoke(ctx, Seaweed_VolumeMarkReadonly_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, Seaweed_VolumeMarkReadonly_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -274,8 +231,9 @@ func (c *seaweedClient) VolumeMarkReadonly(ctx context.Context, in *VolumeMarkRe } func (c *seaweedClient) GetMasterConfiguration(ctx context.Context, in *GetMasterConfigurationRequest, opts ...grpc.CallOption) (*GetMasterConfigurationResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(GetMasterConfigurationResponse) - err := c.cc.Invoke(ctx, Seaweed_GetMasterConfiguration_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, Seaweed_GetMasterConfiguration_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -283,8 +241,9 @@ func (c *seaweedClient) GetMasterConfiguration(ctx context.Context, in *GetMaste } func (c *seaweedClient) ListClusterNodes(ctx context.Context, in *ListClusterNodesRequest, opts ...grpc.CallOption) (*ListClusterNodesResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(ListClusterNodesResponse) - err := c.cc.Invoke(ctx, Seaweed_ListClusterNodes_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, Seaweed_ListClusterNodes_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -292,8 +251,9 @@ func (c *seaweedClient) ListClusterNodes(ctx context.Context, in *ListClusterNod } func (c *seaweedClient) LeaseAdminToken(ctx context.Context, in *LeaseAdminTokenRequest, opts ...grpc.CallOption) (*LeaseAdminTokenResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(LeaseAdminTokenResponse) - err := c.cc.Invoke(ctx, Seaweed_LeaseAdminToken_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, Seaweed_LeaseAdminToken_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -301,8 +261,9 @@ func (c *seaweedClient) LeaseAdminToken(ctx context.Context, in *LeaseAdminToken } func (c *seaweedClient) ReleaseAdminToken(ctx context.Context, in *ReleaseAdminTokenRequest, opts ...grpc.CallOption) (*ReleaseAdminTokenResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(ReleaseAdminTokenResponse) - err := c.cc.Invoke(ctx, Seaweed_ReleaseAdminToken_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, Seaweed_ReleaseAdminToken_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -310,8 +271,9 @@ func (c *seaweedClient) ReleaseAdminToken(ctx context.Context, in *ReleaseAdminT } func (c *seaweedClient) Ping(ctx context.Context, in *PingRequest, opts ...grpc.CallOption) (*PingResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(PingResponse) - err := c.cc.Invoke(ctx, Seaweed_Ping_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, Seaweed_Ping_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -319,8 +281,9 @@ func (c *seaweedClient) Ping(ctx context.Context, in *PingRequest, opts ...grpc. } func (c *seaweedClient) RaftListClusterServers(ctx context.Context, in *RaftListClusterServersRequest, opts ...grpc.CallOption) (*RaftListClusterServersResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(RaftListClusterServersResponse) - err := c.cc.Invoke(ctx, Seaweed_RaftListClusterServers_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, Seaweed_RaftListClusterServers_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -328,8 +291,9 @@ func (c *seaweedClient) RaftListClusterServers(ctx context.Context, in *RaftList } func (c *seaweedClient) RaftAddServer(ctx context.Context, in *RaftAddServerRequest, opts ...grpc.CallOption) (*RaftAddServerResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(RaftAddServerResponse) - err := c.cc.Invoke(ctx, Seaweed_RaftAddServer_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, Seaweed_RaftAddServer_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -337,8 +301,9 @@ func (c *seaweedClient) RaftAddServer(ctx context.Context, in *RaftAddServerRequ } func (c *seaweedClient) RaftRemoveServer(ctx context.Context, in *RaftRemoveServerRequest, opts ...grpc.CallOption) (*RaftRemoveServerResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(RaftRemoveServerResponse) - err := c.cc.Invoke(ctx, Seaweed_RaftRemoveServer_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, Seaweed_RaftRemoveServer_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -346,8 +311,9 @@ func (c *seaweedClient) RaftRemoveServer(ctx context.Context, in *RaftRemoveServ } func (c *seaweedClient) VolumeGrow(ctx context.Context, in *VolumeGrowRequest, opts ...grpc.CallOption) (*VolumeGrowResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(VolumeGrowResponse) - err := c.cc.Invoke(ctx, Seaweed_VolumeGrow_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, Seaweed_VolumeGrow_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -356,13 +322,13 @@ func (c *seaweedClient) VolumeGrow(ctx context.Context, in *VolumeGrowRequest, o // SeaweedServer is the server API for Seaweed service. // All implementations must embed UnimplementedSeaweedServer -// for forward compatibility +// for forward compatibility. type SeaweedServer interface { - SendHeartbeat(Seaweed_SendHeartbeatServer) error - KeepConnected(Seaweed_KeepConnectedServer) error + SendHeartbeat(grpc.BidiStreamingServer[Heartbeat, HeartbeatResponse]) error + KeepConnected(grpc.BidiStreamingServer[KeepConnectedRequest, KeepConnectedResponse]) error LookupVolume(context.Context, *LookupVolumeRequest) (*LookupVolumeResponse, error) Assign(context.Context, *AssignRequest) (*AssignResponse, error) - StreamAssign(Seaweed_StreamAssignServer) error + StreamAssign(grpc.BidiStreamingServer[AssignRequest, AssignResponse]) error Statistics(context.Context, *StatisticsRequest) (*StatisticsResponse, error) CollectionList(context.Context, *CollectionListRequest) (*CollectionListResponse, error) CollectionDelete(context.Context, *CollectionDeleteRequest) (*CollectionDeleteResponse, error) @@ -384,14 +350,17 @@ type SeaweedServer interface { mustEmbedUnimplementedSeaweedServer() } -// UnimplementedSeaweedServer must be embedded to have forward compatible implementations. -type UnimplementedSeaweedServer struct { -} +// UnimplementedSeaweedServer must be embedded to have +// forward compatible implementations. +// +// NOTE: this should be embedded by value instead of pointer to avoid a nil +// pointer dereference when methods are called. +type UnimplementedSeaweedServer struct{} -func (UnimplementedSeaweedServer) SendHeartbeat(Seaweed_SendHeartbeatServer) error { +func (UnimplementedSeaweedServer) SendHeartbeat(grpc.BidiStreamingServer[Heartbeat, HeartbeatResponse]) error { return status.Errorf(codes.Unimplemented, "method SendHeartbeat not implemented") } -func (UnimplementedSeaweedServer) KeepConnected(Seaweed_KeepConnectedServer) error { +func (UnimplementedSeaweedServer) KeepConnected(grpc.BidiStreamingServer[KeepConnectedRequest, KeepConnectedResponse]) error { return status.Errorf(codes.Unimplemented, "method KeepConnected not implemented") } func (UnimplementedSeaweedServer) LookupVolume(context.Context, *LookupVolumeRequest) (*LookupVolumeResponse, error) { @@ -400,7 +369,7 @@ func (UnimplementedSeaweedServer) LookupVolume(context.Context, *LookupVolumeReq func (UnimplementedSeaweedServer) Assign(context.Context, *AssignRequest) (*AssignResponse, error) { return nil, status.Errorf(codes.Unimplemented, "method Assign not implemented") } -func (UnimplementedSeaweedServer) StreamAssign(Seaweed_StreamAssignServer) error { +func (UnimplementedSeaweedServer) StreamAssign(grpc.BidiStreamingServer[AssignRequest, AssignResponse]) error { return status.Errorf(codes.Unimplemented, "method StreamAssign not implemented") } func (UnimplementedSeaweedServer) Statistics(context.Context, *StatisticsRequest) (*StatisticsResponse, error) { @@ -458,6 +427,7 @@ func (UnimplementedSeaweedServer) VolumeGrow(context.Context, *VolumeGrowRequest return nil, status.Errorf(codes.Unimplemented, "method VolumeGrow not implemented") } func (UnimplementedSeaweedServer) mustEmbedUnimplementedSeaweedServer() {} +func (UnimplementedSeaweedServer) testEmbeddedByValue() {} // UnsafeSeaweedServer may be embedded to opt out of forward compatibility for this service. // Use of this interface is not recommended, as added methods to SeaweedServer will @@ -467,60 +437,29 @@ type UnsafeSeaweedServer interface { } func RegisterSeaweedServer(s grpc.ServiceRegistrar, srv SeaweedServer) { + // If the following call pancis, it indicates UnimplementedSeaweedServer was + // embedded by pointer and is nil. This will cause panics if an + // unimplemented method is ever invoked, so we test this at initialization + // time to prevent it from happening at runtime later due to I/O. + if t, ok := srv.(interface{ testEmbeddedByValue() }); ok { + t.testEmbeddedByValue() + } s.RegisterService(&Seaweed_ServiceDesc, srv) } func _Seaweed_SendHeartbeat_Handler(srv interface{}, stream grpc.ServerStream) error { - return srv.(SeaweedServer).SendHeartbeat(&seaweedSendHeartbeatServer{stream}) -} - -type Seaweed_SendHeartbeatServer interface { - Send(*HeartbeatResponse) error - Recv() (*Heartbeat, error) - grpc.ServerStream -} - -type seaweedSendHeartbeatServer struct { - grpc.ServerStream -} - -func (x *seaweedSendHeartbeatServer) Send(m *HeartbeatResponse) error { - return x.ServerStream.SendMsg(m) + return srv.(SeaweedServer).SendHeartbeat(&grpc.GenericServerStream[Heartbeat, HeartbeatResponse]{ServerStream: stream}) } -func (x *seaweedSendHeartbeatServer) Recv() (*Heartbeat, error) { - m := new(Heartbeat) - if err := x.ServerStream.RecvMsg(m); err != nil { - return nil, err - } - return m, nil -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type Seaweed_SendHeartbeatServer = grpc.BidiStreamingServer[Heartbeat, HeartbeatResponse] func _Seaweed_KeepConnected_Handler(srv interface{}, stream grpc.ServerStream) error { - return srv.(SeaweedServer).KeepConnected(&seaweedKeepConnectedServer{stream}) -} - -type Seaweed_KeepConnectedServer interface { - Send(*KeepConnectedResponse) error - Recv() (*KeepConnectedRequest, error) - grpc.ServerStream -} - -type seaweedKeepConnectedServer struct { - grpc.ServerStream + return srv.(SeaweedServer).KeepConnected(&grpc.GenericServerStream[KeepConnectedRequest, KeepConnectedResponse]{ServerStream: stream}) } -func (x *seaweedKeepConnectedServer) Send(m *KeepConnectedResponse) error { - return x.ServerStream.SendMsg(m) -} - -func (x *seaweedKeepConnectedServer) Recv() (*KeepConnectedRequest, error) { - m := new(KeepConnectedRequest) - if err := x.ServerStream.RecvMsg(m); err != nil { - return nil, err - } - return m, nil -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type Seaweed_KeepConnectedServer = grpc.BidiStreamingServer[KeepConnectedRequest, KeepConnectedResponse] func _Seaweed_LookupVolume_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) { in := new(LookupVolumeRequest) @@ -559,30 +498,11 @@ func _Seaweed_Assign_Handler(srv interface{}, ctx context.Context, dec func(inte } func _Seaweed_StreamAssign_Handler(srv interface{}, stream grpc.ServerStream) error { - return srv.(SeaweedServer).StreamAssign(&seaweedStreamAssignServer{stream}) -} - -type Seaweed_StreamAssignServer interface { - Send(*AssignResponse) error - Recv() (*AssignRequest, error) - grpc.ServerStream + return srv.(SeaweedServer).StreamAssign(&grpc.GenericServerStream[AssignRequest, AssignResponse]{ServerStream: stream}) } -type seaweedStreamAssignServer struct { - grpc.ServerStream -} - -func (x *seaweedStreamAssignServer) Send(m *AssignResponse) error { - return x.ServerStream.SendMsg(m) -} - -func (x *seaweedStreamAssignServer) Recv() (*AssignRequest, error) { - m := new(AssignRequest) - if err := x.ServerStream.RecvMsg(m); err != nil { - return nil, err - } - return m, nil -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type Seaweed_StreamAssignServer = grpc.BidiStreamingServer[AssignRequest, AssignResponse] func _Seaweed_Statistics_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) { in := new(StatisticsRequest) diff --git a/weed/pb/mount_pb/mount.pb.go b/weed/pb/mount_pb/mount.pb.go index b64592fb1..d5ef3a765 100644 --- a/weed/pb/mount_pb/mount.pb.go +++ b/weed/pb/mount_pb/mount.pb.go @@ -1,7 +1,7 @@ // Code generated by protoc-gen-go. DO NOT EDIT. // versions: -// protoc-gen-go v1.32.0 -// protoc v4.25.3 +// protoc-gen-go v1.34.2 +// protoc v5.28.1 // source: mount.proto package mount_pb @@ -142,7 +142,7 @@ func file_mount_proto_rawDescGZIP() []byte { } var file_mount_proto_msgTypes = make([]protoimpl.MessageInfo, 2) -var file_mount_proto_goTypes = []interface{}{ +var file_mount_proto_goTypes = []any{ (*ConfigureRequest)(nil), // 0: messaging_pb.ConfigureRequest (*ConfigureResponse)(nil), // 1: messaging_pb.ConfigureResponse } @@ -162,7 +162,7 @@ func file_mount_proto_init() { return } if !protoimpl.UnsafeEnabled { - file_mount_proto_msgTypes[0].Exporter = func(v interface{}, i int) interface{} { + file_mount_proto_msgTypes[0].Exporter = func(v any, i int) any { switch v := v.(*ConfigureRequest); i { case 0: return &v.state @@ -174,7 +174,7 @@ func file_mount_proto_init() { return nil } } - file_mount_proto_msgTypes[1].Exporter = func(v interface{}, i int) interface{} { + file_mount_proto_msgTypes[1].Exporter = func(v any, i int) any { switch v := v.(*ConfigureResponse); i { case 0: return &v.state diff --git a/weed/pb/mount_pb/mount_grpc.pb.go b/weed/pb/mount_pb/mount_grpc.pb.go index 3dd6d126b..58c677eb1 100644 --- a/weed/pb/mount_pb/mount_grpc.pb.go +++ b/weed/pb/mount_pb/mount_grpc.pb.go @@ -1,7 +1,7 @@ // Code generated by protoc-gen-go-grpc. DO NOT EDIT. // versions: -// - protoc-gen-go-grpc v1.3.0 -// - protoc v4.25.3 +// - protoc-gen-go-grpc v1.5.1 +// - protoc v5.28.1 // source: mount.proto package mount_pb @@ -15,8 +15,8 @@ import ( // This is a compile-time assertion to ensure that this generated file // is compatible with the grpc package it is being compiled against. -// Requires gRPC-Go v1.32.0 or later. -const _ = grpc.SupportPackageIsVersion7 +// Requires gRPC-Go v1.64.0 or later. +const _ = grpc.SupportPackageIsVersion9 const ( SeaweedMount_Configure_FullMethodName = "/messaging_pb.SeaweedMount/Configure" @@ -38,8 +38,9 @@ func NewSeaweedMountClient(cc grpc.ClientConnInterface) SeaweedMountClient { } func (c *seaweedMountClient) Configure(ctx context.Context, in *ConfigureRequest, opts ...grpc.CallOption) (*ConfigureResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(ConfigureResponse) - err := c.cc.Invoke(ctx, SeaweedMount_Configure_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, SeaweedMount_Configure_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -48,20 +49,24 @@ func (c *seaweedMountClient) Configure(ctx context.Context, in *ConfigureRequest // SeaweedMountServer is the server API for SeaweedMount service. // All implementations must embed UnimplementedSeaweedMountServer -// for forward compatibility +// for forward compatibility. type SeaweedMountServer interface { Configure(context.Context, *ConfigureRequest) (*ConfigureResponse, error) mustEmbedUnimplementedSeaweedMountServer() } -// UnimplementedSeaweedMountServer must be embedded to have forward compatible implementations. -type UnimplementedSeaweedMountServer struct { -} +// UnimplementedSeaweedMountServer must be embedded to have +// forward compatible implementations. +// +// NOTE: this should be embedded by value instead of pointer to avoid a nil +// pointer dereference when methods are called. +type UnimplementedSeaweedMountServer struct{} func (UnimplementedSeaweedMountServer) Configure(context.Context, *ConfigureRequest) (*ConfigureResponse, error) { return nil, status.Errorf(codes.Unimplemented, "method Configure not implemented") } func (UnimplementedSeaweedMountServer) mustEmbedUnimplementedSeaweedMountServer() {} +func (UnimplementedSeaweedMountServer) testEmbeddedByValue() {} // UnsafeSeaweedMountServer may be embedded to opt out of forward compatibility for this service. // Use of this interface is not recommended, as added methods to SeaweedMountServer will @@ -71,6 +76,13 @@ type UnsafeSeaweedMountServer interface { } func RegisterSeaweedMountServer(s grpc.ServiceRegistrar, srv SeaweedMountServer) { + // If the following call pancis, it indicates UnimplementedSeaweedMountServer was + // embedded by pointer and is nil. This will cause panics if an + // unimplemented method is ever invoked, so we test this at initialization + // time to prevent it from happening at runtime later due to I/O. + if t, ok := srv.(interface{ testEmbeddedByValue() }); ok { + t.testEmbeddedByValue() + } s.RegisterService(&SeaweedMount_ServiceDesc, srv) } diff --git a/weed/pb/mq_pb/mq.pb.go b/weed/pb/mq_pb/mq.pb.go index fb76a1f50..35516378c 100644 --- a/weed/pb/mq_pb/mq.pb.go +++ b/weed/pb/mq_pb/mq.pb.go @@ -1,7 +1,7 @@ // Code generated by protoc-gen-go. DO NOT EDIT. // versions: -// protoc-gen-go v1.32.0 -// protoc v4.25.3 +// protoc-gen-go v1.34.2 +// protoc v5.28.1 // source: mq.proto package mq_pb @@ -3770,7 +3770,7 @@ func file_mq_proto_rawDescGZIP() []byte { var file_mq_proto_enumTypes = make([]protoimpl.EnumInfo, 1) var file_mq_proto_msgTypes = make([]protoimpl.MessageInfo, 54) -var file_mq_proto_goTypes = []interface{}{ +var file_mq_proto_goTypes = []any{ (PartitionOffsetStartType)(0), // 0: messaging_pb.PartitionOffsetStartType (*FindBrokerLeaderRequest)(nil), // 1: messaging_pb.FindBrokerLeaderRequest (*FindBrokerLeaderResponse)(nil), // 2: messaging_pb.FindBrokerLeaderResponse @@ -3925,7 +3925,7 @@ func file_mq_proto_init() { return } if !protoimpl.UnsafeEnabled { - file_mq_proto_msgTypes[0].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[0].Exporter = func(v any, i int) any { switch v := v.(*FindBrokerLeaderRequest); i { case 0: return &v.state @@ -3937,7 +3937,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[1].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[1].Exporter = func(v any, i int) any { switch v := v.(*FindBrokerLeaderResponse); i { case 0: return &v.state @@ -3949,7 +3949,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[2].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[2].Exporter = func(v any, i int) any { switch v := v.(*Topic); i { case 0: return &v.state @@ -3961,7 +3961,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[3].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[3].Exporter = func(v any, i int) any { switch v := v.(*Partition); i { case 0: return &v.state @@ -3973,7 +3973,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[4].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[4].Exporter = func(v any, i int) any { switch v := v.(*Offset); i { case 0: return &v.state @@ -3985,7 +3985,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[5].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[5].Exporter = func(v any, i int) any { switch v := v.(*PartitionOffset); i { case 0: return &v.state @@ -3997,7 +3997,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[6].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[6].Exporter = func(v any, i int) any { switch v := v.(*BrokerStats); i { case 0: return &v.state @@ -4009,7 +4009,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[7].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[7].Exporter = func(v any, i int) any { switch v := v.(*TopicPartitionStats); i { case 0: return &v.state @@ -4021,7 +4021,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[8].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[8].Exporter = func(v any, i int) any { switch v := v.(*PublisherToPubBalancerRequest); i { case 0: return &v.state @@ -4033,7 +4033,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[9].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[9].Exporter = func(v any, i int) any { switch v := v.(*PublisherToPubBalancerResponse); i { case 0: return &v.state @@ -4045,7 +4045,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[10].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[10].Exporter = func(v any, i int) any { switch v := v.(*BalanceTopicsRequest); i { case 0: return &v.state @@ -4057,7 +4057,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[11].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[11].Exporter = func(v any, i int) any { switch v := v.(*BalanceTopicsResponse); i { case 0: return &v.state @@ -4069,7 +4069,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[12].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[12].Exporter = func(v any, i int) any { switch v := v.(*ConfigureTopicRequest); i { case 0: return &v.state @@ -4081,7 +4081,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[13].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[13].Exporter = func(v any, i int) any { switch v := v.(*ConfigureTopicResponse); i { case 0: return &v.state @@ -4093,7 +4093,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[14].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[14].Exporter = func(v any, i int) any { switch v := v.(*ListTopicsRequest); i { case 0: return &v.state @@ -4105,7 +4105,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[15].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[15].Exporter = func(v any, i int) any { switch v := v.(*ListTopicsResponse); i { case 0: return &v.state @@ -4117,7 +4117,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[16].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[16].Exporter = func(v any, i int) any { switch v := v.(*LookupTopicBrokersRequest); i { case 0: return &v.state @@ -4129,7 +4129,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[17].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[17].Exporter = func(v any, i int) any { switch v := v.(*LookupTopicBrokersResponse); i { case 0: return &v.state @@ -4141,7 +4141,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[18].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[18].Exporter = func(v any, i int) any { switch v := v.(*BrokerPartitionAssignment); i { case 0: return &v.state @@ -4153,7 +4153,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[19].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[19].Exporter = func(v any, i int) any { switch v := v.(*AssignTopicPartitionsRequest); i { case 0: return &v.state @@ -4165,7 +4165,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[20].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[20].Exporter = func(v any, i int) any { switch v := v.(*AssignTopicPartitionsResponse); i { case 0: return &v.state @@ -4177,7 +4177,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[21].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[21].Exporter = func(v any, i int) any { switch v := v.(*SubscriberToSubCoordinatorRequest); i { case 0: return &v.state @@ -4189,7 +4189,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[22].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[22].Exporter = func(v any, i int) any { switch v := v.(*SubscriberToSubCoordinatorResponse); i { case 0: return &v.state @@ -4201,7 +4201,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[23].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[23].Exporter = func(v any, i int) any { switch v := v.(*ControlMessage); i { case 0: return &v.state @@ -4213,7 +4213,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[24].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[24].Exporter = func(v any, i int) any { switch v := v.(*DataMessage); i { case 0: return &v.state @@ -4225,7 +4225,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[25].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[25].Exporter = func(v any, i int) any { switch v := v.(*PublishMessageRequest); i { case 0: return &v.state @@ -4237,7 +4237,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[26].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[26].Exporter = func(v any, i int) any { switch v := v.(*PublishMessageResponse); i { case 0: return &v.state @@ -4249,7 +4249,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[27].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[27].Exporter = func(v any, i int) any { switch v := v.(*PublishFollowMeRequest); i { case 0: return &v.state @@ -4261,7 +4261,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[28].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[28].Exporter = func(v any, i int) any { switch v := v.(*PublishFollowMeResponse); i { case 0: return &v.state @@ -4273,7 +4273,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[29].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[29].Exporter = func(v any, i int) any { switch v := v.(*SubscribeMessageRequest); i { case 0: return &v.state @@ -4285,7 +4285,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[30].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[30].Exporter = func(v any, i int) any { switch v := v.(*SubscribeMessageResponse); i { case 0: return &v.state @@ -4297,7 +4297,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[31].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[31].Exporter = func(v any, i int) any { switch v := v.(*SubscribeFollowMeRequest); i { case 0: return &v.state @@ -4309,7 +4309,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[32].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[32].Exporter = func(v any, i int) any { switch v := v.(*SubscribeFollowMeResponse); i { case 0: return &v.state @@ -4321,7 +4321,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[33].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[33].Exporter = func(v any, i int) any { switch v := v.(*ClosePublishersRequest); i { case 0: return &v.state @@ -4333,7 +4333,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[34].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[34].Exporter = func(v any, i int) any { switch v := v.(*ClosePublishersResponse); i { case 0: return &v.state @@ -4345,7 +4345,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[35].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[35].Exporter = func(v any, i int) any { switch v := v.(*CloseSubscribersRequest); i { case 0: return &v.state @@ -4357,7 +4357,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[36].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[36].Exporter = func(v any, i int) any { switch v := v.(*CloseSubscribersResponse); i { case 0: return &v.state @@ -4369,7 +4369,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[38].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[38].Exporter = func(v any, i int) any { switch v := v.(*PublisherToPubBalancerRequest_InitMessage); i { case 0: return &v.state @@ -4381,7 +4381,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[39].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[39].Exporter = func(v any, i int) any { switch v := v.(*SubscriberToSubCoordinatorRequest_InitMessage); i { case 0: return &v.state @@ -4393,7 +4393,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[40].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[40].Exporter = func(v any, i int) any { switch v := v.(*SubscriberToSubCoordinatorRequest_AckUnAssignmentMessage); i { case 0: return &v.state @@ -4405,7 +4405,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[41].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[41].Exporter = func(v any, i int) any { switch v := v.(*SubscriberToSubCoordinatorRequest_AckAssignmentMessage); i { case 0: return &v.state @@ -4417,7 +4417,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[42].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[42].Exporter = func(v any, i int) any { switch v := v.(*SubscriberToSubCoordinatorResponse_Assignment); i { case 0: return &v.state @@ -4429,7 +4429,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[43].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[43].Exporter = func(v any, i int) any { switch v := v.(*SubscriberToSubCoordinatorResponse_UnAssignment); i { case 0: return &v.state @@ -4441,7 +4441,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[44].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[44].Exporter = func(v any, i int) any { switch v := v.(*PublishMessageRequest_InitMessage); i { case 0: return &v.state @@ -4453,7 +4453,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[45].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[45].Exporter = func(v any, i int) any { switch v := v.(*PublishFollowMeRequest_InitMessage); i { case 0: return &v.state @@ -4465,7 +4465,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[46].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[46].Exporter = func(v any, i int) any { switch v := v.(*PublishFollowMeRequest_FlushMessage); i { case 0: return &v.state @@ -4477,7 +4477,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[47].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[47].Exporter = func(v any, i int) any { switch v := v.(*PublishFollowMeRequest_CloseMessage); i { case 0: return &v.state @@ -4489,7 +4489,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[48].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[48].Exporter = func(v any, i int) any { switch v := v.(*SubscribeMessageRequest_InitMessage); i { case 0: return &v.state @@ -4501,7 +4501,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[49].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[49].Exporter = func(v any, i int) any { switch v := v.(*SubscribeMessageRequest_AckMessage); i { case 0: return &v.state @@ -4513,7 +4513,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[50].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[50].Exporter = func(v any, i int) any { switch v := v.(*SubscribeMessageResponse_SubscribeCtrlMessage); i { case 0: return &v.state @@ -4525,7 +4525,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[51].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[51].Exporter = func(v any, i int) any { switch v := v.(*SubscribeFollowMeRequest_InitMessage); i { case 0: return &v.state @@ -4537,7 +4537,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[52].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[52].Exporter = func(v any, i int) any { switch v := v.(*SubscribeFollowMeRequest_AckMessage); i { case 0: return &v.state @@ -4549,7 +4549,7 @@ func file_mq_proto_init() { return nil } } - file_mq_proto_msgTypes[53].Exporter = func(v interface{}, i int) interface{} { + file_mq_proto_msgTypes[53].Exporter = func(v any, i int) any { switch v := v.(*SubscribeFollowMeRequest_CloseMessage); i { case 0: return &v.state @@ -4562,38 +4562,38 @@ func file_mq_proto_init() { } } } - file_mq_proto_msgTypes[8].OneofWrappers = []interface{}{ + file_mq_proto_msgTypes[8].OneofWrappers = []any{ (*PublisherToPubBalancerRequest_Init)(nil), (*PublisherToPubBalancerRequest_Stats)(nil), } - file_mq_proto_msgTypes[21].OneofWrappers = []interface{}{ + file_mq_proto_msgTypes[21].OneofWrappers = []any{ (*SubscriberToSubCoordinatorRequest_Init)(nil), (*SubscriberToSubCoordinatorRequest_AckAssignment)(nil), (*SubscriberToSubCoordinatorRequest_AckUnAssignment)(nil), } - file_mq_proto_msgTypes[22].OneofWrappers = []interface{}{ + file_mq_proto_msgTypes[22].OneofWrappers = []any{ (*SubscriberToSubCoordinatorResponse_Assignment_)(nil), (*SubscriberToSubCoordinatorResponse_UnAssignment_)(nil), } - file_mq_proto_msgTypes[25].OneofWrappers = []interface{}{ + file_mq_proto_msgTypes[25].OneofWrappers = []any{ (*PublishMessageRequest_Init)(nil), (*PublishMessageRequest_Data)(nil), } - file_mq_proto_msgTypes[27].OneofWrappers = []interface{}{ + file_mq_proto_msgTypes[27].OneofWrappers = []any{ (*PublishFollowMeRequest_Init)(nil), (*PublishFollowMeRequest_Data)(nil), (*PublishFollowMeRequest_Flush)(nil), (*PublishFollowMeRequest_Close)(nil), } - file_mq_proto_msgTypes[29].OneofWrappers = []interface{}{ + file_mq_proto_msgTypes[29].OneofWrappers = []any{ (*SubscribeMessageRequest_Init)(nil), (*SubscribeMessageRequest_Ack)(nil), } - file_mq_proto_msgTypes[30].OneofWrappers = []interface{}{ + file_mq_proto_msgTypes[30].OneofWrappers = []any{ (*SubscribeMessageResponse_Ctrl)(nil), (*SubscribeMessageResponse_Data)(nil), } - file_mq_proto_msgTypes[31].OneofWrappers = []interface{}{ + file_mq_proto_msgTypes[31].OneofWrappers = []any{ (*SubscribeFollowMeRequest_Init)(nil), (*SubscribeFollowMeRequest_Ack)(nil), (*SubscribeFollowMeRequest_Close)(nil), diff --git a/weed/pb/mq_pb/mq_grpc.pb.go b/weed/pb/mq_pb/mq_grpc.pb.go index 2123415a8..a4789ff4f 100644 --- a/weed/pb/mq_pb/mq_grpc.pb.go +++ b/weed/pb/mq_pb/mq_grpc.pb.go @@ -1,7 +1,7 @@ // Code generated by protoc-gen-go-grpc. DO NOT EDIT. // versions: -// - protoc-gen-go-grpc v1.3.0 -// - protoc v4.25.3 +// - protoc-gen-go-grpc v1.5.1 +// - protoc v5.28.1 // source: mq.proto package mq_pb @@ -15,8 +15,8 @@ import ( // This is a compile-time assertion to ensure that this generated file // is compatible with the grpc package it is being compiled against. -// Requires gRPC-Go v1.32.0 or later. -const _ = grpc.SupportPackageIsVersion7 +// Requires gRPC-Go v1.64.0 or later. +const _ = grpc.SupportPackageIsVersion9 const ( SeaweedMessaging_FindBrokerLeader_FullMethodName = "/messaging_pb.SeaweedMessaging/FindBrokerLeader" @@ -42,7 +42,7 @@ type SeaweedMessagingClient interface { // control plane FindBrokerLeader(ctx context.Context, in *FindBrokerLeaderRequest, opts ...grpc.CallOption) (*FindBrokerLeaderResponse, error) // control plane for balancer - PublisherToPubBalancer(ctx context.Context, opts ...grpc.CallOption) (SeaweedMessaging_PublisherToPubBalancerClient, error) + PublisherToPubBalancer(ctx context.Context, opts ...grpc.CallOption) (grpc.BidiStreamingClient[PublisherToPubBalancerRequest, PublisherToPubBalancerResponse], error) BalanceTopics(ctx context.Context, in *BalanceTopicsRequest, opts ...grpc.CallOption) (*BalanceTopicsResponse, error) // control plane for topic partitions ListTopics(ctx context.Context, in *ListTopicsRequest, opts ...grpc.CallOption) (*ListTopicsResponse, error) @@ -53,13 +53,13 @@ type SeaweedMessagingClient interface { ClosePublishers(ctx context.Context, in *ClosePublishersRequest, opts ...grpc.CallOption) (*ClosePublishersResponse, error) CloseSubscribers(ctx context.Context, in *CloseSubscribersRequest, opts ...grpc.CallOption) (*CloseSubscribersResponse, error) // subscriber connects to broker balancer, which coordinates with the subscribers - SubscriberToSubCoordinator(ctx context.Context, opts ...grpc.CallOption) (SeaweedMessaging_SubscriberToSubCoordinatorClient, error) + SubscriberToSubCoordinator(ctx context.Context, opts ...grpc.CallOption) (grpc.BidiStreamingClient[SubscriberToSubCoordinatorRequest, SubscriberToSubCoordinatorResponse], error) // data plane for each topic partition - PublishMessage(ctx context.Context, opts ...grpc.CallOption) (SeaweedMessaging_PublishMessageClient, error) - SubscribeMessage(ctx context.Context, opts ...grpc.CallOption) (SeaweedMessaging_SubscribeMessageClient, error) + PublishMessage(ctx context.Context, opts ...grpc.CallOption) (grpc.BidiStreamingClient[PublishMessageRequest, PublishMessageResponse], error) + SubscribeMessage(ctx context.Context, opts ...grpc.CallOption) (grpc.BidiStreamingClient[SubscribeMessageRequest, SubscribeMessageResponse], error) // The lead broker asks a follower broker to follow itself - PublishFollowMe(ctx context.Context, opts ...grpc.CallOption) (SeaweedMessaging_PublishFollowMeClient, error) - SubscribeFollowMe(ctx context.Context, opts ...grpc.CallOption) (SeaweedMessaging_SubscribeFollowMeClient, error) + PublishFollowMe(ctx context.Context, opts ...grpc.CallOption) (grpc.BidiStreamingClient[PublishFollowMeRequest, PublishFollowMeResponse], error) + SubscribeFollowMe(ctx context.Context, opts ...grpc.CallOption) (grpc.ClientStreamingClient[SubscribeFollowMeRequest, SubscribeFollowMeResponse], error) } type seaweedMessagingClient struct { @@ -71,48 +71,32 @@ func NewSeaweedMessagingClient(cc grpc.ClientConnInterface) SeaweedMessagingClie } func (c *seaweedMessagingClient) FindBrokerLeader(ctx context.Context, in *FindBrokerLeaderRequest, opts ...grpc.CallOption) (*FindBrokerLeaderResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(FindBrokerLeaderResponse) - err := c.cc.Invoke(ctx, SeaweedMessaging_FindBrokerLeader_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, SeaweedMessaging_FindBrokerLeader_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } return out, nil } -func (c *seaweedMessagingClient) PublisherToPubBalancer(ctx context.Context, opts ...grpc.CallOption) (SeaweedMessaging_PublisherToPubBalancerClient, error) { - stream, err := c.cc.NewStream(ctx, &SeaweedMessaging_ServiceDesc.Streams[0], SeaweedMessaging_PublisherToPubBalancer_FullMethodName, opts...) +func (c *seaweedMessagingClient) PublisherToPubBalancer(ctx context.Context, opts ...grpc.CallOption) (grpc.BidiStreamingClient[PublisherToPubBalancerRequest, PublisherToPubBalancerResponse], error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) + stream, err := c.cc.NewStream(ctx, &SeaweedMessaging_ServiceDesc.Streams[0], SeaweedMessaging_PublisherToPubBalancer_FullMethodName, cOpts...) if err != nil { return nil, err } - x := &seaweedMessagingPublisherToPubBalancerClient{stream} + x := &grpc.GenericClientStream[PublisherToPubBalancerRequest, PublisherToPubBalancerResponse]{ClientStream: stream} return x, nil } -type SeaweedMessaging_PublisherToPubBalancerClient interface { - Send(*PublisherToPubBalancerRequest) error - Recv() (*PublisherToPubBalancerResponse, error) - grpc.ClientStream -} - -type seaweedMessagingPublisherToPubBalancerClient struct { - grpc.ClientStream -} - -func (x *seaweedMessagingPublisherToPubBalancerClient) Send(m *PublisherToPubBalancerRequest) error { - return x.ClientStream.SendMsg(m) -} - -func (x *seaweedMessagingPublisherToPubBalancerClient) Recv() (*PublisherToPubBalancerResponse, error) { - m := new(PublisherToPubBalancerResponse) - if err := x.ClientStream.RecvMsg(m); err != nil { - return nil, err - } - return m, nil -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type SeaweedMessaging_PublisherToPubBalancerClient = grpc.BidiStreamingClient[PublisherToPubBalancerRequest, PublisherToPubBalancerResponse] func (c *seaweedMessagingClient) BalanceTopics(ctx context.Context, in *BalanceTopicsRequest, opts ...grpc.CallOption) (*BalanceTopicsResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(BalanceTopicsResponse) - err := c.cc.Invoke(ctx, SeaweedMessaging_BalanceTopics_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, SeaweedMessaging_BalanceTopics_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -120,8 +104,9 @@ func (c *seaweedMessagingClient) BalanceTopics(ctx context.Context, in *BalanceT } func (c *seaweedMessagingClient) ListTopics(ctx context.Context, in *ListTopicsRequest, opts ...grpc.CallOption) (*ListTopicsResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(ListTopicsResponse) - err := c.cc.Invoke(ctx, SeaweedMessaging_ListTopics_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, SeaweedMessaging_ListTopics_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -129,8 +114,9 @@ func (c *seaweedMessagingClient) ListTopics(ctx context.Context, in *ListTopicsR } func (c *seaweedMessagingClient) ConfigureTopic(ctx context.Context, in *ConfigureTopicRequest, opts ...grpc.CallOption) (*ConfigureTopicResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(ConfigureTopicResponse) - err := c.cc.Invoke(ctx, SeaweedMessaging_ConfigureTopic_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, SeaweedMessaging_ConfigureTopic_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -138,8 +124,9 @@ func (c *seaweedMessagingClient) ConfigureTopic(ctx context.Context, in *Configu } func (c *seaweedMessagingClient) LookupTopicBrokers(ctx context.Context, in *LookupTopicBrokersRequest, opts ...grpc.CallOption) (*LookupTopicBrokersResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(LookupTopicBrokersResponse) - err := c.cc.Invoke(ctx, SeaweedMessaging_LookupTopicBrokers_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, SeaweedMessaging_LookupTopicBrokers_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -147,8 +134,9 @@ func (c *seaweedMessagingClient) LookupTopicBrokers(ctx context.Context, in *Loo } func (c *seaweedMessagingClient) AssignTopicPartitions(ctx context.Context, in *AssignTopicPartitionsRequest, opts ...grpc.CallOption) (*AssignTopicPartitionsResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(AssignTopicPartitionsResponse) - err := c.cc.Invoke(ctx, SeaweedMessaging_AssignTopicPartitions_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, SeaweedMessaging_AssignTopicPartitions_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -156,8 +144,9 @@ func (c *seaweedMessagingClient) AssignTopicPartitions(ctx context.Context, in * } func (c *seaweedMessagingClient) ClosePublishers(ctx context.Context, in *ClosePublishersRequest, opts ...grpc.CallOption) (*ClosePublishersResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(ClosePublishersResponse) - err := c.cc.Invoke(ctx, SeaweedMessaging_ClosePublishers_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, SeaweedMessaging_ClosePublishers_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -165,180 +154,88 @@ func (c *seaweedMessagingClient) ClosePublishers(ctx context.Context, in *CloseP } func (c *seaweedMessagingClient) CloseSubscribers(ctx context.Context, in *CloseSubscribersRequest, opts ...grpc.CallOption) (*CloseSubscribersResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(CloseSubscribersResponse) - err := c.cc.Invoke(ctx, SeaweedMessaging_CloseSubscribers_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, SeaweedMessaging_CloseSubscribers_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } return out, nil } -func (c *seaweedMessagingClient) SubscriberToSubCoordinator(ctx context.Context, opts ...grpc.CallOption) (SeaweedMessaging_SubscriberToSubCoordinatorClient, error) { - stream, err := c.cc.NewStream(ctx, &SeaweedMessaging_ServiceDesc.Streams[1], SeaweedMessaging_SubscriberToSubCoordinator_FullMethodName, opts...) +func (c *seaweedMessagingClient) SubscriberToSubCoordinator(ctx context.Context, opts ...grpc.CallOption) (grpc.BidiStreamingClient[SubscriberToSubCoordinatorRequest, SubscriberToSubCoordinatorResponse], error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) + stream, err := c.cc.NewStream(ctx, &SeaweedMessaging_ServiceDesc.Streams[1], SeaweedMessaging_SubscriberToSubCoordinator_FullMethodName, cOpts...) if err != nil { return nil, err } - x := &seaweedMessagingSubscriberToSubCoordinatorClient{stream} + x := &grpc.GenericClientStream[SubscriberToSubCoordinatorRequest, SubscriberToSubCoordinatorResponse]{ClientStream: stream} return x, nil } -type SeaweedMessaging_SubscriberToSubCoordinatorClient interface { - Send(*SubscriberToSubCoordinatorRequest) error - Recv() (*SubscriberToSubCoordinatorResponse, error) - grpc.ClientStream -} - -type seaweedMessagingSubscriberToSubCoordinatorClient struct { - grpc.ClientStream -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type SeaweedMessaging_SubscriberToSubCoordinatorClient = grpc.BidiStreamingClient[SubscriberToSubCoordinatorRequest, SubscriberToSubCoordinatorResponse] -func (x *seaweedMessagingSubscriberToSubCoordinatorClient) Send(m *SubscriberToSubCoordinatorRequest) error { - return x.ClientStream.SendMsg(m) -} - -func (x *seaweedMessagingSubscriberToSubCoordinatorClient) Recv() (*SubscriberToSubCoordinatorResponse, error) { - m := new(SubscriberToSubCoordinatorResponse) - if err := x.ClientStream.RecvMsg(m); err != nil { - return nil, err - } - return m, nil -} - -func (c *seaweedMessagingClient) PublishMessage(ctx context.Context, opts ...grpc.CallOption) (SeaweedMessaging_PublishMessageClient, error) { - stream, err := c.cc.NewStream(ctx, &SeaweedMessaging_ServiceDesc.Streams[2], SeaweedMessaging_PublishMessage_FullMethodName, opts...) +func (c *seaweedMessagingClient) PublishMessage(ctx context.Context, opts ...grpc.CallOption) (grpc.BidiStreamingClient[PublishMessageRequest, PublishMessageResponse], error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) + stream, err := c.cc.NewStream(ctx, &SeaweedMessaging_ServiceDesc.Streams[2], SeaweedMessaging_PublishMessage_FullMethodName, cOpts...) if err != nil { return nil, err } - x := &seaweedMessagingPublishMessageClient{stream} + x := &grpc.GenericClientStream[PublishMessageRequest, PublishMessageResponse]{ClientStream: stream} return x, nil } -type SeaweedMessaging_PublishMessageClient interface { - Send(*PublishMessageRequest) error - Recv() (*PublishMessageResponse, error) - grpc.ClientStream -} - -type seaweedMessagingPublishMessageClient struct { - grpc.ClientStream -} - -func (x *seaweedMessagingPublishMessageClient) Send(m *PublishMessageRequest) error { - return x.ClientStream.SendMsg(m) -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type SeaweedMessaging_PublishMessageClient = grpc.BidiStreamingClient[PublishMessageRequest, PublishMessageResponse] -func (x *seaweedMessagingPublishMessageClient) Recv() (*PublishMessageResponse, error) { - m := new(PublishMessageResponse) - if err := x.ClientStream.RecvMsg(m); err != nil { - return nil, err - } - return m, nil -} - -func (c *seaweedMessagingClient) SubscribeMessage(ctx context.Context, opts ...grpc.CallOption) (SeaweedMessaging_SubscribeMessageClient, error) { - stream, err := c.cc.NewStream(ctx, &SeaweedMessaging_ServiceDesc.Streams[3], SeaweedMessaging_SubscribeMessage_FullMethodName, opts...) +func (c *seaweedMessagingClient) SubscribeMessage(ctx context.Context, opts ...grpc.CallOption) (grpc.BidiStreamingClient[SubscribeMessageRequest, SubscribeMessageResponse], error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) + stream, err := c.cc.NewStream(ctx, &SeaweedMessaging_ServiceDesc.Streams[3], SeaweedMessaging_SubscribeMessage_FullMethodName, cOpts...) if err != nil { return nil, err } - x := &seaweedMessagingSubscribeMessageClient{stream} + x := &grpc.GenericClientStream[SubscribeMessageRequest, SubscribeMessageResponse]{ClientStream: stream} return x, nil } -type SeaweedMessaging_SubscribeMessageClient interface { - Send(*SubscribeMessageRequest) error - Recv() (*SubscribeMessageResponse, error) - grpc.ClientStream -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type SeaweedMessaging_SubscribeMessageClient = grpc.BidiStreamingClient[SubscribeMessageRequest, SubscribeMessageResponse] -type seaweedMessagingSubscribeMessageClient struct { - grpc.ClientStream -} - -func (x *seaweedMessagingSubscribeMessageClient) Send(m *SubscribeMessageRequest) error { - return x.ClientStream.SendMsg(m) -} - -func (x *seaweedMessagingSubscribeMessageClient) Recv() (*SubscribeMessageResponse, error) { - m := new(SubscribeMessageResponse) - if err := x.ClientStream.RecvMsg(m); err != nil { - return nil, err - } - return m, nil -} - -func (c *seaweedMessagingClient) PublishFollowMe(ctx context.Context, opts ...grpc.CallOption) (SeaweedMessaging_PublishFollowMeClient, error) { - stream, err := c.cc.NewStream(ctx, &SeaweedMessaging_ServiceDesc.Streams[4], SeaweedMessaging_PublishFollowMe_FullMethodName, opts...) +func (c *seaweedMessagingClient) PublishFollowMe(ctx context.Context, opts ...grpc.CallOption) (grpc.BidiStreamingClient[PublishFollowMeRequest, PublishFollowMeResponse], error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) + stream, err := c.cc.NewStream(ctx, &SeaweedMessaging_ServiceDesc.Streams[4], SeaweedMessaging_PublishFollowMe_FullMethodName, cOpts...) if err != nil { return nil, err } - x := &seaweedMessagingPublishFollowMeClient{stream} + x := &grpc.GenericClientStream[PublishFollowMeRequest, PublishFollowMeResponse]{ClientStream: stream} return x, nil } -type SeaweedMessaging_PublishFollowMeClient interface { - Send(*PublishFollowMeRequest) error - Recv() (*PublishFollowMeResponse, error) - grpc.ClientStream -} - -type seaweedMessagingPublishFollowMeClient struct { - grpc.ClientStream -} - -func (x *seaweedMessagingPublishFollowMeClient) Send(m *PublishFollowMeRequest) error { - return x.ClientStream.SendMsg(m) -} - -func (x *seaweedMessagingPublishFollowMeClient) Recv() (*PublishFollowMeResponse, error) { - m := new(PublishFollowMeResponse) - if err := x.ClientStream.RecvMsg(m); err != nil { - return nil, err - } - return m, nil -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type SeaweedMessaging_PublishFollowMeClient = grpc.BidiStreamingClient[PublishFollowMeRequest, PublishFollowMeResponse] -func (c *seaweedMessagingClient) SubscribeFollowMe(ctx context.Context, opts ...grpc.CallOption) (SeaweedMessaging_SubscribeFollowMeClient, error) { - stream, err := c.cc.NewStream(ctx, &SeaweedMessaging_ServiceDesc.Streams[5], SeaweedMessaging_SubscribeFollowMe_FullMethodName, opts...) +func (c *seaweedMessagingClient) SubscribeFollowMe(ctx context.Context, opts ...grpc.CallOption) (grpc.ClientStreamingClient[SubscribeFollowMeRequest, SubscribeFollowMeResponse], error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) + stream, err := c.cc.NewStream(ctx, &SeaweedMessaging_ServiceDesc.Streams[5], SeaweedMessaging_SubscribeFollowMe_FullMethodName, cOpts...) if err != nil { return nil, err } - x := &seaweedMessagingSubscribeFollowMeClient{stream} + x := &grpc.GenericClientStream[SubscribeFollowMeRequest, SubscribeFollowMeResponse]{ClientStream: stream} return x, nil } -type SeaweedMessaging_SubscribeFollowMeClient interface { - Send(*SubscribeFollowMeRequest) error - CloseAndRecv() (*SubscribeFollowMeResponse, error) - grpc.ClientStream -} - -type seaweedMessagingSubscribeFollowMeClient struct { - grpc.ClientStream -} - -func (x *seaweedMessagingSubscribeFollowMeClient) Send(m *SubscribeFollowMeRequest) error { - return x.ClientStream.SendMsg(m) -} - -func (x *seaweedMessagingSubscribeFollowMeClient) CloseAndRecv() (*SubscribeFollowMeResponse, error) { - if err := x.ClientStream.CloseSend(); err != nil { - return nil, err - } - m := new(SubscribeFollowMeResponse) - if err := x.ClientStream.RecvMsg(m); err != nil { - return nil, err - } - return m, nil -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type SeaweedMessaging_SubscribeFollowMeClient = grpc.ClientStreamingClient[SubscribeFollowMeRequest, SubscribeFollowMeResponse] // SeaweedMessagingServer is the server API for SeaweedMessaging service. // All implementations must embed UnimplementedSeaweedMessagingServer -// for forward compatibility +// for forward compatibility. type SeaweedMessagingServer interface { // control plane FindBrokerLeader(context.Context, *FindBrokerLeaderRequest) (*FindBrokerLeaderResponse, error) // control plane for balancer - PublisherToPubBalancer(SeaweedMessaging_PublisherToPubBalancerServer) error + PublisherToPubBalancer(grpc.BidiStreamingServer[PublisherToPubBalancerRequest, PublisherToPubBalancerResponse]) error BalanceTopics(context.Context, *BalanceTopicsRequest) (*BalanceTopicsResponse, error) // control plane for topic partitions ListTopics(context.Context, *ListTopicsRequest) (*ListTopicsResponse, error) @@ -349,24 +246,27 @@ type SeaweedMessagingServer interface { ClosePublishers(context.Context, *ClosePublishersRequest) (*ClosePublishersResponse, error) CloseSubscribers(context.Context, *CloseSubscribersRequest) (*CloseSubscribersResponse, error) // subscriber connects to broker balancer, which coordinates with the subscribers - SubscriberToSubCoordinator(SeaweedMessaging_SubscriberToSubCoordinatorServer) error + SubscriberToSubCoordinator(grpc.BidiStreamingServer[SubscriberToSubCoordinatorRequest, SubscriberToSubCoordinatorResponse]) error // data plane for each topic partition - PublishMessage(SeaweedMessaging_PublishMessageServer) error - SubscribeMessage(SeaweedMessaging_SubscribeMessageServer) error + PublishMessage(grpc.BidiStreamingServer[PublishMessageRequest, PublishMessageResponse]) error + SubscribeMessage(grpc.BidiStreamingServer[SubscribeMessageRequest, SubscribeMessageResponse]) error // The lead broker asks a follower broker to follow itself - PublishFollowMe(SeaweedMessaging_PublishFollowMeServer) error - SubscribeFollowMe(SeaweedMessaging_SubscribeFollowMeServer) error + PublishFollowMe(grpc.BidiStreamingServer[PublishFollowMeRequest, PublishFollowMeResponse]) error + SubscribeFollowMe(grpc.ClientStreamingServer[SubscribeFollowMeRequest, SubscribeFollowMeResponse]) error mustEmbedUnimplementedSeaweedMessagingServer() } -// UnimplementedSeaweedMessagingServer must be embedded to have forward compatible implementations. -type UnimplementedSeaweedMessagingServer struct { -} +// UnimplementedSeaweedMessagingServer must be embedded to have +// forward compatible implementations. +// +// NOTE: this should be embedded by value instead of pointer to avoid a nil +// pointer dereference when methods are called. +type UnimplementedSeaweedMessagingServer struct{} func (UnimplementedSeaweedMessagingServer) FindBrokerLeader(context.Context, *FindBrokerLeaderRequest) (*FindBrokerLeaderResponse, error) { return nil, status.Errorf(codes.Unimplemented, "method FindBrokerLeader not implemented") } -func (UnimplementedSeaweedMessagingServer) PublisherToPubBalancer(SeaweedMessaging_PublisherToPubBalancerServer) error { +func (UnimplementedSeaweedMessagingServer) PublisherToPubBalancer(grpc.BidiStreamingServer[PublisherToPubBalancerRequest, PublisherToPubBalancerResponse]) error { return status.Errorf(codes.Unimplemented, "method PublisherToPubBalancer not implemented") } func (UnimplementedSeaweedMessagingServer) BalanceTopics(context.Context, *BalanceTopicsRequest) (*BalanceTopicsResponse, error) { @@ -390,22 +290,23 @@ func (UnimplementedSeaweedMessagingServer) ClosePublishers(context.Context, *Clo func (UnimplementedSeaweedMessagingServer) CloseSubscribers(context.Context, *CloseSubscribersRequest) (*CloseSubscribersResponse, error) { return nil, status.Errorf(codes.Unimplemented, "method CloseSubscribers not implemented") } -func (UnimplementedSeaweedMessagingServer) SubscriberToSubCoordinator(SeaweedMessaging_SubscriberToSubCoordinatorServer) error { +func (UnimplementedSeaweedMessagingServer) SubscriberToSubCoordinator(grpc.BidiStreamingServer[SubscriberToSubCoordinatorRequest, SubscriberToSubCoordinatorResponse]) error { return status.Errorf(codes.Unimplemented, "method SubscriberToSubCoordinator not implemented") } -func (UnimplementedSeaweedMessagingServer) PublishMessage(SeaweedMessaging_PublishMessageServer) error { +func (UnimplementedSeaweedMessagingServer) PublishMessage(grpc.BidiStreamingServer[PublishMessageRequest, PublishMessageResponse]) error { return status.Errorf(codes.Unimplemented, "method PublishMessage not implemented") } -func (UnimplementedSeaweedMessagingServer) SubscribeMessage(SeaweedMessaging_SubscribeMessageServer) error { +func (UnimplementedSeaweedMessagingServer) SubscribeMessage(grpc.BidiStreamingServer[SubscribeMessageRequest, SubscribeMessageResponse]) error { return status.Errorf(codes.Unimplemented, "method SubscribeMessage not implemented") } -func (UnimplementedSeaweedMessagingServer) PublishFollowMe(SeaweedMessaging_PublishFollowMeServer) error { +func (UnimplementedSeaweedMessagingServer) PublishFollowMe(grpc.BidiStreamingServer[PublishFollowMeRequest, PublishFollowMeResponse]) error { return status.Errorf(codes.Unimplemented, "method PublishFollowMe not implemented") } -func (UnimplementedSeaweedMessagingServer) SubscribeFollowMe(SeaweedMessaging_SubscribeFollowMeServer) error { +func (UnimplementedSeaweedMessagingServer) SubscribeFollowMe(grpc.ClientStreamingServer[SubscribeFollowMeRequest, SubscribeFollowMeResponse]) error { return status.Errorf(codes.Unimplemented, "method SubscribeFollowMe not implemented") } func (UnimplementedSeaweedMessagingServer) mustEmbedUnimplementedSeaweedMessagingServer() {} +func (UnimplementedSeaweedMessagingServer) testEmbeddedByValue() {} // UnsafeSeaweedMessagingServer may be embedded to opt out of forward compatibility for this service. // Use of this interface is not recommended, as added methods to SeaweedMessagingServer will @@ -415,6 +316,13 @@ type UnsafeSeaweedMessagingServer interface { } func RegisterSeaweedMessagingServer(s grpc.ServiceRegistrar, srv SeaweedMessagingServer) { + // If the following call pancis, it indicates UnimplementedSeaweedMessagingServer was + // embedded by pointer and is nil. This will cause panics if an + // unimplemented method is ever invoked, so we test this at initialization + // time to prevent it from happening at runtime later due to I/O. + if t, ok := srv.(interface{ testEmbeddedByValue() }); ok { + t.testEmbeddedByValue() + } s.RegisterService(&SeaweedMessaging_ServiceDesc, srv) } @@ -437,30 +345,11 @@ func _SeaweedMessaging_FindBrokerLeader_Handler(srv interface{}, ctx context.Con } func _SeaweedMessaging_PublisherToPubBalancer_Handler(srv interface{}, stream grpc.ServerStream) error { - return srv.(SeaweedMessagingServer).PublisherToPubBalancer(&seaweedMessagingPublisherToPubBalancerServer{stream}) -} - -type SeaweedMessaging_PublisherToPubBalancerServer interface { - Send(*PublisherToPubBalancerResponse) error - Recv() (*PublisherToPubBalancerRequest, error) - grpc.ServerStream -} - -type seaweedMessagingPublisherToPubBalancerServer struct { - grpc.ServerStream -} - -func (x *seaweedMessagingPublisherToPubBalancerServer) Send(m *PublisherToPubBalancerResponse) error { - return x.ServerStream.SendMsg(m) + return srv.(SeaweedMessagingServer).PublisherToPubBalancer(&grpc.GenericServerStream[PublisherToPubBalancerRequest, PublisherToPubBalancerResponse]{ServerStream: stream}) } -func (x *seaweedMessagingPublisherToPubBalancerServer) Recv() (*PublisherToPubBalancerRequest, error) { - m := new(PublisherToPubBalancerRequest) - if err := x.ServerStream.RecvMsg(m); err != nil { - return nil, err - } - return m, nil -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type SeaweedMessaging_PublisherToPubBalancerServer = grpc.BidiStreamingServer[PublisherToPubBalancerRequest, PublisherToPubBalancerResponse] func _SeaweedMessaging_BalanceTopics_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) { in := new(BalanceTopicsRequest) @@ -589,134 +478,39 @@ func _SeaweedMessaging_CloseSubscribers_Handler(srv interface{}, ctx context.Con } func _SeaweedMessaging_SubscriberToSubCoordinator_Handler(srv interface{}, stream grpc.ServerStream) error { - return srv.(SeaweedMessagingServer).SubscriberToSubCoordinator(&seaweedMessagingSubscriberToSubCoordinatorServer{stream}) -} - -type SeaweedMessaging_SubscriberToSubCoordinatorServer interface { - Send(*SubscriberToSubCoordinatorResponse) error - Recv() (*SubscriberToSubCoordinatorRequest, error) - grpc.ServerStream -} - -type seaweedMessagingSubscriberToSubCoordinatorServer struct { - grpc.ServerStream + return srv.(SeaweedMessagingServer).SubscriberToSubCoordinator(&grpc.GenericServerStream[SubscriberToSubCoordinatorRequest, SubscriberToSubCoordinatorResponse]{ServerStream: stream}) } -func (x *seaweedMessagingSubscriberToSubCoordinatorServer) Send(m *SubscriberToSubCoordinatorResponse) error { - return x.ServerStream.SendMsg(m) -} - -func (x *seaweedMessagingSubscriberToSubCoordinatorServer) Recv() (*SubscriberToSubCoordinatorRequest, error) { - m := new(SubscriberToSubCoordinatorRequest) - if err := x.ServerStream.RecvMsg(m); err != nil { - return nil, err - } - return m, nil -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type SeaweedMessaging_SubscriberToSubCoordinatorServer = grpc.BidiStreamingServer[SubscriberToSubCoordinatorRequest, SubscriberToSubCoordinatorResponse] func _SeaweedMessaging_PublishMessage_Handler(srv interface{}, stream grpc.ServerStream) error { - return srv.(SeaweedMessagingServer).PublishMessage(&seaweedMessagingPublishMessageServer{stream}) -} - -type SeaweedMessaging_PublishMessageServer interface { - Send(*PublishMessageResponse) error - Recv() (*PublishMessageRequest, error) - grpc.ServerStream -} - -type seaweedMessagingPublishMessageServer struct { - grpc.ServerStream + return srv.(SeaweedMessagingServer).PublishMessage(&grpc.GenericServerStream[PublishMessageRequest, PublishMessageResponse]{ServerStream: stream}) } -func (x *seaweedMessagingPublishMessageServer) Send(m *PublishMessageResponse) error { - return x.ServerStream.SendMsg(m) -} - -func (x *seaweedMessagingPublishMessageServer) Recv() (*PublishMessageRequest, error) { - m := new(PublishMessageRequest) - if err := x.ServerStream.RecvMsg(m); err != nil { - return nil, err - } - return m, nil -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type SeaweedMessaging_PublishMessageServer = grpc.BidiStreamingServer[PublishMessageRequest, PublishMessageResponse] func _SeaweedMessaging_SubscribeMessage_Handler(srv interface{}, stream grpc.ServerStream) error { - return srv.(SeaweedMessagingServer).SubscribeMessage(&seaweedMessagingSubscribeMessageServer{stream}) -} - -type SeaweedMessaging_SubscribeMessageServer interface { - Send(*SubscribeMessageResponse) error - Recv() (*SubscribeMessageRequest, error) - grpc.ServerStream -} - -type seaweedMessagingSubscribeMessageServer struct { - grpc.ServerStream -} - -func (x *seaweedMessagingSubscribeMessageServer) Send(m *SubscribeMessageResponse) error { - return x.ServerStream.SendMsg(m) + return srv.(SeaweedMessagingServer).SubscribeMessage(&grpc.GenericServerStream[SubscribeMessageRequest, SubscribeMessageResponse]{ServerStream: stream}) } -func (x *seaweedMessagingSubscribeMessageServer) Recv() (*SubscribeMessageRequest, error) { - m := new(SubscribeMessageRequest) - if err := x.ServerStream.RecvMsg(m); err != nil { - return nil, err - } - return m, nil -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type SeaweedMessaging_SubscribeMessageServer = grpc.BidiStreamingServer[SubscribeMessageRequest, SubscribeMessageResponse] func _SeaweedMessaging_PublishFollowMe_Handler(srv interface{}, stream grpc.ServerStream) error { - return srv.(SeaweedMessagingServer).PublishFollowMe(&seaweedMessagingPublishFollowMeServer{stream}) -} - -type SeaweedMessaging_PublishFollowMeServer interface { - Send(*PublishFollowMeResponse) error - Recv() (*PublishFollowMeRequest, error) - grpc.ServerStream -} - -type seaweedMessagingPublishFollowMeServer struct { - grpc.ServerStream + return srv.(SeaweedMessagingServer).PublishFollowMe(&grpc.GenericServerStream[PublishFollowMeRequest, PublishFollowMeResponse]{ServerStream: stream}) } -func (x *seaweedMessagingPublishFollowMeServer) Send(m *PublishFollowMeResponse) error { - return x.ServerStream.SendMsg(m) -} - -func (x *seaweedMessagingPublishFollowMeServer) Recv() (*PublishFollowMeRequest, error) { - m := new(PublishFollowMeRequest) - if err := x.ServerStream.RecvMsg(m); err != nil { - return nil, err - } - return m, nil -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type SeaweedMessaging_PublishFollowMeServer = grpc.BidiStreamingServer[PublishFollowMeRequest, PublishFollowMeResponse] func _SeaweedMessaging_SubscribeFollowMe_Handler(srv interface{}, stream grpc.ServerStream) error { - return srv.(SeaweedMessagingServer).SubscribeFollowMe(&seaweedMessagingSubscribeFollowMeServer{stream}) -} - -type SeaweedMessaging_SubscribeFollowMeServer interface { - SendAndClose(*SubscribeFollowMeResponse) error - Recv() (*SubscribeFollowMeRequest, error) - grpc.ServerStream + return srv.(SeaweedMessagingServer).SubscribeFollowMe(&grpc.GenericServerStream[SubscribeFollowMeRequest, SubscribeFollowMeResponse]{ServerStream: stream}) } -type seaweedMessagingSubscribeFollowMeServer struct { - grpc.ServerStream -} - -func (x *seaweedMessagingSubscribeFollowMeServer) SendAndClose(m *SubscribeFollowMeResponse) error { - return x.ServerStream.SendMsg(m) -} - -func (x *seaweedMessagingSubscribeFollowMeServer) Recv() (*SubscribeFollowMeRequest, error) { - m := new(SubscribeFollowMeRequest) - if err := x.ServerStream.RecvMsg(m); err != nil { - return nil, err - } - return m, nil -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type SeaweedMessaging_SubscribeFollowMeServer = grpc.ClientStreamingServer[SubscribeFollowMeRequest, SubscribeFollowMeResponse] // SeaweedMessaging_ServiceDesc is the grpc.ServiceDesc for SeaweedMessaging service. // It's only intended for direct use with grpc.RegisterService, diff --git a/weed/pb/remote_pb/remote.pb.go b/weed/pb/remote_pb/remote.pb.go index 870db5ad2..94e2f6ed9 100644 --- a/weed/pb/remote_pb/remote.pb.go +++ b/weed/pb/remote_pb/remote.pb.go @@ -1,7 +1,7 @@ // Code generated by protoc-gen-go. DO NOT EDIT. // versions: -// protoc-gen-go v1.32.0 -// protoc v4.25.3 +// protoc-gen-go v1.34.2 +// protoc v5.28.1 // source: remote.proto package remote_pb @@ -685,7 +685,7 @@ func file_remote_proto_rawDescGZIP() []byte { } var file_remote_proto_msgTypes = make([]protoimpl.MessageInfo, 4) -var file_remote_proto_goTypes = []interface{}{ +var file_remote_proto_goTypes = []any{ (*RemoteConf)(nil), // 0: remote_pb.RemoteConf (*RemoteStorageMapping)(nil), // 1: remote_pb.RemoteStorageMapping (*RemoteStorageLocation)(nil), // 2: remote_pb.RemoteStorageLocation @@ -707,7 +707,7 @@ func file_remote_proto_init() { return } if !protoimpl.UnsafeEnabled { - file_remote_proto_msgTypes[0].Exporter = func(v interface{}, i int) interface{} { + file_remote_proto_msgTypes[0].Exporter = func(v any, i int) any { switch v := v.(*RemoteConf); i { case 0: return &v.state @@ -719,7 +719,7 @@ func file_remote_proto_init() { return nil } } - file_remote_proto_msgTypes[1].Exporter = func(v interface{}, i int) interface{} { + file_remote_proto_msgTypes[1].Exporter = func(v any, i int) any { switch v := v.(*RemoteStorageMapping); i { case 0: return &v.state @@ -731,7 +731,7 @@ func file_remote_proto_init() { return nil } } - file_remote_proto_msgTypes[2].Exporter = func(v interface{}, i int) interface{} { + file_remote_proto_msgTypes[2].Exporter = func(v any, i int) any { switch v := v.(*RemoteStorageLocation); i { case 0: return &v.state diff --git a/weed/pb/s3_pb/s3.pb.go b/weed/pb/s3_pb/s3.pb.go index c9fca3d2b..fad0c1fb8 100644 --- a/weed/pb/s3_pb/s3.pb.go +++ b/weed/pb/s3_pb/s3.pb.go @@ -1,7 +1,7 @@ // Code generated by protoc-gen-go. DO NOT EDIT. // versions: -// protoc-gen-go v1.32.0 -// protoc v4.25.3 +// protoc-gen-go v1.34.2 +// protoc v5.28.1 // source: s3.proto package s3_pb @@ -282,7 +282,7 @@ func file_s3_proto_rawDescGZIP() []byte { } var file_s3_proto_msgTypes = make([]protoimpl.MessageInfo, 6) -var file_s3_proto_goTypes = []interface{}{ +var file_s3_proto_goTypes = []any{ (*S3ConfigureRequest)(nil), // 0: messaging_pb.S3ConfigureRequest (*S3ConfigureResponse)(nil), // 1: messaging_pb.S3ConfigureResponse (*S3CircuitBreakerConfig)(nil), // 2: messaging_pb.S3CircuitBreakerConfig @@ -310,7 +310,7 @@ func file_s3_proto_init() { return } if !protoimpl.UnsafeEnabled { - file_s3_proto_msgTypes[0].Exporter = func(v interface{}, i int) interface{} { + file_s3_proto_msgTypes[0].Exporter = func(v any, i int) any { switch v := v.(*S3ConfigureRequest); i { case 0: return &v.state @@ -322,7 +322,7 @@ func file_s3_proto_init() { return nil } } - file_s3_proto_msgTypes[1].Exporter = func(v interface{}, i int) interface{} { + file_s3_proto_msgTypes[1].Exporter = func(v any, i int) any { switch v := v.(*S3ConfigureResponse); i { case 0: return &v.state @@ -334,7 +334,7 @@ func file_s3_proto_init() { return nil } } - file_s3_proto_msgTypes[2].Exporter = func(v interface{}, i int) interface{} { + file_s3_proto_msgTypes[2].Exporter = func(v any, i int) any { switch v := v.(*S3CircuitBreakerConfig); i { case 0: return &v.state @@ -346,7 +346,7 @@ func file_s3_proto_init() { return nil } } - file_s3_proto_msgTypes[3].Exporter = func(v interface{}, i int) interface{} { + file_s3_proto_msgTypes[3].Exporter = func(v any, i int) any { switch v := v.(*S3CircuitBreakerOptions); i { case 0: return &v.state diff --git a/weed/pb/s3_pb/s3_grpc.pb.go b/weed/pb/s3_pb/s3_grpc.pb.go index 2fedf571b..054b84307 100644 --- a/weed/pb/s3_pb/s3_grpc.pb.go +++ b/weed/pb/s3_pb/s3_grpc.pb.go @@ -1,7 +1,7 @@ // Code generated by protoc-gen-go-grpc. DO NOT EDIT. // versions: -// - protoc-gen-go-grpc v1.3.0 -// - protoc v4.25.3 +// - protoc-gen-go-grpc v1.5.1 +// - protoc v5.28.1 // source: s3.proto package s3_pb @@ -15,8 +15,8 @@ import ( // This is a compile-time assertion to ensure that this generated file // is compatible with the grpc package it is being compiled against. -// Requires gRPC-Go v1.32.0 or later. -const _ = grpc.SupportPackageIsVersion7 +// Requires gRPC-Go v1.64.0 or later. +const _ = grpc.SupportPackageIsVersion9 const ( SeaweedS3_Configure_FullMethodName = "/messaging_pb.SeaweedS3/Configure" @@ -38,8 +38,9 @@ func NewSeaweedS3Client(cc grpc.ClientConnInterface) SeaweedS3Client { } func (c *seaweedS3Client) Configure(ctx context.Context, in *S3ConfigureRequest, opts ...grpc.CallOption) (*S3ConfigureResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(S3ConfigureResponse) - err := c.cc.Invoke(ctx, SeaweedS3_Configure_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, SeaweedS3_Configure_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -48,20 +49,24 @@ func (c *seaweedS3Client) Configure(ctx context.Context, in *S3ConfigureRequest, // SeaweedS3Server is the server API for SeaweedS3 service. // All implementations must embed UnimplementedSeaweedS3Server -// for forward compatibility +// for forward compatibility. type SeaweedS3Server interface { Configure(context.Context, *S3ConfigureRequest) (*S3ConfigureResponse, error) mustEmbedUnimplementedSeaweedS3Server() } -// UnimplementedSeaweedS3Server must be embedded to have forward compatible implementations. -type UnimplementedSeaweedS3Server struct { -} +// UnimplementedSeaweedS3Server must be embedded to have +// forward compatible implementations. +// +// NOTE: this should be embedded by value instead of pointer to avoid a nil +// pointer dereference when methods are called. +type UnimplementedSeaweedS3Server struct{} func (UnimplementedSeaweedS3Server) Configure(context.Context, *S3ConfigureRequest) (*S3ConfigureResponse, error) { return nil, status.Errorf(codes.Unimplemented, "method Configure not implemented") } func (UnimplementedSeaweedS3Server) mustEmbedUnimplementedSeaweedS3Server() {} +func (UnimplementedSeaweedS3Server) testEmbeddedByValue() {} // UnsafeSeaweedS3Server may be embedded to opt out of forward compatibility for this service. // Use of this interface is not recommended, as added methods to SeaweedS3Server will @@ -71,6 +76,13 @@ type UnsafeSeaweedS3Server interface { } func RegisterSeaweedS3Server(s grpc.ServiceRegistrar, srv SeaweedS3Server) { + // If the following call pancis, it indicates UnimplementedSeaweedS3Server was + // embedded by pointer and is nil. This will cause panics if an + // unimplemented method is ever invoked, so we test this at initialization + // time to prevent it from happening at runtime later due to I/O. + if t, ok := srv.(interface{ testEmbeddedByValue() }); ok { + t.testEmbeddedByValue() + } s.RegisterService(&SeaweedS3_ServiceDesc, srv) } diff --git a/weed/pb/schema_pb/schema.pb.go b/weed/pb/schema_pb/schema.pb.go index 4d9b0176f..8ea9bb739 100644 --- a/weed/pb/schema_pb/schema.pb.go +++ b/weed/pb/schema_pb/schema.pb.go @@ -1,7 +1,7 @@ // Code generated by protoc-gen-go. DO NOT EDIT. // versions: -// protoc-gen-go v1.32.0 -// protoc v4.25.3 +// protoc-gen-go v1.34.2 +// protoc v5.28.1 // source: schema.proto package schema_pb @@ -722,7 +722,7 @@ func file_schema_proto_rawDescGZIP() []byte { var file_schema_proto_enumTypes = make([]protoimpl.EnumInfo, 1) var file_schema_proto_msgTypes = make([]protoimpl.MessageInfo, 8) -var file_schema_proto_goTypes = []interface{}{ +var file_schema_proto_goTypes = []any{ (ScalarType)(0), // 0: schema_pb.ScalarType (*RecordType)(nil), // 1: schema_pb.RecordType (*Field)(nil), // 2: schema_pb.Field @@ -758,7 +758,7 @@ func file_schema_proto_init() { return } if !protoimpl.UnsafeEnabled { - file_schema_proto_msgTypes[0].Exporter = func(v interface{}, i int) interface{} { + file_schema_proto_msgTypes[0].Exporter = func(v any, i int) any { switch v := v.(*RecordType); i { case 0: return &v.state @@ -770,7 +770,7 @@ func file_schema_proto_init() { return nil } } - file_schema_proto_msgTypes[1].Exporter = func(v interface{}, i int) interface{} { + file_schema_proto_msgTypes[1].Exporter = func(v any, i int) any { switch v := v.(*Field); i { case 0: return &v.state @@ -782,7 +782,7 @@ func file_schema_proto_init() { return nil } } - file_schema_proto_msgTypes[2].Exporter = func(v interface{}, i int) interface{} { + file_schema_proto_msgTypes[2].Exporter = func(v any, i int) any { switch v := v.(*Type); i { case 0: return &v.state @@ -794,7 +794,7 @@ func file_schema_proto_init() { return nil } } - file_schema_proto_msgTypes[3].Exporter = func(v interface{}, i int) interface{} { + file_schema_proto_msgTypes[3].Exporter = func(v any, i int) any { switch v := v.(*ListType); i { case 0: return &v.state @@ -806,7 +806,7 @@ func file_schema_proto_init() { return nil } } - file_schema_proto_msgTypes[4].Exporter = func(v interface{}, i int) interface{} { + file_schema_proto_msgTypes[4].Exporter = func(v any, i int) any { switch v := v.(*RecordValue); i { case 0: return &v.state @@ -818,7 +818,7 @@ func file_schema_proto_init() { return nil } } - file_schema_proto_msgTypes[5].Exporter = func(v interface{}, i int) interface{} { + file_schema_proto_msgTypes[5].Exporter = func(v any, i int) any { switch v := v.(*Value); i { case 0: return &v.state @@ -830,7 +830,7 @@ func file_schema_proto_init() { return nil } } - file_schema_proto_msgTypes[6].Exporter = func(v interface{}, i int) interface{} { + file_schema_proto_msgTypes[6].Exporter = func(v any, i int) any { switch v := v.(*ListValue); i { case 0: return &v.state @@ -843,12 +843,12 @@ func file_schema_proto_init() { } } } - file_schema_proto_msgTypes[2].OneofWrappers = []interface{}{ + file_schema_proto_msgTypes[2].OneofWrappers = []any{ (*Type_ScalarType)(nil), (*Type_RecordType)(nil), (*Type_ListType)(nil), } - file_schema_proto_msgTypes[5].OneofWrappers = []interface{}{ + file_schema_proto_msgTypes[5].OneofWrappers = []any{ (*Value_BoolValue)(nil), (*Value_Int32Value)(nil), (*Value_Int64Value)(nil), diff --git a/weed/pb/volume_server.proto b/weed/pb/volume_server.proto index 372ce37ac..d5071a5be 100644 --- a/weed/pb/volume_server.proto +++ b/weed/pb/volume_server.proto @@ -475,12 +475,21 @@ message RemoteFile { string extension = 7; } message VolumeInfo { + repeated RemoteFile files = 1; + uint32 version = 2; + string replication = 3; + uint32 bytes_offset = 4; + int64 dat_file_size = 5; // store the original dat file size + uint64 expire_at_sec = 6; // expiration time of ec volume + bool read_only = 7; +} +message OldVersionVolumeInfo { repeated RemoteFile files = 1; uint32 version = 2; string replication = 3; uint32 BytesOffset = 4; - int64 dat_file_size = 5; // used for EC encoded volumes to store the original file size - uint64 DestroyTime = 6; // used to record the destruction time of ec volume + int64 dat_file_size = 5; // store the original dat file size + uint64 DestroyTime = 6; // expiration time of ec volume bool read_only = 7; } diff --git a/weed/pb/volume_server_pb/volume_server.pb.go b/weed/pb/volume_server_pb/volume_server.pb.go index 0757f01c4..5492e71d4 100644 --- a/weed/pb/volume_server_pb/volume_server.pb.go +++ b/weed/pb/volume_server_pb/volume_server.pb.go @@ -1,7 +1,7 @@ // Code generated by protoc-gen-go. DO NOT EDIT. // versions: -// protoc-gen-go v1.32.0 -// protoc v4.25.3 +// protoc-gen-go v1.34.2 +// protoc v5.28.1 // source: volume_server.proto package volume_server_pb @@ -4235,9 +4235,9 @@ type VolumeInfo struct { Files []*RemoteFile `protobuf:"bytes,1,rep,name=files,proto3" json:"files,omitempty"` Version uint32 `protobuf:"varint,2,opt,name=version,proto3" json:"version,omitempty"` Replication string `protobuf:"bytes,3,opt,name=replication,proto3" json:"replication,omitempty"` - BytesOffset uint32 `protobuf:"varint,4,opt,name=BytesOffset,proto3" json:"BytesOffset,omitempty"` - DatFileSize int64 `protobuf:"varint,5,opt,name=dat_file_size,json=datFileSize,proto3" json:"dat_file_size,omitempty"` // used for EC encoded volumes to store the original file size - DestroyTime uint64 `protobuf:"varint,6,opt,name=DestroyTime,proto3" json:"DestroyTime,omitempty"` // used to record the destruction time of ec volume + BytesOffset uint32 `protobuf:"varint,4,opt,name=bytes_offset,json=bytesOffset,proto3" json:"bytes_offset,omitempty"` + DatFileSize int64 `protobuf:"varint,5,opt,name=dat_file_size,json=datFileSize,proto3" json:"dat_file_size,omitempty"` // store the original dat file size + ExpireAtSec uint64 `protobuf:"varint,6,opt,name=expire_at_sec,json=expireAtSec,proto3" json:"expire_at_sec,omitempty"` // expiration time of ec volume ReadOnly bool `protobuf:"varint,7,opt,name=read_only,json=readOnly,proto3" json:"read_only,omitempty"` } @@ -4308,9 +4308,9 @@ func (x *VolumeInfo) GetDatFileSize() int64 { return 0 } -func (x *VolumeInfo) GetDestroyTime() uint64 { +func (x *VolumeInfo) GetExpireAtSec() uint64 { if x != nil { - return x.DestroyTime + return x.ExpireAtSec } return 0 } @@ -4322,6 +4322,101 @@ func (x *VolumeInfo) GetReadOnly() bool { return false } +type OldVersionVolumeInfo struct { + state protoimpl.MessageState + sizeCache protoimpl.SizeCache + unknownFields protoimpl.UnknownFields + + Files []*RemoteFile `protobuf:"bytes,1,rep,name=files,proto3" json:"files,omitempty"` + Version uint32 `protobuf:"varint,2,opt,name=version,proto3" json:"version,omitempty"` + Replication string `protobuf:"bytes,3,opt,name=replication,proto3" json:"replication,omitempty"` + BytesOffset uint32 `protobuf:"varint,4,opt,name=BytesOffset,proto3" json:"BytesOffset,omitempty"` + DatFileSize int64 `protobuf:"varint,5,opt,name=dat_file_size,json=datFileSize,proto3" json:"dat_file_size,omitempty"` // store the original dat file size + DestroyTime uint64 `protobuf:"varint,6,opt,name=DestroyTime,proto3" json:"DestroyTime,omitempty"` // expiration time of ec volume + ReadOnly bool `protobuf:"varint,7,opt,name=read_only,json=readOnly,proto3" json:"read_only,omitempty"` +} + +func (x *OldVersionVolumeInfo) Reset() { + *x = OldVersionVolumeInfo{} + if protoimpl.UnsafeEnabled { + mi := &file_volume_server_proto_msgTypes[74] + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + ms.StoreMessageInfo(mi) + } +} + +func (x *OldVersionVolumeInfo) String() string { + return protoimpl.X.MessageStringOf(x) +} + +func (*OldVersionVolumeInfo) ProtoMessage() {} + +func (x *OldVersionVolumeInfo) ProtoReflect() protoreflect.Message { + mi := &file_volume_server_proto_msgTypes[74] + if protoimpl.UnsafeEnabled && x != nil { + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + if ms.LoadMessageInfo() == nil { + ms.StoreMessageInfo(mi) + } + return ms + } + return mi.MessageOf(x) +} + +// Deprecated: Use OldVersionVolumeInfo.ProtoReflect.Descriptor instead. +func (*OldVersionVolumeInfo) Descriptor() ([]byte, []int) { + return file_volume_server_proto_rawDescGZIP(), []int{74} +} + +func (x *OldVersionVolumeInfo) GetFiles() []*RemoteFile { + if x != nil { + return x.Files + } + return nil +} + +func (x *OldVersionVolumeInfo) GetVersion() uint32 { + if x != nil { + return x.Version + } + return 0 +} + +func (x *OldVersionVolumeInfo) GetReplication() string { + if x != nil { + return x.Replication + } + return "" +} + +func (x *OldVersionVolumeInfo) GetBytesOffset() uint32 { + if x != nil { + return x.BytesOffset + } + return 0 +} + +func (x *OldVersionVolumeInfo) GetDatFileSize() int64 { + if x != nil { + return x.DatFileSize + } + return 0 +} + +func (x *OldVersionVolumeInfo) GetDestroyTime() uint64 { + if x != nil { + return x.DestroyTime + } + return 0 +} + +func (x *OldVersionVolumeInfo) GetReadOnly() bool { + if x != nil { + return x.ReadOnly + } + return false +} + // tiered storage type VolumeTierMoveDatToRemoteRequest struct { state protoimpl.MessageState @@ -4337,7 +4432,7 @@ type VolumeTierMoveDatToRemoteRequest struct { func (x *VolumeTierMoveDatToRemoteRequest) Reset() { *x = VolumeTierMoveDatToRemoteRequest{} if protoimpl.UnsafeEnabled { - mi := &file_volume_server_proto_msgTypes[74] + mi := &file_volume_server_proto_msgTypes[75] ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) ms.StoreMessageInfo(mi) } @@ -4350,7 +4445,7 @@ func (x *VolumeTierMoveDatToRemoteRequest) String() string { func (*VolumeTierMoveDatToRemoteRequest) ProtoMessage() {} func (x *VolumeTierMoveDatToRemoteRequest) ProtoReflect() protoreflect.Message { - mi := &file_volume_server_proto_msgTypes[74] + mi := &file_volume_server_proto_msgTypes[75] if protoimpl.UnsafeEnabled && x != nil { ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) if ms.LoadMessageInfo() == nil { @@ -4363,7 +4458,7 @@ func (x *VolumeTierMoveDatToRemoteRequest) ProtoReflect() protoreflect.Message { // Deprecated: Use VolumeTierMoveDatToRemoteRequest.ProtoReflect.Descriptor instead. func (*VolumeTierMoveDatToRemoteRequest) Descriptor() ([]byte, []int) { - return file_volume_server_proto_rawDescGZIP(), []int{74} + return file_volume_server_proto_rawDescGZIP(), []int{75} } func (x *VolumeTierMoveDatToRemoteRequest) GetVolumeId() uint32 { @@ -4406,7 +4501,7 @@ type VolumeTierMoveDatToRemoteResponse struct { func (x *VolumeTierMoveDatToRemoteResponse) Reset() { *x = VolumeTierMoveDatToRemoteResponse{} if protoimpl.UnsafeEnabled { - mi := &file_volume_server_proto_msgTypes[75] + mi := &file_volume_server_proto_msgTypes[76] ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) ms.StoreMessageInfo(mi) } @@ -4419,7 +4514,7 @@ func (x *VolumeTierMoveDatToRemoteResponse) String() string { func (*VolumeTierMoveDatToRemoteResponse) ProtoMessage() {} func (x *VolumeTierMoveDatToRemoteResponse) ProtoReflect() protoreflect.Message { - mi := &file_volume_server_proto_msgTypes[75] + mi := &file_volume_server_proto_msgTypes[76] if protoimpl.UnsafeEnabled && x != nil { ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) if ms.LoadMessageInfo() == nil { @@ -4432,7 +4527,7 @@ func (x *VolumeTierMoveDatToRemoteResponse) ProtoReflect() protoreflect.Message // Deprecated: Use VolumeTierMoveDatToRemoteResponse.ProtoReflect.Descriptor instead. func (*VolumeTierMoveDatToRemoteResponse) Descriptor() ([]byte, []int) { - return file_volume_server_proto_rawDescGZIP(), []int{75} + return file_volume_server_proto_rawDescGZIP(), []int{76} } func (x *VolumeTierMoveDatToRemoteResponse) GetProcessed() int64 { @@ -4462,7 +4557,7 @@ type VolumeTierMoveDatFromRemoteRequest struct { func (x *VolumeTierMoveDatFromRemoteRequest) Reset() { *x = VolumeTierMoveDatFromRemoteRequest{} if protoimpl.UnsafeEnabled { - mi := &file_volume_server_proto_msgTypes[76] + mi := &file_volume_server_proto_msgTypes[77] ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) ms.StoreMessageInfo(mi) } @@ -4475,7 +4570,7 @@ func (x *VolumeTierMoveDatFromRemoteRequest) String() string { func (*VolumeTierMoveDatFromRemoteRequest) ProtoMessage() {} func (x *VolumeTierMoveDatFromRemoteRequest) ProtoReflect() protoreflect.Message { - mi := &file_volume_server_proto_msgTypes[76] + mi := &file_volume_server_proto_msgTypes[77] if protoimpl.UnsafeEnabled && x != nil { ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) if ms.LoadMessageInfo() == nil { @@ -4488,7 +4583,7 @@ func (x *VolumeTierMoveDatFromRemoteRequest) ProtoReflect() protoreflect.Message // Deprecated: Use VolumeTierMoveDatFromRemoteRequest.ProtoReflect.Descriptor instead. func (*VolumeTierMoveDatFromRemoteRequest) Descriptor() ([]byte, []int) { - return file_volume_server_proto_rawDescGZIP(), []int{76} + return file_volume_server_proto_rawDescGZIP(), []int{77} } func (x *VolumeTierMoveDatFromRemoteRequest) GetVolumeId() uint32 { @@ -4524,7 +4619,7 @@ type VolumeTierMoveDatFromRemoteResponse struct { func (x *VolumeTierMoveDatFromRemoteResponse) Reset() { *x = VolumeTierMoveDatFromRemoteResponse{} if protoimpl.UnsafeEnabled { - mi := &file_volume_server_proto_msgTypes[77] + mi := &file_volume_server_proto_msgTypes[78] ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) ms.StoreMessageInfo(mi) } @@ -4537,7 +4632,7 @@ func (x *VolumeTierMoveDatFromRemoteResponse) String() string { func (*VolumeTierMoveDatFromRemoteResponse) ProtoMessage() {} func (x *VolumeTierMoveDatFromRemoteResponse) ProtoReflect() protoreflect.Message { - mi := &file_volume_server_proto_msgTypes[77] + mi := &file_volume_server_proto_msgTypes[78] if protoimpl.UnsafeEnabled && x != nil { ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) if ms.LoadMessageInfo() == nil { @@ -4550,7 +4645,7 @@ func (x *VolumeTierMoveDatFromRemoteResponse) ProtoReflect() protoreflect.Messag // Deprecated: Use VolumeTierMoveDatFromRemoteResponse.ProtoReflect.Descriptor instead. func (*VolumeTierMoveDatFromRemoteResponse) Descriptor() ([]byte, []int) { - return file_volume_server_proto_rawDescGZIP(), []int{77} + return file_volume_server_proto_rawDescGZIP(), []int{78} } func (x *VolumeTierMoveDatFromRemoteResponse) GetProcessed() int64 { @@ -4576,7 +4671,7 @@ type VolumeServerStatusRequest struct { func (x *VolumeServerStatusRequest) Reset() { *x = VolumeServerStatusRequest{} if protoimpl.UnsafeEnabled { - mi := &file_volume_server_proto_msgTypes[78] + mi := &file_volume_server_proto_msgTypes[79] ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) ms.StoreMessageInfo(mi) } @@ -4589,7 +4684,7 @@ func (x *VolumeServerStatusRequest) String() string { func (*VolumeServerStatusRequest) ProtoMessage() {} func (x *VolumeServerStatusRequest) ProtoReflect() protoreflect.Message { - mi := &file_volume_server_proto_msgTypes[78] + mi := &file_volume_server_proto_msgTypes[79] if protoimpl.UnsafeEnabled && x != nil { ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) if ms.LoadMessageInfo() == nil { @@ -4602,7 +4697,7 @@ func (x *VolumeServerStatusRequest) ProtoReflect() protoreflect.Message { // Deprecated: Use VolumeServerStatusRequest.ProtoReflect.Descriptor instead. func (*VolumeServerStatusRequest) Descriptor() ([]byte, []int) { - return file_volume_server_proto_rawDescGZIP(), []int{78} + return file_volume_server_proto_rawDescGZIP(), []int{79} } type VolumeServerStatusResponse struct { @@ -4620,7 +4715,7 @@ type VolumeServerStatusResponse struct { func (x *VolumeServerStatusResponse) Reset() { *x = VolumeServerStatusResponse{} if protoimpl.UnsafeEnabled { - mi := &file_volume_server_proto_msgTypes[79] + mi := &file_volume_server_proto_msgTypes[80] ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) ms.StoreMessageInfo(mi) } @@ -4633,7 +4728,7 @@ func (x *VolumeServerStatusResponse) String() string { func (*VolumeServerStatusResponse) ProtoMessage() {} func (x *VolumeServerStatusResponse) ProtoReflect() protoreflect.Message { - mi := &file_volume_server_proto_msgTypes[79] + mi := &file_volume_server_proto_msgTypes[80] if protoimpl.UnsafeEnabled && x != nil { ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) if ms.LoadMessageInfo() == nil { @@ -4646,7 +4741,7 @@ func (x *VolumeServerStatusResponse) ProtoReflect() protoreflect.Message { // Deprecated: Use VolumeServerStatusResponse.ProtoReflect.Descriptor instead. func (*VolumeServerStatusResponse) Descriptor() ([]byte, []int) { - return file_volume_server_proto_rawDescGZIP(), []int{79} + return file_volume_server_proto_rawDescGZIP(), []int{80} } func (x *VolumeServerStatusResponse) GetDiskStatuses() []*DiskStatus { @@ -4693,7 +4788,7 @@ type VolumeServerLeaveRequest struct { func (x *VolumeServerLeaveRequest) Reset() { *x = VolumeServerLeaveRequest{} if protoimpl.UnsafeEnabled { - mi := &file_volume_server_proto_msgTypes[80] + mi := &file_volume_server_proto_msgTypes[81] ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) ms.StoreMessageInfo(mi) } @@ -4706,7 +4801,7 @@ func (x *VolumeServerLeaveRequest) String() string { func (*VolumeServerLeaveRequest) ProtoMessage() {} func (x *VolumeServerLeaveRequest) ProtoReflect() protoreflect.Message { - mi := &file_volume_server_proto_msgTypes[80] + mi := &file_volume_server_proto_msgTypes[81] if protoimpl.UnsafeEnabled && x != nil { ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) if ms.LoadMessageInfo() == nil { @@ -4719,7 +4814,7 @@ func (x *VolumeServerLeaveRequest) ProtoReflect() protoreflect.Message { // Deprecated: Use VolumeServerLeaveRequest.ProtoReflect.Descriptor instead. func (*VolumeServerLeaveRequest) Descriptor() ([]byte, []int) { - return file_volume_server_proto_rawDescGZIP(), []int{80} + return file_volume_server_proto_rawDescGZIP(), []int{81} } type VolumeServerLeaveResponse struct { @@ -4731,7 +4826,7 @@ type VolumeServerLeaveResponse struct { func (x *VolumeServerLeaveResponse) Reset() { *x = VolumeServerLeaveResponse{} if protoimpl.UnsafeEnabled { - mi := &file_volume_server_proto_msgTypes[81] + mi := &file_volume_server_proto_msgTypes[82] ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) ms.StoreMessageInfo(mi) } @@ -4744,7 +4839,7 @@ func (x *VolumeServerLeaveResponse) String() string { func (*VolumeServerLeaveResponse) ProtoMessage() {} func (x *VolumeServerLeaveResponse) ProtoReflect() protoreflect.Message { - mi := &file_volume_server_proto_msgTypes[81] + mi := &file_volume_server_proto_msgTypes[82] if protoimpl.UnsafeEnabled && x != nil { ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) if ms.LoadMessageInfo() == nil { @@ -4757,7 +4852,7 @@ func (x *VolumeServerLeaveResponse) ProtoReflect() protoreflect.Message { // Deprecated: Use VolumeServerLeaveResponse.ProtoReflect.Descriptor instead. func (*VolumeServerLeaveResponse) Descriptor() ([]byte, []int) { - return file_volume_server_proto_rawDescGZIP(), []int{81} + return file_volume_server_proto_rawDescGZIP(), []int{82} } // remote storage @@ -4781,7 +4876,7 @@ type FetchAndWriteNeedleRequest struct { func (x *FetchAndWriteNeedleRequest) Reset() { *x = FetchAndWriteNeedleRequest{} if protoimpl.UnsafeEnabled { - mi := &file_volume_server_proto_msgTypes[82] + mi := &file_volume_server_proto_msgTypes[83] ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) ms.StoreMessageInfo(mi) } @@ -4794,7 +4889,7 @@ func (x *FetchAndWriteNeedleRequest) String() string { func (*FetchAndWriteNeedleRequest) ProtoMessage() {} func (x *FetchAndWriteNeedleRequest) ProtoReflect() protoreflect.Message { - mi := &file_volume_server_proto_msgTypes[82] + mi := &file_volume_server_proto_msgTypes[83] if protoimpl.UnsafeEnabled && x != nil { ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) if ms.LoadMessageInfo() == nil { @@ -4807,7 +4902,7 @@ func (x *FetchAndWriteNeedleRequest) ProtoReflect() protoreflect.Message { // Deprecated: Use FetchAndWriteNeedleRequest.ProtoReflect.Descriptor instead. func (*FetchAndWriteNeedleRequest) Descriptor() ([]byte, []int) { - return file_volume_server_proto_rawDescGZIP(), []int{82} + return file_volume_server_proto_rawDescGZIP(), []int{83} } func (x *FetchAndWriteNeedleRequest) GetVolumeId() uint32 { @@ -4884,7 +4979,7 @@ type FetchAndWriteNeedleResponse struct { func (x *FetchAndWriteNeedleResponse) Reset() { *x = FetchAndWriteNeedleResponse{} if protoimpl.UnsafeEnabled { - mi := &file_volume_server_proto_msgTypes[83] + mi := &file_volume_server_proto_msgTypes[84] ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) ms.StoreMessageInfo(mi) } @@ -4897,7 +4992,7 @@ func (x *FetchAndWriteNeedleResponse) String() string { func (*FetchAndWriteNeedleResponse) ProtoMessage() {} func (x *FetchAndWriteNeedleResponse) ProtoReflect() protoreflect.Message { - mi := &file_volume_server_proto_msgTypes[83] + mi := &file_volume_server_proto_msgTypes[84] if protoimpl.UnsafeEnabled && x != nil { ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) if ms.LoadMessageInfo() == nil { @@ -4910,7 +5005,7 @@ func (x *FetchAndWriteNeedleResponse) ProtoReflect() protoreflect.Message { // Deprecated: Use FetchAndWriteNeedleResponse.ProtoReflect.Descriptor instead. func (*FetchAndWriteNeedleResponse) Descriptor() ([]byte, []int) { - return file_volume_server_proto_rawDescGZIP(), []int{83} + return file_volume_server_proto_rawDescGZIP(), []int{84} } func (x *FetchAndWriteNeedleResponse) GetETag() string { @@ -4936,7 +5031,7 @@ type QueryRequest struct { func (x *QueryRequest) Reset() { *x = QueryRequest{} if protoimpl.UnsafeEnabled { - mi := &file_volume_server_proto_msgTypes[84] + mi := &file_volume_server_proto_msgTypes[85] ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) ms.StoreMessageInfo(mi) } @@ -4949,7 +5044,7 @@ func (x *QueryRequest) String() string { func (*QueryRequest) ProtoMessage() {} func (x *QueryRequest) ProtoReflect() protoreflect.Message { - mi := &file_volume_server_proto_msgTypes[84] + mi := &file_volume_server_proto_msgTypes[85] if protoimpl.UnsafeEnabled && x != nil { ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) if ms.LoadMessageInfo() == nil { @@ -4962,7 +5057,7 @@ func (x *QueryRequest) ProtoReflect() protoreflect.Message { // Deprecated: Use QueryRequest.ProtoReflect.Descriptor instead. func (*QueryRequest) Descriptor() ([]byte, []int) { - return file_volume_server_proto_rawDescGZIP(), []int{84} + return file_volume_server_proto_rawDescGZIP(), []int{85} } func (x *QueryRequest) GetSelections() []string { @@ -5011,7 +5106,7 @@ type QueriedStripe struct { func (x *QueriedStripe) Reset() { *x = QueriedStripe{} if protoimpl.UnsafeEnabled { - mi := &file_volume_server_proto_msgTypes[85] + mi := &file_volume_server_proto_msgTypes[86] ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) ms.StoreMessageInfo(mi) } @@ -5024,7 +5119,7 @@ func (x *QueriedStripe) String() string { func (*QueriedStripe) ProtoMessage() {} func (x *QueriedStripe) ProtoReflect() protoreflect.Message { - mi := &file_volume_server_proto_msgTypes[85] + mi := &file_volume_server_proto_msgTypes[86] if protoimpl.UnsafeEnabled && x != nil { ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) if ms.LoadMessageInfo() == nil { @@ -5037,7 +5132,7 @@ func (x *QueriedStripe) ProtoReflect() protoreflect.Message { // Deprecated: Use QueriedStripe.ProtoReflect.Descriptor instead. func (*QueriedStripe) Descriptor() ([]byte, []int) { - return file_volume_server_proto_rawDescGZIP(), []int{85} + return file_volume_server_proto_rawDescGZIP(), []int{86} } func (x *QueriedStripe) GetRecords() []byte { @@ -5059,7 +5154,7 @@ type VolumeNeedleStatusRequest struct { func (x *VolumeNeedleStatusRequest) Reset() { *x = VolumeNeedleStatusRequest{} if protoimpl.UnsafeEnabled { - mi := &file_volume_server_proto_msgTypes[86] + mi := &file_volume_server_proto_msgTypes[87] ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) ms.StoreMessageInfo(mi) } @@ -5072,7 +5167,7 @@ func (x *VolumeNeedleStatusRequest) String() string { func (*VolumeNeedleStatusRequest) ProtoMessage() {} func (x *VolumeNeedleStatusRequest) ProtoReflect() protoreflect.Message { - mi := &file_volume_server_proto_msgTypes[86] + mi := &file_volume_server_proto_msgTypes[87] if protoimpl.UnsafeEnabled && x != nil { ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) if ms.LoadMessageInfo() == nil { @@ -5085,7 +5180,7 @@ func (x *VolumeNeedleStatusRequest) ProtoReflect() protoreflect.Message { // Deprecated: Use VolumeNeedleStatusRequest.ProtoReflect.Descriptor instead. func (*VolumeNeedleStatusRequest) Descriptor() ([]byte, []int) { - return file_volume_server_proto_rawDescGZIP(), []int{86} + return file_volume_server_proto_rawDescGZIP(), []int{87} } func (x *VolumeNeedleStatusRequest) GetVolumeId() uint32 { @@ -5118,7 +5213,7 @@ type VolumeNeedleStatusResponse struct { func (x *VolumeNeedleStatusResponse) Reset() { *x = VolumeNeedleStatusResponse{} if protoimpl.UnsafeEnabled { - mi := &file_volume_server_proto_msgTypes[87] + mi := &file_volume_server_proto_msgTypes[88] ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) ms.StoreMessageInfo(mi) } @@ -5131,7 +5226,7 @@ func (x *VolumeNeedleStatusResponse) String() string { func (*VolumeNeedleStatusResponse) ProtoMessage() {} func (x *VolumeNeedleStatusResponse) ProtoReflect() protoreflect.Message { - mi := &file_volume_server_proto_msgTypes[87] + mi := &file_volume_server_proto_msgTypes[88] if protoimpl.UnsafeEnabled && x != nil { ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) if ms.LoadMessageInfo() == nil { @@ -5144,7 +5239,7 @@ func (x *VolumeNeedleStatusResponse) ProtoReflect() protoreflect.Message { // Deprecated: Use VolumeNeedleStatusResponse.ProtoReflect.Descriptor instead. func (*VolumeNeedleStatusResponse) Descriptor() ([]byte, []int) { - return file_volume_server_proto_rawDescGZIP(), []int{87} + return file_volume_server_proto_rawDescGZIP(), []int{88} } func (x *VolumeNeedleStatusResponse) GetNeedleId() uint64 { @@ -5201,7 +5296,7 @@ type PingRequest struct { func (x *PingRequest) Reset() { *x = PingRequest{} if protoimpl.UnsafeEnabled { - mi := &file_volume_server_proto_msgTypes[88] + mi := &file_volume_server_proto_msgTypes[89] ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) ms.StoreMessageInfo(mi) } @@ -5214,7 +5309,7 @@ func (x *PingRequest) String() string { func (*PingRequest) ProtoMessage() {} func (x *PingRequest) ProtoReflect() protoreflect.Message { - mi := &file_volume_server_proto_msgTypes[88] + mi := &file_volume_server_proto_msgTypes[89] if protoimpl.UnsafeEnabled && x != nil { ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) if ms.LoadMessageInfo() == nil { @@ -5227,7 +5322,7 @@ func (x *PingRequest) ProtoReflect() protoreflect.Message { // Deprecated: Use PingRequest.ProtoReflect.Descriptor instead. func (*PingRequest) Descriptor() ([]byte, []int) { - return file_volume_server_proto_rawDescGZIP(), []int{88} + return file_volume_server_proto_rawDescGZIP(), []int{89} } func (x *PingRequest) GetTarget() string { @@ -5257,7 +5352,7 @@ type PingResponse struct { func (x *PingResponse) Reset() { *x = PingResponse{} if protoimpl.UnsafeEnabled { - mi := &file_volume_server_proto_msgTypes[89] + mi := &file_volume_server_proto_msgTypes[90] ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) ms.StoreMessageInfo(mi) } @@ -5270,7 +5365,7 @@ func (x *PingResponse) String() string { func (*PingResponse) ProtoMessage() {} func (x *PingResponse) ProtoReflect() protoreflect.Message { - mi := &file_volume_server_proto_msgTypes[89] + mi := &file_volume_server_proto_msgTypes[90] if protoimpl.UnsafeEnabled && x != nil { ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) if ms.LoadMessageInfo() == nil { @@ -5283,7 +5378,7 @@ func (x *PingResponse) ProtoReflect() protoreflect.Message { // Deprecated: Use PingResponse.ProtoReflect.Descriptor instead. func (*PingResponse) Descriptor() ([]byte, []int) { - return file_volume_server_proto_rawDescGZIP(), []int{89} + return file_volume_server_proto_rawDescGZIP(), []int{90} } func (x *PingResponse) GetStartTimeNs() int64 { @@ -5320,7 +5415,7 @@ type FetchAndWriteNeedleRequest_Replica struct { func (x *FetchAndWriteNeedleRequest_Replica) Reset() { *x = FetchAndWriteNeedleRequest_Replica{} if protoimpl.UnsafeEnabled { - mi := &file_volume_server_proto_msgTypes[90] + mi := &file_volume_server_proto_msgTypes[91] ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) ms.StoreMessageInfo(mi) } @@ -5333,7 +5428,7 @@ func (x *FetchAndWriteNeedleRequest_Replica) String() string { func (*FetchAndWriteNeedleRequest_Replica) ProtoMessage() {} func (x *FetchAndWriteNeedleRequest_Replica) ProtoReflect() protoreflect.Message { - mi := &file_volume_server_proto_msgTypes[90] + mi := &file_volume_server_proto_msgTypes[91] if protoimpl.UnsafeEnabled && x != nil { ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) if ms.LoadMessageInfo() == nil { @@ -5346,7 +5441,7 @@ func (x *FetchAndWriteNeedleRequest_Replica) ProtoReflect() protoreflect.Message // Deprecated: Use FetchAndWriteNeedleRequest_Replica.ProtoReflect.Descriptor instead. func (*FetchAndWriteNeedleRequest_Replica) Descriptor() ([]byte, []int) { - return file_volume_server_proto_rawDescGZIP(), []int{82, 0} + return file_volume_server_proto_rawDescGZIP(), []int{83, 0} } func (x *FetchAndWriteNeedleRequest_Replica) GetUrl() string { @@ -5383,7 +5478,7 @@ type QueryRequest_Filter struct { func (x *QueryRequest_Filter) Reset() { *x = QueryRequest_Filter{} if protoimpl.UnsafeEnabled { - mi := &file_volume_server_proto_msgTypes[91] + mi := &file_volume_server_proto_msgTypes[92] ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) ms.StoreMessageInfo(mi) } @@ -5396,7 +5491,7 @@ func (x *QueryRequest_Filter) String() string { func (*QueryRequest_Filter) ProtoMessage() {} func (x *QueryRequest_Filter) ProtoReflect() protoreflect.Message { - mi := &file_volume_server_proto_msgTypes[91] + mi := &file_volume_server_proto_msgTypes[92] if protoimpl.UnsafeEnabled && x != nil { ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) if ms.LoadMessageInfo() == nil { @@ -5409,7 +5504,7 @@ func (x *QueryRequest_Filter) ProtoReflect() protoreflect.Message { // Deprecated: Use QueryRequest_Filter.ProtoReflect.Descriptor instead. func (*QueryRequest_Filter) Descriptor() ([]byte, []int) { - return file_volume_server_proto_rawDescGZIP(), []int{84, 0} + return file_volume_server_proto_rawDescGZIP(), []int{85, 0} } func (x *QueryRequest_Filter) GetField() string { @@ -5448,7 +5543,7 @@ type QueryRequest_InputSerialization struct { func (x *QueryRequest_InputSerialization) Reset() { *x = QueryRequest_InputSerialization{} if protoimpl.UnsafeEnabled { - mi := &file_volume_server_proto_msgTypes[92] + mi := &file_volume_server_proto_msgTypes[93] ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) ms.StoreMessageInfo(mi) } @@ -5461,7 +5556,7 @@ func (x *QueryRequest_InputSerialization) String() string { func (*QueryRequest_InputSerialization) ProtoMessage() {} func (x *QueryRequest_InputSerialization) ProtoReflect() protoreflect.Message { - mi := &file_volume_server_proto_msgTypes[92] + mi := &file_volume_server_proto_msgTypes[93] if protoimpl.UnsafeEnabled && x != nil { ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) if ms.LoadMessageInfo() == nil { @@ -5474,7 +5569,7 @@ func (x *QueryRequest_InputSerialization) ProtoReflect() protoreflect.Message { // Deprecated: Use QueryRequest_InputSerialization.ProtoReflect.Descriptor instead. func (*QueryRequest_InputSerialization) Descriptor() ([]byte, []int) { - return file_volume_server_proto_rawDescGZIP(), []int{84, 1} + return file_volume_server_proto_rawDescGZIP(), []int{85, 1} } func (x *QueryRequest_InputSerialization) GetCompressionType() string { @@ -5517,7 +5612,7 @@ type QueryRequest_OutputSerialization struct { func (x *QueryRequest_OutputSerialization) Reset() { *x = QueryRequest_OutputSerialization{} if protoimpl.UnsafeEnabled { - mi := &file_volume_server_proto_msgTypes[93] + mi := &file_volume_server_proto_msgTypes[94] ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) ms.StoreMessageInfo(mi) } @@ -5530,7 +5625,7 @@ func (x *QueryRequest_OutputSerialization) String() string { func (*QueryRequest_OutputSerialization) ProtoMessage() {} func (x *QueryRequest_OutputSerialization) ProtoReflect() protoreflect.Message { - mi := &file_volume_server_proto_msgTypes[93] + mi := &file_volume_server_proto_msgTypes[94] if protoimpl.UnsafeEnabled && x != nil { ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) if ms.LoadMessageInfo() == nil { @@ -5543,7 +5638,7 @@ func (x *QueryRequest_OutputSerialization) ProtoReflect() protoreflect.Message { // Deprecated: Use QueryRequest_OutputSerialization.ProtoReflect.Descriptor instead. func (*QueryRequest_OutputSerialization) Descriptor() ([]byte, []int) { - return file_volume_server_proto_rawDescGZIP(), []int{84, 2} + return file_volume_server_proto_rawDescGZIP(), []int{85, 2} } func (x *QueryRequest_OutputSerialization) GetCsvOutput() *QueryRequest_OutputSerialization_CSVOutput { @@ -5578,7 +5673,7 @@ type QueryRequest_InputSerialization_CSVInput struct { func (x *QueryRequest_InputSerialization_CSVInput) Reset() { *x = QueryRequest_InputSerialization_CSVInput{} if protoimpl.UnsafeEnabled { - mi := &file_volume_server_proto_msgTypes[94] + mi := &file_volume_server_proto_msgTypes[95] ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) ms.StoreMessageInfo(mi) } @@ -5591,7 +5686,7 @@ func (x *QueryRequest_InputSerialization_CSVInput) String() string { func (*QueryRequest_InputSerialization_CSVInput) ProtoMessage() {} func (x *QueryRequest_InputSerialization_CSVInput) ProtoReflect() protoreflect.Message { - mi := &file_volume_server_proto_msgTypes[94] + mi := &file_volume_server_proto_msgTypes[95] if protoimpl.UnsafeEnabled && x != nil { ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) if ms.LoadMessageInfo() == nil { @@ -5604,7 +5699,7 @@ func (x *QueryRequest_InputSerialization_CSVInput) ProtoReflect() protoreflect.M // Deprecated: Use QueryRequest_InputSerialization_CSVInput.ProtoReflect.Descriptor instead. func (*QueryRequest_InputSerialization_CSVInput) Descriptor() ([]byte, []int) { - return file_volume_server_proto_rawDescGZIP(), []int{84, 1, 0} + return file_volume_server_proto_rawDescGZIP(), []int{85, 1, 0} } func (x *QueryRequest_InputSerialization_CSVInput) GetFileHeaderInfo() string { @@ -5667,7 +5762,7 @@ type QueryRequest_InputSerialization_JSONInput struct { func (x *QueryRequest_InputSerialization_JSONInput) Reset() { *x = QueryRequest_InputSerialization_JSONInput{} if protoimpl.UnsafeEnabled { - mi := &file_volume_server_proto_msgTypes[95] + mi := &file_volume_server_proto_msgTypes[96] ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) ms.StoreMessageInfo(mi) } @@ -5680,7 +5775,7 @@ func (x *QueryRequest_InputSerialization_JSONInput) String() string { func (*QueryRequest_InputSerialization_JSONInput) ProtoMessage() {} func (x *QueryRequest_InputSerialization_JSONInput) ProtoReflect() protoreflect.Message { - mi := &file_volume_server_proto_msgTypes[95] + mi := &file_volume_server_proto_msgTypes[96] if protoimpl.UnsafeEnabled && x != nil { ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) if ms.LoadMessageInfo() == nil { @@ -5693,7 +5788,7 @@ func (x *QueryRequest_InputSerialization_JSONInput) ProtoReflect() protoreflect. // Deprecated: Use QueryRequest_InputSerialization_JSONInput.ProtoReflect.Descriptor instead. func (*QueryRequest_InputSerialization_JSONInput) Descriptor() ([]byte, []int) { - return file_volume_server_proto_rawDescGZIP(), []int{84, 1, 1} + return file_volume_server_proto_rawDescGZIP(), []int{85, 1, 1} } func (x *QueryRequest_InputSerialization_JSONInput) GetType() string { @@ -5712,7 +5807,7 @@ type QueryRequest_InputSerialization_ParquetInput struct { func (x *QueryRequest_InputSerialization_ParquetInput) Reset() { *x = QueryRequest_InputSerialization_ParquetInput{} if protoimpl.UnsafeEnabled { - mi := &file_volume_server_proto_msgTypes[96] + mi := &file_volume_server_proto_msgTypes[97] ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) ms.StoreMessageInfo(mi) } @@ -5725,7 +5820,7 @@ func (x *QueryRequest_InputSerialization_ParquetInput) String() string { func (*QueryRequest_InputSerialization_ParquetInput) ProtoMessage() {} func (x *QueryRequest_InputSerialization_ParquetInput) ProtoReflect() protoreflect.Message { - mi := &file_volume_server_proto_msgTypes[96] + mi := &file_volume_server_proto_msgTypes[97] if protoimpl.UnsafeEnabled && x != nil { ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) if ms.LoadMessageInfo() == nil { @@ -5738,7 +5833,7 @@ func (x *QueryRequest_InputSerialization_ParquetInput) ProtoReflect() protorefle // Deprecated: Use QueryRequest_InputSerialization_ParquetInput.ProtoReflect.Descriptor instead. func (*QueryRequest_InputSerialization_ParquetInput) Descriptor() ([]byte, []int) { - return file_volume_server_proto_rawDescGZIP(), []int{84, 1, 2} + return file_volume_server_proto_rawDescGZIP(), []int{85, 1, 2} } type QueryRequest_OutputSerialization_CSVOutput struct { @@ -5756,7 +5851,7 @@ type QueryRequest_OutputSerialization_CSVOutput struct { func (x *QueryRequest_OutputSerialization_CSVOutput) Reset() { *x = QueryRequest_OutputSerialization_CSVOutput{} if protoimpl.UnsafeEnabled { - mi := &file_volume_server_proto_msgTypes[97] + mi := &file_volume_server_proto_msgTypes[98] ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) ms.StoreMessageInfo(mi) } @@ -5769,7 +5864,7 @@ func (x *QueryRequest_OutputSerialization_CSVOutput) String() string { func (*QueryRequest_OutputSerialization_CSVOutput) ProtoMessage() {} func (x *QueryRequest_OutputSerialization_CSVOutput) ProtoReflect() protoreflect.Message { - mi := &file_volume_server_proto_msgTypes[97] + mi := &file_volume_server_proto_msgTypes[98] if protoimpl.UnsafeEnabled && x != nil { ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) if ms.LoadMessageInfo() == nil { @@ -5782,7 +5877,7 @@ func (x *QueryRequest_OutputSerialization_CSVOutput) ProtoReflect() protoreflect // Deprecated: Use QueryRequest_OutputSerialization_CSVOutput.ProtoReflect.Descriptor instead. func (*QueryRequest_OutputSerialization_CSVOutput) Descriptor() ([]byte, []int) { - return file_volume_server_proto_rawDescGZIP(), []int{84, 2, 0} + return file_volume_server_proto_rawDescGZIP(), []int{85, 2, 0} } func (x *QueryRequest_OutputSerialization_CSVOutput) GetQuoteFields() string { @@ -5831,7 +5926,7 @@ type QueryRequest_OutputSerialization_JSONOutput struct { func (x *QueryRequest_OutputSerialization_JSONOutput) Reset() { *x = QueryRequest_OutputSerialization_JSONOutput{} if protoimpl.UnsafeEnabled { - mi := &file_volume_server_proto_msgTypes[98] + mi := &file_volume_server_proto_msgTypes[99] ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) ms.StoreMessageInfo(mi) } @@ -5844,7 +5939,7 @@ func (x *QueryRequest_OutputSerialization_JSONOutput) String() string { func (*QueryRequest_OutputSerialization_JSONOutput) ProtoMessage() {} func (x *QueryRequest_OutputSerialization_JSONOutput) ProtoReflect() protoreflect.Message { - mi := &file_volume_server_proto_msgTypes[98] + mi := &file_volume_server_proto_msgTypes[99] if protoimpl.UnsafeEnabled && x != nil { ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) if ms.LoadMessageInfo() == nil { @@ -5857,7 +5952,7 @@ func (x *QueryRequest_OutputSerialization_JSONOutput) ProtoReflect() protoreflec // Deprecated: Use QueryRequest_OutputSerialization_JSONOutput.ProtoReflect.Descriptor instead. func (*QueryRequest_OutputSerialization_JSONOutput) Descriptor() ([]byte, []int) { - return file_volume_server_proto_rawDescGZIP(), []int{84, 2, 1} + return file_volume_server_proto_rawDescGZIP(), []int{85, 2, 1} } func (x *QueryRequest_OutputSerialization_JSONOutput) GetRecordDelimiter() string { @@ -6333,7 +6428,7 @@ var file_volume_server_proto_rawDesc = []byte{ 0x74, 0x69, 0x6d, 0x65, 0x18, 0x06, 0x20, 0x01, 0x28, 0x04, 0x52, 0x0c, 0x6d, 0x6f, 0x64, 0x69, 0x66, 0x69, 0x65, 0x64, 0x54, 0x69, 0x6d, 0x65, 0x12, 0x1c, 0x0a, 0x09, 0x65, 0x78, 0x74, 0x65, 0x6e, 0x73, 0x69, 0x6f, 0x6e, 0x18, 0x07, 0x20, 0x01, 0x28, 0x09, 0x52, 0x09, 0x65, 0x78, 0x74, - 0x65, 0x6e, 0x73, 0x69, 0x6f, 0x6e, 0x22, 0x81, 0x02, 0x0a, 0x0a, 0x56, 0x6f, 0x6c, 0x75, 0x6d, + 0x65, 0x6e, 0x73, 0x69, 0x6f, 0x6e, 0x22, 0x84, 0x02, 0x0a, 0x0a, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x49, 0x6e, 0x66, 0x6f, 0x12, 0x32, 0x0a, 0x05, 0x66, 0x69, 0x6c, 0x65, 0x73, 0x18, 0x01, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x1c, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x52, 0x65, 0x6d, 0x6f, 0x74, 0x65, 0x46, 0x69, @@ -6341,537 +6436,554 @@ var file_volume_server_proto_rawDesc = []byte{ 0x73, 0x69, 0x6f, 0x6e, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x07, 0x76, 0x65, 0x72, 0x73, 0x69, 0x6f, 0x6e, 0x12, 0x20, 0x0a, 0x0b, 0x72, 0x65, 0x70, 0x6c, 0x69, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x18, 0x03, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0b, 0x72, 0x65, 0x70, 0x6c, 0x69, 0x63, - 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x12, 0x20, 0x0a, 0x0b, 0x42, 0x79, 0x74, 0x65, 0x73, 0x4f, 0x66, - 0x66, 0x73, 0x65, 0x74, 0x18, 0x04, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x0b, 0x42, 0x79, 0x74, 0x65, - 0x73, 0x4f, 0x66, 0x66, 0x73, 0x65, 0x74, 0x12, 0x22, 0x0a, 0x0d, 0x64, 0x61, 0x74, 0x5f, 0x66, - 0x69, 0x6c, 0x65, 0x5f, 0x73, 0x69, 0x7a, 0x65, 0x18, 0x05, 0x20, 0x01, 0x28, 0x03, 0x52, 0x0b, - 0x64, 0x61, 0x74, 0x46, 0x69, 0x6c, 0x65, 0x53, 0x69, 0x7a, 0x65, 0x12, 0x20, 0x0a, 0x0b, 0x44, - 0x65, 0x73, 0x74, 0x72, 0x6f, 0x79, 0x54, 0x69, 0x6d, 0x65, 0x18, 0x06, 0x20, 0x01, 0x28, 0x04, - 0x52, 0x0b, 0x44, 0x65, 0x73, 0x74, 0x72, 0x6f, 0x79, 0x54, 0x69, 0x6d, 0x65, 0x12, 0x1b, 0x0a, - 0x09, 0x72, 0x65, 0x61, 0x64, 0x5f, 0x6f, 0x6e, 0x6c, 0x79, 0x18, 0x07, 0x20, 0x01, 0x28, 0x08, - 0x52, 0x08, 0x72, 0x65, 0x61, 0x64, 0x4f, 0x6e, 0x6c, 0x79, 0x22, 0xc8, 0x01, 0x0a, 0x20, 0x56, - 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x54, 0x69, 0x65, 0x72, 0x4d, 0x6f, 0x76, 0x65, 0x44, 0x61, 0x74, - 0x54, 0x6f, 0x52, 0x65, 0x6d, 0x6f, 0x74, 0x65, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x12, + 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x12, 0x21, 0x0a, 0x0c, 0x62, 0x79, 0x74, 0x65, 0x73, 0x5f, 0x6f, + 0x66, 0x66, 0x73, 0x65, 0x74, 0x18, 0x04, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x0b, 0x62, 0x79, 0x74, + 0x65, 0x73, 0x4f, 0x66, 0x66, 0x73, 0x65, 0x74, 0x12, 0x22, 0x0a, 0x0d, 0x64, 0x61, 0x74, 0x5f, + 0x66, 0x69, 0x6c, 0x65, 0x5f, 0x73, 0x69, 0x7a, 0x65, 0x18, 0x05, 0x20, 0x01, 0x28, 0x03, 0x52, + 0x0b, 0x64, 0x61, 0x74, 0x46, 0x69, 0x6c, 0x65, 0x53, 0x69, 0x7a, 0x65, 0x12, 0x22, 0x0a, 0x0d, + 0x65, 0x78, 0x70, 0x69, 0x72, 0x65, 0x5f, 0x61, 0x74, 0x5f, 0x73, 0x65, 0x63, 0x18, 0x06, 0x20, + 0x01, 0x28, 0x04, 0x52, 0x0b, 0x65, 0x78, 0x70, 0x69, 0x72, 0x65, 0x41, 0x74, 0x53, 0x65, 0x63, + 0x12, 0x1b, 0x0a, 0x09, 0x72, 0x65, 0x61, 0x64, 0x5f, 0x6f, 0x6e, 0x6c, 0x79, 0x18, 0x07, 0x20, + 0x01, 0x28, 0x08, 0x52, 0x08, 0x72, 0x65, 0x61, 0x64, 0x4f, 0x6e, 0x6c, 0x79, 0x22, 0x8b, 0x02, + 0x0a, 0x14, 0x4f, 0x6c, 0x64, 0x56, 0x65, 0x72, 0x73, 0x69, 0x6f, 0x6e, 0x56, 0x6f, 0x6c, 0x75, + 0x6d, 0x65, 0x49, 0x6e, 0x66, 0x6f, 0x12, 0x32, 0x0a, 0x05, 0x66, 0x69, 0x6c, 0x65, 0x73, 0x18, + 0x01, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x1c, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, + 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x52, 0x65, 0x6d, 0x6f, 0x74, 0x65, 0x46, + 0x69, 0x6c, 0x65, 0x52, 0x05, 0x66, 0x69, 0x6c, 0x65, 0x73, 0x12, 0x18, 0x0a, 0x07, 0x76, 0x65, + 0x72, 0x73, 0x69, 0x6f, 0x6e, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x07, 0x76, 0x65, 0x72, + 0x73, 0x69, 0x6f, 0x6e, 0x12, 0x20, 0x0a, 0x0b, 0x72, 0x65, 0x70, 0x6c, 0x69, 0x63, 0x61, 0x74, + 0x69, 0x6f, 0x6e, 0x18, 0x03, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0b, 0x72, 0x65, 0x70, 0x6c, 0x69, + 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x12, 0x20, 0x0a, 0x0b, 0x42, 0x79, 0x74, 0x65, 0x73, 0x4f, + 0x66, 0x66, 0x73, 0x65, 0x74, 0x18, 0x04, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x0b, 0x42, 0x79, 0x74, + 0x65, 0x73, 0x4f, 0x66, 0x66, 0x73, 0x65, 0x74, 0x12, 0x22, 0x0a, 0x0d, 0x64, 0x61, 0x74, 0x5f, + 0x66, 0x69, 0x6c, 0x65, 0x5f, 0x73, 0x69, 0x7a, 0x65, 0x18, 0x05, 0x20, 0x01, 0x28, 0x03, 0x52, + 0x0b, 0x64, 0x61, 0x74, 0x46, 0x69, 0x6c, 0x65, 0x53, 0x69, 0x7a, 0x65, 0x12, 0x20, 0x0a, 0x0b, + 0x44, 0x65, 0x73, 0x74, 0x72, 0x6f, 0x79, 0x54, 0x69, 0x6d, 0x65, 0x18, 0x06, 0x20, 0x01, 0x28, + 0x04, 0x52, 0x0b, 0x44, 0x65, 0x73, 0x74, 0x72, 0x6f, 0x79, 0x54, 0x69, 0x6d, 0x65, 0x12, 0x1b, + 0x0a, 0x09, 0x72, 0x65, 0x61, 0x64, 0x5f, 0x6f, 0x6e, 0x6c, 0x79, 0x18, 0x07, 0x20, 0x01, 0x28, + 0x08, 0x52, 0x08, 0x72, 0x65, 0x61, 0x64, 0x4f, 0x6e, 0x6c, 0x79, 0x22, 0xc8, 0x01, 0x0a, 0x20, + 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x54, 0x69, 0x65, 0x72, 0x4d, 0x6f, 0x76, 0x65, 0x44, 0x61, + 0x74, 0x54, 0x6f, 0x52, 0x65, 0x6d, 0x6f, 0x74, 0x65, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, + 0x12, 0x1b, 0x0a, 0x09, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x69, 0x64, 0x18, 0x01, 0x20, + 0x01, 0x28, 0x0d, 0x52, 0x08, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x49, 0x64, 0x12, 0x1e, 0x0a, + 0x0a, 0x63, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x18, 0x02, 0x20, 0x01, 0x28, + 0x09, 0x52, 0x0a, 0x63, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x12, 0x38, 0x0a, + 0x18, 0x64, 0x65, 0x73, 0x74, 0x69, 0x6e, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x5f, 0x62, 0x61, 0x63, + 0x6b, 0x65, 0x6e, 0x64, 0x5f, 0x6e, 0x61, 0x6d, 0x65, 0x18, 0x03, 0x20, 0x01, 0x28, 0x09, 0x52, + 0x16, 0x64, 0x65, 0x73, 0x74, 0x69, 0x6e, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x42, 0x61, 0x63, 0x6b, + 0x65, 0x6e, 0x64, 0x4e, 0x61, 0x6d, 0x65, 0x12, 0x2d, 0x0a, 0x13, 0x6b, 0x65, 0x65, 0x70, 0x5f, + 0x6c, 0x6f, 0x63, 0x61, 0x6c, 0x5f, 0x64, 0x61, 0x74, 0x5f, 0x66, 0x69, 0x6c, 0x65, 0x18, 0x04, + 0x20, 0x01, 0x28, 0x08, 0x52, 0x10, 0x6b, 0x65, 0x65, 0x70, 0x4c, 0x6f, 0x63, 0x61, 0x6c, 0x44, + 0x61, 0x74, 0x46, 0x69, 0x6c, 0x65, 0x22, 0x73, 0x0a, 0x21, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, + 0x54, 0x69, 0x65, 0x72, 0x4d, 0x6f, 0x76, 0x65, 0x44, 0x61, 0x74, 0x54, 0x6f, 0x52, 0x65, 0x6d, + 0x6f, 0x74, 0x65, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x12, 0x1c, 0x0a, 0x09, 0x70, + 0x72, 0x6f, 0x63, 0x65, 0x73, 0x73, 0x65, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x03, 0x52, 0x09, + 0x70, 0x72, 0x6f, 0x63, 0x65, 0x73, 0x73, 0x65, 0x64, 0x12, 0x30, 0x0a, 0x13, 0x70, 0x72, 0x6f, + 0x63, 0x65, 0x73, 0x73, 0x65, 0x64, 0x50, 0x65, 0x72, 0x63, 0x65, 0x6e, 0x74, 0x61, 0x67, 0x65, + 0x18, 0x02, 0x20, 0x01, 0x28, 0x02, 0x52, 0x13, 0x70, 0x72, 0x6f, 0x63, 0x65, 0x73, 0x73, 0x65, + 0x64, 0x50, 0x65, 0x72, 0x63, 0x65, 0x6e, 0x74, 0x61, 0x67, 0x65, 0x22, 0x92, 0x01, 0x0a, 0x22, + 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x54, 0x69, 0x65, 0x72, 0x4d, 0x6f, 0x76, 0x65, 0x44, 0x61, + 0x74, 0x46, 0x72, 0x6f, 0x6d, 0x52, 0x65, 0x6d, 0x6f, 0x74, 0x65, 0x52, 0x65, 0x71, 0x75, 0x65, + 0x73, 0x74, 0x12, 0x1b, 0x0a, 0x09, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x69, 0x64, 0x18, + 0x01, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x08, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x49, 0x64, 0x12, + 0x1e, 0x0a, 0x0a, 0x63, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x18, 0x02, 0x20, + 0x01, 0x28, 0x09, 0x52, 0x0a, 0x63, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x12, + 0x2f, 0x0a, 0x14, 0x6b, 0x65, 0x65, 0x70, 0x5f, 0x72, 0x65, 0x6d, 0x6f, 0x74, 0x65, 0x5f, 0x64, + 0x61, 0x74, 0x5f, 0x66, 0x69, 0x6c, 0x65, 0x18, 0x03, 0x20, 0x01, 0x28, 0x08, 0x52, 0x11, 0x6b, + 0x65, 0x65, 0x70, 0x52, 0x65, 0x6d, 0x6f, 0x74, 0x65, 0x44, 0x61, 0x74, 0x46, 0x69, 0x6c, 0x65, + 0x22, 0x75, 0x0a, 0x23, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x54, 0x69, 0x65, 0x72, 0x4d, 0x6f, + 0x76, 0x65, 0x44, 0x61, 0x74, 0x46, 0x72, 0x6f, 0x6d, 0x52, 0x65, 0x6d, 0x6f, 0x74, 0x65, 0x52, + 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x12, 0x1c, 0x0a, 0x09, 0x70, 0x72, 0x6f, 0x63, 0x65, + 0x73, 0x73, 0x65, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x03, 0x52, 0x09, 0x70, 0x72, 0x6f, 0x63, + 0x65, 0x73, 0x73, 0x65, 0x64, 0x12, 0x30, 0x0a, 0x13, 0x70, 0x72, 0x6f, 0x63, 0x65, 0x73, 0x73, + 0x65, 0x64, 0x50, 0x65, 0x72, 0x63, 0x65, 0x6e, 0x74, 0x61, 0x67, 0x65, 0x18, 0x02, 0x20, 0x01, + 0x28, 0x02, 0x52, 0x13, 0x70, 0x72, 0x6f, 0x63, 0x65, 0x73, 0x73, 0x65, 0x64, 0x50, 0x65, 0x72, + 0x63, 0x65, 0x6e, 0x74, 0x61, 0x67, 0x65, 0x22, 0x1b, 0x0a, 0x19, 0x56, 0x6f, 0x6c, 0x75, 0x6d, + 0x65, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x52, 0x65, 0x71, + 0x75, 0x65, 0x73, 0x74, 0x22, 0xf0, 0x01, 0x0a, 0x1a, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x53, + 0x65, 0x72, 0x76, 0x65, 0x72, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x52, 0x65, 0x73, 0x70, 0x6f, + 0x6e, 0x73, 0x65, 0x12, 0x41, 0x0a, 0x0d, 0x64, 0x69, 0x73, 0x6b, 0x5f, 0x73, 0x74, 0x61, 0x74, + 0x75, 0x73, 0x65, 0x73, 0x18, 0x01, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x1c, 0x2e, 0x76, 0x6f, 0x6c, + 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x44, 0x69, + 0x73, 0x6b, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x52, 0x0c, 0x64, 0x69, 0x73, 0x6b, 0x53, 0x74, + 0x61, 0x74, 0x75, 0x73, 0x65, 0x73, 0x12, 0x40, 0x0a, 0x0d, 0x6d, 0x65, 0x6d, 0x6f, 0x72, 0x79, + 0x5f, 0x73, 0x74, 0x61, 0x74, 0x75, 0x73, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1b, 0x2e, + 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, + 0x2e, 0x4d, 0x65, 0x6d, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x52, 0x0c, 0x6d, 0x65, 0x6d, 0x6f, + 0x72, 0x79, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x12, 0x18, 0x0a, 0x07, 0x76, 0x65, 0x72, 0x73, + 0x69, 0x6f, 0x6e, 0x18, 0x03, 0x20, 0x01, 0x28, 0x09, 0x52, 0x07, 0x76, 0x65, 0x72, 0x73, 0x69, + 0x6f, 0x6e, 0x12, 0x1f, 0x0a, 0x0b, 0x64, 0x61, 0x74, 0x61, 0x5f, 0x63, 0x65, 0x6e, 0x74, 0x65, + 0x72, 0x18, 0x04, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0a, 0x64, 0x61, 0x74, 0x61, 0x43, 0x65, 0x6e, + 0x74, 0x65, 0x72, 0x12, 0x12, 0x0a, 0x04, 0x72, 0x61, 0x63, 0x6b, 0x18, 0x05, 0x20, 0x01, 0x28, + 0x09, 0x52, 0x04, 0x72, 0x61, 0x63, 0x6b, 0x22, 0x1a, 0x0a, 0x18, 0x56, 0x6f, 0x6c, 0x75, 0x6d, + 0x65, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x4c, 0x65, 0x61, 0x76, 0x65, 0x52, 0x65, 0x71, 0x75, + 0x65, 0x73, 0x74, 0x22, 0x1b, 0x0a, 0x19, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x53, 0x65, 0x72, + 0x76, 0x65, 0x72, 0x4c, 0x65, 0x61, 0x76, 0x65, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, + 0x22, 0xdc, 0x03, 0x0a, 0x1a, 0x46, 0x65, 0x74, 0x63, 0x68, 0x41, 0x6e, 0x64, 0x57, 0x72, 0x69, + 0x74, 0x65, 0x4e, 0x65, 0x65, 0x64, 0x6c, 0x65, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x12, 0x1b, 0x0a, 0x09, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x69, 0x64, 0x18, 0x01, 0x20, 0x01, - 0x28, 0x0d, 0x52, 0x08, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x49, 0x64, 0x12, 0x1e, 0x0a, 0x0a, - 0x63, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x18, 0x02, 0x20, 0x01, 0x28, 0x09, - 0x52, 0x0a, 0x63, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x12, 0x38, 0x0a, 0x18, - 0x64, 0x65, 0x73, 0x74, 0x69, 0x6e, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x5f, 0x62, 0x61, 0x63, 0x6b, - 0x65, 0x6e, 0x64, 0x5f, 0x6e, 0x61, 0x6d, 0x65, 0x18, 0x03, 0x20, 0x01, 0x28, 0x09, 0x52, 0x16, - 0x64, 0x65, 0x73, 0x74, 0x69, 0x6e, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x42, 0x61, 0x63, 0x6b, 0x65, - 0x6e, 0x64, 0x4e, 0x61, 0x6d, 0x65, 0x12, 0x2d, 0x0a, 0x13, 0x6b, 0x65, 0x65, 0x70, 0x5f, 0x6c, - 0x6f, 0x63, 0x61, 0x6c, 0x5f, 0x64, 0x61, 0x74, 0x5f, 0x66, 0x69, 0x6c, 0x65, 0x18, 0x04, 0x20, - 0x01, 0x28, 0x08, 0x52, 0x10, 0x6b, 0x65, 0x65, 0x70, 0x4c, 0x6f, 0x63, 0x61, 0x6c, 0x44, 0x61, - 0x74, 0x46, 0x69, 0x6c, 0x65, 0x22, 0x73, 0x0a, 0x21, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x54, - 0x69, 0x65, 0x72, 0x4d, 0x6f, 0x76, 0x65, 0x44, 0x61, 0x74, 0x54, 0x6f, 0x52, 0x65, 0x6d, 0x6f, - 0x74, 0x65, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x12, 0x1c, 0x0a, 0x09, 0x70, 0x72, - 0x6f, 0x63, 0x65, 0x73, 0x73, 0x65, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x03, 0x52, 0x09, 0x70, - 0x72, 0x6f, 0x63, 0x65, 0x73, 0x73, 0x65, 0x64, 0x12, 0x30, 0x0a, 0x13, 0x70, 0x72, 0x6f, 0x63, - 0x65, 0x73, 0x73, 0x65, 0x64, 0x50, 0x65, 0x72, 0x63, 0x65, 0x6e, 0x74, 0x61, 0x67, 0x65, 0x18, - 0x02, 0x20, 0x01, 0x28, 0x02, 0x52, 0x13, 0x70, 0x72, 0x6f, 0x63, 0x65, 0x73, 0x73, 0x65, 0x64, - 0x50, 0x65, 0x72, 0x63, 0x65, 0x6e, 0x74, 0x61, 0x67, 0x65, 0x22, 0x92, 0x01, 0x0a, 0x22, 0x56, - 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x54, 0x69, 0x65, 0x72, 0x4d, 0x6f, 0x76, 0x65, 0x44, 0x61, 0x74, - 0x46, 0x72, 0x6f, 0x6d, 0x52, 0x65, 0x6d, 0x6f, 0x74, 0x65, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, - 0x74, 0x12, 0x1b, 0x0a, 0x09, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x69, 0x64, 0x18, 0x01, - 0x20, 0x01, 0x28, 0x0d, 0x52, 0x08, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x49, 0x64, 0x12, 0x1e, - 0x0a, 0x0a, 0x63, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x18, 0x02, 0x20, 0x01, - 0x28, 0x09, 0x52, 0x0a, 0x63, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x12, 0x2f, - 0x0a, 0x14, 0x6b, 0x65, 0x65, 0x70, 0x5f, 0x72, 0x65, 0x6d, 0x6f, 0x74, 0x65, 0x5f, 0x64, 0x61, - 0x74, 0x5f, 0x66, 0x69, 0x6c, 0x65, 0x18, 0x03, 0x20, 0x01, 0x28, 0x08, 0x52, 0x11, 0x6b, 0x65, - 0x65, 0x70, 0x52, 0x65, 0x6d, 0x6f, 0x74, 0x65, 0x44, 0x61, 0x74, 0x46, 0x69, 0x6c, 0x65, 0x22, - 0x75, 0x0a, 0x23, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x54, 0x69, 0x65, 0x72, 0x4d, 0x6f, 0x76, - 0x65, 0x44, 0x61, 0x74, 0x46, 0x72, 0x6f, 0x6d, 0x52, 0x65, 0x6d, 0x6f, 0x74, 0x65, 0x52, 0x65, - 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x12, 0x1c, 0x0a, 0x09, 0x70, 0x72, 0x6f, 0x63, 0x65, 0x73, - 0x73, 0x65, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x03, 0x52, 0x09, 0x70, 0x72, 0x6f, 0x63, 0x65, - 0x73, 0x73, 0x65, 0x64, 0x12, 0x30, 0x0a, 0x13, 0x70, 0x72, 0x6f, 0x63, 0x65, 0x73, 0x73, 0x65, - 0x64, 0x50, 0x65, 0x72, 0x63, 0x65, 0x6e, 0x74, 0x61, 0x67, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, - 0x02, 0x52, 0x13, 0x70, 0x72, 0x6f, 0x63, 0x65, 0x73, 0x73, 0x65, 0x64, 0x50, 0x65, 0x72, 0x63, - 0x65, 0x6e, 0x74, 0x61, 0x67, 0x65, 0x22, 0x1b, 0x0a, 0x19, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, - 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x52, 0x65, 0x71, 0x75, - 0x65, 0x73, 0x74, 0x22, 0xf0, 0x01, 0x0a, 0x1a, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x53, 0x65, - 0x72, 0x76, 0x65, 0x72, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, - 0x73, 0x65, 0x12, 0x41, 0x0a, 0x0d, 0x64, 0x69, 0x73, 0x6b, 0x5f, 0x73, 0x74, 0x61, 0x74, 0x75, - 0x73, 0x65, 0x73, 0x18, 0x01, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x1c, 0x2e, 0x76, 0x6f, 0x6c, 0x75, - 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x44, 0x69, 0x73, - 0x6b, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x52, 0x0c, 0x64, 0x69, 0x73, 0x6b, 0x53, 0x74, 0x61, - 0x74, 0x75, 0x73, 0x65, 0x73, 0x12, 0x40, 0x0a, 0x0d, 0x6d, 0x65, 0x6d, 0x6f, 0x72, 0x79, 0x5f, - 0x73, 0x74, 0x61, 0x74, 0x75, 0x73, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x1b, 0x2e, 0x76, - 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, - 0x4d, 0x65, 0x6d, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x52, 0x0c, 0x6d, 0x65, 0x6d, 0x6f, 0x72, - 0x79, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x12, 0x18, 0x0a, 0x07, 0x76, 0x65, 0x72, 0x73, 0x69, - 0x6f, 0x6e, 0x18, 0x03, 0x20, 0x01, 0x28, 0x09, 0x52, 0x07, 0x76, 0x65, 0x72, 0x73, 0x69, 0x6f, - 0x6e, 0x12, 0x1f, 0x0a, 0x0b, 0x64, 0x61, 0x74, 0x61, 0x5f, 0x63, 0x65, 0x6e, 0x74, 0x65, 0x72, - 0x18, 0x04, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0a, 0x64, 0x61, 0x74, 0x61, 0x43, 0x65, 0x6e, 0x74, - 0x65, 0x72, 0x12, 0x12, 0x0a, 0x04, 0x72, 0x61, 0x63, 0x6b, 0x18, 0x05, 0x20, 0x01, 0x28, 0x09, - 0x52, 0x04, 0x72, 0x61, 0x63, 0x6b, 0x22, 0x1a, 0x0a, 0x18, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, - 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x4c, 0x65, 0x61, 0x76, 0x65, 0x52, 0x65, 0x71, 0x75, 0x65, - 0x73, 0x74, 0x22, 0x1b, 0x0a, 0x19, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x53, 0x65, 0x72, 0x76, - 0x65, 0x72, 0x4c, 0x65, 0x61, 0x76, 0x65, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, - 0xdc, 0x03, 0x0a, 0x1a, 0x46, 0x65, 0x74, 0x63, 0x68, 0x41, 0x6e, 0x64, 0x57, 0x72, 0x69, 0x74, - 0x65, 0x4e, 0x65, 0x65, 0x64, 0x6c, 0x65, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x12, 0x1b, - 0x0a, 0x09, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x69, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, - 0x0d, 0x52, 0x08, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x49, 0x64, 0x12, 0x1b, 0x0a, 0x09, 0x6e, - 0x65, 0x65, 0x64, 0x6c, 0x65, 0x5f, 0x69, 0x64, 0x18, 0x02, 0x20, 0x01, 0x28, 0x04, 0x52, 0x08, - 0x6e, 0x65, 0x65, 0x64, 0x6c, 0x65, 0x49, 0x64, 0x12, 0x16, 0x0a, 0x06, 0x63, 0x6f, 0x6f, 0x6b, - 0x69, 0x65, 0x18, 0x03, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x06, 0x63, 0x6f, 0x6f, 0x6b, 0x69, 0x65, - 0x12, 0x16, 0x0a, 0x06, 0x6f, 0x66, 0x66, 0x73, 0x65, 0x74, 0x18, 0x04, 0x20, 0x01, 0x28, 0x03, - 0x52, 0x06, 0x6f, 0x66, 0x66, 0x73, 0x65, 0x74, 0x12, 0x12, 0x0a, 0x04, 0x73, 0x69, 0x7a, 0x65, - 0x18, 0x05, 0x20, 0x01, 0x28, 0x03, 0x52, 0x04, 0x73, 0x69, 0x7a, 0x65, 0x12, 0x50, 0x0a, 0x08, - 0x72, 0x65, 0x70, 0x6c, 0x69, 0x63, 0x61, 0x73, 0x18, 0x06, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x34, - 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, - 0x62, 0x2e, 0x46, 0x65, 0x74, 0x63, 0x68, 0x41, 0x6e, 0x64, 0x57, 0x72, 0x69, 0x74, 0x65, 0x4e, - 0x65, 0x65, 0x64, 0x6c, 0x65, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x2e, 0x52, 0x65, 0x70, - 0x6c, 0x69, 0x63, 0x61, 0x52, 0x08, 0x72, 0x65, 0x70, 0x6c, 0x69, 0x63, 0x61, 0x73, 0x12, 0x12, - 0x0a, 0x04, 0x61, 0x75, 0x74, 0x68, 0x18, 0x07, 0x20, 0x01, 0x28, 0x09, 0x52, 0x04, 0x61, 0x75, - 0x74, 0x68, 0x12, 0x36, 0x0a, 0x0b, 0x72, 0x65, 0x6d, 0x6f, 0x74, 0x65, 0x5f, 0x63, 0x6f, 0x6e, - 0x66, 0x18, 0x0f, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x15, 0x2e, 0x72, 0x65, 0x6d, 0x6f, 0x74, 0x65, - 0x5f, 0x70, 0x62, 0x2e, 0x52, 0x65, 0x6d, 0x6f, 0x74, 0x65, 0x43, 0x6f, 0x6e, 0x66, 0x52, 0x0a, - 0x72, 0x65, 0x6d, 0x6f, 0x74, 0x65, 0x43, 0x6f, 0x6e, 0x66, 0x12, 0x49, 0x0a, 0x0f, 0x72, 0x65, - 0x6d, 0x6f, 0x74, 0x65, 0x5f, 0x6c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x18, 0x10, 0x20, - 0x01, 0x28, 0x0b, 0x32, 0x20, 0x2e, 0x72, 0x65, 0x6d, 0x6f, 0x74, 0x65, 0x5f, 0x70, 0x62, 0x2e, - 0x52, 0x65, 0x6d, 0x6f, 0x74, 0x65, 0x53, 0x74, 0x6f, 0x72, 0x61, 0x67, 0x65, 0x4c, 0x6f, 0x63, - 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x52, 0x0e, 0x72, 0x65, 0x6d, 0x6f, 0x74, 0x65, 0x4c, 0x6f, 0x63, - 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x1a, 0x57, 0x0a, 0x07, 0x52, 0x65, 0x70, 0x6c, 0x69, 0x63, 0x61, - 0x12, 0x10, 0x0a, 0x03, 0x75, 0x72, 0x6c, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, 0x75, - 0x72, 0x6c, 0x12, 0x1d, 0x0a, 0x0a, 0x70, 0x75, 0x62, 0x6c, 0x69, 0x63, 0x5f, 0x75, 0x72, 0x6c, - 0x18, 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x09, 0x70, 0x75, 0x62, 0x6c, 0x69, 0x63, 0x55, 0x72, - 0x6c, 0x12, 0x1b, 0x0a, 0x09, 0x67, 0x72, 0x70, 0x63, 0x5f, 0x70, 0x6f, 0x72, 0x74, 0x18, 0x03, - 0x20, 0x01, 0x28, 0x05, 0x52, 0x08, 0x67, 0x72, 0x70, 0x63, 0x50, 0x6f, 0x72, 0x74, 0x22, 0x32, - 0x0a, 0x1b, 0x46, 0x65, 0x74, 0x63, 0x68, 0x41, 0x6e, 0x64, 0x57, 0x72, 0x69, 0x74, 0x65, 0x4e, - 0x65, 0x65, 0x64, 0x6c, 0x65, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x12, 0x13, 0x0a, - 0x05, 0x65, 0x5f, 0x74, 0x61, 0x67, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x04, 0x65, 0x54, - 0x61, 0x67, 0x22, 0xf4, 0x0c, 0x0a, 0x0c, 0x51, 0x75, 0x65, 0x72, 0x79, 0x52, 0x65, 0x71, 0x75, - 0x65, 0x73, 0x74, 0x12, 0x1e, 0x0a, 0x0a, 0x73, 0x65, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, - 0x73, 0x18, 0x01, 0x20, 0x03, 0x28, 0x09, 0x52, 0x0a, 0x73, 0x65, 0x6c, 0x65, 0x63, 0x74, 0x69, - 0x6f, 0x6e, 0x73, 0x12, 0x22, 0x0a, 0x0d, 0x66, 0x72, 0x6f, 0x6d, 0x5f, 0x66, 0x69, 0x6c, 0x65, - 0x5f, 0x69, 0x64, 0x73, 0x18, 0x02, 0x20, 0x03, 0x28, 0x09, 0x52, 0x0b, 0x66, 0x72, 0x6f, 0x6d, - 0x46, 0x69, 0x6c, 0x65, 0x49, 0x64, 0x73, 0x12, 0x3d, 0x0a, 0x06, 0x66, 0x69, 0x6c, 0x74, 0x65, - 0x72, 0x18, 0x03, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x25, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, - 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x51, 0x75, 0x65, 0x72, 0x79, - 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x2e, 0x46, 0x69, 0x6c, 0x74, 0x65, 0x72, 0x52, 0x06, - 0x66, 0x69, 0x6c, 0x74, 0x65, 0x72, 0x12, 0x62, 0x0a, 0x13, 0x69, 0x6e, 0x70, 0x75, 0x74, 0x5f, - 0x73, 0x65, 0x72, 0x69, 0x61, 0x6c, 0x69, 0x7a, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x18, 0x04, 0x20, - 0x01, 0x28, 0x0b, 0x32, 0x31, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, - 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x51, 0x75, 0x65, 0x72, 0x79, 0x52, 0x65, 0x71, 0x75, - 0x65, 0x73, 0x74, 0x2e, 0x49, 0x6e, 0x70, 0x75, 0x74, 0x53, 0x65, 0x72, 0x69, 0x61, 0x6c, 0x69, - 0x7a, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x52, 0x12, 0x69, 0x6e, 0x70, 0x75, 0x74, 0x53, 0x65, 0x72, - 0x69, 0x61, 0x6c, 0x69, 0x7a, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x12, 0x65, 0x0a, 0x14, 0x6f, 0x75, - 0x74, 0x70, 0x75, 0x74, 0x5f, 0x73, 0x65, 0x72, 0x69, 0x61, 0x6c, 0x69, 0x7a, 0x61, 0x74, 0x69, - 0x6f, 0x6e, 0x18, 0x05, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x32, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, + 0x28, 0x0d, 0x52, 0x08, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x49, 0x64, 0x12, 0x1b, 0x0a, 0x09, + 0x6e, 0x65, 0x65, 0x64, 0x6c, 0x65, 0x5f, 0x69, 0x64, 0x18, 0x02, 0x20, 0x01, 0x28, 0x04, 0x52, + 0x08, 0x6e, 0x65, 0x65, 0x64, 0x6c, 0x65, 0x49, 0x64, 0x12, 0x16, 0x0a, 0x06, 0x63, 0x6f, 0x6f, + 0x6b, 0x69, 0x65, 0x18, 0x03, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x06, 0x63, 0x6f, 0x6f, 0x6b, 0x69, + 0x65, 0x12, 0x16, 0x0a, 0x06, 0x6f, 0x66, 0x66, 0x73, 0x65, 0x74, 0x18, 0x04, 0x20, 0x01, 0x28, + 0x03, 0x52, 0x06, 0x6f, 0x66, 0x66, 0x73, 0x65, 0x74, 0x12, 0x12, 0x0a, 0x04, 0x73, 0x69, 0x7a, + 0x65, 0x18, 0x05, 0x20, 0x01, 0x28, 0x03, 0x52, 0x04, 0x73, 0x69, 0x7a, 0x65, 0x12, 0x50, 0x0a, + 0x08, 0x72, 0x65, 0x70, 0x6c, 0x69, 0x63, 0x61, 0x73, 0x18, 0x06, 0x20, 0x03, 0x28, 0x0b, 0x32, + 0x34, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, + 0x70, 0x62, 0x2e, 0x46, 0x65, 0x74, 0x63, 0x68, 0x41, 0x6e, 0x64, 0x57, 0x72, 0x69, 0x74, 0x65, + 0x4e, 0x65, 0x65, 0x64, 0x6c, 0x65, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x2e, 0x52, 0x65, + 0x70, 0x6c, 0x69, 0x63, 0x61, 0x52, 0x08, 0x72, 0x65, 0x70, 0x6c, 0x69, 0x63, 0x61, 0x73, 0x12, + 0x12, 0x0a, 0x04, 0x61, 0x75, 0x74, 0x68, 0x18, 0x07, 0x20, 0x01, 0x28, 0x09, 0x52, 0x04, 0x61, + 0x75, 0x74, 0x68, 0x12, 0x36, 0x0a, 0x0b, 0x72, 0x65, 0x6d, 0x6f, 0x74, 0x65, 0x5f, 0x63, 0x6f, + 0x6e, 0x66, 0x18, 0x0f, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x15, 0x2e, 0x72, 0x65, 0x6d, 0x6f, 0x74, + 0x65, 0x5f, 0x70, 0x62, 0x2e, 0x52, 0x65, 0x6d, 0x6f, 0x74, 0x65, 0x43, 0x6f, 0x6e, 0x66, 0x52, + 0x0a, 0x72, 0x65, 0x6d, 0x6f, 0x74, 0x65, 0x43, 0x6f, 0x6e, 0x66, 0x12, 0x49, 0x0a, 0x0f, 0x72, + 0x65, 0x6d, 0x6f, 0x74, 0x65, 0x5f, 0x6c, 0x6f, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x18, 0x10, + 0x20, 0x01, 0x28, 0x0b, 0x32, 0x20, 0x2e, 0x72, 0x65, 0x6d, 0x6f, 0x74, 0x65, 0x5f, 0x70, 0x62, + 0x2e, 0x52, 0x65, 0x6d, 0x6f, 0x74, 0x65, 0x53, 0x74, 0x6f, 0x72, 0x61, 0x67, 0x65, 0x4c, 0x6f, + 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x52, 0x0e, 0x72, 0x65, 0x6d, 0x6f, 0x74, 0x65, 0x4c, 0x6f, + 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x1a, 0x57, 0x0a, 0x07, 0x52, 0x65, 0x70, 0x6c, 0x69, 0x63, + 0x61, 0x12, 0x10, 0x0a, 0x03, 0x75, 0x72, 0x6c, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, + 0x75, 0x72, 0x6c, 0x12, 0x1d, 0x0a, 0x0a, 0x70, 0x75, 0x62, 0x6c, 0x69, 0x63, 0x5f, 0x75, 0x72, + 0x6c, 0x18, 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x09, 0x70, 0x75, 0x62, 0x6c, 0x69, 0x63, 0x55, + 0x72, 0x6c, 0x12, 0x1b, 0x0a, 0x09, 0x67, 0x72, 0x70, 0x63, 0x5f, 0x70, 0x6f, 0x72, 0x74, 0x18, + 0x03, 0x20, 0x01, 0x28, 0x05, 0x52, 0x08, 0x67, 0x72, 0x70, 0x63, 0x50, 0x6f, 0x72, 0x74, 0x22, + 0x32, 0x0a, 0x1b, 0x46, 0x65, 0x74, 0x63, 0x68, 0x41, 0x6e, 0x64, 0x57, 0x72, 0x69, 0x74, 0x65, + 0x4e, 0x65, 0x65, 0x64, 0x6c, 0x65, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x12, 0x13, + 0x0a, 0x05, 0x65, 0x5f, 0x74, 0x61, 0x67, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x04, 0x65, + 0x54, 0x61, 0x67, 0x22, 0xf4, 0x0c, 0x0a, 0x0c, 0x51, 0x75, 0x65, 0x72, 0x79, 0x52, 0x65, 0x71, + 0x75, 0x65, 0x73, 0x74, 0x12, 0x1e, 0x0a, 0x0a, 0x73, 0x65, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, + 0x6e, 0x73, 0x18, 0x01, 0x20, 0x03, 0x28, 0x09, 0x52, 0x0a, 0x73, 0x65, 0x6c, 0x65, 0x63, 0x74, + 0x69, 0x6f, 0x6e, 0x73, 0x12, 0x22, 0x0a, 0x0d, 0x66, 0x72, 0x6f, 0x6d, 0x5f, 0x66, 0x69, 0x6c, + 0x65, 0x5f, 0x69, 0x64, 0x73, 0x18, 0x02, 0x20, 0x03, 0x28, 0x09, 0x52, 0x0b, 0x66, 0x72, 0x6f, + 0x6d, 0x46, 0x69, 0x6c, 0x65, 0x49, 0x64, 0x73, 0x12, 0x3d, 0x0a, 0x06, 0x66, 0x69, 0x6c, 0x74, + 0x65, 0x72, 0x18, 0x03, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x25, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x51, 0x75, 0x65, 0x72, - 0x79, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x2e, 0x4f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x53, - 0x65, 0x72, 0x69, 0x61, 0x6c, 0x69, 0x7a, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x52, 0x13, 0x6f, 0x75, - 0x74, 0x70, 0x75, 0x74, 0x53, 0x65, 0x72, 0x69, 0x61, 0x6c, 0x69, 0x7a, 0x61, 0x74, 0x69, 0x6f, - 0x6e, 0x1a, 0x4e, 0x0a, 0x06, 0x46, 0x69, 0x6c, 0x74, 0x65, 0x72, 0x12, 0x14, 0x0a, 0x05, 0x66, - 0x69, 0x65, 0x6c, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x05, 0x66, 0x69, 0x65, 0x6c, - 0x64, 0x12, 0x18, 0x0a, 0x07, 0x6f, 0x70, 0x65, 0x72, 0x61, 0x6e, 0x64, 0x18, 0x02, 0x20, 0x01, - 0x28, 0x09, 0x52, 0x07, 0x6f, 0x70, 0x65, 0x72, 0x61, 0x6e, 0x64, 0x12, 0x14, 0x0a, 0x05, 0x76, - 0x61, 0x6c, 0x75, 0x65, 0x18, 0x03, 0x20, 0x01, 0x28, 0x09, 0x52, 0x05, 0x76, 0x61, 0x6c, 0x75, - 0x65, 0x1a, 0xd3, 0x05, 0x0a, 0x12, 0x49, 0x6e, 0x70, 0x75, 0x74, 0x53, 0x65, 0x72, 0x69, 0x61, - 0x6c, 0x69, 0x7a, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x12, 0x29, 0x0a, 0x10, 0x63, 0x6f, 0x6d, 0x70, - 0x72, 0x65, 0x73, 0x73, 0x69, 0x6f, 0x6e, 0x5f, 0x74, 0x79, 0x70, 0x65, 0x18, 0x01, 0x20, 0x01, - 0x28, 0x09, 0x52, 0x0f, 0x63, 0x6f, 0x6d, 0x70, 0x72, 0x65, 0x73, 0x73, 0x69, 0x6f, 0x6e, 0x54, - 0x79, 0x70, 0x65, 0x12, 0x57, 0x0a, 0x09, 0x63, 0x73, 0x76, 0x5f, 0x69, 0x6e, 0x70, 0x75, 0x74, - 0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x3a, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, - 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x51, 0x75, 0x65, 0x72, 0x79, 0x52, - 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x2e, 0x49, 0x6e, 0x70, 0x75, 0x74, 0x53, 0x65, 0x72, 0x69, - 0x61, 0x6c, 0x69, 0x7a, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x2e, 0x43, 0x53, 0x56, 0x49, 0x6e, 0x70, - 0x75, 0x74, 0x52, 0x08, 0x63, 0x73, 0x76, 0x49, 0x6e, 0x70, 0x75, 0x74, 0x12, 0x5a, 0x0a, 0x0a, - 0x6a, 0x73, 0x6f, 0x6e, 0x5f, 0x69, 0x6e, 0x70, 0x75, 0x74, 0x18, 0x03, 0x20, 0x01, 0x28, 0x0b, - 0x32, 0x3b, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, + 0x79, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x2e, 0x46, 0x69, 0x6c, 0x74, 0x65, 0x72, 0x52, + 0x06, 0x66, 0x69, 0x6c, 0x74, 0x65, 0x72, 0x12, 0x62, 0x0a, 0x13, 0x69, 0x6e, 0x70, 0x75, 0x74, + 0x5f, 0x73, 0x65, 0x72, 0x69, 0x61, 0x6c, 0x69, 0x7a, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x18, 0x04, + 0x20, 0x01, 0x28, 0x0b, 0x32, 0x31, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, + 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x51, 0x75, 0x65, 0x72, 0x79, 0x52, 0x65, 0x71, + 0x75, 0x65, 0x73, 0x74, 0x2e, 0x49, 0x6e, 0x70, 0x75, 0x74, 0x53, 0x65, 0x72, 0x69, 0x61, 0x6c, + 0x69, 0x7a, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x52, 0x12, 0x69, 0x6e, 0x70, 0x75, 0x74, 0x53, 0x65, + 0x72, 0x69, 0x61, 0x6c, 0x69, 0x7a, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x12, 0x65, 0x0a, 0x14, 0x6f, + 0x75, 0x74, 0x70, 0x75, 0x74, 0x5f, 0x73, 0x65, 0x72, 0x69, 0x61, 0x6c, 0x69, 0x7a, 0x61, 0x74, + 0x69, 0x6f, 0x6e, 0x18, 0x05, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x32, 0x2e, 0x76, 0x6f, 0x6c, 0x75, + 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x51, 0x75, 0x65, + 0x72, 0x79, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x2e, 0x4f, 0x75, 0x74, 0x70, 0x75, 0x74, + 0x53, 0x65, 0x72, 0x69, 0x61, 0x6c, 0x69, 0x7a, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x52, 0x13, 0x6f, + 0x75, 0x74, 0x70, 0x75, 0x74, 0x53, 0x65, 0x72, 0x69, 0x61, 0x6c, 0x69, 0x7a, 0x61, 0x74, 0x69, + 0x6f, 0x6e, 0x1a, 0x4e, 0x0a, 0x06, 0x46, 0x69, 0x6c, 0x74, 0x65, 0x72, 0x12, 0x14, 0x0a, 0x05, + 0x66, 0x69, 0x65, 0x6c, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x05, 0x66, 0x69, 0x65, + 0x6c, 0x64, 0x12, 0x18, 0x0a, 0x07, 0x6f, 0x70, 0x65, 0x72, 0x61, 0x6e, 0x64, 0x18, 0x02, 0x20, + 0x01, 0x28, 0x09, 0x52, 0x07, 0x6f, 0x70, 0x65, 0x72, 0x61, 0x6e, 0x64, 0x12, 0x14, 0x0a, 0x05, + 0x76, 0x61, 0x6c, 0x75, 0x65, 0x18, 0x03, 0x20, 0x01, 0x28, 0x09, 0x52, 0x05, 0x76, 0x61, 0x6c, + 0x75, 0x65, 0x1a, 0xd3, 0x05, 0x0a, 0x12, 0x49, 0x6e, 0x70, 0x75, 0x74, 0x53, 0x65, 0x72, 0x69, + 0x61, 0x6c, 0x69, 0x7a, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x12, 0x29, 0x0a, 0x10, 0x63, 0x6f, 0x6d, + 0x70, 0x72, 0x65, 0x73, 0x73, 0x69, 0x6f, 0x6e, 0x5f, 0x74, 0x79, 0x70, 0x65, 0x18, 0x01, 0x20, + 0x01, 0x28, 0x09, 0x52, 0x0f, 0x63, 0x6f, 0x6d, 0x70, 0x72, 0x65, 0x73, 0x73, 0x69, 0x6f, 0x6e, + 0x54, 0x79, 0x70, 0x65, 0x12, 0x57, 0x0a, 0x09, 0x63, 0x73, 0x76, 0x5f, 0x69, 0x6e, 0x70, 0x75, + 0x74, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x3a, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, + 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x51, 0x75, 0x65, 0x72, 0x79, + 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x2e, 0x49, 0x6e, 0x70, 0x75, 0x74, 0x53, 0x65, 0x72, + 0x69, 0x61, 0x6c, 0x69, 0x7a, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x2e, 0x43, 0x53, 0x56, 0x49, 0x6e, + 0x70, 0x75, 0x74, 0x52, 0x08, 0x63, 0x73, 0x76, 0x49, 0x6e, 0x70, 0x75, 0x74, 0x12, 0x5a, 0x0a, + 0x0a, 0x6a, 0x73, 0x6f, 0x6e, 0x5f, 0x69, 0x6e, 0x70, 0x75, 0x74, 0x18, 0x03, 0x20, 0x01, 0x28, + 0x0b, 0x32, 0x3b, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, + 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x51, 0x75, 0x65, 0x72, 0x79, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, + 0x74, 0x2e, 0x49, 0x6e, 0x70, 0x75, 0x74, 0x53, 0x65, 0x72, 0x69, 0x61, 0x6c, 0x69, 0x7a, 0x61, + 0x74, 0x69, 0x6f, 0x6e, 0x2e, 0x4a, 0x53, 0x4f, 0x4e, 0x49, 0x6e, 0x70, 0x75, 0x74, 0x52, 0x09, + 0x6a, 0x73, 0x6f, 0x6e, 0x49, 0x6e, 0x70, 0x75, 0x74, 0x12, 0x63, 0x0a, 0x0d, 0x70, 0x61, 0x72, + 0x71, 0x75, 0x65, 0x74, 0x5f, 0x69, 0x6e, 0x70, 0x75, 0x74, 0x18, 0x04, 0x20, 0x01, 0x28, 0x0b, + 0x32, 0x3e, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x51, 0x75, 0x65, 0x72, 0x79, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x2e, 0x49, 0x6e, 0x70, 0x75, 0x74, 0x53, 0x65, 0x72, 0x69, 0x61, 0x6c, 0x69, 0x7a, 0x61, 0x74, - 0x69, 0x6f, 0x6e, 0x2e, 0x4a, 0x53, 0x4f, 0x4e, 0x49, 0x6e, 0x70, 0x75, 0x74, 0x52, 0x09, 0x6a, - 0x73, 0x6f, 0x6e, 0x49, 0x6e, 0x70, 0x75, 0x74, 0x12, 0x63, 0x0a, 0x0d, 0x70, 0x61, 0x72, 0x71, - 0x75, 0x65, 0x74, 0x5f, 0x69, 0x6e, 0x70, 0x75, 0x74, 0x18, 0x04, 0x20, 0x01, 0x28, 0x0b, 0x32, - 0x3e, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, - 0x70, 0x62, 0x2e, 0x51, 0x75, 0x65, 0x72, 0x79, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x2e, - 0x49, 0x6e, 0x70, 0x75, 0x74, 0x53, 0x65, 0x72, 0x69, 0x61, 0x6c, 0x69, 0x7a, 0x61, 0x74, 0x69, - 0x6f, 0x6e, 0x2e, 0x50, 0x61, 0x72, 0x71, 0x75, 0x65, 0x74, 0x49, 0x6e, 0x70, 0x75, 0x74, 0x52, - 0x0c, 0x70, 0x61, 0x72, 0x71, 0x75, 0x65, 0x74, 0x49, 0x6e, 0x70, 0x75, 0x74, 0x1a, 0xc6, 0x02, - 0x0a, 0x08, 0x43, 0x53, 0x56, 0x49, 0x6e, 0x70, 0x75, 0x74, 0x12, 0x28, 0x0a, 0x10, 0x66, 0x69, - 0x6c, 0x65, 0x5f, 0x68, 0x65, 0x61, 0x64, 0x65, 0x72, 0x5f, 0x69, 0x6e, 0x66, 0x6f, 0x18, 0x01, - 0x20, 0x01, 0x28, 0x09, 0x52, 0x0e, 0x66, 0x69, 0x6c, 0x65, 0x48, 0x65, 0x61, 0x64, 0x65, 0x72, - 0x49, 0x6e, 0x66, 0x6f, 0x12, 0x29, 0x0a, 0x10, 0x72, 0x65, 0x63, 0x6f, 0x72, 0x64, 0x5f, 0x64, - 0x65, 0x6c, 0x69, 0x6d, 0x69, 0x74, 0x65, 0x72, 0x18, 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0f, - 0x72, 0x65, 0x63, 0x6f, 0x72, 0x64, 0x44, 0x65, 0x6c, 0x69, 0x6d, 0x69, 0x74, 0x65, 0x72, 0x12, - 0x27, 0x0a, 0x0f, 0x66, 0x69, 0x65, 0x6c, 0x64, 0x5f, 0x64, 0x65, 0x6c, 0x69, 0x6d, 0x69, 0x74, - 0x65, 0x72, 0x18, 0x03, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0e, 0x66, 0x69, 0x65, 0x6c, 0x64, 0x44, - 0x65, 0x6c, 0x69, 0x6d, 0x69, 0x74, 0x65, 0x72, 0x12, 0x27, 0x0a, 0x0f, 0x71, 0x75, 0x6f, 0x74, - 0x65, 0x5f, 0x63, 0x68, 0x61, 0x72, 0x61, 0x63, 0x74, 0x65, 0x72, 0x18, 0x04, 0x20, 0x01, 0x28, - 0x09, 0x52, 0x0e, 0x71, 0x75, 0x6f, 0x74, 0x65, 0x43, 0x68, 0x61, 0x72, 0x61, 0x63, 0x74, 0x65, - 0x72, 0x12, 0x34, 0x0a, 0x16, 0x71, 0x75, 0x6f, 0x74, 0x65, 0x5f, 0x65, 0x73, 0x63, 0x61, 0x70, - 0x65, 0x5f, 0x63, 0x68, 0x61, 0x72, 0x61, 0x63, 0x74, 0x65, 0x72, 0x18, 0x05, 0x20, 0x01, 0x28, - 0x09, 0x52, 0x14, 0x71, 0x75, 0x6f, 0x74, 0x65, 0x45, 0x73, 0x63, 0x61, 0x70, 0x65, 0x43, 0x68, - 0x61, 0x72, 0x61, 0x63, 0x74, 0x65, 0x72, 0x12, 0x1a, 0x0a, 0x08, 0x63, 0x6f, 0x6d, 0x6d, 0x65, - 0x6e, 0x74, 0x73, 0x18, 0x06, 0x20, 0x01, 0x28, 0x09, 0x52, 0x08, 0x63, 0x6f, 0x6d, 0x6d, 0x65, - 0x6e, 0x74, 0x73, 0x12, 0x41, 0x0a, 0x1d, 0x61, 0x6c, 0x6c, 0x6f, 0x77, 0x5f, 0x71, 0x75, 0x6f, - 0x74, 0x65, 0x64, 0x5f, 0x72, 0x65, 0x63, 0x6f, 0x72, 0x64, 0x5f, 0x64, 0x65, 0x6c, 0x69, 0x6d, - 0x69, 0x74, 0x65, 0x72, 0x18, 0x07, 0x20, 0x01, 0x28, 0x08, 0x52, 0x1a, 0x61, 0x6c, 0x6c, 0x6f, - 0x77, 0x51, 0x75, 0x6f, 0x74, 0x65, 0x64, 0x52, 0x65, 0x63, 0x6f, 0x72, 0x64, 0x44, 0x65, 0x6c, - 0x69, 0x6d, 0x69, 0x74, 0x65, 0x72, 0x1a, 0x1f, 0x0a, 0x09, 0x4a, 0x53, 0x4f, 0x4e, 0x49, 0x6e, - 0x70, 0x75, 0x74, 0x12, 0x12, 0x0a, 0x04, 0x74, 0x79, 0x70, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, - 0x09, 0x52, 0x04, 0x74, 0x79, 0x70, 0x65, 0x1a, 0x0e, 0x0a, 0x0c, 0x50, 0x61, 0x72, 0x71, 0x75, - 0x65, 0x74, 0x49, 0x6e, 0x70, 0x75, 0x74, 0x1a, 0xef, 0x03, 0x0a, 0x13, 0x4f, 0x75, 0x74, 0x70, - 0x75, 0x74, 0x53, 0x65, 0x72, 0x69, 0x61, 0x6c, 0x69, 0x7a, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x12, - 0x5b, 0x0a, 0x0a, 0x63, 0x73, 0x76, 0x5f, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x18, 0x02, 0x20, - 0x01, 0x28, 0x0b, 0x32, 0x3c, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, - 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x51, 0x75, 0x65, 0x72, 0x79, 0x52, 0x65, 0x71, 0x75, - 0x65, 0x73, 0x74, 0x2e, 0x4f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x53, 0x65, 0x72, 0x69, 0x61, 0x6c, - 0x69, 0x7a, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x2e, 0x43, 0x53, 0x56, 0x4f, 0x75, 0x74, 0x70, 0x75, - 0x74, 0x52, 0x09, 0x63, 0x73, 0x76, 0x4f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x12, 0x5e, 0x0a, 0x0b, - 0x6a, 0x73, 0x6f, 0x6e, 0x5f, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x18, 0x03, 0x20, 0x01, 0x28, - 0x0b, 0x32, 0x3d, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, - 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x51, 0x75, 0x65, 0x72, 0x79, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, - 0x74, 0x2e, 0x4f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x53, 0x65, 0x72, 0x69, 0x61, 0x6c, 0x69, 0x7a, - 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x2e, 0x4a, 0x53, 0x4f, 0x4e, 0x4f, 0x75, 0x74, 0x70, 0x75, 0x74, - 0x52, 0x0a, 0x6a, 0x73, 0x6f, 0x6e, 0x4f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x1a, 0xe1, 0x01, 0x0a, - 0x09, 0x43, 0x53, 0x56, 0x4f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x12, 0x21, 0x0a, 0x0c, 0x71, 0x75, - 0x6f, 0x74, 0x65, 0x5f, 0x66, 0x69, 0x65, 0x6c, 0x64, 0x73, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, - 0x52, 0x0b, 0x71, 0x75, 0x6f, 0x74, 0x65, 0x46, 0x69, 0x65, 0x6c, 0x64, 0x73, 0x12, 0x29, 0x0a, - 0x10, 0x72, 0x65, 0x63, 0x6f, 0x72, 0x64, 0x5f, 0x64, 0x65, 0x6c, 0x69, 0x6d, 0x69, 0x74, 0x65, - 0x72, 0x18, 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0f, 0x72, 0x65, 0x63, 0x6f, 0x72, 0x64, 0x44, - 0x65, 0x6c, 0x69, 0x6d, 0x69, 0x74, 0x65, 0x72, 0x12, 0x27, 0x0a, 0x0f, 0x66, 0x69, 0x65, 0x6c, - 0x64, 0x5f, 0x64, 0x65, 0x6c, 0x69, 0x6d, 0x69, 0x74, 0x65, 0x72, 0x18, 0x03, 0x20, 0x01, 0x28, - 0x09, 0x52, 0x0e, 0x66, 0x69, 0x65, 0x6c, 0x64, 0x44, 0x65, 0x6c, 0x69, 0x6d, 0x69, 0x74, 0x65, - 0x72, 0x12, 0x27, 0x0a, 0x0f, 0x71, 0x75, 0x6f, 0x74, 0x65, 0x5f, 0x63, 0x68, 0x61, 0x72, 0x61, - 0x63, 0x74, 0x65, 0x72, 0x18, 0x04, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0e, 0x71, 0x75, 0x6f, 0x74, - 0x65, 0x43, 0x68, 0x61, 0x72, 0x61, 0x63, 0x74, 0x65, 0x72, 0x12, 0x34, 0x0a, 0x16, 0x71, 0x75, - 0x6f, 0x74, 0x65, 0x5f, 0x65, 0x73, 0x63, 0x61, 0x70, 0x65, 0x5f, 0x63, 0x68, 0x61, 0x72, 0x61, - 0x63, 0x74, 0x65, 0x72, 0x18, 0x05, 0x20, 0x01, 0x28, 0x09, 0x52, 0x14, 0x71, 0x75, 0x6f, 0x74, - 0x65, 0x45, 0x73, 0x63, 0x61, 0x70, 0x65, 0x43, 0x68, 0x61, 0x72, 0x61, 0x63, 0x74, 0x65, 0x72, - 0x1a, 0x37, 0x0a, 0x0a, 0x4a, 0x53, 0x4f, 0x4e, 0x4f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x12, 0x29, + 0x69, 0x6f, 0x6e, 0x2e, 0x50, 0x61, 0x72, 0x71, 0x75, 0x65, 0x74, 0x49, 0x6e, 0x70, 0x75, 0x74, + 0x52, 0x0c, 0x70, 0x61, 0x72, 0x71, 0x75, 0x65, 0x74, 0x49, 0x6e, 0x70, 0x75, 0x74, 0x1a, 0xc6, + 0x02, 0x0a, 0x08, 0x43, 0x53, 0x56, 0x49, 0x6e, 0x70, 0x75, 0x74, 0x12, 0x28, 0x0a, 0x10, 0x66, + 0x69, 0x6c, 0x65, 0x5f, 0x68, 0x65, 0x61, 0x64, 0x65, 0x72, 0x5f, 0x69, 0x6e, 0x66, 0x6f, 0x18, + 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0e, 0x66, 0x69, 0x6c, 0x65, 0x48, 0x65, 0x61, 0x64, 0x65, + 0x72, 0x49, 0x6e, 0x66, 0x6f, 0x12, 0x29, 0x0a, 0x10, 0x72, 0x65, 0x63, 0x6f, 0x72, 0x64, 0x5f, + 0x64, 0x65, 0x6c, 0x69, 0x6d, 0x69, 0x74, 0x65, 0x72, 0x18, 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, + 0x0f, 0x72, 0x65, 0x63, 0x6f, 0x72, 0x64, 0x44, 0x65, 0x6c, 0x69, 0x6d, 0x69, 0x74, 0x65, 0x72, + 0x12, 0x27, 0x0a, 0x0f, 0x66, 0x69, 0x65, 0x6c, 0x64, 0x5f, 0x64, 0x65, 0x6c, 0x69, 0x6d, 0x69, + 0x74, 0x65, 0x72, 0x18, 0x03, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0e, 0x66, 0x69, 0x65, 0x6c, 0x64, + 0x44, 0x65, 0x6c, 0x69, 0x6d, 0x69, 0x74, 0x65, 0x72, 0x12, 0x27, 0x0a, 0x0f, 0x71, 0x75, 0x6f, + 0x74, 0x65, 0x5f, 0x63, 0x68, 0x61, 0x72, 0x61, 0x63, 0x74, 0x65, 0x72, 0x18, 0x04, 0x20, 0x01, + 0x28, 0x09, 0x52, 0x0e, 0x71, 0x75, 0x6f, 0x74, 0x65, 0x43, 0x68, 0x61, 0x72, 0x61, 0x63, 0x74, + 0x65, 0x72, 0x12, 0x34, 0x0a, 0x16, 0x71, 0x75, 0x6f, 0x74, 0x65, 0x5f, 0x65, 0x73, 0x63, 0x61, + 0x70, 0x65, 0x5f, 0x63, 0x68, 0x61, 0x72, 0x61, 0x63, 0x74, 0x65, 0x72, 0x18, 0x05, 0x20, 0x01, + 0x28, 0x09, 0x52, 0x14, 0x71, 0x75, 0x6f, 0x74, 0x65, 0x45, 0x73, 0x63, 0x61, 0x70, 0x65, 0x43, + 0x68, 0x61, 0x72, 0x61, 0x63, 0x74, 0x65, 0x72, 0x12, 0x1a, 0x0a, 0x08, 0x63, 0x6f, 0x6d, 0x6d, + 0x65, 0x6e, 0x74, 0x73, 0x18, 0x06, 0x20, 0x01, 0x28, 0x09, 0x52, 0x08, 0x63, 0x6f, 0x6d, 0x6d, + 0x65, 0x6e, 0x74, 0x73, 0x12, 0x41, 0x0a, 0x1d, 0x61, 0x6c, 0x6c, 0x6f, 0x77, 0x5f, 0x71, 0x75, + 0x6f, 0x74, 0x65, 0x64, 0x5f, 0x72, 0x65, 0x63, 0x6f, 0x72, 0x64, 0x5f, 0x64, 0x65, 0x6c, 0x69, + 0x6d, 0x69, 0x74, 0x65, 0x72, 0x18, 0x07, 0x20, 0x01, 0x28, 0x08, 0x52, 0x1a, 0x61, 0x6c, 0x6c, + 0x6f, 0x77, 0x51, 0x75, 0x6f, 0x74, 0x65, 0x64, 0x52, 0x65, 0x63, 0x6f, 0x72, 0x64, 0x44, 0x65, + 0x6c, 0x69, 0x6d, 0x69, 0x74, 0x65, 0x72, 0x1a, 0x1f, 0x0a, 0x09, 0x4a, 0x53, 0x4f, 0x4e, 0x49, + 0x6e, 0x70, 0x75, 0x74, 0x12, 0x12, 0x0a, 0x04, 0x74, 0x79, 0x70, 0x65, 0x18, 0x01, 0x20, 0x01, + 0x28, 0x09, 0x52, 0x04, 0x74, 0x79, 0x70, 0x65, 0x1a, 0x0e, 0x0a, 0x0c, 0x50, 0x61, 0x72, 0x71, + 0x75, 0x65, 0x74, 0x49, 0x6e, 0x70, 0x75, 0x74, 0x1a, 0xef, 0x03, 0x0a, 0x13, 0x4f, 0x75, 0x74, + 0x70, 0x75, 0x74, 0x53, 0x65, 0x72, 0x69, 0x61, 0x6c, 0x69, 0x7a, 0x61, 0x74, 0x69, 0x6f, 0x6e, + 0x12, 0x5b, 0x0a, 0x0a, 0x63, 0x73, 0x76, 0x5f, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x18, 0x02, + 0x20, 0x01, 0x28, 0x0b, 0x32, 0x3c, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, + 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x51, 0x75, 0x65, 0x72, 0x79, 0x52, 0x65, 0x71, + 0x75, 0x65, 0x73, 0x74, 0x2e, 0x4f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x53, 0x65, 0x72, 0x69, 0x61, + 0x6c, 0x69, 0x7a, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x2e, 0x43, 0x53, 0x56, 0x4f, 0x75, 0x74, 0x70, + 0x75, 0x74, 0x52, 0x09, 0x63, 0x73, 0x76, 0x4f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x12, 0x5e, 0x0a, + 0x0b, 0x6a, 0x73, 0x6f, 0x6e, 0x5f, 0x6f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x18, 0x03, 0x20, 0x01, + 0x28, 0x0b, 0x32, 0x3d, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, + 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x51, 0x75, 0x65, 0x72, 0x79, 0x52, 0x65, 0x71, 0x75, 0x65, + 0x73, 0x74, 0x2e, 0x4f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x53, 0x65, 0x72, 0x69, 0x61, 0x6c, 0x69, + 0x7a, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x2e, 0x4a, 0x53, 0x4f, 0x4e, 0x4f, 0x75, 0x74, 0x70, 0x75, + 0x74, 0x52, 0x0a, 0x6a, 0x73, 0x6f, 0x6e, 0x4f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x1a, 0xe1, 0x01, + 0x0a, 0x09, 0x43, 0x53, 0x56, 0x4f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x12, 0x21, 0x0a, 0x0c, 0x71, + 0x75, 0x6f, 0x74, 0x65, 0x5f, 0x66, 0x69, 0x65, 0x6c, 0x64, 0x73, 0x18, 0x01, 0x20, 0x01, 0x28, + 0x09, 0x52, 0x0b, 0x71, 0x75, 0x6f, 0x74, 0x65, 0x46, 0x69, 0x65, 0x6c, 0x64, 0x73, 0x12, 0x29, 0x0a, 0x10, 0x72, 0x65, 0x63, 0x6f, 0x72, 0x64, 0x5f, 0x64, 0x65, 0x6c, 0x69, 0x6d, 0x69, 0x74, - 0x65, 0x72, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0f, 0x72, 0x65, 0x63, 0x6f, 0x72, 0x64, - 0x44, 0x65, 0x6c, 0x69, 0x6d, 0x69, 0x74, 0x65, 0x72, 0x22, 0x29, 0x0a, 0x0d, 0x51, 0x75, 0x65, - 0x72, 0x69, 0x65, 0x64, 0x53, 0x74, 0x72, 0x69, 0x70, 0x65, 0x12, 0x18, 0x0a, 0x07, 0x72, 0x65, - 0x63, 0x6f, 0x72, 0x64, 0x73, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x07, 0x72, 0x65, 0x63, - 0x6f, 0x72, 0x64, 0x73, 0x22, 0x55, 0x0a, 0x19, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x4e, 0x65, - 0x65, 0x64, 0x6c, 0x65, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, - 0x74, 0x12, 0x1b, 0x0a, 0x09, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x69, 0x64, 0x18, 0x01, - 0x20, 0x01, 0x28, 0x0d, 0x52, 0x08, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x49, 0x64, 0x12, 0x1b, - 0x0a, 0x09, 0x6e, 0x65, 0x65, 0x64, 0x6c, 0x65, 0x5f, 0x69, 0x64, 0x18, 0x02, 0x20, 0x01, 0x28, - 0x04, 0x52, 0x08, 0x6e, 0x65, 0x65, 0x64, 0x6c, 0x65, 0x49, 0x64, 0x22, 0xae, 0x01, 0x0a, 0x1a, - 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x4e, 0x65, 0x65, 0x64, 0x6c, 0x65, 0x53, 0x74, 0x61, 0x74, - 0x75, 0x73, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x12, 0x1b, 0x0a, 0x09, 0x6e, 0x65, - 0x65, 0x64, 0x6c, 0x65, 0x5f, 0x69, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x04, 0x52, 0x08, 0x6e, - 0x65, 0x65, 0x64, 0x6c, 0x65, 0x49, 0x64, 0x12, 0x16, 0x0a, 0x06, 0x63, 0x6f, 0x6f, 0x6b, 0x69, - 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x06, 0x63, 0x6f, 0x6f, 0x6b, 0x69, 0x65, 0x12, - 0x12, 0x0a, 0x04, 0x73, 0x69, 0x7a, 0x65, 0x18, 0x03, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x04, 0x73, - 0x69, 0x7a, 0x65, 0x12, 0x23, 0x0a, 0x0d, 0x6c, 0x61, 0x73, 0x74, 0x5f, 0x6d, 0x6f, 0x64, 0x69, - 0x66, 0x69, 0x65, 0x64, 0x18, 0x04, 0x20, 0x01, 0x28, 0x04, 0x52, 0x0c, 0x6c, 0x61, 0x73, 0x74, - 0x4d, 0x6f, 0x64, 0x69, 0x66, 0x69, 0x65, 0x64, 0x12, 0x10, 0x0a, 0x03, 0x63, 0x72, 0x63, 0x18, - 0x05, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x03, 0x63, 0x72, 0x63, 0x12, 0x10, 0x0a, 0x03, 0x74, 0x74, - 0x6c, 0x18, 0x06, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, 0x74, 0x74, 0x6c, 0x22, 0x46, 0x0a, 0x0b, - 0x50, 0x69, 0x6e, 0x67, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x12, 0x16, 0x0a, 0x06, 0x74, - 0x61, 0x72, 0x67, 0x65, 0x74, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x06, 0x74, 0x61, 0x72, - 0x67, 0x65, 0x74, 0x12, 0x1f, 0x0a, 0x0b, 0x74, 0x61, 0x72, 0x67, 0x65, 0x74, 0x5f, 0x74, 0x79, - 0x70, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0a, 0x74, 0x61, 0x72, 0x67, 0x65, 0x74, - 0x54, 0x79, 0x70, 0x65, 0x22, 0x7a, 0x0a, 0x0c, 0x50, 0x69, 0x6e, 0x67, 0x52, 0x65, 0x73, 0x70, - 0x6f, 0x6e, 0x73, 0x65, 0x12, 0x22, 0x0a, 0x0d, 0x73, 0x74, 0x61, 0x72, 0x74, 0x5f, 0x74, 0x69, - 0x6d, 0x65, 0x5f, 0x6e, 0x73, 0x18, 0x01, 0x20, 0x01, 0x28, 0x03, 0x52, 0x0b, 0x73, 0x74, 0x61, - 0x72, 0x74, 0x54, 0x69, 0x6d, 0x65, 0x4e, 0x73, 0x12, 0x24, 0x0a, 0x0e, 0x72, 0x65, 0x6d, 0x6f, - 0x74, 0x65, 0x5f, 0x74, 0x69, 0x6d, 0x65, 0x5f, 0x6e, 0x73, 0x18, 0x02, 0x20, 0x01, 0x28, 0x03, - 0x52, 0x0c, 0x72, 0x65, 0x6d, 0x6f, 0x74, 0x65, 0x54, 0x69, 0x6d, 0x65, 0x4e, 0x73, 0x12, 0x20, - 0x0a, 0x0c, 0x73, 0x74, 0x6f, 0x70, 0x5f, 0x74, 0x69, 0x6d, 0x65, 0x5f, 0x6e, 0x73, 0x18, 0x03, - 0x20, 0x01, 0x28, 0x03, 0x52, 0x0a, 0x73, 0x74, 0x6f, 0x70, 0x54, 0x69, 0x6d, 0x65, 0x4e, 0x73, - 0x32, 0xbc, 0x24, 0x0a, 0x0c, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x53, 0x65, 0x72, 0x76, 0x65, - 0x72, 0x12, 0x5c, 0x0a, 0x0b, 0x42, 0x61, 0x74, 0x63, 0x68, 0x44, 0x65, 0x6c, 0x65, 0x74, 0x65, - 0x12, 0x24, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, - 0x5f, 0x70, 0x62, 0x2e, 0x42, 0x61, 0x74, 0x63, 0x68, 0x44, 0x65, 0x6c, 0x65, 0x74, 0x65, 0x52, - 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x25, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, - 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x42, 0x61, 0x74, 0x63, 0x68, 0x44, - 0x65, 0x6c, 0x65, 0x74, 0x65, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, - 0x6e, 0x0a, 0x11, 0x56, 0x61, 0x63, 0x75, 0x75, 0x6d, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x43, - 0x68, 0x65, 0x63, 0x6b, 0x12, 0x2a, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, - 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x61, 0x63, 0x75, 0x75, 0x6d, 0x56, 0x6f, - 0x6c, 0x75, 0x6d, 0x65, 0x43, 0x68, 0x65, 0x63, 0x6b, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, - 0x1a, 0x2b, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, - 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x61, 0x63, 0x75, 0x75, 0x6d, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, - 0x43, 0x68, 0x65, 0x63, 0x6b, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, - 0x76, 0x0a, 0x13, 0x56, 0x61, 0x63, 0x75, 0x75, 0x6d, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x43, - 0x6f, 0x6d, 0x70, 0x61, 0x63, 0x74, 0x12, 0x2c, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, - 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x61, 0x63, 0x75, 0x75, 0x6d, - 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x43, 0x6f, 0x6d, 0x70, 0x61, 0x63, 0x74, 0x52, 0x65, 0x71, - 0x75, 0x65, 0x73, 0x74, 0x1a, 0x2d, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, - 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x61, 0x63, 0x75, 0x75, 0x6d, 0x56, 0x6f, - 0x6c, 0x75, 0x6d, 0x65, 0x43, 0x6f, 0x6d, 0x70, 0x61, 0x63, 0x74, 0x52, 0x65, 0x73, 0x70, 0x6f, - 0x6e, 0x73, 0x65, 0x22, 0x00, 0x30, 0x01, 0x12, 0x71, 0x0a, 0x12, 0x56, 0x61, 0x63, 0x75, 0x75, - 0x6d, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x43, 0x6f, 0x6d, 0x6d, 0x69, 0x74, 0x12, 0x2b, 0x2e, - 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, - 0x2e, 0x56, 0x61, 0x63, 0x75, 0x75, 0x6d, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x43, 0x6f, 0x6d, - 0x6d, 0x69, 0x74, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x2c, 0x2e, 0x76, 0x6f, 0x6c, - 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x61, - 0x63, 0x75, 0x75, 0x6d, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x43, 0x6f, 0x6d, 0x6d, 0x69, 0x74, - 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x74, 0x0a, 0x13, 0x56, 0x61, - 0x63, 0x75, 0x75, 0x6d, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x43, 0x6c, 0x65, 0x61, 0x6e, 0x75, - 0x70, 0x12, 0x2c, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, + 0x65, 0x72, 0x18, 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0f, 0x72, 0x65, 0x63, 0x6f, 0x72, 0x64, + 0x44, 0x65, 0x6c, 0x69, 0x6d, 0x69, 0x74, 0x65, 0x72, 0x12, 0x27, 0x0a, 0x0f, 0x66, 0x69, 0x65, + 0x6c, 0x64, 0x5f, 0x64, 0x65, 0x6c, 0x69, 0x6d, 0x69, 0x74, 0x65, 0x72, 0x18, 0x03, 0x20, 0x01, + 0x28, 0x09, 0x52, 0x0e, 0x66, 0x69, 0x65, 0x6c, 0x64, 0x44, 0x65, 0x6c, 0x69, 0x6d, 0x69, 0x74, + 0x65, 0x72, 0x12, 0x27, 0x0a, 0x0f, 0x71, 0x75, 0x6f, 0x74, 0x65, 0x5f, 0x63, 0x68, 0x61, 0x72, + 0x61, 0x63, 0x74, 0x65, 0x72, 0x18, 0x04, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0e, 0x71, 0x75, 0x6f, + 0x74, 0x65, 0x43, 0x68, 0x61, 0x72, 0x61, 0x63, 0x74, 0x65, 0x72, 0x12, 0x34, 0x0a, 0x16, 0x71, + 0x75, 0x6f, 0x74, 0x65, 0x5f, 0x65, 0x73, 0x63, 0x61, 0x70, 0x65, 0x5f, 0x63, 0x68, 0x61, 0x72, + 0x61, 0x63, 0x74, 0x65, 0x72, 0x18, 0x05, 0x20, 0x01, 0x28, 0x09, 0x52, 0x14, 0x71, 0x75, 0x6f, + 0x74, 0x65, 0x45, 0x73, 0x63, 0x61, 0x70, 0x65, 0x43, 0x68, 0x61, 0x72, 0x61, 0x63, 0x74, 0x65, + 0x72, 0x1a, 0x37, 0x0a, 0x0a, 0x4a, 0x53, 0x4f, 0x4e, 0x4f, 0x75, 0x74, 0x70, 0x75, 0x74, 0x12, + 0x29, 0x0a, 0x10, 0x72, 0x65, 0x63, 0x6f, 0x72, 0x64, 0x5f, 0x64, 0x65, 0x6c, 0x69, 0x6d, 0x69, + 0x74, 0x65, 0x72, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0f, 0x72, 0x65, 0x63, 0x6f, 0x72, + 0x64, 0x44, 0x65, 0x6c, 0x69, 0x6d, 0x69, 0x74, 0x65, 0x72, 0x22, 0x29, 0x0a, 0x0d, 0x51, 0x75, + 0x65, 0x72, 0x69, 0x65, 0x64, 0x53, 0x74, 0x72, 0x69, 0x70, 0x65, 0x12, 0x18, 0x0a, 0x07, 0x72, + 0x65, 0x63, 0x6f, 0x72, 0x64, 0x73, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x07, 0x72, 0x65, + 0x63, 0x6f, 0x72, 0x64, 0x73, 0x22, 0x55, 0x0a, 0x19, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x4e, + 0x65, 0x65, 0x64, 0x6c, 0x65, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x52, 0x65, 0x71, 0x75, 0x65, + 0x73, 0x74, 0x12, 0x1b, 0x0a, 0x09, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x69, 0x64, 0x18, + 0x01, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x08, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x49, 0x64, 0x12, + 0x1b, 0x0a, 0x09, 0x6e, 0x65, 0x65, 0x64, 0x6c, 0x65, 0x5f, 0x69, 0x64, 0x18, 0x02, 0x20, 0x01, + 0x28, 0x04, 0x52, 0x08, 0x6e, 0x65, 0x65, 0x64, 0x6c, 0x65, 0x49, 0x64, 0x22, 0xae, 0x01, 0x0a, + 0x1a, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x4e, 0x65, 0x65, 0x64, 0x6c, 0x65, 0x53, 0x74, 0x61, + 0x74, 0x75, 0x73, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x12, 0x1b, 0x0a, 0x09, 0x6e, + 0x65, 0x65, 0x64, 0x6c, 0x65, 0x5f, 0x69, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x04, 0x52, 0x08, + 0x6e, 0x65, 0x65, 0x64, 0x6c, 0x65, 0x49, 0x64, 0x12, 0x16, 0x0a, 0x06, 0x63, 0x6f, 0x6f, 0x6b, + 0x69, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x06, 0x63, 0x6f, 0x6f, 0x6b, 0x69, 0x65, + 0x12, 0x12, 0x0a, 0x04, 0x73, 0x69, 0x7a, 0x65, 0x18, 0x03, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x04, + 0x73, 0x69, 0x7a, 0x65, 0x12, 0x23, 0x0a, 0x0d, 0x6c, 0x61, 0x73, 0x74, 0x5f, 0x6d, 0x6f, 0x64, + 0x69, 0x66, 0x69, 0x65, 0x64, 0x18, 0x04, 0x20, 0x01, 0x28, 0x04, 0x52, 0x0c, 0x6c, 0x61, 0x73, + 0x74, 0x4d, 0x6f, 0x64, 0x69, 0x66, 0x69, 0x65, 0x64, 0x12, 0x10, 0x0a, 0x03, 0x63, 0x72, 0x63, + 0x18, 0x05, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x03, 0x63, 0x72, 0x63, 0x12, 0x10, 0x0a, 0x03, 0x74, + 0x74, 0x6c, 0x18, 0x06, 0x20, 0x01, 0x28, 0x09, 0x52, 0x03, 0x74, 0x74, 0x6c, 0x22, 0x46, 0x0a, + 0x0b, 0x50, 0x69, 0x6e, 0x67, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x12, 0x16, 0x0a, 0x06, + 0x74, 0x61, 0x72, 0x67, 0x65, 0x74, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x06, 0x74, 0x61, + 0x72, 0x67, 0x65, 0x74, 0x12, 0x1f, 0x0a, 0x0b, 0x74, 0x61, 0x72, 0x67, 0x65, 0x74, 0x5f, 0x74, + 0x79, 0x70, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0a, 0x74, 0x61, 0x72, 0x67, 0x65, + 0x74, 0x54, 0x79, 0x70, 0x65, 0x22, 0x7a, 0x0a, 0x0c, 0x50, 0x69, 0x6e, 0x67, 0x52, 0x65, 0x73, + 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x12, 0x22, 0x0a, 0x0d, 0x73, 0x74, 0x61, 0x72, 0x74, 0x5f, 0x74, + 0x69, 0x6d, 0x65, 0x5f, 0x6e, 0x73, 0x18, 0x01, 0x20, 0x01, 0x28, 0x03, 0x52, 0x0b, 0x73, 0x74, + 0x61, 0x72, 0x74, 0x54, 0x69, 0x6d, 0x65, 0x4e, 0x73, 0x12, 0x24, 0x0a, 0x0e, 0x72, 0x65, 0x6d, + 0x6f, 0x74, 0x65, 0x5f, 0x74, 0x69, 0x6d, 0x65, 0x5f, 0x6e, 0x73, 0x18, 0x02, 0x20, 0x01, 0x28, + 0x03, 0x52, 0x0c, 0x72, 0x65, 0x6d, 0x6f, 0x74, 0x65, 0x54, 0x69, 0x6d, 0x65, 0x4e, 0x73, 0x12, + 0x20, 0x0a, 0x0c, 0x73, 0x74, 0x6f, 0x70, 0x5f, 0x74, 0x69, 0x6d, 0x65, 0x5f, 0x6e, 0x73, 0x18, + 0x03, 0x20, 0x01, 0x28, 0x03, 0x52, 0x0a, 0x73, 0x74, 0x6f, 0x70, 0x54, 0x69, 0x6d, 0x65, 0x4e, + 0x73, 0x32, 0xbc, 0x24, 0x0a, 0x0c, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x53, 0x65, 0x72, 0x76, + 0x65, 0x72, 0x12, 0x5c, 0x0a, 0x0b, 0x42, 0x61, 0x74, 0x63, 0x68, 0x44, 0x65, 0x6c, 0x65, 0x74, + 0x65, 0x12, 0x24, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, + 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x42, 0x61, 0x74, 0x63, 0x68, 0x44, 0x65, 0x6c, 0x65, 0x74, 0x65, + 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x25, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, + 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x42, 0x61, 0x74, 0x63, 0x68, + 0x44, 0x65, 0x6c, 0x65, 0x74, 0x65, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, + 0x12, 0x6e, 0x0a, 0x11, 0x56, 0x61, 0x63, 0x75, 0x75, 0x6d, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, + 0x43, 0x68, 0x65, 0x63, 0x6b, 0x12, 0x2a, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, + 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x61, 0x63, 0x75, 0x75, 0x6d, 0x56, + 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x43, 0x68, 0x65, 0x63, 0x6b, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, + 0x74, 0x1a, 0x2b, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x61, 0x63, 0x75, 0x75, 0x6d, 0x56, 0x6f, 0x6c, 0x75, 0x6d, - 0x65, 0x43, 0x6c, 0x65, 0x61, 0x6e, 0x75, 0x70, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, - 0x2d, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, - 0x70, 0x62, 0x2e, 0x56, 0x61, 0x63, 0x75, 0x75, 0x6d, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x43, - 0x6c, 0x65, 0x61, 0x6e, 0x75, 0x70, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, - 0x12, 0x6b, 0x0a, 0x10, 0x44, 0x65, 0x6c, 0x65, 0x74, 0x65, 0x43, 0x6f, 0x6c, 0x6c, 0x65, 0x63, - 0x74, 0x69, 0x6f, 0x6e, 0x12, 0x29, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, - 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x44, 0x65, 0x6c, 0x65, 0x74, 0x65, 0x43, 0x6f, - 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, - 0x2a, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, - 0x70, 0x62, 0x2e, 0x44, 0x65, 0x6c, 0x65, 0x74, 0x65, 0x43, 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, - 0x69, 0x6f, 0x6e, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x65, 0x0a, - 0x0e, 0x41, 0x6c, 0x6c, 0x6f, 0x63, 0x61, 0x74, 0x65, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x12, - 0x27, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, - 0x70, 0x62, 0x2e, 0x41, 0x6c, 0x6c, 0x6f, 0x63, 0x61, 0x74, 0x65, 0x56, 0x6f, 0x6c, 0x75, 0x6d, - 0x65, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x28, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, - 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x41, 0x6c, 0x6c, 0x6f, - 0x63, 0x61, 0x74, 0x65, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, - 0x73, 0x65, 0x22, 0x00, 0x12, 0x6b, 0x0a, 0x10, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x53, 0x79, - 0x6e, 0x63, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x12, 0x29, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, - 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, - 0x6d, 0x65, 0x53, 0x79, 0x6e, 0x63, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x52, 0x65, 0x71, 0x75, - 0x65, 0x73, 0x74, 0x1a, 0x2a, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, - 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x53, 0x79, 0x6e, - 0x63, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, - 0x00, 0x12, 0x7c, 0x0a, 0x15, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x49, 0x6e, 0x63, 0x72, 0x65, - 0x6d, 0x65, 0x6e, 0x74, 0x61, 0x6c, 0x43, 0x6f, 0x70, 0x79, 0x12, 0x2e, 0x2e, 0x76, 0x6f, 0x6c, - 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, - 0x6c, 0x75, 0x6d, 0x65, 0x49, 0x6e, 0x63, 0x72, 0x65, 0x6d, 0x65, 0x6e, 0x74, 0x61, 0x6c, 0x43, - 0x6f, 0x70, 0x79, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x2f, 0x2e, 0x76, 0x6f, 0x6c, - 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, - 0x6c, 0x75, 0x6d, 0x65, 0x49, 0x6e, 0x63, 0x72, 0x65, 0x6d, 0x65, 0x6e, 0x74, 0x61, 0x6c, 0x43, - 0x6f, 0x70, 0x79, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x30, 0x01, 0x12, - 0x5c, 0x0a, 0x0b, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x4d, 0x6f, 0x75, 0x6e, 0x74, 0x12, 0x24, + 0x65, 0x43, 0x68, 0x65, 0x63, 0x6b, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, + 0x12, 0x76, 0x0a, 0x13, 0x56, 0x61, 0x63, 0x75, 0x75, 0x6d, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, + 0x43, 0x6f, 0x6d, 0x70, 0x61, 0x63, 0x74, 0x12, 0x2c, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, + 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x61, 0x63, 0x75, 0x75, + 0x6d, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x43, 0x6f, 0x6d, 0x70, 0x61, 0x63, 0x74, 0x52, 0x65, + 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x2d, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, + 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x61, 0x63, 0x75, 0x75, 0x6d, 0x56, + 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x43, 0x6f, 0x6d, 0x70, 0x61, 0x63, 0x74, 0x52, 0x65, 0x73, 0x70, + 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x30, 0x01, 0x12, 0x71, 0x0a, 0x12, 0x56, 0x61, 0x63, 0x75, + 0x75, 0x6d, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x43, 0x6f, 0x6d, 0x6d, 0x69, 0x74, 0x12, 0x2b, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, - 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x4d, 0x6f, 0x75, 0x6e, 0x74, 0x52, 0x65, 0x71, - 0x75, 0x65, 0x73, 0x74, 0x1a, 0x25, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, - 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x4d, 0x6f, - 0x75, 0x6e, 0x74, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x62, 0x0a, - 0x0d, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x55, 0x6e, 0x6d, 0x6f, 0x75, 0x6e, 0x74, 0x12, 0x26, - 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, - 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x55, 0x6e, 0x6d, 0x6f, 0x75, 0x6e, 0x74, 0x52, - 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x27, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, - 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, - 0x55, 0x6e, 0x6d, 0x6f, 0x75, 0x6e, 0x74, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, - 0x00, 0x12, 0x5f, 0x0a, 0x0c, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x44, 0x65, 0x6c, 0x65, 0x74, - 0x65, 0x12, 0x25, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, - 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x44, 0x65, 0x6c, 0x65, 0x74, - 0x65, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x26, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, - 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, - 0x6d, 0x65, 0x44, 0x65, 0x6c, 0x65, 0x74, 0x65, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, - 0x22, 0x00, 0x12, 0x71, 0x0a, 0x12, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x4d, 0x61, 0x72, 0x6b, - 0x52, 0x65, 0x61, 0x64, 0x6f, 0x6e, 0x6c, 0x79, 0x12, 0x2b, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, - 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, - 0x6d, 0x65, 0x4d, 0x61, 0x72, 0x6b, 0x52, 0x65, 0x61, 0x64, 0x6f, 0x6e, 0x6c, 0x79, 0x52, 0x65, - 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x2c, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, - 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x4d, - 0x61, 0x72, 0x6b, 0x52, 0x65, 0x61, 0x64, 0x6f, 0x6e, 0x6c, 0x79, 0x52, 0x65, 0x73, 0x70, 0x6f, - 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x71, 0x0a, 0x12, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x4d, - 0x61, 0x72, 0x6b, 0x57, 0x72, 0x69, 0x74, 0x61, 0x62, 0x6c, 0x65, 0x12, 0x2b, 0x2e, 0x76, 0x6f, + 0x62, 0x2e, 0x56, 0x61, 0x63, 0x75, 0x75, 0x6d, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x43, 0x6f, + 0x6d, 0x6d, 0x69, 0x74, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x2c, 0x2e, 0x76, 0x6f, + 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, + 0x61, 0x63, 0x75, 0x75, 0x6d, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x43, 0x6f, 0x6d, 0x6d, 0x69, + 0x74, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x74, 0x0a, 0x13, 0x56, + 0x61, 0x63, 0x75, 0x75, 0x6d, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x43, 0x6c, 0x65, 0x61, 0x6e, + 0x75, 0x70, 0x12, 0x2c, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, + 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x61, 0x63, 0x75, 0x75, 0x6d, 0x56, 0x6f, 0x6c, 0x75, + 0x6d, 0x65, 0x43, 0x6c, 0x65, 0x61, 0x6e, 0x75, 0x70, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, + 0x1a, 0x2d, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, + 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x61, 0x63, 0x75, 0x75, 0x6d, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, + 0x43, 0x6c, 0x65, 0x61, 0x6e, 0x75, 0x70, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, + 0x00, 0x12, 0x6b, 0x0a, 0x10, 0x44, 0x65, 0x6c, 0x65, 0x74, 0x65, 0x43, 0x6f, 0x6c, 0x6c, 0x65, + 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x12, 0x29, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, + 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x44, 0x65, 0x6c, 0x65, 0x74, 0x65, 0x43, + 0x6f, 0x6c, 0x6c, 0x65, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, + 0x1a, 0x2a, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, + 0x5f, 0x70, 0x62, 0x2e, 0x44, 0x65, 0x6c, 0x65, 0x74, 0x65, 0x43, 0x6f, 0x6c, 0x6c, 0x65, 0x63, + 0x74, 0x69, 0x6f, 0x6e, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x65, + 0x0a, 0x0e, 0x41, 0x6c, 0x6c, 0x6f, 0x63, 0x61, 0x74, 0x65, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, + 0x12, 0x27, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, + 0x5f, 0x70, 0x62, 0x2e, 0x41, 0x6c, 0x6c, 0x6f, 0x63, 0x61, 0x74, 0x65, 0x56, 0x6f, 0x6c, 0x75, + 0x6d, 0x65, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x28, 0x2e, 0x76, 0x6f, 0x6c, 0x75, + 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x41, 0x6c, 0x6c, + 0x6f, 0x63, 0x61, 0x74, 0x65, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x52, 0x65, 0x73, 0x70, 0x6f, + 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x6b, 0x0a, 0x10, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x53, + 0x79, 0x6e, 0x63, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x12, 0x29, 0x2e, 0x76, 0x6f, 0x6c, 0x75, + 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, + 0x75, 0x6d, 0x65, 0x53, 0x79, 0x6e, 0x63, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x52, 0x65, 0x71, + 0x75, 0x65, 0x73, 0x74, 0x1a, 0x2a, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, + 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x53, 0x79, + 0x6e, 0x63, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, + 0x22, 0x00, 0x12, 0x7c, 0x0a, 0x15, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x49, 0x6e, 0x63, 0x72, + 0x65, 0x6d, 0x65, 0x6e, 0x74, 0x61, 0x6c, 0x43, 0x6f, 0x70, 0x79, 0x12, 0x2e, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, - 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x4d, 0x61, 0x72, 0x6b, 0x57, 0x72, 0x69, 0x74, 0x61, 0x62, 0x6c, - 0x65, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x2c, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, - 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, - 0x6d, 0x65, 0x4d, 0x61, 0x72, 0x6b, 0x57, 0x72, 0x69, 0x74, 0x61, 0x62, 0x6c, 0x65, 0x52, 0x65, - 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x68, 0x0a, 0x0f, 0x56, 0x6f, 0x6c, 0x75, - 0x6d, 0x65, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x75, 0x72, 0x65, 0x12, 0x28, 0x2e, 0x76, 0x6f, + 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x49, 0x6e, 0x63, 0x72, 0x65, 0x6d, 0x65, 0x6e, 0x74, 0x61, 0x6c, + 0x43, 0x6f, 0x70, 0x79, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x2f, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, - 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x75, 0x72, 0x65, 0x52, 0x65, - 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x29, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, - 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x43, - 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x75, 0x72, 0x65, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, - 0x22, 0x00, 0x12, 0x5f, 0x0a, 0x0c, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x53, 0x74, 0x61, 0x74, - 0x75, 0x73, 0x12, 0x25, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, - 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x53, 0x74, 0x61, 0x74, - 0x75, 0x73, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x26, 0x2e, 0x76, 0x6f, 0x6c, 0x75, + 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x49, 0x6e, 0x63, 0x72, 0x65, 0x6d, 0x65, 0x6e, 0x74, 0x61, 0x6c, + 0x43, 0x6f, 0x70, 0x79, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x30, 0x01, + 0x12, 0x5c, 0x0a, 0x0b, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x4d, 0x6f, 0x75, 0x6e, 0x74, 0x12, + 0x24, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, + 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x4d, 0x6f, 0x75, 0x6e, 0x74, 0x52, 0x65, + 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x25, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, + 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x4d, + 0x6f, 0x75, 0x6e, 0x74, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x62, + 0x0a, 0x0d, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x55, 0x6e, 0x6d, 0x6f, 0x75, 0x6e, 0x74, 0x12, + 0x26, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, + 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x55, 0x6e, 0x6d, 0x6f, 0x75, 0x6e, 0x74, + 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x27, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, + 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, + 0x65, 0x55, 0x6e, 0x6d, 0x6f, 0x75, 0x6e, 0x74, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, + 0x22, 0x00, 0x12, 0x5f, 0x0a, 0x0c, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x44, 0x65, 0x6c, 0x65, + 0x74, 0x65, 0x12, 0x25, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, + 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x44, 0x65, 0x6c, 0x65, + 0x74, 0x65, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x26, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, - 0x75, 0x6d, 0x65, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, - 0x65, 0x22, 0x00, 0x12, 0x5b, 0x0a, 0x0a, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x43, 0x6f, 0x70, - 0x79, 0x12, 0x23, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, - 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x43, 0x6f, 0x70, 0x79, 0x52, - 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x24, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, + 0x75, 0x6d, 0x65, 0x44, 0x65, 0x6c, 0x65, 0x74, 0x65, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, + 0x65, 0x22, 0x00, 0x12, 0x71, 0x0a, 0x12, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x4d, 0x61, 0x72, + 0x6b, 0x52, 0x65, 0x61, 0x64, 0x6f, 0x6e, 0x6c, 0x79, 0x12, 0x2b, 0x2e, 0x76, 0x6f, 0x6c, 0x75, + 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, + 0x75, 0x6d, 0x65, 0x4d, 0x61, 0x72, 0x6b, 0x52, 0x65, 0x61, 0x64, 0x6f, 0x6e, 0x6c, 0x79, 0x52, + 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x2c, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, - 0x43, 0x6f, 0x70, 0x79, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x30, 0x01, - 0x12, 0x77, 0x0a, 0x14, 0x52, 0x65, 0x61, 0x64, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x46, 0x69, - 0x6c, 0x65, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x12, 0x2d, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, + 0x4d, 0x61, 0x72, 0x6b, 0x52, 0x65, 0x61, 0x64, 0x6f, 0x6e, 0x6c, 0x79, 0x52, 0x65, 0x73, 0x70, + 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x71, 0x0a, 0x12, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, + 0x4d, 0x61, 0x72, 0x6b, 0x57, 0x72, 0x69, 0x74, 0x61, 0x62, 0x6c, 0x65, 0x12, 0x2b, 0x2e, 0x76, + 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, + 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x4d, 0x61, 0x72, 0x6b, 0x57, 0x72, 0x69, 0x74, 0x61, 0x62, + 0x6c, 0x65, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x2c, 0x2e, 0x76, 0x6f, 0x6c, 0x75, + 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, + 0x75, 0x6d, 0x65, 0x4d, 0x61, 0x72, 0x6b, 0x57, 0x72, 0x69, 0x74, 0x61, 0x62, 0x6c, 0x65, 0x52, + 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x68, 0x0a, 0x0f, 0x56, 0x6f, 0x6c, + 0x75, 0x6d, 0x65, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x75, 0x72, 0x65, 0x12, 0x28, 0x2e, 0x76, + 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, + 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x75, 0x72, 0x65, 0x52, + 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x29, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, + 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, + 0x43, 0x6f, 0x6e, 0x66, 0x69, 0x67, 0x75, 0x72, 0x65, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, + 0x65, 0x22, 0x00, 0x12, 0x5f, 0x0a, 0x0c, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x53, 0x74, 0x61, + 0x74, 0x75, 0x73, 0x12, 0x25, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, + 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x53, 0x74, 0x61, + 0x74, 0x75, 0x73, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x26, 0x2e, 0x76, 0x6f, 0x6c, + 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, + 0x6c, 0x75, 0x6d, 0x65, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, + 0x73, 0x65, 0x22, 0x00, 0x12, 0x5b, 0x0a, 0x0a, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x43, 0x6f, + 0x70, 0x79, 0x12, 0x23, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, + 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x43, 0x6f, 0x70, 0x79, + 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x24, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, + 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, + 0x65, 0x43, 0x6f, 0x70, 0x79, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x30, + 0x01, 0x12, 0x77, 0x0a, 0x14, 0x52, 0x65, 0x61, 0x64, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x46, + 0x69, 0x6c, 0x65, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x12, 0x2d, 0x2e, 0x76, 0x6f, 0x6c, 0x75, + 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x52, 0x65, 0x61, + 0x64, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x46, 0x69, 0x6c, 0x65, 0x53, 0x74, 0x61, 0x74, 0x75, + 0x73, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x2e, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x52, 0x65, 0x61, 0x64, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x46, 0x69, 0x6c, 0x65, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, - 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x2e, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, - 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x52, 0x65, 0x61, 0x64, 0x56, - 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x46, 0x69, 0x6c, 0x65, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x52, - 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x55, 0x0a, 0x08, 0x43, 0x6f, 0x70, - 0x79, 0x46, 0x69, 0x6c, 0x65, 0x12, 0x21, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, - 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x43, 0x6f, 0x70, 0x79, 0x46, 0x69, 0x6c, - 0x65, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x22, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, - 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x43, 0x6f, 0x70, 0x79, - 0x46, 0x69, 0x6c, 0x65, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x30, 0x01, - 0x12, 0x65, 0x0a, 0x0e, 0x52, 0x65, 0x61, 0x64, 0x4e, 0x65, 0x65, 0x64, 0x6c, 0x65, 0x42, 0x6c, - 0x6f, 0x62, 0x12, 0x27, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, - 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x52, 0x65, 0x61, 0x64, 0x4e, 0x65, 0x65, 0x64, 0x6c, 0x65, - 0x42, 0x6c, 0x6f, 0x62, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x28, 0x2e, 0x76, 0x6f, - 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x52, - 0x65, 0x61, 0x64, 0x4e, 0x65, 0x65, 0x64, 0x6c, 0x65, 0x42, 0x6c, 0x6f, 0x62, 0x52, 0x65, 0x73, - 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x65, 0x0a, 0x0e, 0x52, 0x65, 0x61, 0x64, 0x4e, - 0x65, 0x65, 0x64, 0x6c, 0x65, 0x4d, 0x65, 0x74, 0x61, 0x12, 0x27, 0x2e, 0x76, 0x6f, 0x6c, 0x75, - 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x52, 0x65, 0x61, - 0x64, 0x4e, 0x65, 0x65, 0x64, 0x6c, 0x65, 0x4d, 0x65, 0x74, 0x61, 0x52, 0x65, 0x71, 0x75, 0x65, - 0x73, 0x74, 0x1a, 0x28, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, - 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x52, 0x65, 0x61, 0x64, 0x4e, 0x65, 0x65, 0x64, 0x6c, 0x65, - 0x4d, 0x65, 0x74, 0x61, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x68, - 0x0a, 0x0f, 0x57, 0x72, 0x69, 0x74, 0x65, 0x4e, 0x65, 0x65, 0x64, 0x6c, 0x65, 0x42, 0x6c, 0x6f, - 0x62, 0x12, 0x28, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, - 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x57, 0x72, 0x69, 0x74, 0x65, 0x4e, 0x65, 0x65, 0x64, 0x6c, 0x65, - 0x42, 0x6c, 0x6f, 0x62, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x29, 0x2e, 0x76, 0x6f, - 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x57, - 0x72, 0x69, 0x74, 0x65, 0x4e, 0x65, 0x65, 0x64, 0x6c, 0x65, 0x42, 0x6c, 0x6f, 0x62, 0x52, 0x65, - 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x67, 0x0a, 0x0e, 0x52, 0x65, 0x61, 0x64, - 0x41, 0x6c, 0x6c, 0x4e, 0x65, 0x65, 0x64, 0x6c, 0x65, 0x73, 0x12, 0x27, 0x2e, 0x76, 0x6f, 0x6c, + 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x55, 0x0a, 0x08, 0x43, 0x6f, + 0x70, 0x79, 0x46, 0x69, 0x6c, 0x65, 0x12, 0x21, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, + 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x43, 0x6f, 0x70, 0x79, 0x46, 0x69, + 0x6c, 0x65, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x22, 0x2e, 0x76, 0x6f, 0x6c, 0x75, + 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x43, 0x6f, 0x70, + 0x79, 0x46, 0x69, 0x6c, 0x65, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x30, + 0x01, 0x12, 0x65, 0x0a, 0x0e, 0x52, 0x65, 0x61, 0x64, 0x4e, 0x65, 0x65, 0x64, 0x6c, 0x65, 0x42, + 0x6c, 0x6f, 0x62, 0x12, 0x27, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, + 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x52, 0x65, 0x61, 0x64, 0x4e, 0x65, 0x65, 0x64, 0x6c, + 0x65, 0x42, 0x6c, 0x6f, 0x62, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x28, 0x2e, 0x76, + 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, + 0x52, 0x65, 0x61, 0x64, 0x4e, 0x65, 0x65, 0x64, 0x6c, 0x65, 0x42, 0x6c, 0x6f, 0x62, 0x52, 0x65, + 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x65, 0x0a, 0x0e, 0x52, 0x65, 0x61, 0x64, + 0x4e, 0x65, 0x65, 0x64, 0x6c, 0x65, 0x4d, 0x65, 0x74, 0x61, 0x12, 0x27, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x52, 0x65, - 0x61, 0x64, 0x41, 0x6c, 0x6c, 0x4e, 0x65, 0x65, 0x64, 0x6c, 0x65, 0x73, 0x52, 0x65, 0x71, 0x75, + 0x61, 0x64, 0x4e, 0x65, 0x65, 0x64, 0x6c, 0x65, 0x4d, 0x65, 0x74, 0x61, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x28, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, - 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x52, 0x65, 0x61, 0x64, 0x41, 0x6c, 0x6c, 0x4e, 0x65, - 0x65, 0x64, 0x6c, 0x65, 0x73, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x30, - 0x01, 0x12, 0x6d, 0x0a, 0x10, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x54, 0x61, 0x69, 0x6c, 0x53, - 0x65, 0x6e, 0x64, 0x65, 0x72, 0x12, 0x29, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, - 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x54, - 0x61, 0x69, 0x6c, 0x53, 0x65, 0x6e, 0x64, 0x65, 0x72, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, - 0x1a, 0x2a, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, - 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x54, 0x61, 0x69, 0x6c, 0x53, 0x65, - 0x6e, 0x64, 0x65, 0x72, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x30, 0x01, - 0x12, 0x71, 0x0a, 0x12, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x54, 0x61, 0x69, 0x6c, 0x52, 0x65, - 0x63, 0x65, 0x69, 0x76, 0x65, 0x72, 0x12, 0x2b, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, + 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x52, 0x65, 0x61, 0x64, 0x4e, 0x65, 0x65, 0x64, 0x6c, + 0x65, 0x4d, 0x65, 0x74, 0x61, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, + 0x68, 0x0a, 0x0f, 0x57, 0x72, 0x69, 0x74, 0x65, 0x4e, 0x65, 0x65, 0x64, 0x6c, 0x65, 0x42, 0x6c, + 0x6f, 0x62, 0x12, 0x28, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, + 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x57, 0x72, 0x69, 0x74, 0x65, 0x4e, 0x65, 0x65, 0x64, 0x6c, + 0x65, 0x42, 0x6c, 0x6f, 0x62, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x29, 0x2e, 0x76, + 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, + 0x57, 0x72, 0x69, 0x74, 0x65, 0x4e, 0x65, 0x65, 0x64, 0x6c, 0x65, 0x42, 0x6c, 0x6f, 0x62, 0x52, + 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x67, 0x0a, 0x0e, 0x52, 0x65, 0x61, + 0x64, 0x41, 0x6c, 0x6c, 0x4e, 0x65, 0x65, 0x64, 0x6c, 0x65, 0x73, 0x12, 0x27, 0x2e, 0x76, 0x6f, + 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x52, + 0x65, 0x61, 0x64, 0x41, 0x6c, 0x6c, 0x4e, 0x65, 0x65, 0x64, 0x6c, 0x65, 0x73, 0x52, 0x65, 0x71, + 0x75, 0x65, 0x73, 0x74, 0x1a, 0x28, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, + 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x52, 0x65, 0x61, 0x64, 0x41, 0x6c, 0x6c, 0x4e, + 0x65, 0x65, 0x64, 0x6c, 0x65, 0x73, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, + 0x30, 0x01, 0x12, 0x6d, 0x0a, 0x10, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x54, 0x61, 0x69, 0x6c, + 0x53, 0x65, 0x6e, 0x64, 0x65, 0x72, 0x12, 0x29, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, - 0x54, 0x61, 0x69, 0x6c, 0x52, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x72, 0x52, 0x65, 0x71, 0x75, - 0x65, 0x73, 0x74, 0x1a, 0x2c, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, - 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x54, 0x61, 0x69, - 0x6c, 0x52, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x72, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, - 0x65, 0x22, 0x00, 0x12, 0x7d, 0x0a, 0x16, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, 0x53, - 0x68, 0x61, 0x72, 0x64, 0x73, 0x47, 0x65, 0x6e, 0x65, 0x72, 0x61, 0x74, 0x65, 0x12, 0x2f, 0x2e, - 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, - 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, 0x53, 0x68, 0x61, 0x72, 0x64, 0x73, 0x47, - 0x65, 0x6e, 0x65, 0x72, 0x61, 0x74, 0x65, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x30, + 0x54, 0x61, 0x69, 0x6c, 0x53, 0x65, 0x6e, 0x64, 0x65, 0x72, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, + 0x74, 0x1a, 0x2a, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, + 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x54, 0x61, 0x69, 0x6c, 0x53, + 0x65, 0x6e, 0x64, 0x65, 0x72, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x30, + 0x01, 0x12, 0x71, 0x0a, 0x12, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x54, 0x61, 0x69, 0x6c, 0x52, + 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x72, 0x12, 0x2b, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, + 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, + 0x65, 0x54, 0x61, 0x69, 0x6c, 0x52, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x72, 0x52, 0x65, 0x71, + 0x75, 0x65, 0x73, 0x74, 0x1a, 0x2c, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, + 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x54, 0x61, + 0x69, 0x6c, 0x52, 0x65, 0x63, 0x65, 0x69, 0x76, 0x65, 0x72, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, + 0x73, 0x65, 0x22, 0x00, 0x12, 0x7d, 0x0a, 0x16, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, + 0x53, 0x68, 0x61, 0x72, 0x64, 0x73, 0x47, 0x65, 0x6e, 0x65, 0x72, 0x61, 0x74, 0x65, 0x12, 0x2f, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, 0x53, 0x68, 0x61, 0x72, 0x64, 0x73, - 0x47, 0x65, 0x6e, 0x65, 0x72, 0x61, 0x74, 0x65, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, - 0x22, 0x00, 0x12, 0x7a, 0x0a, 0x15, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, 0x53, 0x68, - 0x61, 0x72, 0x64, 0x73, 0x52, 0x65, 0x62, 0x75, 0x69, 0x6c, 0x64, 0x12, 0x2e, 0x2e, 0x76, 0x6f, - 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, - 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, 0x53, 0x68, 0x61, 0x72, 0x64, 0x73, 0x52, 0x65, 0x62, - 0x75, 0x69, 0x6c, 0x64, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x2f, 0x2e, 0x76, 0x6f, - 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, - 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, 0x53, 0x68, 0x61, 0x72, 0x64, 0x73, 0x52, 0x65, 0x62, - 0x75, 0x69, 0x6c, 0x64, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x71, - 0x0a, 0x12, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, 0x53, 0x68, 0x61, 0x72, 0x64, 0x73, - 0x43, 0x6f, 0x70, 0x79, 0x12, 0x2b, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, - 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, - 0x53, 0x68, 0x61, 0x72, 0x64, 0x73, 0x43, 0x6f, 0x70, 0x79, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, - 0x74, 0x1a, 0x2c, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, - 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, 0x53, 0x68, 0x61, - 0x72, 0x64, 0x73, 0x43, 0x6f, 0x70, 0x79, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, - 0x00, 0x12, 0x77, 0x0a, 0x14, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, 0x53, 0x68, 0x61, - 0x72, 0x64, 0x73, 0x44, 0x65, 0x6c, 0x65, 0x74, 0x65, 0x12, 0x2d, 0x2e, 0x76, 0x6f, 0x6c, 0x75, - 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, - 0x75, 0x6d, 0x65, 0x45, 0x63, 0x53, 0x68, 0x61, 0x72, 0x64, 0x73, 0x44, 0x65, 0x6c, 0x65, 0x74, - 0x65, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x2e, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, - 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, - 0x6d, 0x65, 0x45, 0x63, 0x53, 0x68, 0x61, 0x72, 0x64, 0x73, 0x44, 0x65, 0x6c, 0x65, 0x74, 0x65, - 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x74, 0x0a, 0x13, 0x56, 0x6f, - 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, 0x53, 0x68, 0x61, 0x72, 0x64, 0x73, 0x4d, 0x6f, 0x75, 0x6e, - 0x74, 0x12, 0x2c, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, - 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, 0x53, 0x68, 0x61, - 0x72, 0x64, 0x73, 0x4d, 0x6f, 0x75, 0x6e, 0x74, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, - 0x2d, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, + 0x47, 0x65, 0x6e, 0x65, 0x72, 0x61, 0x74, 0x65, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, + 0x30, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, 0x53, 0x68, 0x61, 0x72, 0x64, - 0x73, 0x4d, 0x6f, 0x75, 0x6e, 0x74, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, - 0x12, 0x7a, 0x0a, 0x15, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, 0x53, 0x68, 0x61, 0x72, - 0x64, 0x73, 0x55, 0x6e, 0x6d, 0x6f, 0x75, 0x6e, 0x74, 0x12, 0x2e, 0x2e, 0x76, 0x6f, 0x6c, 0x75, - 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, - 0x75, 0x6d, 0x65, 0x45, 0x63, 0x53, 0x68, 0x61, 0x72, 0x64, 0x73, 0x55, 0x6e, 0x6d, 0x6f, 0x75, - 0x6e, 0x74, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x2f, 0x2e, 0x76, 0x6f, 0x6c, 0x75, + 0x73, 0x47, 0x65, 0x6e, 0x65, 0x72, 0x61, 0x74, 0x65, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, + 0x65, 0x22, 0x00, 0x12, 0x7a, 0x0a, 0x15, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, 0x53, + 0x68, 0x61, 0x72, 0x64, 0x73, 0x52, 0x65, 0x62, 0x75, 0x69, 0x6c, 0x64, 0x12, 0x2e, 0x2e, 0x76, + 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, + 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, 0x53, 0x68, 0x61, 0x72, 0x64, 0x73, 0x52, 0x65, + 0x62, 0x75, 0x69, 0x6c, 0x64, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x2f, 0x2e, 0x76, + 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, + 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, 0x53, 0x68, 0x61, 0x72, 0x64, 0x73, 0x52, 0x65, + 0x62, 0x75, 0x69, 0x6c, 0x64, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, + 0x71, 0x0a, 0x12, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, 0x53, 0x68, 0x61, 0x72, 0x64, + 0x73, 0x43, 0x6f, 0x70, 0x79, 0x12, 0x2b, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, + 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x45, + 0x63, 0x53, 0x68, 0x61, 0x72, 0x64, 0x73, 0x43, 0x6f, 0x70, 0x79, 0x52, 0x65, 0x71, 0x75, 0x65, + 0x73, 0x74, 0x1a, 0x2c, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, + 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, 0x53, 0x68, + 0x61, 0x72, 0x64, 0x73, 0x43, 0x6f, 0x70, 0x79, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, + 0x22, 0x00, 0x12, 0x77, 0x0a, 0x14, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, 0x53, 0x68, + 0x61, 0x72, 0x64, 0x73, 0x44, 0x65, 0x6c, 0x65, 0x74, 0x65, 0x12, 0x2d, 0x2e, 0x76, 0x6f, 0x6c, + 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, + 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, 0x53, 0x68, 0x61, 0x72, 0x64, 0x73, 0x44, 0x65, 0x6c, 0x65, + 0x74, 0x65, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x2e, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, - 0x75, 0x6d, 0x65, 0x45, 0x63, 0x53, 0x68, 0x61, 0x72, 0x64, 0x73, 0x55, 0x6e, 0x6d, 0x6f, 0x75, - 0x6e, 0x74, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x70, 0x0a, 0x11, - 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, 0x53, 0x68, 0x61, 0x72, 0x64, 0x52, 0x65, 0x61, - 0x64, 0x12, 0x2a, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, - 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, 0x53, 0x68, 0x61, - 0x72, 0x64, 0x52, 0x65, 0x61, 0x64, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x2b, 0x2e, - 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, - 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, 0x53, 0x68, 0x61, 0x72, 0x64, 0x52, 0x65, - 0x61, 0x64, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x30, 0x01, 0x12, 0x71, - 0x0a, 0x12, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, 0x42, 0x6c, 0x6f, 0x62, 0x44, 0x65, - 0x6c, 0x65, 0x74, 0x65, 0x12, 0x2b, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, - 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, - 0x42, 0x6c, 0x6f, 0x62, 0x44, 0x65, 0x6c, 0x65, 0x74, 0x65, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, - 0x74, 0x1a, 0x2c, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, - 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, 0x42, 0x6c, 0x6f, - 0x62, 0x44, 0x65, 0x6c, 0x65, 0x74, 0x65, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, - 0x00, 0x12, 0x7d, 0x0a, 0x16, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, 0x53, 0x68, 0x61, - 0x72, 0x64, 0x73, 0x54, 0x6f, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x12, 0x2f, 0x2e, 0x76, 0x6f, - 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, - 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, 0x53, 0x68, 0x61, 0x72, 0x64, 0x73, 0x54, 0x6f, 0x56, - 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x30, 0x2e, 0x76, + 0x75, 0x6d, 0x65, 0x45, 0x63, 0x53, 0x68, 0x61, 0x72, 0x64, 0x73, 0x44, 0x65, 0x6c, 0x65, 0x74, + 0x65, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x74, 0x0a, 0x13, 0x56, + 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, 0x53, 0x68, 0x61, 0x72, 0x64, 0x73, 0x4d, 0x6f, 0x75, + 0x6e, 0x74, 0x12, 0x2c, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, + 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, 0x53, 0x68, + 0x61, 0x72, 0x64, 0x73, 0x4d, 0x6f, 0x75, 0x6e, 0x74, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, + 0x1a, 0x2d, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, + 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, 0x53, 0x68, 0x61, 0x72, + 0x64, 0x73, 0x4d, 0x6f, 0x75, 0x6e, 0x74, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, + 0x00, 0x12, 0x7a, 0x0a, 0x15, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, 0x53, 0x68, 0x61, + 0x72, 0x64, 0x73, 0x55, 0x6e, 0x6d, 0x6f, 0x75, 0x6e, 0x74, 0x12, 0x2e, 0x2e, 0x76, 0x6f, 0x6c, + 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, + 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, 0x53, 0x68, 0x61, 0x72, 0x64, 0x73, 0x55, 0x6e, 0x6d, 0x6f, + 0x75, 0x6e, 0x74, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x2f, 0x2e, 0x76, 0x6f, 0x6c, + 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, + 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, 0x53, 0x68, 0x61, 0x72, 0x64, 0x73, 0x55, 0x6e, 0x6d, 0x6f, + 0x75, 0x6e, 0x74, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x70, 0x0a, + 0x11, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, 0x53, 0x68, 0x61, 0x72, 0x64, 0x52, 0x65, + 0x61, 0x64, 0x12, 0x2a, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, + 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, 0x53, 0x68, + 0x61, 0x72, 0x64, 0x52, 0x65, 0x61, 0x64, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x2b, + 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, + 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, 0x53, 0x68, 0x61, 0x72, 0x64, 0x52, + 0x65, 0x61, 0x64, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x30, 0x01, 0x12, + 0x71, 0x0a, 0x12, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, 0x42, 0x6c, 0x6f, 0x62, 0x44, + 0x65, 0x6c, 0x65, 0x74, 0x65, 0x12, 0x2b, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, + 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x45, + 0x63, 0x42, 0x6c, 0x6f, 0x62, 0x44, 0x65, 0x6c, 0x65, 0x74, 0x65, 0x52, 0x65, 0x71, 0x75, 0x65, + 0x73, 0x74, 0x1a, 0x2c, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, + 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, 0x42, 0x6c, + 0x6f, 0x62, 0x44, 0x65, 0x6c, 0x65, 0x74, 0x65, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, + 0x22, 0x00, 0x12, 0x7d, 0x0a, 0x16, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, 0x53, 0x68, + 0x61, 0x72, 0x64, 0x73, 0x54, 0x6f, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x12, 0x2f, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, 0x53, 0x68, 0x61, 0x72, 0x64, 0x73, 0x54, 0x6f, - 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, - 0x12, 0x88, 0x01, 0x0a, 0x19, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x54, 0x69, 0x65, 0x72, 0x4d, - 0x6f, 0x76, 0x65, 0x44, 0x61, 0x74, 0x54, 0x6f, 0x52, 0x65, 0x6d, 0x6f, 0x74, 0x65, 0x12, 0x32, - 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, - 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x54, 0x69, 0x65, 0x72, 0x4d, 0x6f, 0x76, 0x65, - 0x44, 0x61, 0x74, 0x54, 0x6f, 0x52, 0x65, 0x6d, 0x6f, 0x74, 0x65, 0x52, 0x65, 0x71, 0x75, 0x65, - 0x73, 0x74, 0x1a, 0x33, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, - 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x54, 0x69, 0x65, 0x72, - 0x4d, 0x6f, 0x76, 0x65, 0x44, 0x61, 0x74, 0x54, 0x6f, 0x52, 0x65, 0x6d, 0x6f, 0x74, 0x65, 0x52, - 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x30, 0x01, 0x12, 0x8e, 0x01, 0x0a, 0x1b, + 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x30, 0x2e, + 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, + 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x45, 0x63, 0x53, 0x68, 0x61, 0x72, 0x64, 0x73, 0x54, + 0x6f, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, + 0x00, 0x12, 0x88, 0x01, 0x0a, 0x19, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x54, 0x69, 0x65, 0x72, + 0x4d, 0x6f, 0x76, 0x65, 0x44, 0x61, 0x74, 0x54, 0x6f, 0x52, 0x65, 0x6d, 0x6f, 0x74, 0x65, 0x12, + 0x32, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, + 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x54, 0x69, 0x65, 0x72, 0x4d, 0x6f, 0x76, + 0x65, 0x44, 0x61, 0x74, 0x54, 0x6f, 0x52, 0x65, 0x6d, 0x6f, 0x74, 0x65, 0x52, 0x65, 0x71, 0x75, + 0x65, 0x73, 0x74, 0x1a, 0x33, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, + 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x54, 0x69, 0x65, + 0x72, 0x4d, 0x6f, 0x76, 0x65, 0x44, 0x61, 0x74, 0x54, 0x6f, 0x52, 0x65, 0x6d, 0x6f, 0x74, 0x65, + 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x30, 0x01, 0x12, 0x8e, 0x01, 0x0a, + 0x1b, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x54, 0x69, 0x65, 0x72, 0x4d, 0x6f, 0x76, 0x65, 0x44, + 0x61, 0x74, 0x46, 0x72, 0x6f, 0x6d, 0x52, 0x65, 0x6d, 0x6f, 0x74, 0x65, 0x12, 0x34, 0x2e, 0x76, + 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x54, 0x69, 0x65, 0x72, 0x4d, 0x6f, 0x76, 0x65, 0x44, 0x61, - 0x74, 0x46, 0x72, 0x6f, 0x6d, 0x52, 0x65, 0x6d, 0x6f, 0x74, 0x65, 0x12, 0x34, 0x2e, 0x76, 0x6f, - 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, - 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x54, 0x69, 0x65, 0x72, 0x4d, 0x6f, 0x76, 0x65, 0x44, 0x61, 0x74, - 0x46, 0x72, 0x6f, 0x6d, 0x52, 0x65, 0x6d, 0x6f, 0x74, 0x65, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, - 0x74, 0x1a, 0x35, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, - 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x54, 0x69, 0x65, 0x72, 0x4d, - 0x6f, 0x76, 0x65, 0x44, 0x61, 0x74, 0x46, 0x72, 0x6f, 0x6d, 0x52, 0x65, 0x6d, 0x6f, 0x74, 0x65, - 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x30, 0x01, 0x12, 0x71, 0x0a, 0x12, - 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x53, 0x74, 0x61, 0x74, - 0x75, 0x73, 0x12, 0x2b, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, - 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x53, 0x65, 0x72, 0x76, - 0x65, 0x72, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, - 0x2c, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, - 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x53, - 0x74, 0x61, 0x74, 0x75, 0x73, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, - 0x6e, 0x0a, 0x11, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x4c, - 0x65, 0x61, 0x76, 0x65, 0x12, 0x2a, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, - 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x53, 0x65, - 0x72, 0x76, 0x65, 0x72, 0x4c, 0x65, 0x61, 0x76, 0x65, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, - 0x1a, 0x2b, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, + 0x74, 0x46, 0x72, 0x6f, 0x6d, 0x52, 0x65, 0x6d, 0x6f, 0x74, 0x65, 0x52, 0x65, 0x71, 0x75, 0x65, + 0x73, 0x74, 0x1a, 0x35, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, + 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x54, 0x69, 0x65, 0x72, + 0x4d, 0x6f, 0x76, 0x65, 0x44, 0x61, 0x74, 0x46, 0x72, 0x6f, 0x6d, 0x52, 0x65, 0x6d, 0x6f, 0x74, + 0x65, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x30, 0x01, 0x12, 0x71, 0x0a, + 0x12, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, 0x53, 0x74, 0x61, + 0x74, 0x75, 0x73, 0x12, 0x2b, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, + 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x53, 0x65, 0x72, + 0x76, 0x65, 0x72, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, + 0x1a, 0x2c, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, - 0x4c, 0x65, 0x61, 0x76, 0x65, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, - 0x74, 0x0a, 0x13, 0x46, 0x65, 0x74, 0x63, 0x68, 0x41, 0x6e, 0x64, 0x57, 0x72, 0x69, 0x74, 0x65, - 0x4e, 0x65, 0x65, 0x64, 0x6c, 0x65, 0x12, 0x2c, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, - 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x46, 0x65, 0x74, 0x63, 0x68, 0x41, - 0x6e, 0x64, 0x57, 0x72, 0x69, 0x74, 0x65, 0x4e, 0x65, 0x65, 0x64, 0x6c, 0x65, 0x52, 0x65, 0x71, - 0x75, 0x65, 0x73, 0x74, 0x1a, 0x2d, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, - 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x46, 0x65, 0x74, 0x63, 0x68, 0x41, 0x6e, 0x64, - 0x57, 0x72, 0x69, 0x74, 0x65, 0x4e, 0x65, 0x65, 0x64, 0x6c, 0x65, 0x52, 0x65, 0x73, 0x70, 0x6f, - 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x4c, 0x0a, 0x05, 0x51, 0x75, 0x65, 0x72, 0x79, 0x12, 0x1e, - 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, - 0x62, 0x2e, 0x51, 0x75, 0x65, 0x72, 0x79, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x1f, - 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, - 0x62, 0x2e, 0x51, 0x75, 0x65, 0x72, 0x69, 0x65, 0x64, 0x53, 0x74, 0x72, 0x69, 0x70, 0x65, 0x22, - 0x00, 0x30, 0x01, 0x12, 0x71, 0x0a, 0x12, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x4e, 0x65, 0x65, - 0x64, 0x6c, 0x65, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x12, 0x2b, 0x2e, 0x76, 0x6f, 0x6c, 0x75, - 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, - 0x75, 0x6d, 0x65, 0x4e, 0x65, 0x65, 0x64, 0x6c, 0x65, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x52, - 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x2c, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, - 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, - 0x4e, 0x65, 0x65, 0x64, 0x6c, 0x65, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x52, 0x65, 0x73, 0x70, - 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x47, 0x0a, 0x04, 0x50, 0x69, 0x6e, 0x67, 0x12, 0x1d, + 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, + 0x12, 0x6e, 0x0a, 0x11, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x53, 0x65, 0x72, 0x76, 0x65, 0x72, + 0x4c, 0x65, 0x61, 0x76, 0x65, 0x12, 0x2a, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, + 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x53, + 0x65, 0x72, 0x76, 0x65, 0x72, 0x4c, 0x65, 0x61, 0x76, 0x65, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, + 0x74, 0x1a, 0x2b, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, + 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x53, 0x65, 0x72, 0x76, 0x65, + 0x72, 0x4c, 0x65, 0x61, 0x76, 0x65, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, + 0x12, 0x74, 0x0a, 0x13, 0x46, 0x65, 0x74, 0x63, 0x68, 0x41, 0x6e, 0x64, 0x57, 0x72, 0x69, 0x74, + 0x65, 0x4e, 0x65, 0x65, 0x64, 0x6c, 0x65, 0x12, 0x2c, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, + 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x46, 0x65, 0x74, 0x63, 0x68, + 0x41, 0x6e, 0x64, 0x57, 0x72, 0x69, 0x74, 0x65, 0x4e, 0x65, 0x65, 0x64, 0x6c, 0x65, 0x52, 0x65, + 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x2d, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, + 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x46, 0x65, 0x74, 0x63, 0x68, 0x41, 0x6e, + 0x64, 0x57, 0x72, 0x69, 0x74, 0x65, 0x4e, 0x65, 0x65, 0x64, 0x6c, 0x65, 0x52, 0x65, 0x73, 0x70, + 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x4c, 0x0a, 0x05, 0x51, 0x75, 0x65, 0x72, 0x79, 0x12, + 0x1e, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, + 0x70, 0x62, 0x2e, 0x51, 0x75, 0x65, 0x72, 0x79, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, + 0x1f, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, + 0x70, 0x62, 0x2e, 0x51, 0x75, 0x65, 0x72, 0x69, 0x65, 0x64, 0x53, 0x74, 0x72, 0x69, 0x70, 0x65, + 0x22, 0x00, 0x30, 0x01, 0x12, 0x71, 0x0a, 0x12, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x4e, 0x65, + 0x65, 0x64, 0x6c, 0x65, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x12, 0x2b, 0x2e, 0x76, 0x6f, 0x6c, + 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, + 0x6c, 0x75, 0x6d, 0x65, 0x4e, 0x65, 0x65, 0x64, 0x6c, 0x65, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, + 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x2c, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, + 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x2e, 0x56, 0x6f, 0x6c, 0x75, 0x6d, + 0x65, 0x4e, 0x65, 0x65, 0x64, 0x6c, 0x65, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x52, 0x65, 0x73, + 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x12, 0x47, 0x0a, 0x04, 0x50, 0x69, 0x6e, 0x67, 0x12, + 0x1d, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, + 0x70, 0x62, 0x2e, 0x50, 0x69, 0x6e, 0x67, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x1e, 0x2e, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, - 0x62, 0x2e, 0x50, 0x69, 0x6e, 0x67, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x1e, 0x2e, - 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, - 0x2e, 0x50, 0x69, 0x6e, 0x67, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, 0x42, - 0x39, 0x5a, 0x37, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x73, 0x65, - 0x61, 0x77, 0x65, 0x65, 0x64, 0x66, 0x73, 0x2f, 0x73, 0x65, 0x61, 0x77, 0x65, 0x65, 0x64, 0x66, - 0x73, 0x2f, 0x77, 0x65, 0x65, 0x64, 0x2f, 0x70, 0x62, 0x2f, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, - 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, - 0x6f, 0x33, + 0x62, 0x2e, 0x50, 0x69, 0x6e, 0x67, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x00, + 0x42, 0x39, 0x5a, 0x37, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x73, + 0x65, 0x61, 0x77, 0x65, 0x65, 0x64, 0x66, 0x73, 0x2f, 0x73, 0x65, 0x61, 0x77, 0x65, 0x65, 0x64, + 0x66, 0x73, 0x2f, 0x77, 0x65, 0x65, 0x64, 0x2f, 0x70, 0x62, 0x2f, 0x76, 0x6f, 0x6c, 0x75, 0x6d, + 0x65, 0x5f, 0x73, 0x65, 0x72, 0x76, 0x65, 0x72, 0x5f, 0x70, 0x62, 0x62, 0x06, 0x70, 0x72, 0x6f, + 0x74, 0x6f, 0x33, } var ( @@ -6886,8 +6998,8 @@ func file_volume_server_proto_rawDescGZIP() []byte { return file_volume_server_proto_rawDescData } -var file_volume_server_proto_msgTypes = make([]protoimpl.MessageInfo, 99) -var file_volume_server_proto_goTypes = []interface{}{ +var file_volume_server_proto_msgTypes = make([]protoimpl.MessageInfo, 100) +var file_volume_server_proto_goTypes = []any{ (*BatchDeleteRequest)(nil), // 0: volume_server_pb.BatchDeleteRequest (*BatchDeleteResponse)(nil), // 1: volume_server_pb.BatchDeleteResponse (*DeleteResult)(nil), // 2: volume_server_pb.DeleteResult @@ -6962,140 +7074,142 @@ var file_volume_server_proto_goTypes = []interface{}{ (*MemStatus)(nil), // 71: volume_server_pb.MemStatus (*RemoteFile)(nil), // 72: volume_server_pb.RemoteFile (*VolumeInfo)(nil), // 73: volume_server_pb.VolumeInfo - (*VolumeTierMoveDatToRemoteRequest)(nil), // 74: volume_server_pb.VolumeTierMoveDatToRemoteRequest - (*VolumeTierMoveDatToRemoteResponse)(nil), // 75: volume_server_pb.VolumeTierMoveDatToRemoteResponse - (*VolumeTierMoveDatFromRemoteRequest)(nil), // 76: volume_server_pb.VolumeTierMoveDatFromRemoteRequest - (*VolumeTierMoveDatFromRemoteResponse)(nil), // 77: volume_server_pb.VolumeTierMoveDatFromRemoteResponse - (*VolumeServerStatusRequest)(nil), // 78: volume_server_pb.VolumeServerStatusRequest - (*VolumeServerStatusResponse)(nil), // 79: volume_server_pb.VolumeServerStatusResponse - (*VolumeServerLeaveRequest)(nil), // 80: volume_server_pb.VolumeServerLeaveRequest - (*VolumeServerLeaveResponse)(nil), // 81: volume_server_pb.VolumeServerLeaveResponse - (*FetchAndWriteNeedleRequest)(nil), // 82: volume_server_pb.FetchAndWriteNeedleRequest - (*FetchAndWriteNeedleResponse)(nil), // 83: volume_server_pb.FetchAndWriteNeedleResponse - (*QueryRequest)(nil), // 84: volume_server_pb.QueryRequest - (*QueriedStripe)(nil), // 85: volume_server_pb.QueriedStripe - (*VolumeNeedleStatusRequest)(nil), // 86: volume_server_pb.VolumeNeedleStatusRequest - (*VolumeNeedleStatusResponse)(nil), // 87: volume_server_pb.VolumeNeedleStatusResponse - (*PingRequest)(nil), // 88: volume_server_pb.PingRequest - (*PingResponse)(nil), // 89: volume_server_pb.PingResponse - (*FetchAndWriteNeedleRequest_Replica)(nil), // 90: volume_server_pb.FetchAndWriteNeedleRequest.Replica - (*QueryRequest_Filter)(nil), // 91: volume_server_pb.QueryRequest.Filter - (*QueryRequest_InputSerialization)(nil), // 92: volume_server_pb.QueryRequest.InputSerialization - (*QueryRequest_OutputSerialization)(nil), // 93: volume_server_pb.QueryRequest.OutputSerialization - (*QueryRequest_InputSerialization_CSVInput)(nil), // 94: volume_server_pb.QueryRequest.InputSerialization.CSVInput - (*QueryRequest_InputSerialization_JSONInput)(nil), // 95: volume_server_pb.QueryRequest.InputSerialization.JSONInput - (*QueryRequest_InputSerialization_ParquetInput)(nil), // 96: volume_server_pb.QueryRequest.InputSerialization.ParquetInput - (*QueryRequest_OutputSerialization_CSVOutput)(nil), // 97: volume_server_pb.QueryRequest.OutputSerialization.CSVOutput - (*QueryRequest_OutputSerialization_JSONOutput)(nil), // 98: volume_server_pb.QueryRequest.OutputSerialization.JSONOutput - (*remote_pb.RemoteConf)(nil), // 99: remote_pb.RemoteConf - (*remote_pb.RemoteStorageLocation)(nil), // 100: remote_pb.RemoteStorageLocation + (*OldVersionVolumeInfo)(nil), // 74: volume_server_pb.OldVersionVolumeInfo + (*VolumeTierMoveDatToRemoteRequest)(nil), // 75: volume_server_pb.VolumeTierMoveDatToRemoteRequest + (*VolumeTierMoveDatToRemoteResponse)(nil), // 76: volume_server_pb.VolumeTierMoveDatToRemoteResponse + (*VolumeTierMoveDatFromRemoteRequest)(nil), // 77: volume_server_pb.VolumeTierMoveDatFromRemoteRequest + (*VolumeTierMoveDatFromRemoteResponse)(nil), // 78: volume_server_pb.VolumeTierMoveDatFromRemoteResponse + (*VolumeServerStatusRequest)(nil), // 79: volume_server_pb.VolumeServerStatusRequest + (*VolumeServerStatusResponse)(nil), // 80: volume_server_pb.VolumeServerStatusResponse + (*VolumeServerLeaveRequest)(nil), // 81: volume_server_pb.VolumeServerLeaveRequest + (*VolumeServerLeaveResponse)(nil), // 82: volume_server_pb.VolumeServerLeaveResponse + (*FetchAndWriteNeedleRequest)(nil), // 83: volume_server_pb.FetchAndWriteNeedleRequest + (*FetchAndWriteNeedleResponse)(nil), // 84: volume_server_pb.FetchAndWriteNeedleResponse + (*QueryRequest)(nil), // 85: volume_server_pb.QueryRequest + (*QueriedStripe)(nil), // 86: volume_server_pb.QueriedStripe + (*VolumeNeedleStatusRequest)(nil), // 87: volume_server_pb.VolumeNeedleStatusRequest + (*VolumeNeedleStatusResponse)(nil), // 88: volume_server_pb.VolumeNeedleStatusResponse + (*PingRequest)(nil), // 89: volume_server_pb.PingRequest + (*PingResponse)(nil), // 90: volume_server_pb.PingResponse + (*FetchAndWriteNeedleRequest_Replica)(nil), // 91: volume_server_pb.FetchAndWriteNeedleRequest.Replica + (*QueryRequest_Filter)(nil), // 92: volume_server_pb.QueryRequest.Filter + (*QueryRequest_InputSerialization)(nil), // 93: volume_server_pb.QueryRequest.InputSerialization + (*QueryRequest_OutputSerialization)(nil), // 94: volume_server_pb.QueryRequest.OutputSerialization + (*QueryRequest_InputSerialization_CSVInput)(nil), // 95: volume_server_pb.QueryRequest.InputSerialization.CSVInput + (*QueryRequest_InputSerialization_JSONInput)(nil), // 96: volume_server_pb.QueryRequest.InputSerialization.JSONInput + (*QueryRequest_InputSerialization_ParquetInput)(nil), // 97: volume_server_pb.QueryRequest.InputSerialization.ParquetInput + (*QueryRequest_OutputSerialization_CSVOutput)(nil), // 98: volume_server_pb.QueryRequest.OutputSerialization.CSVOutput + (*QueryRequest_OutputSerialization_JSONOutput)(nil), // 99: volume_server_pb.QueryRequest.OutputSerialization.JSONOutput + (*remote_pb.RemoteConf)(nil), // 100: remote_pb.RemoteConf + (*remote_pb.RemoteStorageLocation)(nil), // 101: remote_pb.RemoteStorageLocation } var file_volume_server_proto_depIdxs = []int32{ 2, // 0: volume_server_pb.BatchDeleteResponse.results:type_name -> volume_server_pb.DeleteResult 73, // 1: volume_server_pb.ReadVolumeFileStatusResponse.volume_info:type_name -> volume_server_pb.VolumeInfo 72, // 2: volume_server_pb.VolumeInfo.files:type_name -> volume_server_pb.RemoteFile - 70, // 3: volume_server_pb.VolumeServerStatusResponse.disk_statuses:type_name -> volume_server_pb.DiskStatus - 71, // 4: volume_server_pb.VolumeServerStatusResponse.memory_status:type_name -> volume_server_pb.MemStatus - 90, // 5: volume_server_pb.FetchAndWriteNeedleRequest.replicas:type_name -> volume_server_pb.FetchAndWriteNeedleRequest.Replica - 99, // 6: volume_server_pb.FetchAndWriteNeedleRequest.remote_conf:type_name -> remote_pb.RemoteConf - 100, // 7: volume_server_pb.FetchAndWriteNeedleRequest.remote_location:type_name -> remote_pb.RemoteStorageLocation - 91, // 8: volume_server_pb.QueryRequest.filter:type_name -> volume_server_pb.QueryRequest.Filter - 92, // 9: volume_server_pb.QueryRequest.input_serialization:type_name -> volume_server_pb.QueryRequest.InputSerialization - 93, // 10: volume_server_pb.QueryRequest.output_serialization:type_name -> volume_server_pb.QueryRequest.OutputSerialization - 94, // 11: volume_server_pb.QueryRequest.InputSerialization.csv_input:type_name -> volume_server_pb.QueryRequest.InputSerialization.CSVInput - 95, // 12: volume_server_pb.QueryRequest.InputSerialization.json_input:type_name -> volume_server_pb.QueryRequest.InputSerialization.JSONInput - 96, // 13: volume_server_pb.QueryRequest.InputSerialization.parquet_input:type_name -> volume_server_pb.QueryRequest.InputSerialization.ParquetInput - 97, // 14: volume_server_pb.QueryRequest.OutputSerialization.csv_output:type_name -> volume_server_pb.QueryRequest.OutputSerialization.CSVOutput - 98, // 15: volume_server_pb.QueryRequest.OutputSerialization.json_output:type_name -> volume_server_pb.QueryRequest.OutputSerialization.JSONOutput - 0, // 16: volume_server_pb.VolumeServer.BatchDelete:input_type -> volume_server_pb.BatchDeleteRequest - 4, // 17: volume_server_pb.VolumeServer.VacuumVolumeCheck:input_type -> volume_server_pb.VacuumVolumeCheckRequest - 6, // 18: volume_server_pb.VolumeServer.VacuumVolumeCompact:input_type -> volume_server_pb.VacuumVolumeCompactRequest - 8, // 19: volume_server_pb.VolumeServer.VacuumVolumeCommit:input_type -> volume_server_pb.VacuumVolumeCommitRequest - 10, // 20: volume_server_pb.VolumeServer.VacuumVolumeCleanup:input_type -> volume_server_pb.VacuumVolumeCleanupRequest - 12, // 21: volume_server_pb.VolumeServer.DeleteCollection:input_type -> volume_server_pb.DeleteCollectionRequest - 14, // 22: volume_server_pb.VolumeServer.AllocateVolume:input_type -> volume_server_pb.AllocateVolumeRequest - 16, // 23: volume_server_pb.VolumeServer.VolumeSyncStatus:input_type -> volume_server_pb.VolumeSyncStatusRequest - 18, // 24: volume_server_pb.VolumeServer.VolumeIncrementalCopy:input_type -> volume_server_pb.VolumeIncrementalCopyRequest - 20, // 25: volume_server_pb.VolumeServer.VolumeMount:input_type -> volume_server_pb.VolumeMountRequest - 22, // 26: volume_server_pb.VolumeServer.VolumeUnmount:input_type -> volume_server_pb.VolumeUnmountRequest - 24, // 27: volume_server_pb.VolumeServer.VolumeDelete:input_type -> volume_server_pb.VolumeDeleteRequest - 26, // 28: volume_server_pb.VolumeServer.VolumeMarkReadonly:input_type -> volume_server_pb.VolumeMarkReadonlyRequest - 28, // 29: volume_server_pb.VolumeServer.VolumeMarkWritable:input_type -> volume_server_pb.VolumeMarkWritableRequest - 30, // 30: volume_server_pb.VolumeServer.VolumeConfigure:input_type -> volume_server_pb.VolumeConfigureRequest - 32, // 31: volume_server_pb.VolumeServer.VolumeStatus:input_type -> volume_server_pb.VolumeStatusRequest - 34, // 32: volume_server_pb.VolumeServer.VolumeCopy:input_type -> volume_server_pb.VolumeCopyRequest - 68, // 33: volume_server_pb.VolumeServer.ReadVolumeFileStatus:input_type -> volume_server_pb.ReadVolumeFileStatusRequest - 36, // 34: volume_server_pb.VolumeServer.CopyFile:input_type -> volume_server_pb.CopyFileRequest - 38, // 35: volume_server_pb.VolumeServer.ReadNeedleBlob:input_type -> volume_server_pb.ReadNeedleBlobRequest - 40, // 36: volume_server_pb.VolumeServer.ReadNeedleMeta:input_type -> volume_server_pb.ReadNeedleMetaRequest - 42, // 37: volume_server_pb.VolumeServer.WriteNeedleBlob:input_type -> volume_server_pb.WriteNeedleBlobRequest - 44, // 38: volume_server_pb.VolumeServer.ReadAllNeedles:input_type -> volume_server_pb.ReadAllNeedlesRequest - 46, // 39: volume_server_pb.VolumeServer.VolumeTailSender:input_type -> volume_server_pb.VolumeTailSenderRequest - 48, // 40: volume_server_pb.VolumeServer.VolumeTailReceiver:input_type -> volume_server_pb.VolumeTailReceiverRequest - 50, // 41: volume_server_pb.VolumeServer.VolumeEcShardsGenerate:input_type -> volume_server_pb.VolumeEcShardsGenerateRequest - 52, // 42: volume_server_pb.VolumeServer.VolumeEcShardsRebuild:input_type -> volume_server_pb.VolumeEcShardsRebuildRequest - 54, // 43: volume_server_pb.VolumeServer.VolumeEcShardsCopy:input_type -> volume_server_pb.VolumeEcShardsCopyRequest - 56, // 44: volume_server_pb.VolumeServer.VolumeEcShardsDelete:input_type -> volume_server_pb.VolumeEcShardsDeleteRequest - 58, // 45: volume_server_pb.VolumeServer.VolumeEcShardsMount:input_type -> volume_server_pb.VolumeEcShardsMountRequest - 60, // 46: volume_server_pb.VolumeServer.VolumeEcShardsUnmount:input_type -> volume_server_pb.VolumeEcShardsUnmountRequest - 62, // 47: volume_server_pb.VolumeServer.VolumeEcShardRead:input_type -> volume_server_pb.VolumeEcShardReadRequest - 64, // 48: volume_server_pb.VolumeServer.VolumeEcBlobDelete:input_type -> volume_server_pb.VolumeEcBlobDeleteRequest - 66, // 49: volume_server_pb.VolumeServer.VolumeEcShardsToVolume:input_type -> volume_server_pb.VolumeEcShardsToVolumeRequest - 74, // 50: volume_server_pb.VolumeServer.VolumeTierMoveDatToRemote:input_type -> volume_server_pb.VolumeTierMoveDatToRemoteRequest - 76, // 51: volume_server_pb.VolumeServer.VolumeTierMoveDatFromRemote:input_type -> volume_server_pb.VolumeTierMoveDatFromRemoteRequest - 78, // 52: volume_server_pb.VolumeServer.VolumeServerStatus:input_type -> volume_server_pb.VolumeServerStatusRequest - 80, // 53: volume_server_pb.VolumeServer.VolumeServerLeave:input_type -> volume_server_pb.VolumeServerLeaveRequest - 82, // 54: volume_server_pb.VolumeServer.FetchAndWriteNeedle:input_type -> volume_server_pb.FetchAndWriteNeedleRequest - 84, // 55: volume_server_pb.VolumeServer.Query:input_type -> volume_server_pb.QueryRequest - 86, // 56: volume_server_pb.VolumeServer.VolumeNeedleStatus:input_type -> volume_server_pb.VolumeNeedleStatusRequest - 88, // 57: volume_server_pb.VolumeServer.Ping:input_type -> volume_server_pb.PingRequest - 1, // 58: volume_server_pb.VolumeServer.BatchDelete:output_type -> volume_server_pb.BatchDeleteResponse - 5, // 59: volume_server_pb.VolumeServer.VacuumVolumeCheck:output_type -> volume_server_pb.VacuumVolumeCheckResponse - 7, // 60: volume_server_pb.VolumeServer.VacuumVolumeCompact:output_type -> volume_server_pb.VacuumVolumeCompactResponse - 9, // 61: volume_server_pb.VolumeServer.VacuumVolumeCommit:output_type -> volume_server_pb.VacuumVolumeCommitResponse - 11, // 62: volume_server_pb.VolumeServer.VacuumVolumeCleanup:output_type -> volume_server_pb.VacuumVolumeCleanupResponse - 13, // 63: volume_server_pb.VolumeServer.DeleteCollection:output_type -> volume_server_pb.DeleteCollectionResponse - 15, // 64: volume_server_pb.VolumeServer.AllocateVolume:output_type -> volume_server_pb.AllocateVolumeResponse - 17, // 65: volume_server_pb.VolumeServer.VolumeSyncStatus:output_type -> volume_server_pb.VolumeSyncStatusResponse - 19, // 66: volume_server_pb.VolumeServer.VolumeIncrementalCopy:output_type -> volume_server_pb.VolumeIncrementalCopyResponse - 21, // 67: volume_server_pb.VolumeServer.VolumeMount:output_type -> volume_server_pb.VolumeMountResponse - 23, // 68: volume_server_pb.VolumeServer.VolumeUnmount:output_type -> volume_server_pb.VolumeUnmountResponse - 25, // 69: volume_server_pb.VolumeServer.VolumeDelete:output_type -> volume_server_pb.VolumeDeleteResponse - 27, // 70: volume_server_pb.VolumeServer.VolumeMarkReadonly:output_type -> volume_server_pb.VolumeMarkReadonlyResponse - 29, // 71: volume_server_pb.VolumeServer.VolumeMarkWritable:output_type -> volume_server_pb.VolumeMarkWritableResponse - 31, // 72: volume_server_pb.VolumeServer.VolumeConfigure:output_type -> volume_server_pb.VolumeConfigureResponse - 33, // 73: volume_server_pb.VolumeServer.VolumeStatus:output_type -> volume_server_pb.VolumeStatusResponse - 35, // 74: volume_server_pb.VolumeServer.VolumeCopy:output_type -> volume_server_pb.VolumeCopyResponse - 69, // 75: volume_server_pb.VolumeServer.ReadVolumeFileStatus:output_type -> volume_server_pb.ReadVolumeFileStatusResponse - 37, // 76: volume_server_pb.VolumeServer.CopyFile:output_type -> volume_server_pb.CopyFileResponse - 39, // 77: volume_server_pb.VolumeServer.ReadNeedleBlob:output_type -> volume_server_pb.ReadNeedleBlobResponse - 41, // 78: volume_server_pb.VolumeServer.ReadNeedleMeta:output_type -> volume_server_pb.ReadNeedleMetaResponse - 43, // 79: volume_server_pb.VolumeServer.WriteNeedleBlob:output_type -> volume_server_pb.WriteNeedleBlobResponse - 45, // 80: volume_server_pb.VolumeServer.ReadAllNeedles:output_type -> volume_server_pb.ReadAllNeedlesResponse - 47, // 81: volume_server_pb.VolumeServer.VolumeTailSender:output_type -> volume_server_pb.VolumeTailSenderResponse - 49, // 82: volume_server_pb.VolumeServer.VolumeTailReceiver:output_type -> volume_server_pb.VolumeTailReceiverResponse - 51, // 83: volume_server_pb.VolumeServer.VolumeEcShardsGenerate:output_type -> volume_server_pb.VolumeEcShardsGenerateResponse - 53, // 84: volume_server_pb.VolumeServer.VolumeEcShardsRebuild:output_type -> volume_server_pb.VolumeEcShardsRebuildResponse - 55, // 85: volume_server_pb.VolumeServer.VolumeEcShardsCopy:output_type -> volume_server_pb.VolumeEcShardsCopyResponse - 57, // 86: volume_server_pb.VolumeServer.VolumeEcShardsDelete:output_type -> volume_server_pb.VolumeEcShardsDeleteResponse - 59, // 87: volume_server_pb.VolumeServer.VolumeEcShardsMount:output_type -> volume_server_pb.VolumeEcShardsMountResponse - 61, // 88: volume_server_pb.VolumeServer.VolumeEcShardsUnmount:output_type -> volume_server_pb.VolumeEcShardsUnmountResponse - 63, // 89: volume_server_pb.VolumeServer.VolumeEcShardRead:output_type -> volume_server_pb.VolumeEcShardReadResponse - 65, // 90: volume_server_pb.VolumeServer.VolumeEcBlobDelete:output_type -> volume_server_pb.VolumeEcBlobDeleteResponse - 67, // 91: volume_server_pb.VolumeServer.VolumeEcShardsToVolume:output_type -> volume_server_pb.VolumeEcShardsToVolumeResponse - 75, // 92: volume_server_pb.VolumeServer.VolumeTierMoveDatToRemote:output_type -> volume_server_pb.VolumeTierMoveDatToRemoteResponse - 77, // 93: volume_server_pb.VolumeServer.VolumeTierMoveDatFromRemote:output_type -> volume_server_pb.VolumeTierMoveDatFromRemoteResponse - 79, // 94: volume_server_pb.VolumeServer.VolumeServerStatus:output_type -> volume_server_pb.VolumeServerStatusResponse - 81, // 95: volume_server_pb.VolumeServer.VolumeServerLeave:output_type -> volume_server_pb.VolumeServerLeaveResponse - 83, // 96: volume_server_pb.VolumeServer.FetchAndWriteNeedle:output_type -> volume_server_pb.FetchAndWriteNeedleResponse - 85, // 97: volume_server_pb.VolumeServer.Query:output_type -> volume_server_pb.QueriedStripe - 87, // 98: volume_server_pb.VolumeServer.VolumeNeedleStatus:output_type -> volume_server_pb.VolumeNeedleStatusResponse - 89, // 99: volume_server_pb.VolumeServer.Ping:output_type -> volume_server_pb.PingResponse - 58, // [58:100] is the sub-list for method output_type - 16, // [16:58] is the sub-list for method input_type - 16, // [16:16] is the sub-list for extension type_name - 16, // [16:16] is the sub-list for extension extendee - 0, // [0:16] is the sub-list for field type_name + 72, // 3: volume_server_pb.OldVersionVolumeInfo.files:type_name -> volume_server_pb.RemoteFile + 70, // 4: volume_server_pb.VolumeServerStatusResponse.disk_statuses:type_name -> volume_server_pb.DiskStatus + 71, // 5: volume_server_pb.VolumeServerStatusResponse.memory_status:type_name -> volume_server_pb.MemStatus + 91, // 6: volume_server_pb.FetchAndWriteNeedleRequest.replicas:type_name -> volume_server_pb.FetchAndWriteNeedleRequest.Replica + 100, // 7: volume_server_pb.FetchAndWriteNeedleRequest.remote_conf:type_name -> remote_pb.RemoteConf + 101, // 8: volume_server_pb.FetchAndWriteNeedleRequest.remote_location:type_name -> remote_pb.RemoteStorageLocation + 92, // 9: volume_server_pb.QueryRequest.filter:type_name -> volume_server_pb.QueryRequest.Filter + 93, // 10: volume_server_pb.QueryRequest.input_serialization:type_name -> volume_server_pb.QueryRequest.InputSerialization + 94, // 11: volume_server_pb.QueryRequest.output_serialization:type_name -> volume_server_pb.QueryRequest.OutputSerialization + 95, // 12: volume_server_pb.QueryRequest.InputSerialization.csv_input:type_name -> volume_server_pb.QueryRequest.InputSerialization.CSVInput + 96, // 13: volume_server_pb.QueryRequest.InputSerialization.json_input:type_name -> volume_server_pb.QueryRequest.InputSerialization.JSONInput + 97, // 14: volume_server_pb.QueryRequest.InputSerialization.parquet_input:type_name -> volume_server_pb.QueryRequest.InputSerialization.ParquetInput + 98, // 15: volume_server_pb.QueryRequest.OutputSerialization.csv_output:type_name -> volume_server_pb.QueryRequest.OutputSerialization.CSVOutput + 99, // 16: volume_server_pb.QueryRequest.OutputSerialization.json_output:type_name -> volume_server_pb.QueryRequest.OutputSerialization.JSONOutput + 0, // 17: volume_server_pb.VolumeServer.BatchDelete:input_type -> volume_server_pb.BatchDeleteRequest + 4, // 18: volume_server_pb.VolumeServer.VacuumVolumeCheck:input_type -> volume_server_pb.VacuumVolumeCheckRequest + 6, // 19: volume_server_pb.VolumeServer.VacuumVolumeCompact:input_type -> volume_server_pb.VacuumVolumeCompactRequest + 8, // 20: volume_server_pb.VolumeServer.VacuumVolumeCommit:input_type -> volume_server_pb.VacuumVolumeCommitRequest + 10, // 21: volume_server_pb.VolumeServer.VacuumVolumeCleanup:input_type -> volume_server_pb.VacuumVolumeCleanupRequest + 12, // 22: volume_server_pb.VolumeServer.DeleteCollection:input_type -> volume_server_pb.DeleteCollectionRequest + 14, // 23: volume_server_pb.VolumeServer.AllocateVolume:input_type -> volume_server_pb.AllocateVolumeRequest + 16, // 24: volume_server_pb.VolumeServer.VolumeSyncStatus:input_type -> volume_server_pb.VolumeSyncStatusRequest + 18, // 25: volume_server_pb.VolumeServer.VolumeIncrementalCopy:input_type -> volume_server_pb.VolumeIncrementalCopyRequest + 20, // 26: volume_server_pb.VolumeServer.VolumeMount:input_type -> volume_server_pb.VolumeMountRequest + 22, // 27: volume_server_pb.VolumeServer.VolumeUnmount:input_type -> volume_server_pb.VolumeUnmountRequest + 24, // 28: volume_server_pb.VolumeServer.VolumeDelete:input_type -> volume_server_pb.VolumeDeleteRequest + 26, // 29: volume_server_pb.VolumeServer.VolumeMarkReadonly:input_type -> volume_server_pb.VolumeMarkReadonlyRequest + 28, // 30: volume_server_pb.VolumeServer.VolumeMarkWritable:input_type -> volume_server_pb.VolumeMarkWritableRequest + 30, // 31: volume_server_pb.VolumeServer.VolumeConfigure:input_type -> volume_server_pb.VolumeConfigureRequest + 32, // 32: volume_server_pb.VolumeServer.VolumeStatus:input_type -> volume_server_pb.VolumeStatusRequest + 34, // 33: volume_server_pb.VolumeServer.VolumeCopy:input_type -> volume_server_pb.VolumeCopyRequest + 68, // 34: volume_server_pb.VolumeServer.ReadVolumeFileStatus:input_type -> volume_server_pb.ReadVolumeFileStatusRequest + 36, // 35: volume_server_pb.VolumeServer.CopyFile:input_type -> volume_server_pb.CopyFileRequest + 38, // 36: volume_server_pb.VolumeServer.ReadNeedleBlob:input_type -> volume_server_pb.ReadNeedleBlobRequest + 40, // 37: volume_server_pb.VolumeServer.ReadNeedleMeta:input_type -> volume_server_pb.ReadNeedleMetaRequest + 42, // 38: volume_server_pb.VolumeServer.WriteNeedleBlob:input_type -> volume_server_pb.WriteNeedleBlobRequest + 44, // 39: volume_server_pb.VolumeServer.ReadAllNeedles:input_type -> volume_server_pb.ReadAllNeedlesRequest + 46, // 40: volume_server_pb.VolumeServer.VolumeTailSender:input_type -> volume_server_pb.VolumeTailSenderRequest + 48, // 41: volume_server_pb.VolumeServer.VolumeTailReceiver:input_type -> volume_server_pb.VolumeTailReceiverRequest + 50, // 42: volume_server_pb.VolumeServer.VolumeEcShardsGenerate:input_type -> volume_server_pb.VolumeEcShardsGenerateRequest + 52, // 43: volume_server_pb.VolumeServer.VolumeEcShardsRebuild:input_type -> volume_server_pb.VolumeEcShardsRebuildRequest + 54, // 44: volume_server_pb.VolumeServer.VolumeEcShardsCopy:input_type -> volume_server_pb.VolumeEcShardsCopyRequest + 56, // 45: volume_server_pb.VolumeServer.VolumeEcShardsDelete:input_type -> volume_server_pb.VolumeEcShardsDeleteRequest + 58, // 46: volume_server_pb.VolumeServer.VolumeEcShardsMount:input_type -> volume_server_pb.VolumeEcShardsMountRequest + 60, // 47: volume_server_pb.VolumeServer.VolumeEcShardsUnmount:input_type -> volume_server_pb.VolumeEcShardsUnmountRequest + 62, // 48: volume_server_pb.VolumeServer.VolumeEcShardRead:input_type -> volume_server_pb.VolumeEcShardReadRequest + 64, // 49: volume_server_pb.VolumeServer.VolumeEcBlobDelete:input_type -> volume_server_pb.VolumeEcBlobDeleteRequest + 66, // 50: volume_server_pb.VolumeServer.VolumeEcShardsToVolume:input_type -> volume_server_pb.VolumeEcShardsToVolumeRequest + 75, // 51: volume_server_pb.VolumeServer.VolumeTierMoveDatToRemote:input_type -> volume_server_pb.VolumeTierMoveDatToRemoteRequest + 77, // 52: volume_server_pb.VolumeServer.VolumeTierMoveDatFromRemote:input_type -> volume_server_pb.VolumeTierMoveDatFromRemoteRequest + 79, // 53: volume_server_pb.VolumeServer.VolumeServerStatus:input_type -> volume_server_pb.VolumeServerStatusRequest + 81, // 54: volume_server_pb.VolumeServer.VolumeServerLeave:input_type -> volume_server_pb.VolumeServerLeaveRequest + 83, // 55: volume_server_pb.VolumeServer.FetchAndWriteNeedle:input_type -> volume_server_pb.FetchAndWriteNeedleRequest + 85, // 56: volume_server_pb.VolumeServer.Query:input_type -> volume_server_pb.QueryRequest + 87, // 57: volume_server_pb.VolumeServer.VolumeNeedleStatus:input_type -> volume_server_pb.VolumeNeedleStatusRequest + 89, // 58: volume_server_pb.VolumeServer.Ping:input_type -> volume_server_pb.PingRequest + 1, // 59: volume_server_pb.VolumeServer.BatchDelete:output_type -> volume_server_pb.BatchDeleteResponse + 5, // 60: volume_server_pb.VolumeServer.VacuumVolumeCheck:output_type -> volume_server_pb.VacuumVolumeCheckResponse + 7, // 61: volume_server_pb.VolumeServer.VacuumVolumeCompact:output_type -> volume_server_pb.VacuumVolumeCompactResponse + 9, // 62: volume_server_pb.VolumeServer.VacuumVolumeCommit:output_type -> volume_server_pb.VacuumVolumeCommitResponse + 11, // 63: volume_server_pb.VolumeServer.VacuumVolumeCleanup:output_type -> volume_server_pb.VacuumVolumeCleanupResponse + 13, // 64: volume_server_pb.VolumeServer.DeleteCollection:output_type -> volume_server_pb.DeleteCollectionResponse + 15, // 65: volume_server_pb.VolumeServer.AllocateVolume:output_type -> volume_server_pb.AllocateVolumeResponse + 17, // 66: volume_server_pb.VolumeServer.VolumeSyncStatus:output_type -> volume_server_pb.VolumeSyncStatusResponse + 19, // 67: volume_server_pb.VolumeServer.VolumeIncrementalCopy:output_type -> volume_server_pb.VolumeIncrementalCopyResponse + 21, // 68: volume_server_pb.VolumeServer.VolumeMount:output_type -> volume_server_pb.VolumeMountResponse + 23, // 69: volume_server_pb.VolumeServer.VolumeUnmount:output_type -> volume_server_pb.VolumeUnmountResponse + 25, // 70: volume_server_pb.VolumeServer.VolumeDelete:output_type -> volume_server_pb.VolumeDeleteResponse + 27, // 71: volume_server_pb.VolumeServer.VolumeMarkReadonly:output_type -> volume_server_pb.VolumeMarkReadonlyResponse + 29, // 72: volume_server_pb.VolumeServer.VolumeMarkWritable:output_type -> volume_server_pb.VolumeMarkWritableResponse + 31, // 73: volume_server_pb.VolumeServer.VolumeConfigure:output_type -> volume_server_pb.VolumeConfigureResponse + 33, // 74: volume_server_pb.VolumeServer.VolumeStatus:output_type -> volume_server_pb.VolumeStatusResponse + 35, // 75: volume_server_pb.VolumeServer.VolumeCopy:output_type -> volume_server_pb.VolumeCopyResponse + 69, // 76: volume_server_pb.VolumeServer.ReadVolumeFileStatus:output_type -> volume_server_pb.ReadVolumeFileStatusResponse + 37, // 77: volume_server_pb.VolumeServer.CopyFile:output_type -> volume_server_pb.CopyFileResponse + 39, // 78: volume_server_pb.VolumeServer.ReadNeedleBlob:output_type -> volume_server_pb.ReadNeedleBlobResponse + 41, // 79: volume_server_pb.VolumeServer.ReadNeedleMeta:output_type -> volume_server_pb.ReadNeedleMetaResponse + 43, // 80: volume_server_pb.VolumeServer.WriteNeedleBlob:output_type -> volume_server_pb.WriteNeedleBlobResponse + 45, // 81: volume_server_pb.VolumeServer.ReadAllNeedles:output_type -> volume_server_pb.ReadAllNeedlesResponse + 47, // 82: volume_server_pb.VolumeServer.VolumeTailSender:output_type -> volume_server_pb.VolumeTailSenderResponse + 49, // 83: volume_server_pb.VolumeServer.VolumeTailReceiver:output_type -> volume_server_pb.VolumeTailReceiverResponse + 51, // 84: volume_server_pb.VolumeServer.VolumeEcShardsGenerate:output_type -> volume_server_pb.VolumeEcShardsGenerateResponse + 53, // 85: volume_server_pb.VolumeServer.VolumeEcShardsRebuild:output_type -> volume_server_pb.VolumeEcShardsRebuildResponse + 55, // 86: volume_server_pb.VolumeServer.VolumeEcShardsCopy:output_type -> volume_server_pb.VolumeEcShardsCopyResponse + 57, // 87: volume_server_pb.VolumeServer.VolumeEcShardsDelete:output_type -> volume_server_pb.VolumeEcShardsDeleteResponse + 59, // 88: volume_server_pb.VolumeServer.VolumeEcShardsMount:output_type -> volume_server_pb.VolumeEcShardsMountResponse + 61, // 89: volume_server_pb.VolumeServer.VolumeEcShardsUnmount:output_type -> volume_server_pb.VolumeEcShardsUnmountResponse + 63, // 90: volume_server_pb.VolumeServer.VolumeEcShardRead:output_type -> volume_server_pb.VolumeEcShardReadResponse + 65, // 91: volume_server_pb.VolumeServer.VolumeEcBlobDelete:output_type -> volume_server_pb.VolumeEcBlobDeleteResponse + 67, // 92: volume_server_pb.VolumeServer.VolumeEcShardsToVolume:output_type -> volume_server_pb.VolumeEcShardsToVolumeResponse + 76, // 93: volume_server_pb.VolumeServer.VolumeTierMoveDatToRemote:output_type -> volume_server_pb.VolumeTierMoveDatToRemoteResponse + 78, // 94: volume_server_pb.VolumeServer.VolumeTierMoveDatFromRemote:output_type -> volume_server_pb.VolumeTierMoveDatFromRemoteResponse + 80, // 95: volume_server_pb.VolumeServer.VolumeServerStatus:output_type -> volume_server_pb.VolumeServerStatusResponse + 82, // 96: volume_server_pb.VolumeServer.VolumeServerLeave:output_type -> volume_server_pb.VolumeServerLeaveResponse + 84, // 97: volume_server_pb.VolumeServer.FetchAndWriteNeedle:output_type -> volume_server_pb.FetchAndWriteNeedleResponse + 86, // 98: volume_server_pb.VolumeServer.Query:output_type -> volume_server_pb.QueriedStripe + 88, // 99: volume_server_pb.VolumeServer.VolumeNeedleStatus:output_type -> volume_server_pb.VolumeNeedleStatusResponse + 90, // 100: volume_server_pb.VolumeServer.Ping:output_type -> volume_server_pb.PingResponse + 59, // [59:101] is the sub-list for method output_type + 17, // [17:59] is the sub-list for method input_type + 17, // [17:17] is the sub-list for extension type_name + 17, // [17:17] is the sub-list for extension extendee + 0, // [0:17] is the sub-list for field type_name } func init() { file_volume_server_proto_init() } @@ -7104,7 +7218,7 @@ func file_volume_server_proto_init() { return } if !protoimpl.UnsafeEnabled { - file_volume_server_proto_msgTypes[0].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[0].Exporter = func(v any, i int) any { switch v := v.(*BatchDeleteRequest); i { case 0: return &v.state @@ -7116,7 +7230,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[1].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[1].Exporter = func(v any, i int) any { switch v := v.(*BatchDeleteResponse); i { case 0: return &v.state @@ -7128,7 +7242,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[2].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[2].Exporter = func(v any, i int) any { switch v := v.(*DeleteResult); i { case 0: return &v.state @@ -7140,7 +7254,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[3].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[3].Exporter = func(v any, i int) any { switch v := v.(*Empty); i { case 0: return &v.state @@ -7152,7 +7266,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[4].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[4].Exporter = func(v any, i int) any { switch v := v.(*VacuumVolumeCheckRequest); i { case 0: return &v.state @@ -7164,7 +7278,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[5].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[5].Exporter = func(v any, i int) any { switch v := v.(*VacuumVolumeCheckResponse); i { case 0: return &v.state @@ -7176,7 +7290,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[6].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[6].Exporter = func(v any, i int) any { switch v := v.(*VacuumVolumeCompactRequest); i { case 0: return &v.state @@ -7188,7 +7302,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[7].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[7].Exporter = func(v any, i int) any { switch v := v.(*VacuumVolumeCompactResponse); i { case 0: return &v.state @@ -7200,7 +7314,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[8].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[8].Exporter = func(v any, i int) any { switch v := v.(*VacuumVolumeCommitRequest); i { case 0: return &v.state @@ -7212,7 +7326,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[9].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[9].Exporter = func(v any, i int) any { switch v := v.(*VacuumVolumeCommitResponse); i { case 0: return &v.state @@ -7224,7 +7338,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[10].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[10].Exporter = func(v any, i int) any { switch v := v.(*VacuumVolumeCleanupRequest); i { case 0: return &v.state @@ -7236,7 +7350,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[11].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[11].Exporter = func(v any, i int) any { switch v := v.(*VacuumVolumeCleanupResponse); i { case 0: return &v.state @@ -7248,7 +7362,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[12].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[12].Exporter = func(v any, i int) any { switch v := v.(*DeleteCollectionRequest); i { case 0: return &v.state @@ -7260,7 +7374,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[13].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[13].Exporter = func(v any, i int) any { switch v := v.(*DeleteCollectionResponse); i { case 0: return &v.state @@ -7272,7 +7386,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[14].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[14].Exporter = func(v any, i int) any { switch v := v.(*AllocateVolumeRequest); i { case 0: return &v.state @@ -7284,7 +7398,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[15].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[15].Exporter = func(v any, i int) any { switch v := v.(*AllocateVolumeResponse); i { case 0: return &v.state @@ -7296,7 +7410,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[16].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[16].Exporter = func(v any, i int) any { switch v := v.(*VolumeSyncStatusRequest); i { case 0: return &v.state @@ -7308,7 +7422,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[17].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[17].Exporter = func(v any, i int) any { switch v := v.(*VolumeSyncStatusResponse); i { case 0: return &v.state @@ -7320,7 +7434,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[18].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[18].Exporter = func(v any, i int) any { switch v := v.(*VolumeIncrementalCopyRequest); i { case 0: return &v.state @@ -7332,7 +7446,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[19].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[19].Exporter = func(v any, i int) any { switch v := v.(*VolumeIncrementalCopyResponse); i { case 0: return &v.state @@ -7344,7 +7458,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[20].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[20].Exporter = func(v any, i int) any { switch v := v.(*VolumeMountRequest); i { case 0: return &v.state @@ -7356,7 +7470,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[21].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[21].Exporter = func(v any, i int) any { switch v := v.(*VolumeMountResponse); i { case 0: return &v.state @@ -7368,7 +7482,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[22].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[22].Exporter = func(v any, i int) any { switch v := v.(*VolumeUnmountRequest); i { case 0: return &v.state @@ -7380,7 +7494,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[23].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[23].Exporter = func(v any, i int) any { switch v := v.(*VolumeUnmountResponse); i { case 0: return &v.state @@ -7392,7 +7506,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[24].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[24].Exporter = func(v any, i int) any { switch v := v.(*VolumeDeleteRequest); i { case 0: return &v.state @@ -7404,7 +7518,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[25].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[25].Exporter = func(v any, i int) any { switch v := v.(*VolumeDeleteResponse); i { case 0: return &v.state @@ -7416,7 +7530,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[26].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[26].Exporter = func(v any, i int) any { switch v := v.(*VolumeMarkReadonlyRequest); i { case 0: return &v.state @@ -7428,7 +7542,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[27].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[27].Exporter = func(v any, i int) any { switch v := v.(*VolumeMarkReadonlyResponse); i { case 0: return &v.state @@ -7440,7 +7554,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[28].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[28].Exporter = func(v any, i int) any { switch v := v.(*VolumeMarkWritableRequest); i { case 0: return &v.state @@ -7452,7 +7566,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[29].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[29].Exporter = func(v any, i int) any { switch v := v.(*VolumeMarkWritableResponse); i { case 0: return &v.state @@ -7464,7 +7578,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[30].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[30].Exporter = func(v any, i int) any { switch v := v.(*VolumeConfigureRequest); i { case 0: return &v.state @@ -7476,7 +7590,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[31].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[31].Exporter = func(v any, i int) any { switch v := v.(*VolumeConfigureResponse); i { case 0: return &v.state @@ -7488,7 +7602,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[32].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[32].Exporter = func(v any, i int) any { switch v := v.(*VolumeStatusRequest); i { case 0: return &v.state @@ -7500,7 +7614,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[33].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[33].Exporter = func(v any, i int) any { switch v := v.(*VolumeStatusResponse); i { case 0: return &v.state @@ -7512,7 +7626,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[34].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[34].Exporter = func(v any, i int) any { switch v := v.(*VolumeCopyRequest); i { case 0: return &v.state @@ -7524,7 +7638,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[35].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[35].Exporter = func(v any, i int) any { switch v := v.(*VolumeCopyResponse); i { case 0: return &v.state @@ -7536,7 +7650,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[36].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[36].Exporter = func(v any, i int) any { switch v := v.(*CopyFileRequest); i { case 0: return &v.state @@ -7548,7 +7662,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[37].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[37].Exporter = func(v any, i int) any { switch v := v.(*CopyFileResponse); i { case 0: return &v.state @@ -7560,7 +7674,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[38].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[38].Exporter = func(v any, i int) any { switch v := v.(*ReadNeedleBlobRequest); i { case 0: return &v.state @@ -7572,7 +7686,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[39].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[39].Exporter = func(v any, i int) any { switch v := v.(*ReadNeedleBlobResponse); i { case 0: return &v.state @@ -7584,7 +7698,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[40].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[40].Exporter = func(v any, i int) any { switch v := v.(*ReadNeedleMetaRequest); i { case 0: return &v.state @@ -7596,7 +7710,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[41].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[41].Exporter = func(v any, i int) any { switch v := v.(*ReadNeedleMetaResponse); i { case 0: return &v.state @@ -7608,7 +7722,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[42].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[42].Exporter = func(v any, i int) any { switch v := v.(*WriteNeedleBlobRequest); i { case 0: return &v.state @@ -7620,7 +7734,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[43].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[43].Exporter = func(v any, i int) any { switch v := v.(*WriteNeedleBlobResponse); i { case 0: return &v.state @@ -7632,7 +7746,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[44].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[44].Exporter = func(v any, i int) any { switch v := v.(*ReadAllNeedlesRequest); i { case 0: return &v.state @@ -7644,7 +7758,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[45].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[45].Exporter = func(v any, i int) any { switch v := v.(*ReadAllNeedlesResponse); i { case 0: return &v.state @@ -7656,7 +7770,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[46].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[46].Exporter = func(v any, i int) any { switch v := v.(*VolumeTailSenderRequest); i { case 0: return &v.state @@ -7668,7 +7782,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[47].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[47].Exporter = func(v any, i int) any { switch v := v.(*VolumeTailSenderResponse); i { case 0: return &v.state @@ -7680,7 +7794,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[48].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[48].Exporter = func(v any, i int) any { switch v := v.(*VolumeTailReceiverRequest); i { case 0: return &v.state @@ -7692,7 +7806,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[49].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[49].Exporter = func(v any, i int) any { switch v := v.(*VolumeTailReceiverResponse); i { case 0: return &v.state @@ -7704,7 +7818,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[50].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[50].Exporter = func(v any, i int) any { switch v := v.(*VolumeEcShardsGenerateRequest); i { case 0: return &v.state @@ -7716,7 +7830,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[51].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[51].Exporter = func(v any, i int) any { switch v := v.(*VolumeEcShardsGenerateResponse); i { case 0: return &v.state @@ -7728,7 +7842,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[52].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[52].Exporter = func(v any, i int) any { switch v := v.(*VolumeEcShardsRebuildRequest); i { case 0: return &v.state @@ -7740,7 +7854,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[53].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[53].Exporter = func(v any, i int) any { switch v := v.(*VolumeEcShardsRebuildResponse); i { case 0: return &v.state @@ -7752,7 +7866,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[54].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[54].Exporter = func(v any, i int) any { switch v := v.(*VolumeEcShardsCopyRequest); i { case 0: return &v.state @@ -7764,7 +7878,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[55].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[55].Exporter = func(v any, i int) any { switch v := v.(*VolumeEcShardsCopyResponse); i { case 0: return &v.state @@ -7776,7 +7890,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[56].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[56].Exporter = func(v any, i int) any { switch v := v.(*VolumeEcShardsDeleteRequest); i { case 0: return &v.state @@ -7788,7 +7902,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[57].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[57].Exporter = func(v any, i int) any { switch v := v.(*VolumeEcShardsDeleteResponse); i { case 0: return &v.state @@ -7800,7 +7914,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[58].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[58].Exporter = func(v any, i int) any { switch v := v.(*VolumeEcShardsMountRequest); i { case 0: return &v.state @@ -7812,7 +7926,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[59].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[59].Exporter = func(v any, i int) any { switch v := v.(*VolumeEcShardsMountResponse); i { case 0: return &v.state @@ -7824,7 +7938,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[60].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[60].Exporter = func(v any, i int) any { switch v := v.(*VolumeEcShardsUnmountRequest); i { case 0: return &v.state @@ -7836,7 +7950,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[61].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[61].Exporter = func(v any, i int) any { switch v := v.(*VolumeEcShardsUnmountResponse); i { case 0: return &v.state @@ -7848,7 +7962,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[62].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[62].Exporter = func(v any, i int) any { switch v := v.(*VolumeEcShardReadRequest); i { case 0: return &v.state @@ -7860,7 +7974,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[63].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[63].Exporter = func(v any, i int) any { switch v := v.(*VolumeEcShardReadResponse); i { case 0: return &v.state @@ -7872,7 +7986,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[64].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[64].Exporter = func(v any, i int) any { switch v := v.(*VolumeEcBlobDeleteRequest); i { case 0: return &v.state @@ -7884,7 +7998,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[65].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[65].Exporter = func(v any, i int) any { switch v := v.(*VolumeEcBlobDeleteResponse); i { case 0: return &v.state @@ -7896,7 +8010,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[66].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[66].Exporter = func(v any, i int) any { switch v := v.(*VolumeEcShardsToVolumeRequest); i { case 0: return &v.state @@ -7908,7 +8022,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[67].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[67].Exporter = func(v any, i int) any { switch v := v.(*VolumeEcShardsToVolumeResponse); i { case 0: return &v.state @@ -7920,7 +8034,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[68].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[68].Exporter = func(v any, i int) any { switch v := v.(*ReadVolumeFileStatusRequest); i { case 0: return &v.state @@ -7932,7 +8046,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[69].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[69].Exporter = func(v any, i int) any { switch v := v.(*ReadVolumeFileStatusResponse); i { case 0: return &v.state @@ -7944,7 +8058,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[70].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[70].Exporter = func(v any, i int) any { switch v := v.(*DiskStatus); i { case 0: return &v.state @@ -7956,7 +8070,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[71].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[71].Exporter = func(v any, i int) any { switch v := v.(*MemStatus); i { case 0: return &v.state @@ -7968,7 +8082,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[72].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[72].Exporter = func(v any, i int) any { switch v := v.(*RemoteFile); i { case 0: return &v.state @@ -7980,7 +8094,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[73].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[73].Exporter = func(v any, i int) any { switch v := v.(*VolumeInfo); i { case 0: return &v.state @@ -7992,7 +8106,19 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[74].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[74].Exporter = func(v any, i int) any { + switch v := v.(*OldVersionVolumeInfo); i { + case 0: + return &v.state + case 1: + return &v.sizeCache + case 2: + return &v.unknownFields + default: + return nil + } + } + file_volume_server_proto_msgTypes[75].Exporter = func(v any, i int) any { switch v := v.(*VolumeTierMoveDatToRemoteRequest); i { case 0: return &v.state @@ -8004,7 +8130,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[75].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[76].Exporter = func(v any, i int) any { switch v := v.(*VolumeTierMoveDatToRemoteResponse); i { case 0: return &v.state @@ -8016,7 +8142,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[76].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[77].Exporter = func(v any, i int) any { switch v := v.(*VolumeTierMoveDatFromRemoteRequest); i { case 0: return &v.state @@ -8028,7 +8154,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[77].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[78].Exporter = func(v any, i int) any { switch v := v.(*VolumeTierMoveDatFromRemoteResponse); i { case 0: return &v.state @@ -8040,7 +8166,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[78].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[79].Exporter = func(v any, i int) any { switch v := v.(*VolumeServerStatusRequest); i { case 0: return &v.state @@ -8052,7 +8178,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[79].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[80].Exporter = func(v any, i int) any { switch v := v.(*VolumeServerStatusResponse); i { case 0: return &v.state @@ -8064,7 +8190,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[80].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[81].Exporter = func(v any, i int) any { switch v := v.(*VolumeServerLeaveRequest); i { case 0: return &v.state @@ -8076,7 +8202,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[81].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[82].Exporter = func(v any, i int) any { switch v := v.(*VolumeServerLeaveResponse); i { case 0: return &v.state @@ -8088,7 +8214,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[82].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[83].Exporter = func(v any, i int) any { switch v := v.(*FetchAndWriteNeedleRequest); i { case 0: return &v.state @@ -8100,7 +8226,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[83].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[84].Exporter = func(v any, i int) any { switch v := v.(*FetchAndWriteNeedleResponse); i { case 0: return &v.state @@ -8112,7 +8238,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[84].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[85].Exporter = func(v any, i int) any { switch v := v.(*QueryRequest); i { case 0: return &v.state @@ -8124,7 +8250,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[85].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[86].Exporter = func(v any, i int) any { switch v := v.(*QueriedStripe); i { case 0: return &v.state @@ -8136,7 +8262,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[86].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[87].Exporter = func(v any, i int) any { switch v := v.(*VolumeNeedleStatusRequest); i { case 0: return &v.state @@ -8148,7 +8274,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[87].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[88].Exporter = func(v any, i int) any { switch v := v.(*VolumeNeedleStatusResponse); i { case 0: return &v.state @@ -8160,7 +8286,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[88].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[89].Exporter = func(v any, i int) any { switch v := v.(*PingRequest); i { case 0: return &v.state @@ -8172,7 +8298,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[89].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[90].Exporter = func(v any, i int) any { switch v := v.(*PingResponse); i { case 0: return &v.state @@ -8184,7 +8310,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[90].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[91].Exporter = func(v any, i int) any { switch v := v.(*FetchAndWriteNeedleRequest_Replica); i { case 0: return &v.state @@ -8196,7 +8322,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[91].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[92].Exporter = func(v any, i int) any { switch v := v.(*QueryRequest_Filter); i { case 0: return &v.state @@ -8208,7 +8334,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[92].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[93].Exporter = func(v any, i int) any { switch v := v.(*QueryRequest_InputSerialization); i { case 0: return &v.state @@ -8220,7 +8346,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[93].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[94].Exporter = func(v any, i int) any { switch v := v.(*QueryRequest_OutputSerialization); i { case 0: return &v.state @@ -8232,7 +8358,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[94].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[95].Exporter = func(v any, i int) any { switch v := v.(*QueryRequest_InputSerialization_CSVInput); i { case 0: return &v.state @@ -8244,7 +8370,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[95].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[96].Exporter = func(v any, i int) any { switch v := v.(*QueryRequest_InputSerialization_JSONInput); i { case 0: return &v.state @@ -8256,7 +8382,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[96].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[97].Exporter = func(v any, i int) any { switch v := v.(*QueryRequest_InputSerialization_ParquetInput); i { case 0: return &v.state @@ -8268,7 +8394,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[97].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[98].Exporter = func(v any, i int) any { switch v := v.(*QueryRequest_OutputSerialization_CSVOutput); i { case 0: return &v.state @@ -8280,7 +8406,7 @@ func file_volume_server_proto_init() { return nil } } - file_volume_server_proto_msgTypes[98].Exporter = func(v interface{}, i int) interface{} { + file_volume_server_proto_msgTypes[99].Exporter = func(v any, i int) any { switch v := v.(*QueryRequest_OutputSerialization_JSONOutput); i { case 0: return &v.state @@ -8299,7 +8425,7 @@ func file_volume_server_proto_init() { GoPackagePath: reflect.TypeOf(x{}).PkgPath(), RawDescriptor: file_volume_server_proto_rawDesc, NumEnums: 0, - NumMessages: 99, + NumMessages: 100, NumExtensions: 0, NumServices: 1, }, diff --git a/weed/pb/volume_server_pb/volume_server_grpc.pb.go b/weed/pb/volume_server_pb/volume_server_grpc.pb.go index b62573dc4..2cbb45491 100644 --- a/weed/pb/volume_server_pb/volume_server_grpc.pb.go +++ b/weed/pb/volume_server_pb/volume_server_grpc.pb.go @@ -1,7 +1,7 @@ // Code generated by protoc-gen-go-grpc. DO NOT EDIT. // versions: -// - protoc-gen-go-grpc v1.3.0 -// - protoc v4.25.3 +// - protoc-gen-go-grpc v1.5.1 +// - protoc v5.28.1 // source: volume_server.proto package volume_server_pb @@ -15,8 +15,8 @@ import ( // This is a compile-time assertion to ensure that this generated file // is compatible with the grpc package it is being compiled against. -// Requires gRPC-Go v1.32.0 or later. -const _ = grpc.SupportPackageIsVersion7 +// Requires gRPC-Go v1.64.0 or later. +const _ = grpc.SupportPackageIsVersion9 const ( VolumeServer_BatchDelete_FullMethodName = "/volume_server_pb.VolumeServer/BatchDelete" @@ -67,16 +67,16 @@ const ( // // For semantics around ctx use and closing/ending streaming RPCs, please refer to https://pkg.go.dev/google.golang.org/grpc/?tab=doc#ClientConn.NewStream. type VolumeServerClient interface { - //Experts only: takes multiple fid parameters. This function does not propagate deletes to replicas. + // Experts only: takes multiple fid parameters. This function does not propagate deletes to replicas. BatchDelete(ctx context.Context, in *BatchDeleteRequest, opts ...grpc.CallOption) (*BatchDeleteResponse, error) VacuumVolumeCheck(ctx context.Context, in *VacuumVolumeCheckRequest, opts ...grpc.CallOption) (*VacuumVolumeCheckResponse, error) - VacuumVolumeCompact(ctx context.Context, in *VacuumVolumeCompactRequest, opts ...grpc.CallOption) (VolumeServer_VacuumVolumeCompactClient, error) + VacuumVolumeCompact(ctx context.Context, in *VacuumVolumeCompactRequest, opts ...grpc.CallOption) (grpc.ServerStreamingClient[VacuumVolumeCompactResponse], error) VacuumVolumeCommit(ctx context.Context, in *VacuumVolumeCommitRequest, opts ...grpc.CallOption) (*VacuumVolumeCommitResponse, error) VacuumVolumeCleanup(ctx context.Context, in *VacuumVolumeCleanupRequest, opts ...grpc.CallOption) (*VacuumVolumeCleanupResponse, error) DeleteCollection(ctx context.Context, in *DeleteCollectionRequest, opts ...grpc.CallOption) (*DeleteCollectionResponse, error) AllocateVolume(ctx context.Context, in *AllocateVolumeRequest, opts ...grpc.CallOption) (*AllocateVolumeResponse, error) VolumeSyncStatus(ctx context.Context, in *VolumeSyncStatusRequest, opts ...grpc.CallOption) (*VolumeSyncStatusResponse, error) - VolumeIncrementalCopy(ctx context.Context, in *VolumeIncrementalCopyRequest, opts ...grpc.CallOption) (VolumeServer_VolumeIncrementalCopyClient, error) + VolumeIncrementalCopy(ctx context.Context, in *VolumeIncrementalCopyRequest, opts ...grpc.CallOption) (grpc.ServerStreamingClient[VolumeIncrementalCopyResponse], error) VolumeMount(ctx context.Context, in *VolumeMountRequest, opts ...grpc.CallOption) (*VolumeMountResponse, error) VolumeUnmount(ctx context.Context, in *VolumeUnmountRequest, opts ...grpc.CallOption) (*VolumeUnmountResponse, error) VolumeDelete(ctx context.Context, in *VolumeDeleteRequest, opts ...grpc.CallOption) (*VolumeDeleteResponse, error) @@ -85,14 +85,14 @@ type VolumeServerClient interface { VolumeConfigure(ctx context.Context, in *VolumeConfigureRequest, opts ...grpc.CallOption) (*VolumeConfigureResponse, error) VolumeStatus(ctx context.Context, in *VolumeStatusRequest, opts ...grpc.CallOption) (*VolumeStatusResponse, error) // copy the .idx .dat files, and mount this volume - VolumeCopy(ctx context.Context, in *VolumeCopyRequest, opts ...grpc.CallOption) (VolumeServer_VolumeCopyClient, error) + VolumeCopy(ctx context.Context, in *VolumeCopyRequest, opts ...grpc.CallOption) (grpc.ServerStreamingClient[VolumeCopyResponse], error) ReadVolumeFileStatus(ctx context.Context, in *ReadVolumeFileStatusRequest, opts ...grpc.CallOption) (*ReadVolumeFileStatusResponse, error) - CopyFile(ctx context.Context, in *CopyFileRequest, opts ...grpc.CallOption) (VolumeServer_CopyFileClient, error) + CopyFile(ctx context.Context, in *CopyFileRequest, opts ...grpc.CallOption) (grpc.ServerStreamingClient[CopyFileResponse], error) ReadNeedleBlob(ctx context.Context, in *ReadNeedleBlobRequest, opts ...grpc.CallOption) (*ReadNeedleBlobResponse, error) ReadNeedleMeta(ctx context.Context, in *ReadNeedleMetaRequest, opts ...grpc.CallOption) (*ReadNeedleMetaResponse, error) WriteNeedleBlob(ctx context.Context, in *WriteNeedleBlobRequest, opts ...grpc.CallOption) (*WriteNeedleBlobResponse, error) - ReadAllNeedles(ctx context.Context, in *ReadAllNeedlesRequest, opts ...grpc.CallOption) (VolumeServer_ReadAllNeedlesClient, error) - VolumeTailSender(ctx context.Context, in *VolumeTailSenderRequest, opts ...grpc.CallOption) (VolumeServer_VolumeTailSenderClient, error) + ReadAllNeedles(ctx context.Context, in *ReadAllNeedlesRequest, opts ...grpc.CallOption) (grpc.ServerStreamingClient[ReadAllNeedlesResponse], error) + VolumeTailSender(ctx context.Context, in *VolumeTailSenderRequest, opts ...grpc.CallOption) (grpc.ServerStreamingClient[VolumeTailSenderResponse], error) VolumeTailReceiver(ctx context.Context, in *VolumeTailReceiverRequest, opts ...grpc.CallOption) (*VolumeTailReceiverResponse, error) // erasure coding VolumeEcShardsGenerate(ctx context.Context, in *VolumeEcShardsGenerateRequest, opts ...grpc.CallOption) (*VolumeEcShardsGenerateResponse, error) @@ -101,18 +101,18 @@ type VolumeServerClient interface { VolumeEcShardsDelete(ctx context.Context, in *VolumeEcShardsDeleteRequest, opts ...grpc.CallOption) (*VolumeEcShardsDeleteResponse, error) VolumeEcShardsMount(ctx context.Context, in *VolumeEcShardsMountRequest, opts ...grpc.CallOption) (*VolumeEcShardsMountResponse, error) VolumeEcShardsUnmount(ctx context.Context, in *VolumeEcShardsUnmountRequest, opts ...grpc.CallOption) (*VolumeEcShardsUnmountResponse, error) - VolumeEcShardRead(ctx context.Context, in *VolumeEcShardReadRequest, opts ...grpc.CallOption) (VolumeServer_VolumeEcShardReadClient, error) + VolumeEcShardRead(ctx context.Context, in *VolumeEcShardReadRequest, opts ...grpc.CallOption) (grpc.ServerStreamingClient[VolumeEcShardReadResponse], error) VolumeEcBlobDelete(ctx context.Context, in *VolumeEcBlobDeleteRequest, opts ...grpc.CallOption) (*VolumeEcBlobDeleteResponse, error) VolumeEcShardsToVolume(ctx context.Context, in *VolumeEcShardsToVolumeRequest, opts ...grpc.CallOption) (*VolumeEcShardsToVolumeResponse, error) // tiered storage - VolumeTierMoveDatToRemote(ctx context.Context, in *VolumeTierMoveDatToRemoteRequest, opts ...grpc.CallOption) (VolumeServer_VolumeTierMoveDatToRemoteClient, error) - VolumeTierMoveDatFromRemote(ctx context.Context, in *VolumeTierMoveDatFromRemoteRequest, opts ...grpc.CallOption) (VolumeServer_VolumeTierMoveDatFromRemoteClient, error) + VolumeTierMoveDatToRemote(ctx context.Context, in *VolumeTierMoveDatToRemoteRequest, opts ...grpc.CallOption) (grpc.ServerStreamingClient[VolumeTierMoveDatToRemoteResponse], error) + VolumeTierMoveDatFromRemote(ctx context.Context, in *VolumeTierMoveDatFromRemoteRequest, opts ...grpc.CallOption) (grpc.ServerStreamingClient[VolumeTierMoveDatFromRemoteResponse], error) VolumeServerStatus(ctx context.Context, in *VolumeServerStatusRequest, opts ...grpc.CallOption) (*VolumeServerStatusResponse, error) VolumeServerLeave(ctx context.Context, in *VolumeServerLeaveRequest, opts ...grpc.CallOption) (*VolumeServerLeaveResponse, error) // remote storage FetchAndWriteNeedle(ctx context.Context, in *FetchAndWriteNeedleRequest, opts ...grpc.CallOption) (*FetchAndWriteNeedleResponse, error) // query - Query(ctx context.Context, in *QueryRequest, opts ...grpc.CallOption) (VolumeServer_QueryClient, error) + Query(ctx context.Context, in *QueryRequest, opts ...grpc.CallOption) (grpc.ServerStreamingClient[QueriedStripe], error) VolumeNeedleStatus(ctx context.Context, in *VolumeNeedleStatusRequest, opts ...grpc.CallOption) (*VolumeNeedleStatusResponse, error) Ping(ctx context.Context, in *PingRequest, opts ...grpc.CallOption) (*PingResponse, error) } @@ -126,8 +126,9 @@ func NewVolumeServerClient(cc grpc.ClientConnInterface) VolumeServerClient { } func (c *volumeServerClient) BatchDelete(ctx context.Context, in *BatchDeleteRequest, opts ...grpc.CallOption) (*BatchDeleteResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(BatchDeleteResponse) - err := c.cc.Invoke(ctx, VolumeServer_BatchDelete_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, VolumeServer_BatchDelete_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -135,20 +136,22 @@ func (c *volumeServerClient) BatchDelete(ctx context.Context, in *BatchDeleteReq } func (c *volumeServerClient) VacuumVolumeCheck(ctx context.Context, in *VacuumVolumeCheckRequest, opts ...grpc.CallOption) (*VacuumVolumeCheckResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(VacuumVolumeCheckResponse) - err := c.cc.Invoke(ctx, VolumeServer_VacuumVolumeCheck_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, VolumeServer_VacuumVolumeCheck_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } return out, nil } -func (c *volumeServerClient) VacuumVolumeCompact(ctx context.Context, in *VacuumVolumeCompactRequest, opts ...grpc.CallOption) (VolumeServer_VacuumVolumeCompactClient, error) { - stream, err := c.cc.NewStream(ctx, &VolumeServer_ServiceDesc.Streams[0], VolumeServer_VacuumVolumeCompact_FullMethodName, opts...) +func (c *volumeServerClient) VacuumVolumeCompact(ctx context.Context, in *VacuumVolumeCompactRequest, opts ...grpc.CallOption) (grpc.ServerStreamingClient[VacuumVolumeCompactResponse], error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) + stream, err := c.cc.NewStream(ctx, &VolumeServer_ServiceDesc.Streams[0], VolumeServer_VacuumVolumeCompact_FullMethodName, cOpts...) if err != nil { return nil, err } - x := &volumeServerVacuumVolumeCompactClient{stream} + x := &grpc.GenericClientStream[VacuumVolumeCompactRequest, VacuumVolumeCompactResponse]{ClientStream: stream} if err := x.ClientStream.SendMsg(in); err != nil { return nil, err } @@ -158,26 +161,13 @@ func (c *volumeServerClient) VacuumVolumeCompact(ctx context.Context, in *Vacuum return x, nil } -type VolumeServer_VacuumVolumeCompactClient interface { - Recv() (*VacuumVolumeCompactResponse, error) - grpc.ClientStream -} - -type volumeServerVacuumVolumeCompactClient struct { - grpc.ClientStream -} - -func (x *volumeServerVacuumVolumeCompactClient) Recv() (*VacuumVolumeCompactResponse, error) { - m := new(VacuumVolumeCompactResponse) - if err := x.ClientStream.RecvMsg(m); err != nil { - return nil, err - } - return m, nil -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type VolumeServer_VacuumVolumeCompactClient = grpc.ServerStreamingClient[VacuumVolumeCompactResponse] func (c *volumeServerClient) VacuumVolumeCommit(ctx context.Context, in *VacuumVolumeCommitRequest, opts ...grpc.CallOption) (*VacuumVolumeCommitResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(VacuumVolumeCommitResponse) - err := c.cc.Invoke(ctx, VolumeServer_VacuumVolumeCommit_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, VolumeServer_VacuumVolumeCommit_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -185,8 +175,9 @@ func (c *volumeServerClient) VacuumVolumeCommit(ctx context.Context, in *VacuumV } func (c *volumeServerClient) VacuumVolumeCleanup(ctx context.Context, in *VacuumVolumeCleanupRequest, opts ...grpc.CallOption) (*VacuumVolumeCleanupResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(VacuumVolumeCleanupResponse) - err := c.cc.Invoke(ctx, VolumeServer_VacuumVolumeCleanup_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, VolumeServer_VacuumVolumeCleanup_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -194,8 +185,9 @@ func (c *volumeServerClient) VacuumVolumeCleanup(ctx context.Context, in *Vacuum } func (c *volumeServerClient) DeleteCollection(ctx context.Context, in *DeleteCollectionRequest, opts ...grpc.CallOption) (*DeleteCollectionResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(DeleteCollectionResponse) - err := c.cc.Invoke(ctx, VolumeServer_DeleteCollection_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, VolumeServer_DeleteCollection_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -203,8 +195,9 @@ func (c *volumeServerClient) DeleteCollection(ctx context.Context, in *DeleteCol } func (c *volumeServerClient) AllocateVolume(ctx context.Context, in *AllocateVolumeRequest, opts ...grpc.CallOption) (*AllocateVolumeResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(AllocateVolumeResponse) - err := c.cc.Invoke(ctx, VolumeServer_AllocateVolume_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, VolumeServer_AllocateVolume_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -212,20 +205,22 @@ func (c *volumeServerClient) AllocateVolume(ctx context.Context, in *AllocateVol } func (c *volumeServerClient) VolumeSyncStatus(ctx context.Context, in *VolumeSyncStatusRequest, opts ...grpc.CallOption) (*VolumeSyncStatusResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(VolumeSyncStatusResponse) - err := c.cc.Invoke(ctx, VolumeServer_VolumeSyncStatus_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, VolumeServer_VolumeSyncStatus_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } return out, nil } -func (c *volumeServerClient) VolumeIncrementalCopy(ctx context.Context, in *VolumeIncrementalCopyRequest, opts ...grpc.CallOption) (VolumeServer_VolumeIncrementalCopyClient, error) { - stream, err := c.cc.NewStream(ctx, &VolumeServer_ServiceDesc.Streams[1], VolumeServer_VolumeIncrementalCopy_FullMethodName, opts...) +func (c *volumeServerClient) VolumeIncrementalCopy(ctx context.Context, in *VolumeIncrementalCopyRequest, opts ...grpc.CallOption) (grpc.ServerStreamingClient[VolumeIncrementalCopyResponse], error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) + stream, err := c.cc.NewStream(ctx, &VolumeServer_ServiceDesc.Streams[1], VolumeServer_VolumeIncrementalCopy_FullMethodName, cOpts...) if err != nil { return nil, err } - x := &volumeServerVolumeIncrementalCopyClient{stream} + x := &grpc.GenericClientStream[VolumeIncrementalCopyRequest, VolumeIncrementalCopyResponse]{ClientStream: stream} if err := x.ClientStream.SendMsg(in); err != nil { return nil, err } @@ -235,26 +230,13 @@ func (c *volumeServerClient) VolumeIncrementalCopy(ctx context.Context, in *Volu return x, nil } -type VolumeServer_VolumeIncrementalCopyClient interface { - Recv() (*VolumeIncrementalCopyResponse, error) - grpc.ClientStream -} - -type volumeServerVolumeIncrementalCopyClient struct { - grpc.ClientStream -} - -func (x *volumeServerVolumeIncrementalCopyClient) Recv() (*VolumeIncrementalCopyResponse, error) { - m := new(VolumeIncrementalCopyResponse) - if err := x.ClientStream.RecvMsg(m); err != nil { - return nil, err - } - return m, nil -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type VolumeServer_VolumeIncrementalCopyClient = grpc.ServerStreamingClient[VolumeIncrementalCopyResponse] func (c *volumeServerClient) VolumeMount(ctx context.Context, in *VolumeMountRequest, opts ...grpc.CallOption) (*VolumeMountResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(VolumeMountResponse) - err := c.cc.Invoke(ctx, VolumeServer_VolumeMount_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, VolumeServer_VolumeMount_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -262,8 +244,9 @@ func (c *volumeServerClient) VolumeMount(ctx context.Context, in *VolumeMountReq } func (c *volumeServerClient) VolumeUnmount(ctx context.Context, in *VolumeUnmountRequest, opts ...grpc.CallOption) (*VolumeUnmountResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(VolumeUnmountResponse) - err := c.cc.Invoke(ctx, VolumeServer_VolumeUnmount_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, VolumeServer_VolumeUnmount_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -271,8 +254,9 @@ func (c *volumeServerClient) VolumeUnmount(ctx context.Context, in *VolumeUnmoun } func (c *volumeServerClient) VolumeDelete(ctx context.Context, in *VolumeDeleteRequest, opts ...grpc.CallOption) (*VolumeDeleteResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(VolumeDeleteResponse) - err := c.cc.Invoke(ctx, VolumeServer_VolumeDelete_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, VolumeServer_VolumeDelete_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -280,8 +264,9 @@ func (c *volumeServerClient) VolumeDelete(ctx context.Context, in *VolumeDeleteR } func (c *volumeServerClient) VolumeMarkReadonly(ctx context.Context, in *VolumeMarkReadonlyRequest, opts ...grpc.CallOption) (*VolumeMarkReadonlyResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(VolumeMarkReadonlyResponse) - err := c.cc.Invoke(ctx, VolumeServer_VolumeMarkReadonly_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, VolumeServer_VolumeMarkReadonly_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -289,8 +274,9 @@ func (c *volumeServerClient) VolumeMarkReadonly(ctx context.Context, in *VolumeM } func (c *volumeServerClient) VolumeMarkWritable(ctx context.Context, in *VolumeMarkWritableRequest, opts ...grpc.CallOption) (*VolumeMarkWritableResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(VolumeMarkWritableResponse) - err := c.cc.Invoke(ctx, VolumeServer_VolumeMarkWritable_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, VolumeServer_VolumeMarkWritable_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -298,8 +284,9 @@ func (c *volumeServerClient) VolumeMarkWritable(ctx context.Context, in *VolumeM } func (c *volumeServerClient) VolumeConfigure(ctx context.Context, in *VolumeConfigureRequest, opts ...grpc.CallOption) (*VolumeConfigureResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(VolumeConfigureResponse) - err := c.cc.Invoke(ctx, VolumeServer_VolumeConfigure_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, VolumeServer_VolumeConfigure_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -307,20 +294,22 @@ func (c *volumeServerClient) VolumeConfigure(ctx context.Context, in *VolumeConf } func (c *volumeServerClient) VolumeStatus(ctx context.Context, in *VolumeStatusRequest, opts ...grpc.CallOption) (*VolumeStatusResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(VolumeStatusResponse) - err := c.cc.Invoke(ctx, VolumeServer_VolumeStatus_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, VolumeServer_VolumeStatus_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } return out, nil } -func (c *volumeServerClient) VolumeCopy(ctx context.Context, in *VolumeCopyRequest, opts ...grpc.CallOption) (VolumeServer_VolumeCopyClient, error) { - stream, err := c.cc.NewStream(ctx, &VolumeServer_ServiceDesc.Streams[2], VolumeServer_VolumeCopy_FullMethodName, opts...) +func (c *volumeServerClient) VolumeCopy(ctx context.Context, in *VolumeCopyRequest, opts ...grpc.CallOption) (grpc.ServerStreamingClient[VolumeCopyResponse], error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) + stream, err := c.cc.NewStream(ctx, &VolumeServer_ServiceDesc.Streams[2], VolumeServer_VolumeCopy_FullMethodName, cOpts...) if err != nil { return nil, err } - x := &volumeServerVolumeCopyClient{stream} + x := &grpc.GenericClientStream[VolumeCopyRequest, VolumeCopyResponse]{ClientStream: stream} if err := x.ClientStream.SendMsg(in); err != nil { return nil, err } @@ -330,38 +319,26 @@ func (c *volumeServerClient) VolumeCopy(ctx context.Context, in *VolumeCopyReque return x, nil } -type VolumeServer_VolumeCopyClient interface { - Recv() (*VolumeCopyResponse, error) - grpc.ClientStream -} - -type volumeServerVolumeCopyClient struct { - grpc.ClientStream -} - -func (x *volumeServerVolumeCopyClient) Recv() (*VolumeCopyResponse, error) { - m := new(VolumeCopyResponse) - if err := x.ClientStream.RecvMsg(m); err != nil { - return nil, err - } - return m, nil -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type VolumeServer_VolumeCopyClient = grpc.ServerStreamingClient[VolumeCopyResponse] func (c *volumeServerClient) ReadVolumeFileStatus(ctx context.Context, in *ReadVolumeFileStatusRequest, opts ...grpc.CallOption) (*ReadVolumeFileStatusResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(ReadVolumeFileStatusResponse) - err := c.cc.Invoke(ctx, VolumeServer_ReadVolumeFileStatus_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, VolumeServer_ReadVolumeFileStatus_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } return out, nil } -func (c *volumeServerClient) CopyFile(ctx context.Context, in *CopyFileRequest, opts ...grpc.CallOption) (VolumeServer_CopyFileClient, error) { - stream, err := c.cc.NewStream(ctx, &VolumeServer_ServiceDesc.Streams[3], VolumeServer_CopyFile_FullMethodName, opts...) +func (c *volumeServerClient) CopyFile(ctx context.Context, in *CopyFileRequest, opts ...grpc.CallOption) (grpc.ServerStreamingClient[CopyFileResponse], error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) + stream, err := c.cc.NewStream(ctx, &VolumeServer_ServiceDesc.Streams[3], VolumeServer_CopyFile_FullMethodName, cOpts...) if err != nil { return nil, err } - x := &volumeServerCopyFileClient{stream} + x := &grpc.GenericClientStream[CopyFileRequest, CopyFileResponse]{ClientStream: stream} if err := x.ClientStream.SendMsg(in); err != nil { return nil, err } @@ -371,26 +348,13 @@ func (c *volumeServerClient) CopyFile(ctx context.Context, in *CopyFileRequest, return x, nil } -type VolumeServer_CopyFileClient interface { - Recv() (*CopyFileResponse, error) - grpc.ClientStream -} - -type volumeServerCopyFileClient struct { - grpc.ClientStream -} - -func (x *volumeServerCopyFileClient) Recv() (*CopyFileResponse, error) { - m := new(CopyFileResponse) - if err := x.ClientStream.RecvMsg(m); err != nil { - return nil, err - } - return m, nil -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type VolumeServer_CopyFileClient = grpc.ServerStreamingClient[CopyFileResponse] func (c *volumeServerClient) ReadNeedleBlob(ctx context.Context, in *ReadNeedleBlobRequest, opts ...grpc.CallOption) (*ReadNeedleBlobResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(ReadNeedleBlobResponse) - err := c.cc.Invoke(ctx, VolumeServer_ReadNeedleBlob_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, VolumeServer_ReadNeedleBlob_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -398,8 +362,9 @@ func (c *volumeServerClient) ReadNeedleBlob(ctx context.Context, in *ReadNeedleB } func (c *volumeServerClient) ReadNeedleMeta(ctx context.Context, in *ReadNeedleMetaRequest, opts ...grpc.CallOption) (*ReadNeedleMetaResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(ReadNeedleMetaResponse) - err := c.cc.Invoke(ctx, VolumeServer_ReadNeedleMeta_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, VolumeServer_ReadNeedleMeta_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -407,20 +372,22 @@ func (c *volumeServerClient) ReadNeedleMeta(ctx context.Context, in *ReadNeedleM } func (c *volumeServerClient) WriteNeedleBlob(ctx context.Context, in *WriteNeedleBlobRequest, opts ...grpc.CallOption) (*WriteNeedleBlobResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(WriteNeedleBlobResponse) - err := c.cc.Invoke(ctx, VolumeServer_WriteNeedleBlob_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, VolumeServer_WriteNeedleBlob_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } return out, nil } -func (c *volumeServerClient) ReadAllNeedles(ctx context.Context, in *ReadAllNeedlesRequest, opts ...grpc.CallOption) (VolumeServer_ReadAllNeedlesClient, error) { - stream, err := c.cc.NewStream(ctx, &VolumeServer_ServiceDesc.Streams[4], VolumeServer_ReadAllNeedles_FullMethodName, opts...) +func (c *volumeServerClient) ReadAllNeedles(ctx context.Context, in *ReadAllNeedlesRequest, opts ...grpc.CallOption) (grpc.ServerStreamingClient[ReadAllNeedlesResponse], error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) + stream, err := c.cc.NewStream(ctx, &VolumeServer_ServiceDesc.Streams[4], VolumeServer_ReadAllNeedles_FullMethodName, cOpts...) if err != nil { return nil, err } - x := &volumeServerReadAllNeedlesClient{stream} + x := &grpc.GenericClientStream[ReadAllNeedlesRequest, ReadAllNeedlesResponse]{ClientStream: stream} if err := x.ClientStream.SendMsg(in); err != nil { return nil, err } @@ -430,29 +397,16 @@ func (c *volumeServerClient) ReadAllNeedles(ctx context.Context, in *ReadAllNeed return x, nil } -type VolumeServer_ReadAllNeedlesClient interface { - Recv() (*ReadAllNeedlesResponse, error) - grpc.ClientStream -} - -type volumeServerReadAllNeedlesClient struct { - grpc.ClientStream -} - -func (x *volumeServerReadAllNeedlesClient) Recv() (*ReadAllNeedlesResponse, error) { - m := new(ReadAllNeedlesResponse) - if err := x.ClientStream.RecvMsg(m); err != nil { - return nil, err - } - return m, nil -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type VolumeServer_ReadAllNeedlesClient = grpc.ServerStreamingClient[ReadAllNeedlesResponse] -func (c *volumeServerClient) VolumeTailSender(ctx context.Context, in *VolumeTailSenderRequest, opts ...grpc.CallOption) (VolumeServer_VolumeTailSenderClient, error) { - stream, err := c.cc.NewStream(ctx, &VolumeServer_ServiceDesc.Streams[5], VolumeServer_VolumeTailSender_FullMethodName, opts...) +func (c *volumeServerClient) VolumeTailSender(ctx context.Context, in *VolumeTailSenderRequest, opts ...grpc.CallOption) (grpc.ServerStreamingClient[VolumeTailSenderResponse], error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) + stream, err := c.cc.NewStream(ctx, &VolumeServer_ServiceDesc.Streams[5], VolumeServer_VolumeTailSender_FullMethodName, cOpts...) if err != nil { return nil, err } - x := &volumeServerVolumeTailSenderClient{stream} + x := &grpc.GenericClientStream[VolumeTailSenderRequest, VolumeTailSenderResponse]{ClientStream: stream} if err := x.ClientStream.SendMsg(in); err != nil { return nil, err } @@ -462,26 +416,13 @@ func (c *volumeServerClient) VolumeTailSender(ctx context.Context, in *VolumeTai return x, nil } -type VolumeServer_VolumeTailSenderClient interface { - Recv() (*VolumeTailSenderResponse, error) - grpc.ClientStream -} - -type volumeServerVolumeTailSenderClient struct { - grpc.ClientStream -} - -func (x *volumeServerVolumeTailSenderClient) Recv() (*VolumeTailSenderResponse, error) { - m := new(VolumeTailSenderResponse) - if err := x.ClientStream.RecvMsg(m); err != nil { - return nil, err - } - return m, nil -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type VolumeServer_VolumeTailSenderClient = grpc.ServerStreamingClient[VolumeTailSenderResponse] func (c *volumeServerClient) VolumeTailReceiver(ctx context.Context, in *VolumeTailReceiverRequest, opts ...grpc.CallOption) (*VolumeTailReceiverResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(VolumeTailReceiverResponse) - err := c.cc.Invoke(ctx, VolumeServer_VolumeTailReceiver_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, VolumeServer_VolumeTailReceiver_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -489,8 +430,9 @@ func (c *volumeServerClient) VolumeTailReceiver(ctx context.Context, in *VolumeT } func (c *volumeServerClient) VolumeEcShardsGenerate(ctx context.Context, in *VolumeEcShardsGenerateRequest, opts ...grpc.CallOption) (*VolumeEcShardsGenerateResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(VolumeEcShardsGenerateResponse) - err := c.cc.Invoke(ctx, VolumeServer_VolumeEcShardsGenerate_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, VolumeServer_VolumeEcShardsGenerate_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -498,8 +440,9 @@ func (c *volumeServerClient) VolumeEcShardsGenerate(ctx context.Context, in *Vol } func (c *volumeServerClient) VolumeEcShardsRebuild(ctx context.Context, in *VolumeEcShardsRebuildRequest, opts ...grpc.CallOption) (*VolumeEcShardsRebuildResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(VolumeEcShardsRebuildResponse) - err := c.cc.Invoke(ctx, VolumeServer_VolumeEcShardsRebuild_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, VolumeServer_VolumeEcShardsRebuild_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -507,8 +450,9 @@ func (c *volumeServerClient) VolumeEcShardsRebuild(ctx context.Context, in *Volu } func (c *volumeServerClient) VolumeEcShardsCopy(ctx context.Context, in *VolumeEcShardsCopyRequest, opts ...grpc.CallOption) (*VolumeEcShardsCopyResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(VolumeEcShardsCopyResponse) - err := c.cc.Invoke(ctx, VolumeServer_VolumeEcShardsCopy_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, VolumeServer_VolumeEcShardsCopy_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -516,8 +460,9 @@ func (c *volumeServerClient) VolumeEcShardsCopy(ctx context.Context, in *VolumeE } func (c *volumeServerClient) VolumeEcShardsDelete(ctx context.Context, in *VolumeEcShardsDeleteRequest, opts ...grpc.CallOption) (*VolumeEcShardsDeleteResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(VolumeEcShardsDeleteResponse) - err := c.cc.Invoke(ctx, VolumeServer_VolumeEcShardsDelete_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, VolumeServer_VolumeEcShardsDelete_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -525,8 +470,9 @@ func (c *volumeServerClient) VolumeEcShardsDelete(ctx context.Context, in *Volum } func (c *volumeServerClient) VolumeEcShardsMount(ctx context.Context, in *VolumeEcShardsMountRequest, opts ...grpc.CallOption) (*VolumeEcShardsMountResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(VolumeEcShardsMountResponse) - err := c.cc.Invoke(ctx, VolumeServer_VolumeEcShardsMount_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, VolumeServer_VolumeEcShardsMount_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -534,20 +480,22 @@ func (c *volumeServerClient) VolumeEcShardsMount(ctx context.Context, in *Volume } func (c *volumeServerClient) VolumeEcShardsUnmount(ctx context.Context, in *VolumeEcShardsUnmountRequest, opts ...grpc.CallOption) (*VolumeEcShardsUnmountResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(VolumeEcShardsUnmountResponse) - err := c.cc.Invoke(ctx, VolumeServer_VolumeEcShardsUnmount_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, VolumeServer_VolumeEcShardsUnmount_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } return out, nil } -func (c *volumeServerClient) VolumeEcShardRead(ctx context.Context, in *VolumeEcShardReadRequest, opts ...grpc.CallOption) (VolumeServer_VolumeEcShardReadClient, error) { - stream, err := c.cc.NewStream(ctx, &VolumeServer_ServiceDesc.Streams[6], VolumeServer_VolumeEcShardRead_FullMethodName, opts...) +func (c *volumeServerClient) VolumeEcShardRead(ctx context.Context, in *VolumeEcShardReadRequest, opts ...grpc.CallOption) (grpc.ServerStreamingClient[VolumeEcShardReadResponse], error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) + stream, err := c.cc.NewStream(ctx, &VolumeServer_ServiceDesc.Streams[6], VolumeServer_VolumeEcShardRead_FullMethodName, cOpts...) if err != nil { return nil, err } - x := &volumeServerVolumeEcShardReadClient{stream} + x := &grpc.GenericClientStream[VolumeEcShardReadRequest, VolumeEcShardReadResponse]{ClientStream: stream} if err := x.ClientStream.SendMsg(in); err != nil { return nil, err } @@ -557,26 +505,13 @@ func (c *volumeServerClient) VolumeEcShardRead(ctx context.Context, in *VolumeEc return x, nil } -type VolumeServer_VolumeEcShardReadClient interface { - Recv() (*VolumeEcShardReadResponse, error) - grpc.ClientStream -} - -type volumeServerVolumeEcShardReadClient struct { - grpc.ClientStream -} - -func (x *volumeServerVolumeEcShardReadClient) Recv() (*VolumeEcShardReadResponse, error) { - m := new(VolumeEcShardReadResponse) - if err := x.ClientStream.RecvMsg(m); err != nil { - return nil, err - } - return m, nil -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type VolumeServer_VolumeEcShardReadClient = grpc.ServerStreamingClient[VolumeEcShardReadResponse] func (c *volumeServerClient) VolumeEcBlobDelete(ctx context.Context, in *VolumeEcBlobDeleteRequest, opts ...grpc.CallOption) (*VolumeEcBlobDeleteResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(VolumeEcBlobDeleteResponse) - err := c.cc.Invoke(ctx, VolumeServer_VolumeEcBlobDelete_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, VolumeServer_VolumeEcBlobDelete_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -584,20 +519,22 @@ func (c *volumeServerClient) VolumeEcBlobDelete(ctx context.Context, in *VolumeE } func (c *volumeServerClient) VolumeEcShardsToVolume(ctx context.Context, in *VolumeEcShardsToVolumeRequest, opts ...grpc.CallOption) (*VolumeEcShardsToVolumeResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(VolumeEcShardsToVolumeResponse) - err := c.cc.Invoke(ctx, VolumeServer_VolumeEcShardsToVolume_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, VolumeServer_VolumeEcShardsToVolume_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } return out, nil } -func (c *volumeServerClient) VolumeTierMoveDatToRemote(ctx context.Context, in *VolumeTierMoveDatToRemoteRequest, opts ...grpc.CallOption) (VolumeServer_VolumeTierMoveDatToRemoteClient, error) { - stream, err := c.cc.NewStream(ctx, &VolumeServer_ServiceDesc.Streams[7], VolumeServer_VolumeTierMoveDatToRemote_FullMethodName, opts...) +func (c *volumeServerClient) VolumeTierMoveDatToRemote(ctx context.Context, in *VolumeTierMoveDatToRemoteRequest, opts ...grpc.CallOption) (grpc.ServerStreamingClient[VolumeTierMoveDatToRemoteResponse], error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) + stream, err := c.cc.NewStream(ctx, &VolumeServer_ServiceDesc.Streams[7], VolumeServer_VolumeTierMoveDatToRemote_FullMethodName, cOpts...) if err != nil { return nil, err } - x := &volumeServerVolumeTierMoveDatToRemoteClient{stream} + x := &grpc.GenericClientStream[VolumeTierMoveDatToRemoteRequest, VolumeTierMoveDatToRemoteResponse]{ClientStream: stream} if err := x.ClientStream.SendMsg(in); err != nil { return nil, err } @@ -607,29 +544,16 @@ func (c *volumeServerClient) VolumeTierMoveDatToRemote(ctx context.Context, in * return x, nil } -type VolumeServer_VolumeTierMoveDatToRemoteClient interface { - Recv() (*VolumeTierMoveDatToRemoteResponse, error) - grpc.ClientStream -} - -type volumeServerVolumeTierMoveDatToRemoteClient struct { - grpc.ClientStream -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type VolumeServer_VolumeTierMoveDatToRemoteClient = grpc.ServerStreamingClient[VolumeTierMoveDatToRemoteResponse] -func (x *volumeServerVolumeTierMoveDatToRemoteClient) Recv() (*VolumeTierMoveDatToRemoteResponse, error) { - m := new(VolumeTierMoveDatToRemoteResponse) - if err := x.ClientStream.RecvMsg(m); err != nil { - return nil, err - } - return m, nil -} - -func (c *volumeServerClient) VolumeTierMoveDatFromRemote(ctx context.Context, in *VolumeTierMoveDatFromRemoteRequest, opts ...grpc.CallOption) (VolumeServer_VolumeTierMoveDatFromRemoteClient, error) { - stream, err := c.cc.NewStream(ctx, &VolumeServer_ServiceDesc.Streams[8], VolumeServer_VolumeTierMoveDatFromRemote_FullMethodName, opts...) +func (c *volumeServerClient) VolumeTierMoveDatFromRemote(ctx context.Context, in *VolumeTierMoveDatFromRemoteRequest, opts ...grpc.CallOption) (grpc.ServerStreamingClient[VolumeTierMoveDatFromRemoteResponse], error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) + stream, err := c.cc.NewStream(ctx, &VolumeServer_ServiceDesc.Streams[8], VolumeServer_VolumeTierMoveDatFromRemote_FullMethodName, cOpts...) if err != nil { return nil, err } - x := &volumeServerVolumeTierMoveDatFromRemoteClient{stream} + x := &grpc.GenericClientStream[VolumeTierMoveDatFromRemoteRequest, VolumeTierMoveDatFromRemoteResponse]{ClientStream: stream} if err := x.ClientStream.SendMsg(in); err != nil { return nil, err } @@ -639,26 +563,13 @@ func (c *volumeServerClient) VolumeTierMoveDatFromRemote(ctx context.Context, in return x, nil } -type VolumeServer_VolumeTierMoveDatFromRemoteClient interface { - Recv() (*VolumeTierMoveDatFromRemoteResponse, error) - grpc.ClientStream -} - -type volumeServerVolumeTierMoveDatFromRemoteClient struct { - grpc.ClientStream -} - -func (x *volumeServerVolumeTierMoveDatFromRemoteClient) Recv() (*VolumeTierMoveDatFromRemoteResponse, error) { - m := new(VolumeTierMoveDatFromRemoteResponse) - if err := x.ClientStream.RecvMsg(m); err != nil { - return nil, err - } - return m, nil -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type VolumeServer_VolumeTierMoveDatFromRemoteClient = grpc.ServerStreamingClient[VolumeTierMoveDatFromRemoteResponse] func (c *volumeServerClient) VolumeServerStatus(ctx context.Context, in *VolumeServerStatusRequest, opts ...grpc.CallOption) (*VolumeServerStatusResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(VolumeServerStatusResponse) - err := c.cc.Invoke(ctx, VolumeServer_VolumeServerStatus_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, VolumeServer_VolumeServerStatus_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -666,8 +577,9 @@ func (c *volumeServerClient) VolumeServerStatus(ctx context.Context, in *VolumeS } func (c *volumeServerClient) VolumeServerLeave(ctx context.Context, in *VolumeServerLeaveRequest, opts ...grpc.CallOption) (*VolumeServerLeaveResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(VolumeServerLeaveResponse) - err := c.cc.Invoke(ctx, VolumeServer_VolumeServerLeave_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, VolumeServer_VolumeServerLeave_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -675,20 +587,22 @@ func (c *volumeServerClient) VolumeServerLeave(ctx context.Context, in *VolumeSe } func (c *volumeServerClient) FetchAndWriteNeedle(ctx context.Context, in *FetchAndWriteNeedleRequest, opts ...grpc.CallOption) (*FetchAndWriteNeedleResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(FetchAndWriteNeedleResponse) - err := c.cc.Invoke(ctx, VolumeServer_FetchAndWriteNeedle_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, VolumeServer_FetchAndWriteNeedle_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } return out, nil } -func (c *volumeServerClient) Query(ctx context.Context, in *QueryRequest, opts ...grpc.CallOption) (VolumeServer_QueryClient, error) { - stream, err := c.cc.NewStream(ctx, &VolumeServer_ServiceDesc.Streams[9], VolumeServer_Query_FullMethodName, opts...) +func (c *volumeServerClient) Query(ctx context.Context, in *QueryRequest, opts ...grpc.CallOption) (grpc.ServerStreamingClient[QueriedStripe], error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) + stream, err := c.cc.NewStream(ctx, &VolumeServer_ServiceDesc.Streams[9], VolumeServer_Query_FullMethodName, cOpts...) if err != nil { return nil, err } - x := &volumeServerQueryClient{stream} + x := &grpc.GenericClientStream[QueryRequest, QueriedStripe]{ClientStream: stream} if err := x.ClientStream.SendMsg(in); err != nil { return nil, err } @@ -698,26 +612,13 @@ func (c *volumeServerClient) Query(ctx context.Context, in *QueryRequest, opts . return x, nil } -type VolumeServer_QueryClient interface { - Recv() (*QueriedStripe, error) - grpc.ClientStream -} - -type volumeServerQueryClient struct { - grpc.ClientStream -} - -func (x *volumeServerQueryClient) Recv() (*QueriedStripe, error) { - m := new(QueriedStripe) - if err := x.ClientStream.RecvMsg(m); err != nil { - return nil, err - } - return m, nil -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type VolumeServer_QueryClient = grpc.ServerStreamingClient[QueriedStripe] func (c *volumeServerClient) VolumeNeedleStatus(ctx context.Context, in *VolumeNeedleStatusRequest, opts ...grpc.CallOption) (*VolumeNeedleStatusResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(VolumeNeedleStatusResponse) - err := c.cc.Invoke(ctx, VolumeServer_VolumeNeedleStatus_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, VolumeServer_VolumeNeedleStatus_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -725,8 +626,9 @@ func (c *volumeServerClient) VolumeNeedleStatus(ctx context.Context, in *VolumeN } func (c *volumeServerClient) Ping(ctx context.Context, in *PingRequest, opts ...grpc.CallOption) (*PingResponse, error) { + cOpts := append([]grpc.CallOption{grpc.StaticMethod()}, opts...) out := new(PingResponse) - err := c.cc.Invoke(ctx, VolumeServer_Ping_FullMethodName, in, out, opts...) + err := c.cc.Invoke(ctx, VolumeServer_Ping_FullMethodName, in, out, cOpts...) if err != nil { return nil, err } @@ -735,18 +637,18 @@ func (c *volumeServerClient) Ping(ctx context.Context, in *PingRequest, opts ... // VolumeServerServer is the server API for VolumeServer service. // All implementations must embed UnimplementedVolumeServerServer -// for forward compatibility +// for forward compatibility. type VolumeServerServer interface { - //Experts only: takes multiple fid parameters. This function does not propagate deletes to replicas. + // Experts only: takes multiple fid parameters. This function does not propagate deletes to replicas. BatchDelete(context.Context, *BatchDeleteRequest) (*BatchDeleteResponse, error) VacuumVolumeCheck(context.Context, *VacuumVolumeCheckRequest) (*VacuumVolumeCheckResponse, error) - VacuumVolumeCompact(*VacuumVolumeCompactRequest, VolumeServer_VacuumVolumeCompactServer) error + VacuumVolumeCompact(*VacuumVolumeCompactRequest, grpc.ServerStreamingServer[VacuumVolumeCompactResponse]) error VacuumVolumeCommit(context.Context, *VacuumVolumeCommitRequest) (*VacuumVolumeCommitResponse, error) VacuumVolumeCleanup(context.Context, *VacuumVolumeCleanupRequest) (*VacuumVolumeCleanupResponse, error) DeleteCollection(context.Context, *DeleteCollectionRequest) (*DeleteCollectionResponse, error) AllocateVolume(context.Context, *AllocateVolumeRequest) (*AllocateVolumeResponse, error) VolumeSyncStatus(context.Context, *VolumeSyncStatusRequest) (*VolumeSyncStatusResponse, error) - VolumeIncrementalCopy(*VolumeIncrementalCopyRequest, VolumeServer_VolumeIncrementalCopyServer) error + VolumeIncrementalCopy(*VolumeIncrementalCopyRequest, grpc.ServerStreamingServer[VolumeIncrementalCopyResponse]) error VolumeMount(context.Context, *VolumeMountRequest) (*VolumeMountResponse, error) VolumeUnmount(context.Context, *VolumeUnmountRequest) (*VolumeUnmountResponse, error) VolumeDelete(context.Context, *VolumeDeleteRequest) (*VolumeDeleteResponse, error) @@ -755,14 +657,14 @@ type VolumeServerServer interface { VolumeConfigure(context.Context, *VolumeConfigureRequest) (*VolumeConfigureResponse, error) VolumeStatus(context.Context, *VolumeStatusRequest) (*VolumeStatusResponse, error) // copy the .idx .dat files, and mount this volume - VolumeCopy(*VolumeCopyRequest, VolumeServer_VolumeCopyServer) error + VolumeCopy(*VolumeCopyRequest, grpc.ServerStreamingServer[VolumeCopyResponse]) error ReadVolumeFileStatus(context.Context, *ReadVolumeFileStatusRequest) (*ReadVolumeFileStatusResponse, error) - CopyFile(*CopyFileRequest, VolumeServer_CopyFileServer) error + CopyFile(*CopyFileRequest, grpc.ServerStreamingServer[CopyFileResponse]) error ReadNeedleBlob(context.Context, *ReadNeedleBlobRequest) (*ReadNeedleBlobResponse, error) ReadNeedleMeta(context.Context, *ReadNeedleMetaRequest) (*ReadNeedleMetaResponse, error) WriteNeedleBlob(context.Context, *WriteNeedleBlobRequest) (*WriteNeedleBlobResponse, error) - ReadAllNeedles(*ReadAllNeedlesRequest, VolumeServer_ReadAllNeedlesServer) error - VolumeTailSender(*VolumeTailSenderRequest, VolumeServer_VolumeTailSenderServer) error + ReadAllNeedles(*ReadAllNeedlesRequest, grpc.ServerStreamingServer[ReadAllNeedlesResponse]) error + VolumeTailSender(*VolumeTailSenderRequest, grpc.ServerStreamingServer[VolumeTailSenderResponse]) error VolumeTailReceiver(context.Context, *VolumeTailReceiverRequest) (*VolumeTailReceiverResponse, error) // erasure coding VolumeEcShardsGenerate(context.Context, *VolumeEcShardsGenerateRequest) (*VolumeEcShardsGenerateResponse, error) @@ -771,26 +673,29 @@ type VolumeServerServer interface { VolumeEcShardsDelete(context.Context, *VolumeEcShardsDeleteRequest) (*VolumeEcShardsDeleteResponse, error) VolumeEcShardsMount(context.Context, *VolumeEcShardsMountRequest) (*VolumeEcShardsMountResponse, error) VolumeEcShardsUnmount(context.Context, *VolumeEcShardsUnmountRequest) (*VolumeEcShardsUnmountResponse, error) - VolumeEcShardRead(*VolumeEcShardReadRequest, VolumeServer_VolumeEcShardReadServer) error + VolumeEcShardRead(*VolumeEcShardReadRequest, grpc.ServerStreamingServer[VolumeEcShardReadResponse]) error VolumeEcBlobDelete(context.Context, *VolumeEcBlobDeleteRequest) (*VolumeEcBlobDeleteResponse, error) VolumeEcShardsToVolume(context.Context, *VolumeEcShardsToVolumeRequest) (*VolumeEcShardsToVolumeResponse, error) // tiered storage - VolumeTierMoveDatToRemote(*VolumeTierMoveDatToRemoteRequest, VolumeServer_VolumeTierMoveDatToRemoteServer) error - VolumeTierMoveDatFromRemote(*VolumeTierMoveDatFromRemoteRequest, VolumeServer_VolumeTierMoveDatFromRemoteServer) error + VolumeTierMoveDatToRemote(*VolumeTierMoveDatToRemoteRequest, grpc.ServerStreamingServer[VolumeTierMoveDatToRemoteResponse]) error + VolumeTierMoveDatFromRemote(*VolumeTierMoveDatFromRemoteRequest, grpc.ServerStreamingServer[VolumeTierMoveDatFromRemoteResponse]) error VolumeServerStatus(context.Context, *VolumeServerStatusRequest) (*VolumeServerStatusResponse, error) VolumeServerLeave(context.Context, *VolumeServerLeaveRequest) (*VolumeServerLeaveResponse, error) // remote storage FetchAndWriteNeedle(context.Context, *FetchAndWriteNeedleRequest) (*FetchAndWriteNeedleResponse, error) // query - Query(*QueryRequest, VolumeServer_QueryServer) error + Query(*QueryRequest, grpc.ServerStreamingServer[QueriedStripe]) error VolumeNeedleStatus(context.Context, *VolumeNeedleStatusRequest) (*VolumeNeedleStatusResponse, error) Ping(context.Context, *PingRequest) (*PingResponse, error) mustEmbedUnimplementedVolumeServerServer() } -// UnimplementedVolumeServerServer must be embedded to have forward compatible implementations. -type UnimplementedVolumeServerServer struct { -} +// UnimplementedVolumeServerServer must be embedded to have +// forward compatible implementations. +// +// NOTE: this should be embedded by value instead of pointer to avoid a nil +// pointer dereference when methods are called. +type UnimplementedVolumeServerServer struct{} func (UnimplementedVolumeServerServer) BatchDelete(context.Context, *BatchDeleteRequest) (*BatchDeleteResponse, error) { return nil, status.Errorf(codes.Unimplemented, "method BatchDelete not implemented") @@ -798,7 +703,7 @@ func (UnimplementedVolumeServerServer) BatchDelete(context.Context, *BatchDelete func (UnimplementedVolumeServerServer) VacuumVolumeCheck(context.Context, *VacuumVolumeCheckRequest) (*VacuumVolumeCheckResponse, error) { return nil, status.Errorf(codes.Unimplemented, "method VacuumVolumeCheck not implemented") } -func (UnimplementedVolumeServerServer) VacuumVolumeCompact(*VacuumVolumeCompactRequest, VolumeServer_VacuumVolumeCompactServer) error { +func (UnimplementedVolumeServerServer) VacuumVolumeCompact(*VacuumVolumeCompactRequest, grpc.ServerStreamingServer[VacuumVolumeCompactResponse]) error { return status.Errorf(codes.Unimplemented, "method VacuumVolumeCompact not implemented") } func (UnimplementedVolumeServerServer) VacuumVolumeCommit(context.Context, *VacuumVolumeCommitRequest) (*VacuumVolumeCommitResponse, error) { @@ -816,7 +721,7 @@ func (UnimplementedVolumeServerServer) AllocateVolume(context.Context, *Allocate func (UnimplementedVolumeServerServer) VolumeSyncStatus(context.Context, *VolumeSyncStatusRequest) (*VolumeSyncStatusResponse, error) { return nil, status.Errorf(codes.Unimplemented, "method VolumeSyncStatus not implemented") } -func (UnimplementedVolumeServerServer) VolumeIncrementalCopy(*VolumeIncrementalCopyRequest, VolumeServer_VolumeIncrementalCopyServer) error { +func (UnimplementedVolumeServerServer) VolumeIncrementalCopy(*VolumeIncrementalCopyRequest, grpc.ServerStreamingServer[VolumeIncrementalCopyResponse]) error { return status.Errorf(codes.Unimplemented, "method VolumeIncrementalCopy not implemented") } func (UnimplementedVolumeServerServer) VolumeMount(context.Context, *VolumeMountRequest) (*VolumeMountResponse, error) { @@ -840,13 +745,13 @@ func (UnimplementedVolumeServerServer) VolumeConfigure(context.Context, *VolumeC func (UnimplementedVolumeServerServer) VolumeStatus(context.Context, *VolumeStatusRequest) (*VolumeStatusResponse, error) { return nil, status.Errorf(codes.Unimplemented, "method VolumeStatus not implemented") } -func (UnimplementedVolumeServerServer) VolumeCopy(*VolumeCopyRequest, VolumeServer_VolumeCopyServer) error { +func (UnimplementedVolumeServerServer) VolumeCopy(*VolumeCopyRequest, grpc.ServerStreamingServer[VolumeCopyResponse]) error { return status.Errorf(codes.Unimplemented, "method VolumeCopy not implemented") } func (UnimplementedVolumeServerServer) ReadVolumeFileStatus(context.Context, *ReadVolumeFileStatusRequest) (*ReadVolumeFileStatusResponse, error) { return nil, status.Errorf(codes.Unimplemented, "method ReadVolumeFileStatus not implemented") } -func (UnimplementedVolumeServerServer) CopyFile(*CopyFileRequest, VolumeServer_CopyFileServer) error { +func (UnimplementedVolumeServerServer) CopyFile(*CopyFileRequest, grpc.ServerStreamingServer[CopyFileResponse]) error { return status.Errorf(codes.Unimplemented, "method CopyFile not implemented") } func (UnimplementedVolumeServerServer) ReadNeedleBlob(context.Context, *ReadNeedleBlobRequest) (*ReadNeedleBlobResponse, error) { @@ -858,10 +763,10 @@ func (UnimplementedVolumeServerServer) ReadNeedleMeta(context.Context, *ReadNeed func (UnimplementedVolumeServerServer) WriteNeedleBlob(context.Context, *WriteNeedleBlobRequest) (*WriteNeedleBlobResponse, error) { return nil, status.Errorf(codes.Unimplemented, "method WriteNeedleBlob not implemented") } -func (UnimplementedVolumeServerServer) ReadAllNeedles(*ReadAllNeedlesRequest, VolumeServer_ReadAllNeedlesServer) error { +func (UnimplementedVolumeServerServer) ReadAllNeedles(*ReadAllNeedlesRequest, grpc.ServerStreamingServer[ReadAllNeedlesResponse]) error { return status.Errorf(codes.Unimplemented, "method ReadAllNeedles not implemented") } -func (UnimplementedVolumeServerServer) VolumeTailSender(*VolumeTailSenderRequest, VolumeServer_VolumeTailSenderServer) error { +func (UnimplementedVolumeServerServer) VolumeTailSender(*VolumeTailSenderRequest, grpc.ServerStreamingServer[VolumeTailSenderResponse]) error { return status.Errorf(codes.Unimplemented, "method VolumeTailSender not implemented") } func (UnimplementedVolumeServerServer) VolumeTailReceiver(context.Context, *VolumeTailReceiverRequest) (*VolumeTailReceiverResponse, error) { @@ -885,7 +790,7 @@ func (UnimplementedVolumeServerServer) VolumeEcShardsMount(context.Context, *Vol func (UnimplementedVolumeServerServer) VolumeEcShardsUnmount(context.Context, *VolumeEcShardsUnmountRequest) (*VolumeEcShardsUnmountResponse, error) { return nil, status.Errorf(codes.Unimplemented, "method VolumeEcShardsUnmount not implemented") } -func (UnimplementedVolumeServerServer) VolumeEcShardRead(*VolumeEcShardReadRequest, VolumeServer_VolumeEcShardReadServer) error { +func (UnimplementedVolumeServerServer) VolumeEcShardRead(*VolumeEcShardReadRequest, grpc.ServerStreamingServer[VolumeEcShardReadResponse]) error { return status.Errorf(codes.Unimplemented, "method VolumeEcShardRead not implemented") } func (UnimplementedVolumeServerServer) VolumeEcBlobDelete(context.Context, *VolumeEcBlobDeleteRequest) (*VolumeEcBlobDeleteResponse, error) { @@ -894,10 +799,10 @@ func (UnimplementedVolumeServerServer) VolumeEcBlobDelete(context.Context, *Volu func (UnimplementedVolumeServerServer) VolumeEcShardsToVolume(context.Context, *VolumeEcShardsToVolumeRequest) (*VolumeEcShardsToVolumeResponse, error) { return nil, status.Errorf(codes.Unimplemented, "method VolumeEcShardsToVolume not implemented") } -func (UnimplementedVolumeServerServer) VolumeTierMoveDatToRemote(*VolumeTierMoveDatToRemoteRequest, VolumeServer_VolumeTierMoveDatToRemoteServer) error { +func (UnimplementedVolumeServerServer) VolumeTierMoveDatToRemote(*VolumeTierMoveDatToRemoteRequest, grpc.ServerStreamingServer[VolumeTierMoveDatToRemoteResponse]) error { return status.Errorf(codes.Unimplemented, "method VolumeTierMoveDatToRemote not implemented") } -func (UnimplementedVolumeServerServer) VolumeTierMoveDatFromRemote(*VolumeTierMoveDatFromRemoteRequest, VolumeServer_VolumeTierMoveDatFromRemoteServer) error { +func (UnimplementedVolumeServerServer) VolumeTierMoveDatFromRemote(*VolumeTierMoveDatFromRemoteRequest, grpc.ServerStreamingServer[VolumeTierMoveDatFromRemoteResponse]) error { return status.Errorf(codes.Unimplemented, "method VolumeTierMoveDatFromRemote not implemented") } func (UnimplementedVolumeServerServer) VolumeServerStatus(context.Context, *VolumeServerStatusRequest) (*VolumeServerStatusResponse, error) { @@ -909,7 +814,7 @@ func (UnimplementedVolumeServerServer) VolumeServerLeave(context.Context, *Volum func (UnimplementedVolumeServerServer) FetchAndWriteNeedle(context.Context, *FetchAndWriteNeedleRequest) (*FetchAndWriteNeedleResponse, error) { return nil, status.Errorf(codes.Unimplemented, "method FetchAndWriteNeedle not implemented") } -func (UnimplementedVolumeServerServer) Query(*QueryRequest, VolumeServer_QueryServer) error { +func (UnimplementedVolumeServerServer) Query(*QueryRequest, grpc.ServerStreamingServer[QueriedStripe]) error { return status.Errorf(codes.Unimplemented, "method Query not implemented") } func (UnimplementedVolumeServerServer) VolumeNeedleStatus(context.Context, *VolumeNeedleStatusRequest) (*VolumeNeedleStatusResponse, error) { @@ -919,6 +824,7 @@ func (UnimplementedVolumeServerServer) Ping(context.Context, *PingRequest) (*Pin return nil, status.Errorf(codes.Unimplemented, "method Ping not implemented") } func (UnimplementedVolumeServerServer) mustEmbedUnimplementedVolumeServerServer() {} +func (UnimplementedVolumeServerServer) testEmbeddedByValue() {} // UnsafeVolumeServerServer may be embedded to opt out of forward compatibility for this service. // Use of this interface is not recommended, as added methods to VolumeServerServer will @@ -928,6 +834,13 @@ type UnsafeVolumeServerServer interface { } func RegisterVolumeServerServer(s grpc.ServiceRegistrar, srv VolumeServerServer) { + // If the following call pancis, it indicates UnimplementedVolumeServerServer was + // embedded by pointer and is nil. This will cause panics if an + // unimplemented method is ever invoked, so we test this at initialization + // time to prevent it from happening at runtime later due to I/O. + if t, ok := srv.(interface{ testEmbeddedByValue() }); ok { + t.testEmbeddedByValue() + } s.RegisterService(&VolumeServer_ServiceDesc, srv) } @@ -972,21 +885,11 @@ func _VolumeServer_VacuumVolumeCompact_Handler(srv interface{}, stream grpc.Serv if err := stream.RecvMsg(m); err != nil { return err } - return srv.(VolumeServerServer).VacuumVolumeCompact(m, &volumeServerVacuumVolumeCompactServer{stream}) -} - -type VolumeServer_VacuumVolumeCompactServer interface { - Send(*VacuumVolumeCompactResponse) error - grpc.ServerStream -} - -type volumeServerVacuumVolumeCompactServer struct { - grpc.ServerStream + return srv.(VolumeServerServer).VacuumVolumeCompact(m, &grpc.GenericServerStream[VacuumVolumeCompactRequest, VacuumVolumeCompactResponse]{ServerStream: stream}) } -func (x *volumeServerVacuumVolumeCompactServer) Send(m *VacuumVolumeCompactResponse) error { - return x.ServerStream.SendMsg(m) -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type VolumeServer_VacuumVolumeCompactServer = grpc.ServerStreamingServer[VacuumVolumeCompactResponse] func _VolumeServer_VacuumVolumeCommit_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) { in := new(VacuumVolumeCommitRequest) @@ -1083,21 +986,11 @@ func _VolumeServer_VolumeIncrementalCopy_Handler(srv interface{}, stream grpc.Se if err := stream.RecvMsg(m); err != nil { return err } - return srv.(VolumeServerServer).VolumeIncrementalCopy(m, &volumeServerVolumeIncrementalCopyServer{stream}) + return srv.(VolumeServerServer).VolumeIncrementalCopy(m, &grpc.GenericServerStream[VolumeIncrementalCopyRequest, VolumeIncrementalCopyResponse]{ServerStream: stream}) } -type VolumeServer_VolumeIncrementalCopyServer interface { - Send(*VolumeIncrementalCopyResponse) error - grpc.ServerStream -} - -type volumeServerVolumeIncrementalCopyServer struct { - grpc.ServerStream -} - -func (x *volumeServerVolumeIncrementalCopyServer) Send(m *VolumeIncrementalCopyResponse) error { - return x.ServerStream.SendMsg(m) -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type VolumeServer_VolumeIncrementalCopyServer = grpc.ServerStreamingServer[VolumeIncrementalCopyResponse] func _VolumeServer_VolumeMount_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) { in := new(VolumeMountRequest) @@ -1230,21 +1123,11 @@ func _VolumeServer_VolumeCopy_Handler(srv interface{}, stream grpc.ServerStream) if err := stream.RecvMsg(m); err != nil { return err } - return srv.(VolumeServerServer).VolumeCopy(m, &volumeServerVolumeCopyServer{stream}) -} - -type VolumeServer_VolumeCopyServer interface { - Send(*VolumeCopyResponse) error - grpc.ServerStream + return srv.(VolumeServerServer).VolumeCopy(m, &grpc.GenericServerStream[VolumeCopyRequest, VolumeCopyResponse]{ServerStream: stream}) } -type volumeServerVolumeCopyServer struct { - grpc.ServerStream -} - -func (x *volumeServerVolumeCopyServer) Send(m *VolumeCopyResponse) error { - return x.ServerStream.SendMsg(m) -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type VolumeServer_VolumeCopyServer = grpc.ServerStreamingServer[VolumeCopyResponse] func _VolumeServer_ReadVolumeFileStatus_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) { in := new(ReadVolumeFileStatusRequest) @@ -1269,21 +1152,11 @@ func _VolumeServer_CopyFile_Handler(srv interface{}, stream grpc.ServerStream) e if err := stream.RecvMsg(m); err != nil { return err } - return srv.(VolumeServerServer).CopyFile(m, &volumeServerCopyFileServer{stream}) -} - -type VolumeServer_CopyFileServer interface { - Send(*CopyFileResponse) error - grpc.ServerStream + return srv.(VolumeServerServer).CopyFile(m, &grpc.GenericServerStream[CopyFileRequest, CopyFileResponse]{ServerStream: stream}) } -type volumeServerCopyFileServer struct { - grpc.ServerStream -} - -func (x *volumeServerCopyFileServer) Send(m *CopyFileResponse) error { - return x.ServerStream.SendMsg(m) -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type VolumeServer_CopyFileServer = grpc.ServerStreamingServer[CopyFileResponse] func _VolumeServer_ReadNeedleBlob_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) { in := new(ReadNeedleBlobRequest) @@ -1344,42 +1217,22 @@ func _VolumeServer_ReadAllNeedles_Handler(srv interface{}, stream grpc.ServerStr if err := stream.RecvMsg(m); err != nil { return err } - return srv.(VolumeServerServer).ReadAllNeedles(m, &volumeServerReadAllNeedlesServer{stream}) + return srv.(VolumeServerServer).ReadAllNeedles(m, &grpc.GenericServerStream[ReadAllNeedlesRequest, ReadAllNeedlesResponse]{ServerStream: stream}) } -type VolumeServer_ReadAllNeedlesServer interface { - Send(*ReadAllNeedlesResponse) error - grpc.ServerStream -} - -type volumeServerReadAllNeedlesServer struct { - grpc.ServerStream -} - -func (x *volumeServerReadAllNeedlesServer) Send(m *ReadAllNeedlesResponse) error { - return x.ServerStream.SendMsg(m) -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type VolumeServer_ReadAllNeedlesServer = grpc.ServerStreamingServer[ReadAllNeedlesResponse] func _VolumeServer_VolumeTailSender_Handler(srv interface{}, stream grpc.ServerStream) error { m := new(VolumeTailSenderRequest) if err := stream.RecvMsg(m); err != nil { return err } - return srv.(VolumeServerServer).VolumeTailSender(m, &volumeServerVolumeTailSenderServer{stream}) -} - -type VolumeServer_VolumeTailSenderServer interface { - Send(*VolumeTailSenderResponse) error - grpc.ServerStream + return srv.(VolumeServerServer).VolumeTailSender(m, &grpc.GenericServerStream[VolumeTailSenderRequest, VolumeTailSenderResponse]{ServerStream: stream}) } -type volumeServerVolumeTailSenderServer struct { - grpc.ServerStream -} - -func (x *volumeServerVolumeTailSenderServer) Send(m *VolumeTailSenderResponse) error { - return x.ServerStream.SendMsg(m) -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type VolumeServer_VolumeTailSenderServer = grpc.ServerStreamingServer[VolumeTailSenderResponse] func _VolumeServer_VolumeTailReceiver_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) { in := new(VolumeTailReceiverRequest) @@ -1512,21 +1365,11 @@ func _VolumeServer_VolumeEcShardRead_Handler(srv interface{}, stream grpc.Server if err := stream.RecvMsg(m); err != nil { return err } - return srv.(VolumeServerServer).VolumeEcShardRead(m, &volumeServerVolumeEcShardReadServer{stream}) -} - -type VolumeServer_VolumeEcShardReadServer interface { - Send(*VolumeEcShardReadResponse) error - grpc.ServerStream + return srv.(VolumeServerServer).VolumeEcShardRead(m, &grpc.GenericServerStream[VolumeEcShardReadRequest, VolumeEcShardReadResponse]{ServerStream: stream}) } -type volumeServerVolumeEcShardReadServer struct { - grpc.ServerStream -} - -func (x *volumeServerVolumeEcShardReadServer) Send(m *VolumeEcShardReadResponse) error { - return x.ServerStream.SendMsg(m) -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type VolumeServer_VolumeEcShardReadServer = grpc.ServerStreamingServer[VolumeEcShardReadResponse] func _VolumeServer_VolumeEcBlobDelete_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) { in := new(VolumeEcBlobDeleteRequest) @@ -1569,42 +1412,22 @@ func _VolumeServer_VolumeTierMoveDatToRemote_Handler(srv interface{}, stream grp if err := stream.RecvMsg(m); err != nil { return err } - return srv.(VolumeServerServer).VolumeTierMoveDatToRemote(m, &volumeServerVolumeTierMoveDatToRemoteServer{stream}) + return srv.(VolumeServerServer).VolumeTierMoveDatToRemote(m, &grpc.GenericServerStream[VolumeTierMoveDatToRemoteRequest, VolumeTierMoveDatToRemoteResponse]{ServerStream: stream}) } -type VolumeServer_VolumeTierMoveDatToRemoteServer interface { - Send(*VolumeTierMoveDatToRemoteResponse) error - grpc.ServerStream -} - -type volumeServerVolumeTierMoveDatToRemoteServer struct { - grpc.ServerStream -} - -func (x *volumeServerVolumeTierMoveDatToRemoteServer) Send(m *VolumeTierMoveDatToRemoteResponse) error { - return x.ServerStream.SendMsg(m) -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type VolumeServer_VolumeTierMoveDatToRemoteServer = grpc.ServerStreamingServer[VolumeTierMoveDatToRemoteResponse] func _VolumeServer_VolumeTierMoveDatFromRemote_Handler(srv interface{}, stream grpc.ServerStream) error { m := new(VolumeTierMoveDatFromRemoteRequest) if err := stream.RecvMsg(m); err != nil { return err } - return srv.(VolumeServerServer).VolumeTierMoveDatFromRemote(m, &volumeServerVolumeTierMoveDatFromRemoteServer{stream}) -} - -type VolumeServer_VolumeTierMoveDatFromRemoteServer interface { - Send(*VolumeTierMoveDatFromRemoteResponse) error - grpc.ServerStream + return srv.(VolumeServerServer).VolumeTierMoveDatFromRemote(m, &grpc.GenericServerStream[VolumeTierMoveDatFromRemoteRequest, VolumeTierMoveDatFromRemoteResponse]{ServerStream: stream}) } -type volumeServerVolumeTierMoveDatFromRemoteServer struct { - grpc.ServerStream -} - -func (x *volumeServerVolumeTierMoveDatFromRemoteServer) Send(m *VolumeTierMoveDatFromRemoteResponse) error { - return x.ServerStream.SendMsg(m) -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type VolumeServer_VolumeTierMoveDatFromRemoteServer = grpc.ServerStreamingServer[VolumeTierMoveDatFromRemoteResponse] func _VolumeServer_VolumeServerStatus_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) { in := new(VolumeServerStatusRequest) @@ -1665,21 +1488,11 @@ func _VolumeServer_Query_Handler(srv interface{}, stream grpc.ServerStream) erro if err := stream.RecvMsg(m); err != nil { return err } - return srv.(VolumeServerServer).Query(m, &volumeServerQueryServer{stream}) -} - -type VolumeServer_QueryServer interface { - Send(*QueriedStripe) error - grpc.ServerStream + return srv.(VolumeServerServer).Query(m, &grpc.GenericServerStream[QueryRequest, QueriedStripe]{ServerStream: stream}) } -type volumeServerQueryServer struct { - grpc.ServerStream -} - -func (x *volumeServerQueryServer) Send(m *QueriedStripe) error { - return x.ServerStream.SendMsg(m) -} +// This type alias is provided for backwards compatibility with existing code that references the prior non-generic stream type by name. +type VolumeServer_QueryServer = grpc.ServerStreamingServer[QueriedStripe] func _VolumeServer_VolumeNeedleStatus_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) { in := new(VolumeNeedleStatusRequest) diff --git a/weed/s3api/auth_signature_v4.go b/weed/s3api/auth_signature_v4.go index 0a156cfce..9cc3e2766 100644 --- a/weed/s3api/auth_signature_v4.go +++ b/weed/s3api/auth_signature_v4.go @@ -148,15 +148,38 @@ func (iam *IdentityAccessManagement) doesSignatureMatch(hashedPayload string, r } } + if forwardedPrefix := r.Header.Get("X-Forwarded-Prefix"); forwardedPrefix != "" { + // Handling usage of reverse proxy at prefix. + // Trying with prefix before main path. + + // Get canonical request. + canonicalRequest := getCanonicalRequest(extractedSignedHeaders, hashedPayload, queryStr, forwardedPrefix+req.URL.Path, req.Method) + + errCode = iam.genAndCompareSignatureV4(canonicalRequest, cred.SecretKey, t, signV4Values) + if errCode == s3err.ErrNone { + return identity, errCode + } + } + // Get canonical request. canonicalRequest := getCanonicalRequest(extractedSignedHeaders, hashedPayload, queryStr, req.URL.Path, req.Method) + errCode = iam.genAndCompareSignatureV4(canonicalRequest, cred.SecretKey, t, signV4Values) + + if errCode == s3err.ErrNone { + return identity, errCode + } + return nil, errCode +} + +// Generate and compare signature for request. +func (iam *IdentityAccessManagement) genAndCompareSignatureV4(canonicalRequest, secretKey string, t time.Time, signV4Values signValues) s3err.ErrorCode { // Get string to sign from canonical request. stringToSign := getStringToSign(canonicalRequest, t, signV4Values.Credential.getScope()) // Calculate signature. newSignature := iam.getSignature( - cred.SecretKey, + secretKey, signV4Values.Credential.scope.date, signV4Values.Credential.scope.region, signV4Values.Credential.scope.service, @@ -165,11 +188,9 @@ func (iam *IdentityAccessManagement) doesSignatureMatch(hashedPayload string, r // Verify if signature match. if !compareSignatureV4(newSignature, signV4Values.Signature) { - return nil, s3err.ErrSignatureDoesNotMatch + return s3err.ErrSignatureDoesNotMatch } - - // Return error none. - return identity, s3err.ErrNone + return s3err.ErrNone } // credentialHeader data type represents structured form of Credential @@ -664,7 +685,11 @@ func extractSignedHeaders(signedHeaders []string, r *http.Request) (http.Header, extractedSignedHeaders.Set(header, "100-continue") case "host": // Go http server removes "host" from Request.Header - extractedSignedHeaders.Set(header, r.Host) + if forwardedHost := r.Header.Get("X-Forwarded-Host"); forwardedHost != "" { + extractedSignedHeaders.Set(header, forwardedHost) + } else { + extractedSignedHeaders.Set(header, r.Host) + } case "transfer-encoding": for _, enc := range r.TransferEncoding { extractedSignedHeaders.Add(header, enc) diff --git a/weed/s3api/filer_multipart.go b/weed/s3api/filer_multipart.go index 43f982897..12ffc78de 100644 --- a/weed/s3api/filer_multipart.go +++ b/weed/s3api/filer_multipart.go @@ -209,6 +209,7 @@ func (s3a *S3ApiServer) completeMultipartUpload(input *s3.CompleteMultipartUploa ModifiedTsNs: chunk.ModifiedTsNs, CipherKey: chunk.CipherKey, ETag: chunk.ETag, + IsCompressed: chunk.IsCompressed, } finalParts = append(finalParts, p) offset += int64(chunk.Size) diff --git a/weed/s3api/policy/post-policy.go b/weed/s3api/policy/post-policy.go index 64b696ac8..ad3cfc401 100644 --- a/weed/s3api/policy/post-policy.go +++ b/weed/s3api/policy/post-policy.go @@ -315,6 +315,6 @@ func errInvalidArgument(message string) error { StatusCode: http.StatusBadRequest, Code: "InvalidArgument", Message: message, - RequestID: "minio", + RequestID: "client", } } diff --git a/weed/s3api/s3api_bucket_skip_handlers.go b/weed/s3api/s3api_bucket_skip_handlers.go index b334d3398..549eaa8ce 100644 --- a/weed/s3api/s3api_bucket_skip_handlers.go +++ b/weed/s3api/s3api_bucket_skip_handlers.go @@ -1,6 +1,8 @@ package s3api import ( + "github.com/seaweedfs/seaweedfs/weed/glog" + "github.com/seaweedfs/seaweedfs/weed/s3api/s3_constants" "net/http" "github.com/seaweedfs/seaweedfs/weed/s3api/s3err" @@ -47,3 +49,53 @@ func (s3a *S3ApiServer) DeleteBucketPolicyHandler(w http.ResponseWriter, r *http func (s3a *S3ApiServer) PutBucketVersioningHandler(w http.ResponseWriter, r *http.Request) { s3err.WriteErrorResponse(w, r, s3err.ErrNotImplemented) } + +// GetBucketTaggingHandler Returns the tag set associated with the bucket +// https://docs.aws.amazon.com/AmazonS3/latest/API/API_GetBucketTagging.html +func (s3a *S3ApiServer) GetBucketTaggingHandler(w http.ResponseWriter, r *http.Request) { + bucket, _ := s3_constants.GetBucketAndObject(r) + glog.V(3).Infof("GetBucketTagging %s", bucket) + + if err := s3a.checkBucket(r, bucket); err != s3err.ErrNone { + s3err.WriteErrorResponse(w, r, err) + return + } + + s3err.WriteErrorResponse(w, r, s3err.ErrNoSuchTagSet) +} + +func (s3a *S3ApiServer) PutBucketTaggingHandler(w http.ResponseWriter, r *http.Request) { + s3err.WriteErrorResponse(w, r, s3err.ErrNotImplemented) +} + +func (s3a *S3ApiServer) DeleteBucketTaggingHandler(w http.ResponseWriter, r *http.Request) { + s3err.WriteErrorResponse(w, r, s3err.ErrNotImplemented) +} + +// GetBucketEncryptionHandler Returns the default encryption configuration +// https://docs.aws.amazon.com/AmazonS3/latest/API/API_GetBucketEncryption.html +func (s3a *S3ApiServer) GetBucketEncryptionHandler(w http.ResponseWriter, r *http.Request) { + s3err.WriteErrorResponse(w, r, s3err.ErrNotImplemented) +} + +func (s3a *S3ApiServer) PutBucketEncryptionHandler(w http.ResponseWriter, r *http.Request) { + s3err.WriteErrorResponse(w, r, s3err.ErrNotImplemented) +} + +func (s3a *S3ApiServer) DeleteBucketEncryptionHandler(w http.ResponseWriter, r *http.Request) { + s3err.WriteErrorResponse(w, r, s3err.ErrNotImplemented) +} + +// GetPublicAccessBlockHandler Retrieves the PublicAccessBlock configuration for an S3 bucket +// https://docs.aws.amazon.com/AmazonS3/latest/API/API_GetPublicAccessBlock.html +func (s3a *S3ApiServer) GetPublicAccessBlockHandler(w http.ResponseWriter, r *http.Request) { + s3err.WriteErrorResponse(w, r, s3err.ErrNotImplemented) +} + +func (s3a *S3ApiServer) PutPublicAccessBlockHandler(w http.ResponseWriter, r *http.Request) { + s3err.WriteErrorResponse(w, r, s3err.ErrNotImplemented) +} + +func (s3a *S3ApiServer) DeletePublicAccessBlockHandler(w http.ResponseWriter, r *http.Request) { + s3err.WriteErrorResponse(w, r, s3err.ErrNotImplemented) +} diff --git a/weed/s3api/s3api_object_handlers.go b/weed/s3api/s3api_object_handlers.go index 5f3631b89..54d6cc69e 100644 --- a/weed/s3api/s3api_object_handlers.go +++ b/weed/s3api/s3api_object_handlers.go @@ -161,6 +161,9 @@ func (s3a *S3ApiServer) proxyToFiler(w http.ResponseWriter, r *http.Request, des for header, values := range r.Header { proxyReq.Header[header] = values } + if proxyReq.ContentLength == 0 && r.ContentLength != 0 { + proxyReq.ContentLength = r.ContentLength + } // ensure that the Authorization header is overriding any previous // Authorization header which might be already present in proxyReq diff --git a/weed/s3api/s3api_object_handlers_list.go b/weed/s3api/s3api_object_handlers_list.go index 27d18800c..6a4740fef 100644 --- a/weed/s3api/s3api_object_handlers_list.go +++ b/weed/s3api/s3api_object_handlers_list.go @@ -100,7 +100,7 @@ func (s3a *S3ApiServer) ListObjectsV2Handler(w http.ResponseWriter, r *http.Requ func (s3a *S3ApiServer) ListObjectsV1Handler(w http.ResponseWriter, r *http.Request) { - // https://docs.aws.amazon.com/AmazonS3/latest/API/RESTBucketGET.html + // https://docs.aws.amazon.com/AmazonS3/latest/API/API_ListObjects.html // collect parameters bucket, _ := s3_constants.GetBucketAndObject(r) diff --git a/weed/s3api/s3api_server.go b/weed/s3api/s3api_server.go index 8c2c4f8f3..2f9e9e3fb 100644 --- a/weed/s3api/s3api_server.go +++ b/weed/s3api/s3api_server.go @@ -51,6 +51,8 @@ type S3ApiServer struct { } func NewS3ApiServer(router *mux.Router, option *S3ApiServerOption) (s3ApiServer *S3ApiServer, err error) { + startTsNs := time.Now().UnixNano() + v := util.GetViper() signingKey := v.GetString("jwt.filer_signing.key") v.SetDefault("jwt.filer_signing.expires_after_seconds", 10) @@ -101,7 +103,7 @@ func NewS3ApiServer(router *mux.Router, option *S3ApiServerOption) (s3ApiServer s3ApiServer.registerRouter(router) - go s3ApiServer.subscribeMetaEvents("s3", time.Now().UnixNano(), filer.DirectoryEtcRoot, []string{option.BucketsPath}) + go s3ApiServer.subscribeMetaEvents("s3", startTsNs, filer.DirectoryEtcRoot, []string{option.BucketsPath}) return s3ApiServer, nil } @@ -256,6 +258,21 @@ func (s3a *S3ApiServer) registerRouter(router *mux.Router) { bucket.Methods(http.MethodGet).HandlerFunc(track(s3a.iam.Auth(s3a.cb.Limit(s3a.GetBucketVersioningHandler, ACTION_READ)), "GET")).Queries("versioning", "") bucket.Methods(http.MethodPut).HandlerFunc(track(s3a.iam.Auth(s3a.cb.Limit(s3a.PutBucketVersioningHandler, ACTION_WRITE)), "PUT")).Queries("versioning", "") + // GetBucketTagging + bucket.Methods(http.MethodGet).HandlerFunc(track(s3a.iam.Auth(s3a.cb.Limit(s3a.GetBucketTaggingHandler, ACTION_TAGGING)), "GET")).Queries("tagging", "") + bucket.Methods(http.MethodPut).HandlerFunc(track(s3a.iam.Auth(s3a.cb.Limit(s3a.PutBucketTaggingHandler, ACTION_TAGGING)), "PUT")).Queries("tagging", "") + bucket.Methods(http.MethodDelete).HandlerFunc(track(s3a.iam.Auth(s3a.cb.Limit(s3a.DeleteBucketTaggingHandler, ACTION_TAGGING)), "DELETE")).Queries("tagging", "") + + // GetBucketEncryption + bucket.Methods(http.MethodGet).HandlerFunc(track(s3a.iam.Auth(s3a.cb.Limit(s3a.GetBucketEncryptionHandler, ACTION_ADMIN)), "GET")).Queries("encryption", "") + bucket.Methods(http.MethodPut).HandlerFunc(track(s3a.iam.Auth(s3a.cb.Limit(s3a.PutBucketEncryptionHandler, ACTION_ADMIN)), "PUT")).Queries("encryption", "") + bucket.Methods(http.MethodDelete).HandlerFunc(track(s3a.iam.Auth(s3a.cb.Limit(s3a.DeleteBucketEncryptionHandler, ACTION_ADMIN)), "DELETE")).Queries("encryption", "") + + // GetPublicAccessBlockHandler + bucket.Methods(http.MethodGet).HandlerFunc(track(s3a.iam.Auth(s3a.cb.Limit(s3a.GetPublicAccessBlockHandler, ACTION_ADMIN)), "GET")).Queries("publicAccessBlock", "") + bucket.Methods(http.MethodPut).HandlerFunc(track(s3a.iam.Auth(s3a.cb.Limit(s3a.PutPublicAccessBlockHandler, ACTION_ADMIN)), "PUT")).Queries("publicAccessBlock", "") + bucket.Methods(http.MethodDelete).HandlerFunc(track(s3a.iam.Auth(s3a.cb.Limit(s3a.DeletePublicAccessBlockHandler, ACTION_ADMIN)), "DELETE")).Queries("publicAccessBlock", "") + // ListObjectsV2 bucket.Methods(http.MethodGet).HandlerFunc(track(s3a.iam.Auth(s3a.cb.Limit(s3a.ListObjectsV2Handler, ACTION_LIST)), "LIST")).Queries("list-type", "2") diff --git a/weed/s3api/s3err/s3api_errors.go b/weed/s3api/s3err/s3api_errors.go index 0348d4ddc..f41c3620c 100644 --- a/weed/s3api/s3err/s3api_errors.go +++ b/weed/s3api/s3err/s3api_errors.go @@ -109,6 +109,7 @@ const ( ErrRequestBytesExceed OwnershipControlsNotFoundError + ErrNoSuchTagSet ) // error code to APIError structure, these fields carry respective @@ -184,6 +185,11 @@ var errorCodeResponse = map[ErrorCode]APIError{ Description: "The bucket policy does not exist", HTTPStatusCode: http.StatusNotFound, }, + ErrNoSuchTagSet: { + Code: "NoSuchTagSet", + Description: "The TagSet does not exist", + HTTPStatusCode: http.StatusNotFound, + }, ErrNoSuchCORSConfiguration: { Code: "NoSuchCORSConfiguration", Description: "The CORS configuration does not exist", diff --git a/weed/s3api/stats.go b/weed/s3api/stats.go index cd04b9970..415ec55dd 100644 --- a/weed/s3api/stats.go +++ b/weed/s3api/stats.go @@ -11,6 +11,10 @@ import ( func track(f http.HandlerFunc, action string) http.HandlerFunc { return func(w http.ResponseWriter, r *http.Request) { + inFlightGauge := stats_collect.S3InFlightRequestsGauge.WithLabelValues(action) + inFlightGauge.Inc() + defer inFlightGauge.Dec() + bucket, _ := s3_constants.GetBucketAndObject(r) w.Header().Set("Server", "SeaweedFS "+util.VERSION) recorder := stats_collect.NewStatusResponseWriter(w) diff --git a/weed/server/filer_grpc_server_sub_meta.go b/weed/server/filer_grpc_server_sub_meta.go index 436d6746a..f4c6bfe9d 100644 --- a/weed/server/filer_grpc_server_sub_meta.go +++ b/weed/server/filer_grpc_server_sub_meta.go @@ -2,11 +2,12 @@ package weed_server import ( "fmt" - "github.com/seaweedfs/seaweedfs/weed/stats" "strings" "sync/atomic" "time" + "github.com/seaweedfs/seaweedfs/weed/stats" + "google.golang.org/protobuf/proto" "github.com/seaweedfs/seaweedfs/weed/filer" @@ -62,8 +63,19 @@ func (fs *FilerServer) SubscribeMetadata(req *filer_pb.SubscribeMetadataRequest, return nil } + glog.V(4).Infof("processed to %v: %v", clientName, processedTsNs) if processedTsNs != 0 { lastReadTime = log_buffer.NewMessagePosition(processedTsNs, -2) + } else { + nextDayTs := util.GetNextDayTsNano(lastReadTime.UnixNano()) + position := log_buffer.NewMessagePosition(nextDayTs, -2) + found, err := fs.filer.HasPersistedLogFiles(position) + if err != nil { + return fmt.Errorf("checking persisted log files: %v", err) + } + if found { + lastReadTime = position + } } glog.V(4).Infof("read in memory %v aggregated subscribe %s from %+v", clientName, req.PathPrefix, lastReadTime) @@ -72,10 +84,7 @@ func (fs *FilerServer) SubscribeMetadata(req *filer_pb.SubscribeMetadataRequest, fs.filer.MetaAggregator.ListenersLock.Lock() fs.filer.MetaAggregator.ListenersCond.Wait() fs.filer.MetaAggregator.ListenersLock.Unlock() - if !fs.hasClient(req.ClientId, req.ClientEpoch) { - return false - } - return true + return fs.hasClient(req.ClientId, req.ClientEpoch) }, eachLogEntryFn) if readInMemoryLogErr != nil { if readInMemoryLogErr == log_buffer.ResumeFromDiskError { diff --git a/weed/server/filer_server_handlers.go b/weed/server/filer_server_handlers.go index 69774ce27..1c5c89dcf 100644 --- a/weed/server/filer_server_handlers.go +++ b/weed/server/filer_server_handlers.go @@ -21,6 +21,11 @@ import ( func (fs *FilerServer) filerHandler(w http.ResponseWriter, r *http.Request) { start := time.Now() + + inFlightGauge := stats.FilerInFlightRequestsGauge.WithLabelValues(r.Method) + inFlightGauge.Inc() + defer inFlightGauge.Dec() + statusRecorder := stats.NewStatusResponseWriter(w) w = statusRecorder origin := r.Header.Get("Origin") diff --git a/weed/server/filer_server_handlers_write.go b/weed/server/filer_server_handlers_write.go index e745f04f2..75fd5984e 100644 --- a/weed/server/filer_server_handlers_write.go +++ b/weed/server/filer_server_handlers_write.go @@ -160,6 +160,14 @@ func (fs *FilerServer) move(ctx context.Context, w http.ResponseWriter, r *http. return } + rule := fs.filer.FilerConf.MatchStorageRule(src) + if rule.Worm { + // you cannot move a worm file or directory + err = fmt.Errorf("cannot move write-once entry from '%s' to '%s': operation not permitted", src, dst) + writeJsonError(w, r, http.StatusForbidden, err) + return + } + oldDir, oldName := srcPath.DirAndName() newDir, newName := dstPath.DirAndName() newName = util.Nvl(newName, oldName) diff --git a/weed/server/filer_server_handlers_write_autochunk.go b/weed/server/filer_server_handlers_write_autochunk.go index ba0260f04..d68849fe7 100644 --- a/weed/server/filer_server_handlers_write_autochunk.go +++ b/weed/server/filer_server_handlers_write_autochunk.go @@ -126,7 +126,7 @@ func (fs *FilerServer) doPutAutoChunk(ctx context.Context, w http.ResponseWriter contentType = "" } - if err := fs.checkPermissions(ctx, r, ""); err != nil { + if err := fs.checkPermissions(ctx, r, fileName); err != nil { return nil, nil, err } diff --git a/weed/server/filer_server_handlers_write_upload.go b/weed/server/filer_server_handlers_write_upload.go index a08d5efe0..fce2a6413 100644 --- a/weed/server/filer_server_handlers_write_upload.go +++ b/weed/server/filer_server_handlers_write_upload.go @@ -100,14 +100,14 @@ func (fs *FilerServer) uploadReaderToChunks(reader io.Reader, startOffset int64, } wg.Add(1) - go func(offset int64) { + go func(offset int64, buf *bytes.Buffer) { defer func() { - bufPool.Put(bytesBuffer) + bufPool.Put(buf) <-bytesBufferLimitChan wg.Done() }() - chunks, toChunkErr := fs.dataToChunk(fileName, contentType, bytesBuffer.Bytes(), offset, so) + chunks, toChunkErr := fs.dataToChunk(fileName, contentType, buf.Bytes(), offset, so) if toChunkErr != nil { uploadErrLock.Lock() if uploadErr == nil { @@ -124,7 +124,7 @@ func (fs *FilerServer) uploadReaderToChunks(reader io.Reader, startOffset int64, } fileChunksLock.Unlock() } - }(chunkOffset) + }(chunkOffset, bytesBuffer) // reset variables for the next chunk chunkOffset = chunkOffset + dataSize @@ -138,6 +138,10 @@ func (fs *FilerServer) uploadReaderToChunks(reader io.Reader, startOffset int64, wg.Wait() if uploadErr != nil { + glog.V(0).Infof("upload file %s error: %v", fileName, uploadErr) + for _, chunk := range fileChunks { + glog.V(4).Infof("purging failed uploaded %s chunk %s [%d,%d)", fileName, chunk.FileId, chunk.Offset, chunk.Offset+int64(chunk.Size)) + } fs.filer.DeleteUncommittedChunks(fileChunks) return nil, md5Hash, 0, uploadErr, nil } diff --git a/weed/server/master_grpc_server.go b/weed/server/master_grpc_server.go index 256a4be52..dcf279e1d 100644 --- a/weed/server/master_grpc_server.go +++ b/weed/server/master_grpc_server.go @@ -4,12 +4,13 @@ import ( "context" "errors" "fmt" - "github.com/google/uuid" - "github.com/seaweedfs/seaweedfs/weed/cluster" "net" "sort" "time" + "github.com/google/uuid" + "github.com/seaweedfs/seaweedfs/weed/cluster" + "github.com/seaweedfs/seaweedfs/weed/pb" "github.com/seaweedfs/seaweedfs/weed/stats" "github.com/seaweedfs/seaweedfs/weed/storage/backend" @@ -89,7 +90,7 @@ func (ms *MasterServer) SendHeartbeat(stream master_pb.Seaweed_SendHeartbeatServ glog.V(0).Infof("unregister disconnected volume server %s:%d", dn.Ip, dn.Port) ms.UnRegisterUuids(dn.Ip, dn.Port) - if len(message.DeletedVids) > 0 || len(message.DeletedEcVids) > 0 { + if ms.Topo.IsLeader() && (len(message.DeletedVids) > 0 || len(message.DeletedEcVids) > 0) { ms.broadcastToClients(&master_pb.KeepConnectedResponse{VolumeLocation: message}) } } @@ -338,8 +339,14 @@ func (ms *MasterServer) KeepConnected(stream master_pb.Seaweed_KeepConnectedServ func (ms *MasterServer) broadcastToClients(message *master_pb.KeepConnectedResponse) { ms.clientChansLock.RLock() - for _, ch := range ms.clientChans { - ch <- message + for client, ch := range ms.clientChans { + select { + case ch <- message: + glog.V(4).Infof("send message to %s", client) + default: + stats.MasterBroadcastToFullErrorCounter.Inc() + glog.Errorf("broadcastToClients %s message full", client) + } } ms.clientChansLock.RUnlock() } diff --git a/weed/server/master_server.go b/weed/server/master_server.go index aefae7126..9b7150d83 100644 --- a/weed/server/master_server.go +++ b/weed/server/master_server.go @@ -314,6 +314,10 @@ func processEachCmd(reg *regexp.Regexp, line string, commandEnv *shell.CommandEn for _, c := range shell.Commands { if c.Name() == cmd { + if c.HasTag(shell.ResourceHeavy) { + glog.Warningf("%s is resource heavy and should not run on master", cmd) + continue + } glog.V(0).Infof("executing: %s %v", cmd, args) if err := c.Do(args, commandEnv, os.Stdout); err != nil { glog.V(0).Infof("error: %v", err) diff --git a/weed/server/raft_server.go b/weed/server/raft_server.go index dc409aa35..4d2209dc0 100644 --- a/weed/server/raft_server.go +++ b/weed/server/raft_server.go @@ -130,7 +130,7 @@ func NewRaftServer(option *RaftServerOption) (*RaftServer, error) { } stateMachine := StateMachine{topo: option.Topo} - s.raftServer, err = raft.NewServer(string(s.serverAddr), s.dataDir, transporter, stateMachine, option.Topo, "") + s.raftServer, err = raft.NewServer(string(s.serverAddr), s.dataDir, transporter, stateMachine, option.Topo, s.serverAddr.ToGrpcAddress()) if err != nil { glog.V(0).Infoln(err) return nil, err diff --git a/weed/server/volume_grpc_erasure_coding.go b/weed/server/volume_grpc_erasure_coding.go index dd51894c5..642e8cce3 100644 --- a/weed/server/volume_grpc_erasure_coding.go +++ b/weed/server/volume_grpc_erasure_coding.go @@ -72,19 +72,16 @@ func (vs *VolumeServer) VolumeEcShardsGenerate(ctx context.Context, req *volume_ } // write .vif files - var destroyTime uint64 + var expireAtSec uint64 if v.Ttl != nil { - ttlMills := v.Ttl.ToSeconds() - if ttlMills > 0 { - destroyTime = uint64(time.Now().Unix()) + v.Ttl.ToSeconds() //calculated destroy time from the ec volume was created + ttlSecond := v.Ttl.ToSeconds() + if ttlSecond > 0 { + expireAtSec = uint64(time.Now().Unix()) + ttlSecond //calculated expiration time } } volumeInfo := &volume_server_pb.VolumeInfo{Version: uint32(v.Version())} - if destroyTime == 0 { - glog.Warningf("gen ec volume,cal ec volume destory time fail,set time to 0,ttl:%v", v.Ttl) - } else { - volumeInfo.DestroyTime = destroyTime - } + volumeInfo.ExpireAtSec = expireAtSec + datSize, _, _ := v.FileStat() volumeInfo.DatFileSize = int64(datSize) if err := volume_info.SaveVolumeInfo(baseFileName+".vif", volumeInfo); err != nil { @@ -150,8 +147,10 @@ func (vs *VolumeServer) VolumeEcShardsCopy(ctx context.Context, req *volume_serv }) } else { location = vs.store.FindFreeLocation(func(location *storage.DiskLocation) bool { - _, found := location.FindEcVolume(needle.VolumeId(req.VolumeId)) - return found + //(location.FindEcVolume) This method is error, will cause location is nil, redundant judgment + // _, found := location.FindEcVolume(needle.VolumeId(req.VolumeId)) + // return found + return true }) } if location == nil { @@ -191,7 +190,6 @@ func (vs *VolumeServer) VolumeEcShardsCopy(ctx context.Context, req *volume_serv return err } } - return nil }) if err != nil { diff --git a/weed/server/volume_server_handlers.go b/weed/server/volume_server_handlers.go index 85fb9ba81..22ef0e1c8 100644 --- a/weed/server/volume_server_handlers.go +++ b/weed/server/volume_server_handlers.go @@ -31,6 +31,10 @@ security settings: */ func (vs *VolumeServer) privateStoreHandler(w http.ResponseWriter, r *http.Request) { + inFlightGauge := stats.VolumeServerInFlightRequestsGauge.WithLabelValues(r.Method) + inFlightGauge.Inc() + defer inFlightGauge.Dec() + statusRecorder := stats.NewStatusResponseWriter(w) w = statusRecorder w.Header().Set("Server", "SeaweedFS Volume "+util.VERSION) diff --git a/weed/shell/command.go b/weed/shell/command.go new file mode 100644 index 000000000..cfd994f3f --- /dev/null +++ b/weed/shell/command.go @@ -0,0 +1,20 @@ +package shell + +import "io" + +type command interface { + Name() string + Help() string + Do([]string, *CommandEnv, io.Writer) error + HasTag(tag CommandTag) bool +} + +var ( + Commands = []command{} +) + +type CommandTag string + +const ( + ResourceHeavy CommandTag = "resourceHeavy" +) diff --git a/weed/shell/command_cluster_check.go b/weed/shell/command_cluster_check.go index 5c9866d29..27a4f2bb3 100644 --- a/weed/shell/command_cluster_check.go +++ b/weed/shell/command_cluster_check.go @@ -32,6 +32,10 @@ func (c *commandClusterCheck) Help() string { ` } +func (c *commandClusterCheck) HasTag(CommandTag) bool { + return false +} + func (c *commandClusterCheck) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { clusterPsCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) diff --git a/weed/shell/command_cluster_ps.go b/weed/shell/command_cluster_ps.go index 22925da5b..5a1503612 100644 --- a/weed/shell/command_cluster_ps.go +++ b/weed/shell/command_cluster_ps.go @@ -35,6 +35,10 @@ func (c *commandClusterPs) Help() string { ` } +func (c *commandClusterPs) HasTag(CommandTag) bool { + return false +} + func (c *commandClusterPs) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { clusterPsCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) diff --git a/weed/shell/command_cluster_raft_add.go b/weed/shell/command_cluster_raft_add.go index 6dce8d147..6089631b1 100644 --- a/weed/shell/command_cluster_raft_add.go +++ b/weed/shell/command_cluster_raft_add.go @@ -27,6 +27,10 @@ func (c *commandRaftServerAdd) Help() string { ` } +func (c *commandRaftServerAdd) HasTag(CommandTag) bool { + return false +} + func (c *commandRaftServerAdd) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { raftServerAddCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) diff --git a/weed/shell/command_cluster_raft_ps.go b/weed/shell/command_cluster_raft_ps.go index 58e7d7585..c8324f635 100644 --- a/weed/shell/command_cluster_raft_ps.go +++ b/weed/shell/command_cluster_raft_ps.go @@ -26,6 +26,10 @@ func (c *commandRaftClusterPs) Help() string { ` } +func (c *commandRaftClusterPs) HasTag(CommandTag) bool { + return false +} + func (c *commandRaftClusterPs) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { raftClusterPsCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) diff --git a/weed/shell/command_cluster_raft_remove.go b/weed/shell/command_cluster_raft_remove.go index c885d145b..109125890 100644 --- a/weed/shell/command_cluster_raft_remove.go +++ b/weed/shell/command_cluster_raft_remove.go @@ -27,6 +27,10 @@ func (c *commandRaftServerRemove) Help() string { ` } +func (c *commandRaftServerRemove) HasTag(CommandTag) bool { + return false +} + func (c *commandRaftServerRemove) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { raftServerAddCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) diff --git a/weed/shell/command_collection_delete.go b/weed/shell/command_collection_delete.go index 936f35b46..0239d4c55 100644 --- a/weed/shell/command_collection_delete.go +++ b/weed/shell/command_collection_delete.go @@ -28,6 +28,10 @@ func (c *commandCollectionDelete) Help() string { ` } +func (c *commandCollectionDelete) HasTag(CommandTag) bool { + return false +} + func (c *commandCollectionDelete) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { colDeleteCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) diff --git a/weed/shell/command_collection_list.go b/weed/shell/command_collection_list.go index c277d4028..32085f565 100644 --- a/weed/shell/command_collection_list.go +++ b/weed/shell/command_collection_list.go @@ -23,6 +23,10 @@ func (c *commandCollectionList) Help() string { return `list all collections` } +func (c *commandCollectionList) HasTag(CommandTag) bool { + return false +} + type CollectionInfo struct { FileCount float64 DeleteCount float64 diff --git a/weed/shell/command_ec_balance.go b/weed/shell/command_ec_balance.go index 217e5750e..6004ad7e4 100644 --- a/weed/shell/command_ec_balance.go +++ b/weed/shell/command_ec_balance.go @@ -4,12 +4,6 @@ import ( "flag" "fmt" "io" - - "github.com/seaweedfs/seaweedfs/weed/pb" - "github.com/seaweedfs/seaweedfs/weed/storage/erasure_coding" - "github.com/seaweedfs/seaweedfs/weed/storage/needle" - "github.com/seaweedfs/seaweedfs/weed/storage/types" - "golang.org/x/exp/slices" ) func init() { @@ -98,8 +92,11 @@ func (c *commandEcBalance) Help() string { ` } -func (c *commandEcBalance) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { +func (c *commandEcBalance) HasTag(CommandTag) bool { + return false +} +func (c *commandEcBalance) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { balanceCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) collection := balanceCommand.String("collection", "EACH_COLLECTION", "collection name, or \"EACH_COLLECTION\" for each collection") dc := balanceCommand.String("dataCenter", "", "only apply the balancing for this dataCenter") @@ -113,431 +110,16 @@ func (c *commandEcBalance) Do(args []string, commandEnv *CommandEnv, writer io.W return } - // collect all ec nodes - allEcNodes, totalFreeEcSlots, err := collectEcNodes(commandEnv, *dc) - if err != nil { - return err - } - if totalFreeEcSlots < 1 { - return fmt.Errorf("no free ec shard slots. only %d left", totalFreeEcSlots) - } - - racks := collectRacks(allEcNodes) - + var collections []string if *collection == "EACH_COLLECTION" { - collections, err := ListCollectionNames(commandEnv, false, true) + collections, err = ListCollectionNames(commandEnv, false, true) if err != nil { return err } - fmt.Printf("balanceEcVolumes collections %+v\n", len(collections)) - for _, c := range collections { - fmt.Printf("balanceEcVolumes collection %+v\n", c) - if err = balanceEcVolumes(commandEnv, c, allEcNodes, racks, *applyBalancing); err != nil { - return err - } - } } else { - if err = balanceEcVolumes(commandEnv, *collection, allEcNodes, racks, *applyBalancing); err != nil { - return err - } - } - - if err := balanceEcRacks(commandEnv, racks, *applyBalancing); err != nil { - return fmt.Errorf("balance ec racks: %v", err) - } - - return nil -} - -func collectRacks(allEcNodes []*EcNode) map[RackId]*EcRack { - // collect racks info - racks := make(map[RackId]*EcRack) - for _, ecNode := range allEcNodes { - if racks[ecNode.rack] == nil { - racks[ecNode.rack] = &EcRack{ - ecNodes: make(map[EcNodeId]*EcNode), - } - } - racks[ecNode.rack].ecNodes[EcNodeId(ecNode.info.Id)] = ecNode - racks[ecNode.rack].freeEcSlot += ecNode.freeEcSlot - } - return racks -} - -func balanceEcVolumes(commandEnv *CommandEnv, collection string, allEcNodes []*EcNode, racks map[RackId]*EcRack, applyBalancing bool) error { - - fmt.Printf("balanceEcVolumes %s\n", collection) - - if err := deleteDuplicatedEcShards(commandEnv, allEcNodes, collection, applyBalancing); err != nil { - return fmt.Errorf("delete duplicated collection %s ec shards: %v", collection, err) - } - - if err := balanceEcShardsAcrossRacks(commandEnv, allEcNodes, racks, collection, applyBalancing); err != nil { - return fmt.Errorf("balance across racks collection %s ec shards: %v", collection, err) + collections = append(collections, *collection) } + fmt.Printf("balanceEcVolumes collections %+v\n", len(collections)) - if err := balanceEcShardsWithinRacks(commandEnv, allEcNodes, racks, collection, applyBalancing); err != nil { - return fmt.Errorf("balance within racks collection %s ec shards: %v", collection, err) - } - - return nil -} - -func deleteDuplicatedEcShards(commandEnv *CommandEnv, allEcNodes []*EcNode, collection string, applyBalancing bool) error { - // vid => []ecNode - vidLocations := collectVolumeIdToEcNodes(allEcNodes, collection) - // deduplicate ec shards - for vid, locations := range vidLocations { - if err := doDeduplicateEcShards(commandEnv, collection, vid, locations, applyBalancing); err != nil { - return err - } - } - return nil -} - -func doDeduplicateEcShards(commandEnv *CommandEnv, collection string, vid needle.VolumeId, locations []*EcNode, applyBalancing bool) error { - - // check whether this volume has ecNodes that are over average - shardToLocations := make([][]*EcNode, erasure_coding.TotalShardsCount) - for _, ecNode := range locations { - shardBits := findEcVolumeShards(ecNode, vid) - for _, shardId := range shardBits.ShardIds() { - shardToLocations[shardId] = append(shardToLocations[shardId], ecNode) - } - } - for shardId, ecNodes := range shardToLocations { - if len(ecNodes) <= 1 { - continue - } - sortEcNodesByFreeslotsAscending(ecNodes) - fmt.Printf("ec shard %d.%d has %d copies, keeping %v\n", vid, shardId, len(ecNodes), ecNodes[0].info.Id) - if !applyBalancing { - continue - } - - duplicatedShardIds := []uint32{uint32(shardId)} - for _, ecNode := range ecNodes[1:] { - if err := unmountEcShards(commandEnv.option.GrpcDialOption, vid, pb.NewServerAddressFromDataNode(ecNode.info), duplicatedShardIds); err != nil { - return err - } - if err := sourceServerDeleteEcShards(commandEnv.option.GrpcDialOption, collection, vid, pb.NewServerAddressFromDataNode(ecNode.info), duplicatedShardIds); err != nil { - return err - } - ecNode.deleteEcVolumeShards(vid, duplicatedShardIds) - } - } - return nil -} - -func balanceEcShardsAcrossRacks(commandEnv *CommandEnv, allEcNodes []*EcNode, racks map[RackId]*EcRack, collection string, applyBalancing bool) error { - // collect vid => []ecNode, since previous steps can change the locations - vidLocations := collectVolumeIdToEcNodes(allEcNodes, collection) - // spread the ec shards evenly - for vid, locations := range vidLocations { - if err := doBalanceEcShardsAcrossRacks(commandEnv, collection, vid, locations, racks, applyBalancing); err != nil { - return err - } - } - return nil -} - -func doBalanceEcShardsAcrossRacks(commandEnv *CommandEnv, collection string, vid needle.VolumeId, locations []*EcNode, racks map[RackId]*EcRack, applyBalancing bool) error { - - // calculate average number of shards an ec rack should have for one volume - averageShardsPerEcRack := ceilDivide(erasure_coding.TotalShardsCount, len(racks)) - - // see the volume's shards are in how many racks, and how many in each rack - rackToShardCount := groupByCount(locations, func(ecNode *EcNode) (id string, count int) { - shardBits := findEcVolumeShards(ecNode, vid) - return string(ecNode.rack), shardBits.ShardIdCount() - }) - rackEcNodesWithVid := groupBy(locations, func(ecNode *EcNode) string { - return string(ecNode.rack) - }) - - // ecShardsToMove = select overflown ec shards from racks with ec shard counts > averageShardsPerEcRack - ecShardsToMove := make(map[erasure_coding.ShardId]*EcNode) - for rackId, count := range rackToShardCount { - if count > averageShardsPerEcRack { - possibleEcNodes := rackEcNodesWithVid[rackId] - for shardId, ecNode := range pickNEcShardsToMoveFrom(possibleEcNodes, vid, count-averageShardsPerEcRack) { - ecShardsToMove[shardId] = ecNode - } - } - } - - for shardId, ecNode := range ecShardsToMove { - rackId := pickOneRack(racks, rackToShardCount, averageShardsPerEcRack) - if rackId == "" { - fmt.Printf("ec shard %d.%d at %s can not find a destination rack\n", vid, shardId, ecNode.info.Id) - continue - } - var possibleDestinationEcNodes []*EcNode - for _, n := range racks[rackId].ecNodes { - possibleDestinationEcNodes = append(possibleDestinationEcNodes, n) - } - err := pickOneEcNodeAndMoveOneShard(commandEnv, averageShardsPerEcRack, ecNode, collection, vid, shardId, possibleDestinationEcNodes, applyBalancing) - if err != nil { - return err - } - rackToShardCount[string(rackId)] += 1 - rackToShardCount[string(ecNode.rack)] -= 1 - racks[rackId].freeEcSlot -= 1 - racks[ecNode.rack].freeEcSlot += 1 - } - - return nil -} - -func pickOneRack(rackToEcNodes map[RackId]*EcRack, rackToShardCount map[string]int, averageShardsPerEcRack int) RackId { - - // TODO later may need to add some randomness - - for rackId, rack := range rackToEcNodes { - if rackToShardCount[string(rackId)] >= averageShardsPerEcRack { - continue - } - - if rack.freeEcSlot <= 0 { - continue - } - - return rackId - } - - return "" -} - -func balanceEcShardsWithinRacks(commandEnv *CommandEnv, allEcNodes []*EcNode, racks map[RackId]*EcRack, collection string, applyBalancing bool) error { - // collect vid => []ecNode, since previous steps can change the locations - vidLocations := collectVolumeIdToEcNodes(allEcNodes, collection) - - // spread the ec shards evenly - for vid, locations := range vidLocations { - - // see the volume's shards are in how many racks, and how many in each rack - rackToShardCount := groupByCount(locations, func(ecNode *EcNode) (id string, count int) { - shardBits := findEcVolumeShards(ecNode, vid) - return string(ecNode.rack), shardBits.ShardIdCount() - }) - rackEcNodesWithVid := groupBy(locations, func(ecNode *EcNode) string { - return string(ecNode.rack) - }) - - for rackId, _ := range rackToShardCount { - - var possibleDestinationEcNodes []*EcNode - for _, n := range racks[RackId(rackId)].ecNodes { - if _, found := n.info.DiskInfos[string(types.HardDriveType)]; found { - possibleDestinationEcNodes = append(possibleDestinationEcNodes, n) - } - } - sourceEcNodes := rackEcNodesWithVid[rackId] - averageShardsPerEcNode := ceilDivide(rackToShardCount[rackId], len(possibleDestinationEcNodes)) - if err := doBalanceEcShardsWithinOneRack(commandEnv, averageShardsPerEcNode, collection, vid, sourceEcNodes, possibleDestinationEcNodes, applyBalancing); err != nil { - return err - } - } - } - return nil -} - -func doBalanceEcShardsWithinOneRack(commandEnv *CommandEnv, averageShardsPerEcNode int, collection string, vid needle.VolumeId, existingLocations, possibleDestinationEcNodes []*EcNode, applyBalancing bool) error { - - for _, ecNode := range existingLocations { - - shardBits := findEcVolumeShards(ecNode, vid) - overLimitCount := shardBits.ShardIdCount() - averageShardsPerEcNode - - for _, shardId := range shardBits.ShardIds() { - - if overLimitCount <= 0 { - break - } - - fmt.Printf("%s has %d overlimit, moving ec shard %d.%d\n", ecNode.info.Id, overLimitCount, vid, shardId) - - err := pickOneEcNodeAndMoveOneShard(commandEnv, averageShardsPerEcNode, ecNode, collection, vid, shardId, possibleDestinationEcNodes, applyBalancing) - if err != nil { - return err - } - - overLimitCount-- - } - } - - return nil -} - -func balanceEcRacks(commandEnv *CommandEnv, racks map[RackId]*EcRack, applyBalancing bool) error { - - // balance one rack for all ec shards - for _, ecRack := range racks { - if err := doBalanceEcRack(commandEnv, ecRack, applyBalancing); err != nil { - return err - } - } - return nil -} - -func doBalanceEcRack(commandEnv *CommandEnv, ecRack *EcRack, applyBalancing bool) error { - - if len(ecRack.ecNodes) <= 1 { - return nil - } - - var rackEcNodes []*EcNode - for _, node := range ecRack.ecNodes { - rackEcNodes = append(rackEcNodes, node) - } - - ecNodeIdToShardCount := groupByCount(rackEcNodes, func(ecNode *EcNode) (id string, count int) { - diskInfo, found := ecNode.info.DiskInfos[string(types.HardDriveType)] - if !found { - return - } - for _, ecShardInfo := range diskInfo.EcShardInfos { - count += erasure_coding.ShardBits(ecShardInfo.EcIndexBits).ShardIdCount() - } - return ecNode.info.Id, count - }) - - var totalShardCount int - for _, count := range ecNodeIdToShardCount { - totalShardCount += count - } - - averageShardCount := ceilDivide(totalShardCount, len(rackEcNodes)) - - hasMove := true - for hasMove { - hasMove = false - slices.SortFunc(rackEcNodes, func(a, b *EcNode) int { - return b.freeEcSlot - a.freeEcSlot - }) - emptyNode, fullNode := rackEcNodes[0], rackEcNodes[len(rackEcNodes)-1] - emptyNodeShardCount, fullNodeShardCount := ecNodeIdToShardCount[emptyNode.info.Id], ecNodeIdToShardCount[fullNode.info.Id] - if fullNodeShardCount > averageShardCount && emptyNodeShardCount+1 <= averageShardCount { - - emptyNodeIds := make(map[uint32]bool) - if emptyDiskInfo, found := emptyNode.info.DiskInfos[string(types.HardDriveType)]; found { - for _, shards := range emptyDiskInfo.EcShardInfos { - emptyNodeIds[shards.Id] = true - } - } - if fullDiskInfo, found := fullNode.info.DiskInfos[string(types.HardDriveType)]; found { - for _, shards := range fullDiskInfo.EcShardInfos { - if _, found := emptyNodeIds[shards.Id]; !found { - for _, shardId := range erasure_coding.ShardBits(shards.EcIndexBits).ShardIds() { - - fmt.Printf("%s moves ec shards %d.%d to %s\n", fullNode.info.Id, shards.Id, shardId, emptyNode.info.Id) - - err := moveMountedShardToEcNode(commandEnv, fullNode, shards.Collection, needle.VolumeId(shards.Id), shardId, emptyNode, applyBalancing) - if err != nil { - return err - } - - ecNodeIdToShardCount[emptyNode.info.Id]++ - ecNodeIdToShardCount[fullNode.info.Id]-- - hasMove = true - break - } - break - } - } - } - } - } - - return nil -} - -func pickOneEcNodeAndMoveOneShard(commandEnv *CommandEnv, averageShardsPerEcNode int, existingLocation *EcNode, collection string, vid needle.VolumeId, shardId erasure_coding.ShardId, possibleDestinationEcNodes []*EcNode, applyBalancing bool) error { - - sortEcNodesByFreeslotsDescending(possibleDestinationEcNodes) - skipReason := "" - for _, destEcNode := range possibleDestinationEcNodes { - - if destEcNode.info.Id == existingLocation.info.Id { - continue - } - - if destEcNode.freeEcSlot <= 0 { - skipReason += fmt.Sprintf(" Skipping %s because it has no free slots\n", destEcNode.info.Id) - continue - } - if findEcVolumeShards(destEcNode, vid).ShardIdCount() >= averageShardsPerEcNode { - skipReason += fmt.Sprintf(" Skipping %s because it %d >= avernageShards (%d)\n", - destEcNode.info.Id, findEcVolumeShards(destEcNode, vid).ShardIdCount(), averageShardsPerEcNode) - continue - } - - fmt.Printf("%s moves ec shard %d.%d to %s\n", existingLocation.info.Id, vid, shardId, destEcNode.info.Id) - - err := moveMountedShardToEcNode(commandEnv, existingLocation, collection, vid, shardId, destEcNode, applyBalancing) - if err != nil { - return err - } - - return nil - } - fmt.Printf("WARNING: Could not find suitable taget node for %d.%d:\n%s", vid, shardId, skipReason) - return nil -} - -func pickNEcShardsToMoveFrom(ecNodes []*EcNode, vid needle.VolumeId, n int) map[erasure_coding.ShardId]*EcNode { - picked := make(map[erasure_coding.ShardId]*EcNode) - var candidateEcNodes []*CandidateEcNode - for _, ecNode := range ecNodes { - shardBits := findEcVolumeShards(ecNode, vid) - if shardBits.ShardIdCount() > 0 { - candidateEcNodes = append(candidateEcNodes, &CandidateEcNode{ - ecNode: ecNode, - shardCount: shardBits.ShardIdCount(), - }) - } - } - slices.SortFunc(candidateEcNodes, func(a, b *CandidateEcNode) int { - return b.shardCount - a.shardCount - }) - for i := 0; i < n; i++ { - selectedEcNodeIndex := -1 - for i, candidateEcNode := range candidateEcNodes { - shardBits := findEcVolumeShards(candidateEcNode.ecNode, vid) - if shardBits > 0 { - selectedEcNodeIndex = i - for _, shardId := range shardBits.ShardIds() { - candidateEcNode.shardCount-- - picked[shardId] = candidateEcNode.ecNode - candidateEcNode.ecNode.deleteEcVolumeShards(vid, []uint32{uint32(shardId)}) - break - } - break - } - } - if selectedEcNodeIndex >= 0 { - ensureSortedEcNodes(candidateEcNodes, selectedEcNodeIndex, func(i, j int) bool { - return candidateEcNodes[i].shardCount > candidateEcNodes[j].shardCount - }) - } - - } - return picked -} - -func collectVolumeIdToEcNodes(allEcNodes []*EcNode, collection string) map[needle.VolumeId][]*EcNode { - vidLocations := make(map[needle.VolumeId][]*EcNode) - for _, ecNode := range allEcNodes { - diskInfo, found := ecNode.info.DiskInfos[string(types.HardDriveType)] - if !found { - continue - } - for _, shardInfo := range diskInfo.EcShardInfos { - // ignore if not in current collection - if shardInfo.Collection == collection { - vidLocations[needle.VolumeId(shardInfo.Id)] = append(vidLocations[needle.VolumeId(shardInfo.Id)], ecNode) - } - } - } - return vidLocations + return EcBalance(commandEnv, collections, *dc, *applyBalancing) } diff --git a/weed/shell/command_ec_common.go b/weed/shell/command_ec_common.go index d3ea19256..fd7a1acdc 100644 --- a/weed/shell/command_ec_common.go +++ b/weed/shell/command_ec_common.go @@ -3,6 +3,8 @@ package shell import ( "context" "fmt" + "math" + "github.com/seaweedfs/seaweedfs/weed/glog" "github.com/seaweedfs/seaweedfs/weed/operation" "github.com/seaweedfs/seaweedfs/weed/pb" @@ -13,7 +15,6 @@ import ( "github.com/seaweedfs/seaweedfs/weed/storage/types" "golang.org/x/exp/slices" "google.golang.org/grpc" - "math" ) func moveMountedShardToEcNode(commandEnv *CommandEnv, existingLocation *EcNode, collection string, vid needle.VolumeId, shardId erasure_coding.ShardId, destinationEcNode *EcNode, applyBalancing bool) (err error) { @@ -377,3 +378,424 @@ func groupBy(data []*EcNode, identifierFn func(*EcNode) (id string)) map[string] } return groupMap } + +func collectRacks(allEcNodes []*EcNode) map[RackId]*EcRack { + // collect racks info + racks := make(map[RackId]*EcRack) + for _, ecNode := range allEcNodes { + if racks[ecNode.rack] == nil { + racks[ecNode.rack] = &EcRack{ + ecNodes: make(map[EcNodeId]*EcNode), + } + } + racks[ecNode.rack].ecNodes[EcNodeId(ecNode.info.Id)] = ecNode + racks[ecNode.rack].freeEcSlot += ecNode.freeEcSlot + } + return racks +} + +func balanceEcVolumes(commandEnv *CommandEnv, collection string, allEcNodes []*EcNode, racks map[RackId]*EcRack, applyBalancing bool) error { + + fmt.Printf("balanceEcVolumes %s\n", collection) + + if err := deleteDuplicatedEcShards(commandEnv, allEcNodes, collection, applyBalancing); err != nil { + return fmt.Errorf("delete duplicated collection %s ec shards: %v", collection, err) + } + + if err := balanceEcShardsAcrossRacks(commandEnv, allEcNodes, racks, collection, applyBalancing); err != nil { + return fmt.Errorf("balance across racks collection %s ec shards: %v", collection, err) + } + + if err := balanceEcShardsWithinRacks(commandEnv, allEcNodes, racks, collection, applyBalancing); err != nil { + return fmt.Errorf("balance within racks collection %s ec shards: %v", collection, err) + } + + return nil +} + +func deleteDuplicatedEcShards(commandEnv *CommandEnv, allEcNodes []*EcNode, collection string, applyBalancing bool) error { + // vid => []ecNode + vidLocations := collectVolumeIdToEcNodes(allEcNodes, collection) + // deduplicate ec shards + for vid, locations := range vidLocations { + if err := doDeduplicateEcShards(commandEnv, collection, vid, locations, applyBalancing); err != nil { + return err + } + } + return nil +} + +func doDeduplicateEcShards(commandEnv *CommandEnv, collection string, vid needle.VolumeId, locations []*EcNode, applyBalancing bool) error { + + // check whether this volume has ecNodes that are over average + shardToLocations := make([][]*EcNode, erasure_coding.TotalShardsCount) + for _, ecNode := range locations { + shardBits := findEcVolumeShards(ecNode, vid) + for _, shardId := range shardBits.ShardIds() { + shardToLocations[shardId] = append(shardToLocations[shardId], ecNode) + } + } + for shardId, ecNodes := range shardToLocations { + if len(ecNodes) <= 1 { + continue + } + sortEcNodesByFreeslotsAscending(ecNodes) + fmt.Printf("ec shard %d.%d has %d copies, keeping %v\n", vid, shardId, len(ecNodes), ecNodes[0].info.Id) + if !applyBalancing { + continue + } + + duplicatedShardIds := []uint32{uint32(shardId)} + for _, ecNode := range ecNodes[1:] { + if err := unmountEcShards(commandEnv.option.GrpcDialOption, vid, pb.NewServerAddressFromDataNode(ecNode.info), duplicatedShardIds); err != nil { + return err + } + if err := sourceServerDeleteEcShards(commandEnv.option.GrpcDialOption, collection, vid, pb.NewServerAddressFromDataNode(ecNode.info), duplicatedShardIds); err != nil { + return err + } + ecNode.deleteEcVolumeShards(vid, duplicatedShardIds) + } + } + return nil +} + +func balanceEcShardsAcrossRacks(commandEnv *CommandEnv, allEcNodes []*EcNode, racks map[RackId]*EcRack, collection string, applyBalancing bool) error { + // collect vid => []ecNode, since previous steps can change the locations + vidLocations := collectVolumeIdToEcNodes(allEcNodes, collection) + // spread the ec shards evenly + for vid, locations := range vidLocations { + if err := doBalanceEcShardsAcrossRacks(commandEnv, collection, vid, locations, racks, applyBalancing); err != nil { + return err + } + } + return nil +} + +func doBalanceEcShardsAcrossRacks(commandEnv *CommandEnv, collection string, vid needle.VolumeId, locations []*EcNode, racks map[RackId]*EcRack, applyBalancing bool) error { + + // calculate average number of shards an ec rack should have for one volume + averageShardsPerEcRack := ceilDivide(erasure_coding.TotalShardsCount, len(racks)) + + // see the volume's shards are in how many racks, and how many in each rack + rackToShardCount := groupByCount(locations, func(ecNode *EcNode) (id string, count int) { + shardBits := findEcVolumeShards(ecNode, vid) + return string(ecNode.rack), shardBits.ShardIdCount() + }) + rackEcNodesWithVid := groupBy(locations, func(ecNode *EcNode) string { + return string(ecNode.rack) + }) + + // ecShardsToMove = select overflown ec shards from racks with ec shard counts > averageShardsPerEcRack + ecShardsToMove := make(map[erasure_coding.ShardId]*EcNode) + for rackId, count := range rackToShardCount { + if count > averageShardsPerEcRack { + possibleEcNodes := rackEcNodesWithVid[rackId] + for shardId, ecNode := range pickNEcShardsToMoveFrom(possibleEcNodes, vid, count-averageShardsPerEcRack) { + ecShardsToMove[shardId] = ecNode + } + } + } + + for shardId, ecNode := range ecShardsToMove { + rackId := pickOneRack(racks, rackToShardCount, averageShardsPerEcRack) + if rackId == "" { + fmt.Printf("ec shard %d.%d at %s can not find a destination rack\n", vid, shardId, ecNode.info.Id) + continue + } + var possibleDestinationEcNodes []*EcNode + for _, n := range racks[rackId].ecNodes { + possibleDestinationEcNodes = append(possibleDestinationEcNodes, n) + } + err := pickOneEcNodeAndMoveOneShard(commandEnv, averageShardsPerEcRack, ecNode, collection, vid, shardId, possibleDestinationEcNodes, applyBalancing) + if err != nil { + return err + } + rackToShardCount[string(rackId)] += 1 + rackToShardCount[string(ecNode.rack)] -= 1 + racks[rackId].freeEcSlot -= 1 + racks[ecNode.rack].freeEcSlot += 1 + } + + return nil +} + +func pickOneRack(rackToEcNodes map[RackId]*EcRack, rackToShardCount map[string]int, averageShardsPerEcRack int) RackId { + + // TODO later may need to add some randomness + + for rackId, rack := range rackToEcNodes { + if rackToShardCount[string(rackId)] >= averageShardsPerEcRack { + continue + } + + if rack.freeEcSlot <= 0 { + continue + } + + return rackId + } + + return "" +} + +func balanceEcShardsWithinRacks(commandEnv *CommandEnv, allEcNodes []*EcNode, racks map[RackId]*EcRack, collection string, applyBalancing bool) error { + // collect vid => []ecNode, since previous steps can change the locations + vidLocations := collectVolumeIdToEcNodes(allEcNodes, collection) + + // spread the ec shards evenly + for vid, locations := range vidLocations { + + // see the volume's shards are in how many racks, and how many in each rack + rackToShardCount := groupByCount(locations, func(ecNode *EcNode) (id string, count int) { + shardBits := findEcVolumeShards(ecNode, vid) + return string(ecNode.rack), shardBits.ShardIdCount() + }) + rackEcNodesWithVid := groupBy(locations, func(ecNode *EcNode) string { + return string(ecNode.rack) + }) + + for rackId, _ := range rackToShardCount { + + var possibleDestinationEcNodes []*EcNode + for _, n := range racks[RackId(rackId)].ecNodes { + if _, found := n.info.DiskInfos[string(types.HardDriveType)]; found { + possibleDestinationEcNodes = append(possibleDestinationEcNodes, n) + } + } + sourceEcNodes := rackEcNodesWithVid[rackId] + averageShardsPerEcNode := ceilDivide(rackToShardCount[rackId], len(possibleDestinationEcNodes)) + if err := doBalanceEcShardsWithinOneRack(commandEnv, averageShardsPerEcNode, collection, vid, sourceEcNodes, possibleDestinationEcNodes, applyBalancing); err != nil { + return err + } + } + } + return nil +} + +func doBalanceEcShardsWithinOneRack(commandEnv *CommandEnv, averageShardsPerEcNode int, collection string, vid needle.VolumeId, existingLocations, possibleDestinationEcNodes []*EcNode, applyBalancing bool) error { + + for _, ecNode := range existingLocations { + + shardBits := findEcVolumeShards(ecNode, vid) + overLimitCount := shardBits.ShardIdCount() - averageShardsPerEcNode + + for _, shardId := range shardBits.ShardIds() { + + if overLimitCount <= 0 { + break + } + + fmt.Printf("%s has %d overlimit, moving ec shard %d.%d\n", ecNode.info.Id, overLimitCount, vid, shardId) + + err := pickOneEcNodeAndMoveOneShard(commandEnv, averageShardsPerEcNode, ecNode, collection, vid, shardId, possibleDestinationEcNodes, applyBalancing) + if err != nil { + return err + } + + overLimitCount-- + } + } + + return nil +} + +func balanceEcRacks(commandEnv *CommandEnv, racks map[RackId]*EcRack, applyBalancing bool) error { + + // balance one rack for all ec shards + for _, ecRack := range racks { + if err := doBalanceEcRack(commandEnv, ecRack, applyBalancing); err != nil { + return err + } + } + return nil +} + +func doBalanceEcRack(commandEnv *CommandEnv, ecRack *EcRack, applyBalancing bool) error { + + if len(ecRack.ecNodes) <= 1 { + return nil + } + + var rackEcNodes []*EcNode + for _, node := range ecRack.ecNodes { + rackEcNodes = append(rackEcNodes, node) + } + + ecNodeIdToShardCount := groupByCount(rackEcNodes, func(ecNode *EcNode) (id string, count int) { + diskInfo, found := ecNode.info.DiskInfos[string(types.HardDriveType)] + if !found { + return + } + for _, ecShardInfo := range diskInfo.EcShardInfos { + count += erasure_coding.ShardBits(ecShardInfo.EcIndexBits).ShardIdCount() + } + return ecNode.info.Id, count + }) + + var totalShardCount int + for _, count := range ecNodeIdToShardCount { + totalShardCount += count + } + + averageShardCount := ceilDivide(totalShardCount, len(rackEcNodes)) + + hasMove := true + for hasMove { + hasMove = false + slices.SortFunc(rackEcNodes, func(a, b *EcNode) int { + return b.freeEcSlot - a.freeEcSlot + }) + emptyNode, fullNode := rackEcNodes[0], rackEcNodes[len(rackEcNodes)-1] + emptyNodeShardCount, fullNodeShardCount := ecNodeIdToShardCount[emptyNode.info.Id], ecNodeIdToShardCount[fullNode.info.Id] + if fullNodeShardCount > averageShardCount && emptyNodeShardCount+1 <= averageShardCount { + + emptyNodeIds := make(map[uint32]bool) + if emptyDiskInfo, found := emptyNode.info.DiskInfos[string(types.HardDriveType)]; found { + for _, shards := range emptyDiskInfo.EcShardInfos { + emptyNodeIds[shards.Id] = true + } + } + if fullDiskInfo, found := fullNode.info.DiskInfos[string(types.HardDriveType)]; found { + for _, shards := range fullDiskInfo.EcShardInfos { + if _, found := emptyNodeIds[shards.Id]; !found { + for _, shardId := range erasure_coding.ShardBits(shards.EcIndexBits).ShardIds() { + + fmt.Printf("%s moves ec shards %d.%d to %s\n", fullNode.info.Id, shards.Id, shardId, emptyNode.info.Id) + + err := moveMountedShardToEcNode(commandEnv, fullNode, shards.Collection, needle.VolumeId(shards.Id), shardId, emptyNode, applyBalancing) + if err != nil { + return err + } + + ecNodeIdToShardCount[emptyNode.info.Id]++ + ecNodeIdToShardCount[fullNode.info.Id]-- + hasMove = true + break + } + break + } + } + } + } + } + + return nil +} + +func pickOneEcNodeAndMoveOneShard(commandEnv *CommandEnv, averageShardsPerEcNode int, existingLocation *EcNode, collection string, vid needle.VolumeId, shardId erasure_coding.ShardId, possibleDestinationEcNodes []*EcNode, applyBalancing bool) error { + + sortEcNodesByFreeslotsDescending(possibleDestinationEcNodes) + skipReason := "" + for _, destEcNode := range possibleDestinationEcNodes { + + if destEcNode.info.Id == existingLocation.info.Id { + continue + } + + if destEcNode.freeEcSlot <= 0 { + skipReason += fmt.Sprintf(" Skipping %s because it has no free slots\n", destEcNode.info.Id) + continue + } + if findEcVolumeShards(destEcNode, vid).ShardIdCount() >= averageShardsPerEcNode { + skipReason += fmt.Sprintf(" Skipping %s because it %d >= avernageShards (%d)\n", + destEcNode.info.Id, findEcVolumeShards(destEcNode, vid).ShardIdCount(), averageShardsPerEcNode) + continue + } + + fmt.Printf("%s moves ec shard %d.%d to %s\n", existingLocation.info.Id, vid, shardId, destEcNode.info.Id) + + err := moveMountedShardToEcNode(commandEnv, existingLocation, collection, vid, shardId, destEcNode, applyBalancing) + if err != nil { + return err + } + + return nil + } + fmt.Printf("WARNING: Could not find suitable taget node for %d.%d:\n%s", vid, shardId, skipReason) + return nil +} + +func pickNEcShardsToMoveFrom(ecNodes []*EcNode, vid needle.VolumeId, n int) map[erasure_coding.ShardId]*EcNode { + picked := make(map[erasure_coding.ShardId]*EcNode) + var candidateEcNodes []*CandidateEcNode + for _, ecNode := range ecNodes { + shardBits := findEcVolumeShards(ecNode, vid) + if shardBits.ShardIdCount() > 0 { + candidateEcNodes = append(candidateEcNodes, &CandidateEcNode{ + ecNode: ecNode, + shardCount: shardBits.ShardIdCount(), + }) + } + } + slices.SortFunc(candidateEcNodes, func(a, b *CandidateEcNode) int { + return b.shardCount - a.shardCount + }) + for i := 0; i < n; i++ { + selectedEcNodeIndex := -1 + for i, candidateEcNode := range candidateEcNodes { + shardBits := findEcVolumeShards(candidateEcNode.ecNode, vid) + if shardBits > 0 { + selectedEcNodeIndex = i + for _, shardId := range shardBits.ShardIds() { + candidateEcNode.shardCount-- + picked[shardId] = candidateEcNode.ecNode + candidateEcNode.ecNode.deleteEcVolumeShards(vid, []uint32{uint32(shardId)}) + break + } + break + } + } + if selectedEcNodeIndex >= 0 { + ensureSortedEcNodes(candidateEcNodes, selectedEcNodeIndex, func(i, j int) bool { + return candidateEcNodes[i].shardCount > candidateEcNodes[j].shardCount + }) + } + + } + return picked +} + +func collectVolumeIdToEcNodes(allEcNodes []*EcNode, collection string) map[needle.VolumeId][]*EcNode { + vidLocations := make(map[needle.VolumeId][]*EcNode) + for _, ecNode := range allEcNodes { + diskInfo, found := ecNode.info.DiskInfos[string(types.HardDriveType)] + if !found { + continue + } + for _, shardInfo := range diskInfo.EcShardInfos { + // ignore if not in current collection + if shardInfo.Collection == collection { + vidLocations[needle.VolumeId(shardInfo.Id)] = append(vidLocations[needle.VolumeId(shardInfo.Id)], ecNode) + } + } + } + return vidLocations +} + +func EcBalance(commandEnv *CommandEnv, collections []string, dc string, applyBalancing bool) (err error) { + if len(collections) == 0 { + return fmt.Errorf("no collections to balance") + } + + // collect all ec nodes + allEcNodes, totalFreeEcSlots, err := collectEcNodes(commandEnv, dc) + if err != nil { + return err + } + if totalFreeEcSlots < 1 { + return fmt.Errorf("no free ec shard slots. only %d left", totalFreeEcSlots) + } + + racks := collectRacks(allEcNodes) + for _, c := range collections { + if err = balanceEcVolumes(commandEnv, c, allEcNodes, racks, applyBalancing); err != nil { + return err + } + } + + if err := balanceEcRacks(commandEnv, racks, applyBalancing); err != nil { + return fmt.Errorf("balance ec racks: %v", err) + } + + return nil +} diff --git a/weed/shell/command_ec_decode.go b/weed/shell/command_ec_decode.go index aa0ca5045..02d0f316d 100644 --- a/weed/shell/command_ec_decode.go +++ b/weed/shell/command_ec_decode.go @@ -37,6 +37,10 @@ func (c *commandEcDecode) Help() string { ` } +func (c *commandEcDecode) HasTag(CommandTag) bool { + return false +} + func (c *commandEcDecode) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { decodeCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) volumeId := decodeCommand.Int("volumeId", 0, "the volume id") diff --git a/weed/shell/command_ec_encode.go b/weed/shell/command_ec_encode.go index 3a686fc75..072a95a2c 100644 --- a/weed/shell/command_ec_encode.go +++ b/weed/shell/command_ec_encode.go @@ -56,6 +56,10 @@ func (c *commandEcEncode) Help() string { ` } +func (c *commandEcEncode) HasTag(CommandTag) bool { + return false +} + func (c *commandEcEncode) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { encodeCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) @@ -311,15 +315,31 @@ func collectVolumeIdsForEcEncode(commandEnv *CommandEnv, selectedCollection stri } if v.Collection == selectedCollection && v.ModifiedAtSecond+quietSeconds < nowUnixSeconds { if float64(v.Size) > fullPercentage/100*float64(volumeSizeLimitMb)*1024*1024 { - vidMap[v.Id] = true + if good, found := vidMap[v.Id]; found { + if good { + if diskInfo.FreeVolumeCount < 2 { + glog.V(0).Infof("skip %s %d on %s, no free disk", v.Collection, v.Id, dn.Id) + vidMap[v.Id] = false + } + } + } else { + if diskInfo.FreeVolumeCount < 2 { + glog.V(0).Infof("skip %s %d on %s, no free disk", v.Collection, v.Id, dn.Id) + vidMap[v.Id] = false + } else { + vidMap[v.Id] = true + } + } } } } } }) - for vid := range vidMap { - vids = append(vids, needle.VolumeId(vid)) + for vid, good := range vidMap { + if good { + vids = append(vids, needle.VolumeId(vid)) + } } return diff --git a/weed/shell/command_ec_rebuild.go b/weed/shell/command_ec_rebuild.go index a4dfac67c..b761ea676 100644 --- a/weed/shell/command_ec_rebuild.go +++ b/weed/shell/command_ec_rebuild.go @@ -55,6 +55,10 @@ func (c *commandEcRebuild) Help() string { ` } +func (c *commandEcRebuild) HasTag(CommandTag) bool { + return false +} + func (c *commandEcRebuild) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { fixCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) diff --git a/weed/shell/command_fs_cat.go b/weed/shell/command_fs_cat.go index bdaa757f5..47a7f3be8 100644 --- a/weed/shell/command_fs_cat.go +++ b/weed/shell/command_fs_cat.go @@ -26,6 +26,10 @@ func (c *commandFsCat) Help() string { ` } +func (c *commandFsCat) HasTag(CommandTag) bool { + return false +} + func (c *commandFsCat) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { path, err := commandEnv.parseUrl(findInputDirectory(args)) diff --git a/weed/shell/command_fs_cd.go b/weed/shell/command_fs_cd.go index 2cc28f7a2..698865142 100644 --- a/weed/shell/command_fs_cd.go +++ b/weed/shell/command_fs_cd.go @@ -28,6 +28,10 @@ func (c *commandFsCd) Help() string { ` } +func (c *commandFsCd) HasTag(CommandTag) bool { + return false +} + func (c *commandFsCd) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { path, err := commandEnv.parseUrl(findInputDirectory(args)) diff --git a/weed/shell/command_fs_configure.go b/weed/shell/command_fs_configure.go index 99ef4a59f..2dc1e1a14 100644 --- a/weed/shell/command_fs_configure.go +++ b/weed/shell/command_fs_configure.go @@ -46,6 +46,10 @@ func (c *commandFsConfigure) Help() string { ` } +func (c *commandFsConfigure) HasTag(CommandTag) bool { + return false +} + func (c *commandFsConfigure) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { fsConfigureCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) @@ -56,7 +60,7 @@ func (c *commandFsConfigure) Do(args []string, commandEnv *CommandEnv, writer io diskType := fsConfigureCommand.String("disk", "", "[hdd|ssd|] hard drive or solid state drive or any tag") fsync := fsConfigureCommand.Bool("fsync", false, "fsync for the writes") isReadOnly := fsConfigureCommand.Bool("readOnly", false, "disable writes") - worm := fsConfigureCommand.Bool("worm", false, "worm mode, If true, a file can only be changed once, after which it becomes readonly and undeletable, see https://en.wikipedia.org/wiki/Write_once_read_many") + worm := fsConfigureCommand.Bool("worm", false, "write-once-read-many, written files are readonly") maxFileNameLength := fsConfigureCommand.Uint("maxFileNameLength", 0, "file name length limits in bytes for compatibility with Unix-based systems") dataCenter := fsConfigureCommand.String("dataCenter", "", "assign writes to this dataCenter") rack := fsConfigureCommand.String("rack", "", "assign writes to this rack") diff --git a/weed/shell/command_fs_du.go b/weed/shell/command_fs_du.go index e27ff6f6c..c35179f88 100644 --- a/weed/shell/command_fs_du.go +++ b/weed/shell/command_fs_du.go @@ -29,6 +29,10 @@ func (c *commandFsDu) Help() string { ` } +func (c *commandFsDu) HasTag(CommandTag) bool { + return false +} + func (c *commandFsDu) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { path, err := commandEnv.parseUrl(findInputDirectory(args)) diff --git a/weed/shell/command_fs_log.go b/weed/shell/command_fs_log.go index 5567f76e6..e6b7a6f9a 100644 --- a/weed/shell/command_fs_log.go +++ b/weed/shell/command_fs_log.go @@ -23,10 +23,14 @@ func (c *commandFsLogPurge) Name() string { func (c *commandFsLogPurge) Help() string { return `purge filer logs - fs.log.purge [-v] [-modifyDayAgo 365] + fs.log.purge [-v] [-daysAgo 365] ` } +func (c *commandFsLogPurge) HasTag(CommandTag) bool { + return false +} + func (c *commandFsLogPurge) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { fsLogPurgeCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) daysAgo := fsLogPurgeCommand.Uint("daysAgo", 365, "purge logs older than N days") diff --git a/weed/shell/command_fs_ls.go b/weed/shell/command_fs_ls.go index 10764175b..e007b4c9e 100644 --- a/weed/shell/command_fs_ls.go +++ b/weed/shell/command_fs_ls.go @@ -33,6 +33,10 @@ func (c *commandFsLs) Help() string { ` } +func (c *commandFsLs) HasTag(CommandTag) bool { + return false +} + func (c *commandFsLs) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { var isLongFormat, showHidden bool diff --git a/weed/shell/command_fs_merge_volumes.go b/weed/shell/command_fs_merge_volumes.go index b77feb8e3..eb401aab1 100644 --- a/weed/shell/command_fs_merge_volumes.go +++ b/weed/shell/command_fs_merge_volumes.go @@ -44,6 +44,10 @@ func (c *commandFsMergeVolumes) Help() string { ` } +func (c *commandFsMergeVolumes) HasTag(CommandTag) bool { + return false +} + func (c *commandFsMergeVolumes) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { fsMergeVolumesCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) @@ -322,7 +326,7 @@ func moveChunk(chunk *filer_pb.FileChunk, toVolumeId needle.VolumeId, masterClie if err != nil { return err } - + _, err, _ = uploader.Upload(reader, &operation.UploadOption{ UploadUrl: uploadURL, Filename: filename, diff --git a/weed/shell/command_fs_meta_cat.go b/weed/shell/command_fs_meta_cat.go index 69eee6e01..e47d8faa6 100644 --- a/weed/shell/command_fs_meta_cat.go +++ b/weed/shell/command_fs_meta_cat.go @@ -30,6 +30,10 @@ func (c *commandFsMetaCat) Help() string { ` } +func (c *commandFsMetaCat) HasTag(CommandTag) bool { + return false +} + func (c *commandFsMetaCat) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { path, err := commandEnv.parseUrl(findInputDirectory(args)) diff --git a/weed/shell/command_fs_meta_change_volume_id.go b/weed/shell/command_fs_meta_change_volume_id.go index 0d350644d..f1c148f5b 100644 --- a/weed/shell/command_fs_meta_change_volume_id.go +++ b/weed/shell/command_fs_meta_change_volume_id.go @@ -37,6 +37,10 @@ func (c *commandFsMetaChangeVolumeId) Help() string { ` } +func (c *commandFsMetaChangeVolumeId) HasTag(CommandTag) bool { + return false +} + func (c *commandFsMetaChangeVolumeId) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { fsMetaChangeVolumeIdCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) diff --git a/weed/shell/command_fs_meta_load.go b/weed/shell/command_fs_meta_load.go index 5f6559867..d56274362 100644 --- a/weed/shell/command_fs_meta_load.go +++ b/weed/shell/command_fs_meta_load.go @@ -38,6 +38,10 @@ func (c *commandFsMetaLoad) Help() string { ` } +func (c *commandFsMetaLoad) HasTag(CommandTag) bool { + return false +} + func (c *commandFsMetaLoad) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { if len(args) == 0 { diff --git a/weed/shell/command_fs_meta_notify.go b/weed/shell/command_fs_meta_notify.go index 5445810ed..d7aca21d3 100644 --- a/weed/shell/command_fs_meta_notify.go +++ b/weed/shell/command_fs_meta_notify.go @@ -30,6 +30,10 @@ func (c *commandFsMetaNotify) Help() string { ` } +func (c *commandFsMetaNotify) HasTag(CommandTag) bool { + return false +} + func (c *commandFsMetaNotify) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { path, err := commandEnv.parseUrl(findInputDirectory(args)) diff --git a/weed/shell/command_fs_meta_save.go b/weed/shell/command_fs_meta_save.go index 6a2ea6e75..a8be9fe2c 100644 --- a/weed/shell/command_fs_meta_save.go +++ b/weed/shell/command_fs_meta_save.go @@ -44,6 +44,10 @@ func (c *commandFsMetaSave) Help() string { ` } +func (c *commandFsMetaSave) HasTag(CommandTag) bool { + return false +} + func (c *commandFsMetaSave) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { fsMetaSaveCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) diff --git a/weed/shell/command_fs_mkdir.go b/weed/shell/command_fs_mkdir.go index 30cd26a20..9c33aa81c 100644 --- a/weed/shell/command_fs_mkdir.go +++ b/weed/shell/command_fs_mkdir.go @@ -27,6 +27,10 @@ func (c *commandFsMkdir) Help() string { ` } +func (c *commandFsMkdir) HasTag(CommandTag) bool { + return false +} + func (c *commandFsMkdir) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { path, err := commandEnv.parseUrl(findInputDirectory(args)) diff --git a/weed/shell/command_fs_mv.go b/weed/shell/command_fs_mv.go index 8e609edc9..cb966571c 100644 --- a/weed/shell/command_fs_mv.go +++ b/weed/shell/command_fs_mv.go @@ -34,6 +34,10 @@ func (c *commandFsMv) Help() string { ` } +func (c *commandFsMv) HasTag(CommandTag) bool { + return false +} + func (c *commandFsMv) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { if len(args) != 2 { diff --git a/weed/shell/command_fs_pwd.go b/weed/shell/command_fs_pwd.go index d7d9819c8..e74fb6c3d 100644 --- a/weed/shell/command_fs_pwd.go +++ b/weed/shell/command_fs_pwd.go @@ -20,6 +20,10 @@ func (c *commandFsPwd) Help() string { return `print out current directory` } +func (c *commandFsPwd) HasTag(CommandTag) bool { + return false +} + func (c *commandFsPwd) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { fmt.Fprintf(writer, "%s\n", commandEnv.option.Directory) diff --git a/weed/shell/command_fs_rm.go b/weed/shell/command_fs_rm.go index b8445b7e9..0af75f048 100644 --- a/weed/shell/command_fs_rm.go +++ b/weed/shell/command_fs_rm.go @@ -34,6 +34,10 @@ func (c *commandFsRm) Help() string { ` } +func (c *commandFsRm) HasTag(CommandTag) bool { + return false +} + func (c *commandFsRm) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { isRecursive := false ignoreRecursiveError := false diff --git a/weed/shell/command_fs_tree.go b/weed/shell/command_fs_tree.go index 2b2ad2cb7..21e352af2 100644 --- a/weed/shell/command_fs_tree.go +++ b/weed/shell/command_fs_tree.go @@ -28,6 +28,10 @@ func (c *commandFsTree) Help() string { ` } +func (c *commandFsTree) HasTag(CommandTag) bool { + return false +} + func (c *commandFsTree) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { path, err := commandEnv.parseUrl(findInputDirectory(args)) diff --git a/weed/shell/command_fs_verify.go b/weed/shell/command_fs_verify.go index 9b0e18f94..ea9f86c3c 100644 --- a/weed/shell/command_fs_verify.go +++ b/weed/shell/command_fs_verify.go @@ -51,6 +51,10 @@ func (c *commandFsVerify) Help() string { ` } +func (c *commandFsVerify) HasTag(CommandTag) bool { + return false +} + func (c *commandFsVerify) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { c.env = commandEnv c.writer = writer diff --git a/weed/shell/command_lock_unlock.go b/weed/shell/command_lock_unlock.go index a214ea91c..79f3c95b1 100644 --- a/weed/shell/command_lock_unlock.go +++ b/weed/shell/command_lock_unlock.go @@ -25,6 +25,10 @@ func (c *commandLock) Help() string { ` } +func (c *commandLock) HasTag(CommandTag) bool { + return false +} + func (c *commandLock) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { commandEnv.locker.RequestLock(util.DetectedHostAddress()) @@ -47,6 +51,10 @@ func (c *commandUnlock) Help() string { ` } +func (c *commandUnlock) HasTag(CommandTag) bool { + return false +} + func (c *commandUnlock) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { commandEnv.locker.ReleaseLock() diff --git a/weed/shell/command_mount_configure.go b/weed/shell/command_mount_configure.go index 941b7c797..5b224c39e 100644 --- a/weed/shell/command_mount_configure.go +++ b/weed/shell/command_mount_configure.go @@ -34,6 +34,10 @@ func (c *commandMountConfigure) Help() string { ` } +func (c *commandMountConfigure) HasTag(CommandTag) bool { + return false +} + func (c *commandMountConfigure) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { mountConfigureCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) diff --git a/weed/shell/command_mq_balance.go b/weed/shell/command_mq_balance.go index dbe218b54..2e61e640c 100644 --- a/weed/shell/command_mq_balance.go +++ b/weed/shell/command_mq_balance.go @@ -25,6 +25,10 @@ func (c *commandMqBalanceTopics) Help() string { ` } +func (c *commandMqBalanceTopics) HasTag(CommandTag) bool { + return false +} + func (c *commandMqBalanceTopics) Do(args []string, commandEnv *CommandEnv, writer io.Writer) error { // find the broker balancer diff --git a/weed/shell/command_mq_topic_compact.go b/weed/shell/command_mq_topic_compact.go new file mode 100644 index 000000000..f1dee8662 --- /dev/null +++ b/weed/shell/command_mq_topic_compact.go @@ -0,0 +1,94 @@ +package shell + +import ( + "flag" + "github.com/seaweedfs/seaweedfs/weed/filer_client" + "github.com/seaweedfs/seaweedfs/weed/mq/logstore" + "github.com/seaweedfs/seaweedfs/weed/mq/schema" + "github.com/seaweedfs/seaweedfs/weed/mq/topic" + "github.com/seaweedfs/seaweedfs/weed/operation" + "github.com/seaweedfs/seaweedfs/weed/pb" + "google.golang.org/grpc" + "io" + "time" +) + +func init() { + Commands = append(Commands, &commandMqTopicCompact{}) +} + +type commandMqTopicCompact struct { +} + +func (c *commandMqTopicCompact) Name() string { + return "mq.topic.compact" +} + +func (c *commandMqTopicCompact) Help() string { + return `compact the topic storage into parquet format + + Example: + mq.topic.compact -namespace -topic -timeAgo + +` +} + +func (c *commandMqTopicCompact) HasTag(tag CommandTag) bool { + return ResourceHeavy == tag +} + +func (c *commandMqTopicCompact) Do(args []string, commandEnv *CommandEnv, writer io.Writer) error { + + // parse parameters + mqCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) + namespace := mqCommand.String("namespace", "", "namespace name") + topicName := mqCommand.String("topic", "", "topic name") + timeAgo := mqCommand.Duration("timeAgo", 2*time.Minute, "start time before now. \"300ms\", \"1.5h\" or \"2h45m\". Valid time units are \"ns\", \"us\" (or \"µs\"), \"ms\", \"s\", \"m\", \"h\"") + replication := mqCommand.String("replication", "", "replication type") + collection := mqCommand.String("collection", "", "optional collection name") + dataCenter := mqCommand.String("dataCenter", "", "optional data center name") + diskType := mqCommand.String("disk", "", "[hdd|ssd|] hard drive or solid state drive or any tag") + maxMB := mqCommand.Int("maxMB", 4, "split files larger than the limit") + + if err := mqCommand.Parse(args); err != nil { + return err + } + + storagePreference := &operation.StoragePreference{ + Replication: *replication, + Collection: *collection, + DataCenter: *dataCenter, + DiskType: *diskType, + MaxMB: *maxMB, + } + + // read topic configuration + fca := &filer_client.FilerClientAccessor{ + GetFiler: func() pb.ServerAddress { + return commandEnv.option.FilerAddress + }, + GetGrpcDialOption: func() grpc.DialOption { + return commandEnv.option.GrpcDialOption + }, + } + t := topic.NewTopic(*namespace, *topicName) + topicConf, err := fca.ReadTopicConfFromFiler(t) + if err != nil { + return err + } + + // get record type + recordType := topicConf.GetRecordType() + recordType = schema.NewRecordTypeBuilder(recordType). + WithField(logstore.SW_COLUMN_NAME_TS, schema.TypeInt64). + WithField(logstore.SW_COLUMN_NAME_KEY, schema.TypeBytes). + RecordTypeEnd() + + // compact the topic partition versions + if err = logstore.CompactTopicPartitions(commandEnv, t, *timeAgo, recordType, storagePreference); err != nil { + return err + } + + return nil + +} diff --git a/weed/shell/command_mq_topic_configure.go b/weed/shell/command_mq_topic_configure.go index c5721d9d9..9342c8604 100644 --- a/weed/shell/command_mq_topic_configure.go +++ b/weed/shell/command_mq_topic_configure.go @@ -29,6 +29,10 @@ func (c *commandMqTopicConfigure) Help() string { ` } +func (c *commandMqTopicConfigure) HasTag(CommandTag) bool { + return false +} + func (c *commandMqTopicConfigure) Do(args []string, commandEnv *CommandEnv, writer io.Writer) error { // parse parameters diff --git a/weed/shell/command_mq_topic_desc.go b/weed/shell/command_mq_topic_desc.go index cedad6ed4..8c944271c 100644 --- a/weed/shell/command_mq_topic_desc.go +++ b/weed/shell/command_mq_topic_desc.go @@ -24,6 +24,10 @@ func (c *commandMqTopicDescribe) Help() string { return `describe a topic` } +func (c *commandMqTopicDescribe) HasTag(CommandTag) bool { + return false +} + func (c *commandMqTopicDescribe) Do(args []string, commandEnv *CommandEnv, writer io.Writer) error { // parse parameters mqCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) diff --git a/weed/shell/command_mq_topic_list.go b/weed/shell/command_mq_topic_list.go index 0a193cb4e..8da86f4a6 100644 --- a/weed/shell/command_mq_topic_list.go +++ b/weed/shell/command_mq_topic_list.go @@ -25,6 +25,10 @@ func (c *commandMqTopicList) Help() string { return `print out all topics` } +func (c *commandMqTopicList) HasTag(CommandTag) bool { + return false +} + func (c *commandMqTopicList) Do(args []string, commandEnv *CommandEnv, writer io.Writer) error { brokerBalancer, err := findBrokerBalancer(commandEnv) diff --git a/weed/shell/command_remote_cache.go b/weed/shell/command_remote_cache.go index 3a44d26e4..da19af0cf 100644 --- a/weed/shell/command_remote_cache.go +++ b/weed/shell/command_remote_cache.go @@ -46,6 +46,10 @@ func (c *commandRemoteCache) Help() string { ` } +func (c *commandRemoteCache) HasTag(CommandTag) bool { + return false +} + func (c *commandRemoteCache) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { remoteMountCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) diff --git a/weed/shell/command_remote_configure.go b/weed/shell/command_remote_configure.go index 11f7696b2..dbc44c8bf 100644 --- a/weed/shell/command_remote_configure.go +++ b/weed/shell/command_remote_configure.go @@ -48,6 +48,10 @@ func (c *commandRemoteConfigure) Help() string { ` } +func (c *commandRemoteConfigure) HasTag(CommandTag) bool { + return false +} + var ( isAlpha = regexp.MustCompile(`^[A-Za-z][A-Za-z0-9]*$`).MatchString ) diff --git a/weed/shell/command_remote_meta_sync.go b/weed/shell/command_remote_meta_sync.go index 3b6d92870..1b2e33c14 100644 --- a/weed/shell/command_remote_meta_sync.go +++ b/weed/shell/command_remote_meta_sync.go @@ -44,6 +44,10 @@ func (c *commandRemoteMetaSync) Help() string { ` } +func (c *commandRemoteMetaSync) HasTag(CommandTag) bool { + return false +} + func (c *commandRemoteMetaSync) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { remoteMetaSyncCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) diff --git a/weed/shell/command_remote_mount.go b/weed/shell/command_remote_mount.go index 9dffd10eb..cfe89ddce 100644 --- a/weed/shell/command_remote_mount.go +++ b/weed/shell/command_remote_mount.go @@ -44,6 +44,10 @@ func (c *commandRemoteMount) Help() string { ` } +func (c *commandRemoteMount) HasTag(CommandTag) bool { + return false +} + func (c *commandRemoteMount) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { remoteMountCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) diff --git a/weed/shell/command_remote_mount_buckets.go b/weed/shell/command_remote_mount_buckets.go index 91375d2d2..d8df09e60 100644 --- a/weed/shell/command_remote_mount_buckets.go +++ b/weed/shell/command_remote_mount_buckets.go @@ -38,6 +38,10 @@ func (c *commandRemoteMountBuckets) Help() string { ` } +func (c *commandRemoteMountBuckets) HasTag(CommandTag) bool { + return false +} + func (c *commandRemoteMountBuckets) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { remoteMountBucketsCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) diff --git a/weed/shell/command_remote_uncache.go b/weed/shell/command_remote_uncache.go index 25e51ff74..86d992ef1 100644 --- a/weed/shell/command_remote_uncache.go +++ b/weed/shell/command_remote_uncache.go @@ -41,6 +41,10 @@ func (c *commandRemoteUncache) Help() string { ` } +func (c *commandRemoteUncache) HasTag(CommandTag) bool { + return false +} + func (c *commandRemoteUncache) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { remoteUncacheCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) @@ -165,12 +169,12 @@ func (ff *FileFilter) matches(entry *filer_pb.Entry) bool { } } if *ff.minAge != -1 { - if entry.Attributes.Crtime + *ff.minAge > time.Now().Unix() { + if entry.Attributes.Crtime+*ff.minAge > time.Now().Unix() { return false } } if *ff.maxAge != -1 { - if entry.Attributes.Crtime + *ff.maxAge < time.Now().Unix() { + if entry.Attributes.Crtime+*ff.maxAge < time.Now().Unix() { return false } } diff --git a/weed/shell/command_remote_unmount.go b/weed/shell/command_remote_unmount.go index f461b09de..6de92e612 100644 --- a/weed/shell/command_remote_unmount.go +++ b/weed/shell/command_remote_unmount.go @@ -37,6 +37,10 @@ func (c *commandRemoteUnmount) Help() string { ` } +func (c *commandRemoteUnmount) HasTag(CommandTag) bool { + return false +} + func (c *commandRemoteUnmount) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { remoteMountCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) diff --git a/weed/shell/command_s3_bucket_create.go b/weed/shell/command_s3_bucket_create.go index 80c8a043b..86c788b0d 100644 --- a/weed/shell/command_s3_bucket_create.go +++ b/weed/shell/command_s3_bucket_create.go @@ -30,6 +30,10 @@ func (c *commandS3BucketCreate) Help() string { ` } +func (c *commandS3BucketCreate) HasTag(CommandTag) bool { + return false +} + func (c *commandS3BucketCreate) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { bucketCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) diff --git a/weed/shell/command_s3_bucket_delete.go b/weed/shell/command_s3_bucket_delete.go index 3b2a9c6e9..6f8c9c4b5 100644 --- a/weed/shell/command_s3_bucket_delete.go +++ b/weed/shell/command_s3_bucket_delete.go @@ -28,6 +28,10 @@ func (c *commandS3BucketDelete) Help() string { ` } +func (c *commandS3BucketDelete) HasTag(CommandTag) bool { + return false +} + func (c *commandS3BucketDelete) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { bucketCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) diff --git a/weed/shell/command_s3_bucket_list.go b/weed/shell/command_s3_bucket_list.go index bf21a3a29..7939f2086 100644 --- a/weed/shell/command_s3_bucket_list.go +++ b/weed/shell/command_s3_bucket_list.go @@ -27,6 +27,10 @@ func (c *commandS3BucketList) Help() string { ` } +func (c *commandS3BucketList) HasTag(CommandTag) bool { + return false +} + func (c *commandS3BucketList) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { bucketCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) diff --git a/weed/shell/command_s3_bucket_quota.go b/weed/shell/command_s3_bucket_quota.go index d603c8156..3301a8d0e 100644 --- a/weed/shell/command_s3_bucket_quota.go +++ b/weed/shell/command_s3_bucket_quota.go @@ -28,6 +28,10 @@ func (c *commandS3BucketQuota) Help() string { ` } +func (c *commandS3BucketQuota) HasTag(CommandTag) bool { + return false +} + func (c *commandS3BucketQuota) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { bucketCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) diff --git a/weed/shell/command_s3_bucket_quota_check.go b/weed/shell/command_s3_bucket_quota_check.go index b130e4fad..04708a0e7 100644 --- a/weed/shell/command_s3_bucket_quota_check.go +++ b/weed/shell/command_s3_bucket_quota_check.go @@ -29,6 +29,10 @@ func (c *commandS3BucketQuotaEnforce) Help() string { ` } +func (c *commandS3BucketQuotaEnforce) HasTag(CommandTag) bool { + return false +} + func (c *commandS3BucketQuotaEnforce) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { bucketCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) diff --git a/weed/shell/command_s3_circuitbreaker.go b/weed/shell/command_s3_circuitbreaker.go index 2f326b079..5abc2d429 100644 --- a/weed/shell/command_s3_circuitbreaker.go +++ b/weed/shell/command_s3_circuitbreaker.go @@ -51,6 +51,10 @@ func (c *commandS3CircuitBreaker) Help() string { ` } +func (c *commandS3CircuitBreaker) HasTag(CommandTag) bool { + return false +} + func (c *commandS3CircuitBreaker) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { dir := s3_constants.CircuitBreakerConfigDir file := s3_constants.CircuitBreakerConfigFile diff --git a/weed/shell/command_s3_clean_uploads.go b/weed/shell/command_s3_clean_uploads.go index accce60ba..aa296dd67 100644 --- a/weed/shell/command_s3_clean_uploads.go +++ b/weed/shell/command_s3_clean_uploads.go @@ -34,6 +34,10 @@ func (c *commandS3CleanUploads) Help() string { ` } +func (c *commandS3CleanUploads) HasTag(CommandTag) bool { + return false +} + func (c *commandS3CleanUploads) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { bucketCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) uploadedTimeAgo := bucketCommand.Duration("timeAgo", 24*time.Hour, "created time before now. \"1.5h\" or \"2h45m\". Valid time units are \"m\", \"h\"") diff --git a/weed/shell/command_s3_configure.go b/weed/shell/command_s3_configure.go index 33c5a4cfc..0726bd143 100644 --- a/weed/shell/command_s3_configure.go +++ b/weed/shell/command_s3_configure.go @@ -33,6 +33,10 @@ func (c *commandS3Configure) Help() string { ` } +func (c *commandS3Configure) HasTag(CommandTag) bool { + return false +} + func (c *commandS3Configure) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { s3ConfigureCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) diff --git a/weed/shell/command_volume_balance.go b/weed/shell/command_volume_balance.go index e9a483f41..8351415e2 100644 --- a/weed/shell/command_volume_balance.go +++ b/weed/shell/command_volume_balance.go @@ -6,6 +6,7 @@ import ( "fmt" "io" "os" + "strings" "time" "github.com/seaweedfs/seaweedfs/weed/pb" @@ -32,7 +33,7 @@ func (c *commandVolumeBalance) Name() string { func (c *commandVolumeBalance) Help() string { return `balance all volumes among volume servers - volume.balance [-collection ALL_COLLECTIONS|EACH_COLLECTION|] [-force] [-dataCenter=] + volume.balance [-collection ALL_COLLECTIONS|EACH_COLLECTION|] [-force] [-dataCenter=] [-racks=rack_name_one,rack_name_two] [-nodes=192.168.0.1:8080,192.168.0.2:8080] Algorithm: @@ -64,28 +65,39 @@ func (c *commandVolumeBalance) Help() string { ` } +func (c *commandVolumeBalance) HasTag(CommandTag) bool { + return false +} + func (c *commandVolumeBalance) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { balanceCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) collection := balanceCommand.String("collection", "ALL_COLLECTIONS", "collection name, or use \"ALL_COLLECTIONS\" across collections, \"EACH_COLLECTION\" for each collection") dc := balanceCommand.String("dataCenter", "", "only apply the balancing for this dataCenter") + racks := balanceCommand.String("racks", "", "only apply the balancing for this racks") + nodes := balanceCommand.String("nodes", "", "only apply the balancing for this nodes") + noLock := balanceCommand.Bool("noLock", false, "do not lock the admin shell at one's own risk") applyBalancing := balanceCommand.Bool("force", false, "apply the balancing plan.") if err = balanceCommand.Parse(args); err != nil { return nil } infoAboutSimulationMode(writer, *applyBalancing, "-force") - if err = commandEnv.confirmIsLocked(args); err != nil { - return + if *noLock { + commandEnv.noLock = true + } else { + if err = commandEnv.confirmIsLocked(args); err != nil { + return + } } // collect topology information - topologyInfo, _, err := collectTopologyInfo(commandEnv, 15*time.Second) + topologyInfo, _, err := collectTopologyInfo(commandEnv, 5*time.Second) if err != nil { return err } - volumeServers := collectVolumeServersByDc(topologyInfo, *dc) + volumeServers := collectVolumeServersByDcRackNode(topologyInfo, *dc, *racks, *nodes) volumeReplicas, _ := collectVolumeReplicaLocations(topologyInfo) diskTypes := collectVolumeDiskTypes(topologyInfo) @@ -138,13 +150,19 @@ func balanceVolumeServersByDiskType(commandEnv *CommandEnv, diskType types.DiskT return nil } -func collectVolumeServersByDc(t *master_pb.TopologyInfo, selectedDataCenter string) (nodes []*Node) { +func collectVolumeServersByDcRackNode(t *master_pb.TopologyInfo, selectedDataCenter string, selectedRacks string, selectedNodes string) (nodes []*Node) { for _, dc := range t.DataCenterInfos { if selectedDataCenter != "" && dc.Id != selectedDataCenter { continue } for _, r := range dc.RackInfos { + if selectedRacks != "" && !strings.Contains(selectedRacks, r.Id) { + continue + } for _, dn := range r.DataNodeInfos { + if selectedNodes != "" && !strings.Contains(selectedNodes, dn.Id) { + continue + } nodes = append(nodes, &Node{ info: dn, dc: dc.Id, @@ -321,7 +339,6 @@ func attemptToMoveOneVolume(commandEnv *CommandEnv, volumeReplicas map[uint32][] } func maybeMoveOneVolume(commandEnv *CommandEnv, volumeReplicas map[uint32][]*VolumeReplica, fullNode *Node, candidateVolume *master_pb.VolumeInformationMessage, emptyNode *Node, applyChange bool) (hasMoved bool, err error) { - if !commandEnv.isLocked() { return false, fmt.Errorf("lock is lost") } diff --git a/weed/shell/command_volume_balance_test.go b/weed/shell/command_volume_balance_test.go index fb39e063f..4e60f6ff8 100644 --- a/weed/shell/command_volume_balance_test.go +++ b/weed/shell/command_volume_balance_test.go @@ -251,7 +251,7 @@ func TestIsGoodMove(t *testing.T) { func TestBalance(t *testing.T) { topologyInfo := parseOutput(topoData) - volumeServers := collectVolumeServersByDc(topologyInfo, "") + volumeServers := collectVolumeServersByDcRackNode(topologyInfo, "", "", "") volumeReplicas, _ := collectVolumeReplicaLocations(topologyInfo) diskTypes := collectVolumeDiskTypes(topologyInfo) diff --git a/weed/shell/command_volume_check_disk.go b/weed/shell/command_volume_check_disk.go index 669bbaf3b..f72dff243 100644 --- a/weed/shell/command_volume_check_disk.go +++ b/weed/shell/command_volume_check_disk.go @@ -48,6 +48,10 @@ func (c *commandVolumeCheckDisk) Help() string { ` } +func (c *commandVolumeCheckDisk) HasTag(tag CommandTag) bool { + return tag == ResourceHeavy +} + func (c *commandVolumeCheckDisk) getVolumeStatusFileCount(vid uint32, dn *master_pb.DataNodeInfo) (totalFileCount, deletedFileCount uint64) { err := operation.WithVolumeServerClient(false, pb.NewServerAddressWithGrpcPort(dn.Id, int(dn.GrpcPort)), c.env.option.GrpcDialOption, func(volumeServerClient volume_server_pb.VolumeServerClient) error { resp, reqErr := volumeServerClient.VolumeStatus(context.Background(), &volume_server_pb.VolumeStatusRequest{ diff --git a/weed/shell/command_volume_configure_replication.go b/weed/shell/command_volume_configure_replication.go index a6acd6838..29d7ebac4 100644 --- a/weed/shell/command_volume_configure_replication.go +++ b/weed/shell/command_volume_configure_replication.go @@ -35,6 +35,10 @@ func (c *commandVolumeConfigureReplication) Help() string { ` } +func (c *commandVolumeConfigureReplication) HasTag(CommandTag) bool { + return false +} + func (c *commandVolumeConfigureReplication) Do(args []string, commandEnv *CommandEnv, _ io.Writer) (err error) { configureReplicationCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) diff --git a/weed/shell/command_volume_copy.go b/weed/shell/command_volume_copy.go index 59193f6bc..be00cb18f 100644 --- a/weed/shell/command_volume_copy.go +++ b/weed/shell/command_volume_copy.go @@ -31,6 +31,10 @@ func (c *commandVolumeCopy) Help() string { ` } +func (c *commandVolumeCopy) HasTag(CommandTag) bool { + return false +} + func (c *commandVolumeCopy) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { volCopyCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) diff --git a/weed/shell/command_volume_delete.go b/weed/shell/command_volume_delete.go index 159981c93..719420bcc 100644 --- a/weed/shell/command_volume_delete.go +++ b/weed/shell/command_volume_delete.go @@ -29,6 +29,10 @@ func (c *commandVolumeDelete) Help() string { ` } +func (c *commandVolumeDelete) HasTag(CommandTag) bool { + return false +} + func (c *commandVolumeDelete) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { volDeleteCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) diff --git a/weed/shell/command_volume_delete_empty.go b/weed/shell/command_volume_delete_empty.go index bb0a194e0..fc1d50e64 100644 --- a/weed/shell/command_volume_delete_empty.go +++ b/weed/shell/command_volume_delete_empty.go @@ -32,6 +32,10 @@ func (c *commandVolumeDeleteEmpty) Help() string { ` } +func (c *commandVolumeDeleteEmpty) HasTag(CommandTag) bool { + return false +} + func (c *commandVolumeDeleteEmpty) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { volDeleteCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) diff --git a/weed/shell/command_volume_fix_replication.go b/weed/shell/command_volume_fix_replication.go index 074931f40..2c35b3bcd 100644 --- a/weed/shell/command_volume_fix_replication.go +++ b/weed/shell/command_volume_fix_replication.go @@ -55,6 +55,10 @@ func (c *commandVolumeFixReplication) Help() string { ` } +func (c *commandVolumeFixReplication) HasTag(tag CommandTag) bool { + return false && tag == ResourceHeavy // resource intensive only when deleting and checking with replicas. +} + func (c *commandVolumeFixReplication) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { volFixReplicationCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) @@ -99,7 +103,7 @@ func (c *commandVolumeFixReplication) Do(args []string, commandEnv *CommandEnv, replica := replicas[0] replicaPlacement, _ := super_block.NewReplicaPlacementFromByte(byte(replica.info.ReplicaPlacement)) switch { - case replicaPlacement.GetCopyCount() > len(replicas): + case replicaPlacement.GetCopyCount() > len(replicas) || !satisfyReplicaCurrentLocation(replicaPlacement, replicas): underReplicatedVolumeIds = append(underReplicatedVolumeIds, vid) case isMisplaced(replicas, replicaPlacement): misplacedVolumeIds = append(misplacedVolumeIds, vid) @@ -377,6 +381,27 @@ func keepDataNodesSorted(dataNodes []location, diskType types.DiskType) { }) } +func satisfyReplicaCurrentLocation(replicaPlacement *super_block.ReplicaPlacement, replicas []*VolumeReplica) bool { + existingDataCenters, existingRacks, _ := countReplicas(replicas) + + if replicaPlacement.DiffDataCenterCount+1 > len(existingDataCenters) { + return false + } + if replicaPlacement.DiffRackCount+1 > len(existingRacks) { + return false + } + if replicaPlacement.SameRackCount > 0 { + foundSatisfyRack := false + for _, rackCount := range existingRacks { + if rackCount >= replicaPlacement.SameRackCount+1 { + foundSatisfyRack = true + } + } + return foundSatisfyRack + } + return true +} + /* if on an existing data node { return false diff --git a/weed/shell/command_volume_fix_replication_test.go b/weed/shell/command_volume_fix_replication_test.go index 97f270306..5f2318c32 100644 --- a/weed/shell/command_volume_fix_replication_test.go +++ b/weed/shell/command_volume_fix_replication_test.go @@ -438,3 +438,90 @@ func TestPickingMisplacedVolumeToDelete(t *testing.T) { } } + +func TestSatisfyReplicaCurrentLocation(t *testing.T) { + + var tests = []testcase{ + { + name: "test 001", + replication: "001", + replicas: []*VolumeReplica{ + { + location: &location{"dc1", "r1", &master_pb.DataNodeInfo{Id: "dn1"}}, + }, + { + location: &location{"dc1", "r2", &master_pb.DataNodeInfo{Id: "dn2"}}, + }, + }, + expected: false, + }, + { + name: "test 010", + replication: "010", + replicas: []*VolumeReplica{ + { + location: &location{"dc1", "r1", &master_pb.DataNodeInfo{Id: "dn1"}}, + }, + { + location: &location{"dc1", "r2", &master_pb.DataNodeInfo{Id: "dn2"}}, + }, + }, + expected: true, + }, + { + name: "test 011", + replication: "011", + replicas: []*VolumeReplica{ + { + location: &location{"dc1", "r1", &master_pb.DataNodeInfo{Id: "dn1"}}, + }, + { + location: &location{"dc1", "r1", &master_pb.DataNodeInfo{Id: "dn2"}}, + }, + { + location: &location{"dc1", "r2", &master_pb.DataNodeInfo{Id: "dn3"}}, + }, + }, + expected: true, + }, + { + name: "test 110", + replication: "110", + replicas: []*VolumeReplica{ + { + location: &location{"dc1", "r1", &master_pb.DataNodeInfo{Id: "dn1"}}, + }, + { + location: &location{"dc1", "r1", &master_pb.DataNodeInfo{Id: "dn2"}}, + }, + { + location: &location{"dc2", "r2", &master_pb.DataNodeInfo{Id: "dn3"}}, + }, + }, + expected: true, + }, + { + name: "test 100", + replication: "100", + replicas: []*VolumeReplica{ + { + location: &location{"dc1", "r1", &master_pb.DataNodeInfo{Id: "dn1"}}, + }, + { + location: &location{"dc1", "r2", &master_pb.DataNodeInfo{Id: "dn2"}}, + }, + }, + expected: false, + }, + } + + for _, tt := range tests { + t.Run(tt.name, func(t *testing.T) { + replicaPlacement, _ := super_block.NewReplicaPlacementFromString(tt.replication) + if satisfyReplicaCurrentLocation(replicaPlacement, tt.replicas) != tt.expected { + t.Errorf("%s: expect %v %v %+v", + tt.name, tt.expected, tt.replication, tt.replicas) + } + }) + } +} diff --git a/weed/shell/command_volume_fsck.go b/weed/shell/command_volume_fsck.go index f40702335..30d3ecd11 100644 --- a/weed/shell/command_volume_fsck.go +++ b/weed/shell/command_volume_fsck.go @@ -60,7 +60,7 @@ func (c *commandVolumeFsck) Name() string { } func (c *commandVolumeFsck) Help() string { - return `check all volumes to find entries not used by the filer + return `check all volumes to find entries not used by the filer. It is optional and resource intensive. Important assumption!!! the system is all used by one filer. @@ -79,6 +79,10 @@ func (c *commandVolumeFsck) Help() string { ` } +func (c *commandVolumeFsck) HasTag(tag CommandTag) bool { + return tag == ResourceHeavy +} + func (c *commandVolumeFsck) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { fsckCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) diff --git a/weed/shell/command_volume_grow.go b/weed/shell/command_volume_grow.go index 026a59b7b..5b351e6ab 100644 --- a/weed/shell/command_volume_grow.go +++ b/weed/shell/command_volume_grow.go @@ -30,6 +30,10 @@ func (c *commandGrow) Help() string { ` } +func (c *commandGrow) HasTag(CommandTag) bool { + return false +} + func (c *commandGrow) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { volumeVacuumCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) diff --git a/weed/shell/command_volume_list.go b/weed/shell/command_volume_list.go index 83e3a0d6f..fe7d5f732 100644 --- a/weed/shell/command_volume_list.go +++ b/weed/shell/command_volume_list.go @@ -39,6 +39,10 @@ func (c *commandVolumeList) Help() string { ` } +func (c *commandVolumeList) HasTag(CommandTag) bool { + return false +} + func (c *commandVolumeList) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { volumeListCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) @@ -175,12 +179,12 @@ func (c *commandVolumeList) writeDiskInfo(writer io.Writer, t *master_pb.DiskInf continue } - var destroyTimeDisplay string - destroyTime := ecShardInfo.DestroyTime + var expireAtString string + destroyTime := ecShardInfo.ExpireAtSec if destroyTime > 0 { - destroyTimeDisplay = time.Unix(int64(destroyTime), 0).Format("2006-01-02 15:04:05") + expireAtString = fmt.Sprintf("expireAt:%s", time.Unix(int64(destroyTime), 0).Format("2006-01-02 15:04:05")) } - output(verbosityLevel >= 5, writer, " ec volume id:%v collection:%v shards:%v destroyTime:%s\n", ecShardInfo.Id, ecShardInfo.Collection, erasure_coding.ShardBits(ecShardInfo.EcIndexBits).ShardIds(), destroyTimeDisplay) + output(verbosityLevel >= 5, writer, " ec volume id:%v collection:%v shards:%v %s\n", ecShardInfo.Id, ecShardInfo.Collection, erasure_coding.ShardBits(ecShardInfo.EcIndexBits).ShardIds(), expireAtString) } output(verbosityLevel >= 4, writer, " Disk %s %+v \n", diskType, s) return s diff --git a/weed/shell/command_volume_mark.go b/weed/shell/command_volume_mark.go index acc4ad368..9bc35e6c1 100644 --- a/weed/shell/command_volume_mark.go +++ b/weed/shell/command_volume_mark.go @@ -28,6 +28,10 @@ func (c *commandVolumeMark) Help() string { ` } +func (c *commandVolumeMark) HasTag(CommandTag) bool { + return false +} + func (c *commandVolumeMark) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { volMarkCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) diff --git a/weed/shell/command_volume_mount.go b/weed/shell/command_volume_mount.go index e4bad222e..0b62905de 100644 --- a/weed/shell/command_volume_mount.go +++ b/weed/shell/command_volume_mount.go @@ -33,6 +33,10 @@ func (c *commandVolumeMount) Help() string { ` } +func (c *commandVolumeMount) HasTag(CommandTag) bool { + return false +} + func (c *commandVolumeMount) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { volMountCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) diff --git a/weed/shell/command_volume_move.go b/weed/shell/command_volume_move.go index f92134d27..cf9991695 100644 --- a/weed/shell/command_volume_move.go +++ b/weed/shell/command_volume_move.go @@ -49,6 +49,10 @@ func (c *commandVolumeMove) Help() string { ` } +func (c *commandVolumeMove) HasTag(CommandTag) bool { + return false +} + func (c *commandVolumeMove) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { volMoveCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) diff --git a/weed/shell/command_volume_server_evacuate.go b/weed/shell/command_volume_server_evacuate.go index bad695cd7..5c7c903de 100644 --- a/weed/shell/command_volume_server_evacuate.go +++ b/weed/shell/command_volume_server_evacuate.go @@ -46,6 +46,10 @@ func (c *commandVolumeServerEvacuate) Help() string { ` } +func (c *commandVolumeServerEvacuate) HasTag(CommandTag) bool { + return false +} + func (c *commandVolumeServerEvacuate) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { vsEvacuateCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) @@ -106,7 +110,7 @@ func (c *commandVolumeServerEvacuate) volumeServerEvacuate(commandEnv *CommandEn func (c *commandVolumeServerEvacuate) evacuateNormalVolumes(commandEnv *CommandEnv, volumeServer string, skipNonMoveable, applyChange bool, writer io.Writer) error { // find this volume server - volumeServers := collectVolumeServersByDc(c.topologyInfo, "") + volumeServers := collectVolumeServersByDcRackNode(c.topologyInfo, "", "", "") thisNodes, otherNodes := c.nodesOtherThan(volumeServers, volumeServer) if len(thisNodes) == 0 { return fmt.Errorf("%s is not found in this cluster", volumeServer) @@ -120,7 +124,7 @@ func (c *commandVolumeServerEvacuate) evacuateNormalVolumes(commandEnv *CommandE fmt.Fprintf(writer, "update topologyInfo %v", err) } else { _, otherNodesNew := c.nodesOtherThan( - collectVolumeServersByDc(topologyInfo, ""), volumeServer) + collectVolumeServersByDcRackNode(topologyInfo, "", "", ""), volumeServer) if len(otherNodesNew) > 0 { otherNodes = otherNodesNew c.topologyInfo = topologyInfo diff --git a/weed/shell/command_volume_server_leave.go b/weed/shell/command_volume_server_leave.go index d0dd023af..e7c979cad 100644 --- a/weed/shell/command_volume_server_leave.go +++ b/weed/shell/command_volume_server_leave.go @@ -35,6 +35,10 @@ func (c *commandVolumeServerLeave) Help() string { ` } +func (c *commandVolumeServerLeave) HasTag(CommandTag) bool { + return false +} + func (c *commandVolumeServerLeave) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { vsLeaveCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) diff --git a/weed/shell/command_volume_tier_download.go b/weed/shell/command_volume_tier_download.go index e60a74735..2878d16fe 100644 --- a/weed/shell/command_volume_tier_download.go +++ b/weed/shell/command_volume_tier_download.go @@ -41,6 +41,10 @@ func (c *commandVolumeTierDownload) Help() string { ` } +func (c *commandVolumeTierDownload) HasTag(CommandTag) bool { + return false +} + func (c *commandVolumeTierDownload) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { tierCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) diff --git a/weed/shell/command_volume_tier_move.go b/weed/shell/command_volume_tier_move.go index 5aa07a7b7..d5087f0ec 100644 --- a/weed/shell/command_volume_tier_move.go +++ b/weed/shell/command_volume_tier_move.go @@ -53,6 +53,10 @@ func (c *commandVolumeTierMove) Help() string { ` } +func (c *commandVolumeTierMove) HasTag(CommandTag) bool { + return false +} + func (c *commandVolumeTierMove) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { tierCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) diff --git a/weed/shell/command_volume_tier_upload.go b/weed/shell/command_volume_tier_upload.go index d30e3f8e5..5ef1c5209 100644 --- a/weed/shell/command_volume_tier_upload.go +++ b/weed/shell/command_volume_tier_upload.go @@ -56,6 +56,10 @@ func (c *commandVolumeTierUpload) Help() string { ` } +func (c *commandVolumeTierUpload) HasTag(CommandTag) bool { + return false +} + func (c *commandVolumeTierUpload) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { tierCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) diff --git a/weed/shell/command_volume_unmount.go b/weed/shell/command_volume_unmount.go index 4b079b944..ccb83bbae 100644 --- a/weed/shell/command_volume_unmount.go +++ b/weed/shell/command_volume_unmount.go @@ -34,6 +34,10 @@ func (c *commandVolumeUnmount) Help() string { ` } +func (c *commandVolumeUnmount) HasTag(CommandTag) bool { + return false +} + func (c *commandVolumeUnmount) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { volUnmountCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) diff --git a/weed/shell/command_volume_vacuum.go b/weed/shell/command_volume_vacuum.go index eb95e3d3d..e55bf1ec9 100644 --- a/weed/shell/command_volume_vacuum.go +++ b/weed/shell/command_volume_vacuum.go @@ -27,6 +27,10 @@ func (c *commandVacuum) Help() string { ` } +func (c *commandVacuum) HasTag(CommandTag) bool { + return false +} + func (c *commandVacuum) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { volumeVacuumCommand := flag.NewFlagSet(c.Name(), flag.ContinueOnError) diff --git a/weed/shell/command_volume_vacuum_disable.go b/weed/shell/command_volume_vacuum_disable.go index ddae744e5..15897ddb0 100644 --- a/weed/shell/command_volume_vacuum_disable.go +++ b/weed/shell/command_volume_vacuum_disable.go @@ -26,6 +26,10 @@ func (c *commandDisableVacuum) Help() string { ` } +func (c *commandDisableVacuum) HasTag(CommandTag) bool { + return false +} + func (c *commandDisableVacuum) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { if err = commandEnv.confirmIsLocked(args); err != nil { diff --git a/weed/shell/command_volume_vacuum_enable.go b/weed/shell/command_volume_vacuum_enable.go index 03284c92f..b8f779b14 100644 --- a/weed/shell/command_volume_vacuum_enable.go +++ b/weed/shell/command_volume_vacuum_enable.go @@ -26,6 +26,10 @@ func (c *commandEnableVacuum) Help() string { ` } +func (c *commandEnableVacuum) HasTag(CommandTag) bool { + return false +} + func (c *commandEnableVacuum) Do(args []string, commandEnv *CommandEnv, writer io.Writer) (err error) { if err = commandEnv.confirmIsLocked(args); err != nil { diff --git a/weed/shell/commands.go b/weed/shell/commands.go index e6e582376..dbbd86f0e 100644 --- a/weed/shell/commands.go +++ b/weed/shell/commands.go @@ -6,7 +6,6 @@ import ( "github.com/seaweedfs/seaweedfs/weed/operation" "github.com/seaweedfs/seaweedfs/weed/pb/volume_server_pb" "github.com/seaweedfs/seaweedfs/weed/storage/needle_map" - "io" "net/url" "strconv" "strings" @@ -36,23 +35,15 @@ type CommandEnv struct { MasterClient *wdclient.MasterClient option *ShellOptions locker *exclusive_locks.ExclusiveLocker + noLock bool } -type command interface { - Name() string - Help() string - Do([]string, *CommandEnv, io.Writer) error -} - -var ( - Commands = []command{} -) - func NewCommandEnv(options *ShellOptions) *CommandEnv { ce := &CommandEnv{ env: make(map[string]string), MasterClient: wdclient.NewMasterClient(options.GrpcDialOption, *options.FilerGroup, pb.AdminShellClient, "", "", "", *pb.ServerAddresses(*options.Masters).ToServiceDiscovery()), option: options, + noLock: false, } ce.locker = exclusive_locks.NewExclusiveLocker(ce.MasterClient, "shell") return ce @@ -90,6 +81,9 @@ func (ce *CommandEnv) isLocked() bool { if ce == nil { return true } + if ce.noLock { + return false + } return ce.locker.IsLocked() } diff --git a/weed/stats/metrics.go b/weed/stats/metrics.go index 956bf4009..9f84a3e70 100644 --- a/weed/stats/metrics.go +++ b/weed/stats/metrics.go @@ -94,6 +94,14 @@ var ( Help: "Counter of master pick for write error", }) + MasterBroadcastToFullErrorCounter = prometheus.NewCounter( + prometheus.CounterOpts{ + Namespace: Namespace, + Subsystem: "master", + Name: "broadcast_to_full", + Help: "Counter of master broadcast send to full message channel err", + }) + MasterLeaderChangeCounter = prometheus.NewCounterVec( prometheus.CounterOpts{ Namespace: Namespace, @@ -127,6 +135,14 @@ var ( Buckets: prometheus.ExponentialBuckets(0.0001, 2, 24), }, []string{"type"}) + FilerInFlightRequestsGauge = prometheus.NewGaugeVec( + prometheus.GaugeOpts{ + Namespace: Namespace, + Subsystem: "filer", + Name: "in_flight_requests", + Help: "Current number of in-flight requests being handled by filer.", + }, []string{"type"}) + FilerServerLastSendTsOfSubscribeGauge = prometheus.NewGaugeVec( prometheus.GaugeOpts{ Namespace: Namespace, @@ -210,6 +226,14 @@ var ( Buckets: prometheus.ExponentialBuckets(0.0001, 2, 24), }, []string{"type"}) + VolumeServerInFlightRequestsGauge = prometheus.NewGaugeVec( + prometheus.GaugeOpts{ + Namespace: Namespace, + Subsystem: "volumeServer", + Name: "in_flight_requests", + Help: "Current number of in-flight requests being handled by volume server.", + }, []string{"type"}) + VolumeServerVolumeGauge = prometheus.NewGaugeVec( prometheus.GaugeOpts{ Namespace: Namespace, @@ -280,6 +304,13 @@ var ( Help: "Bucketed histogram of s3 time to first byte request processing time.", Buckets: prometheus.ExponentialBuckets(0.001, 2, 27), }, []string{"type", "bucket"}) + S3InFlightRequestsGauge = prometheus.NewGaugeVec( + prometheus.GaugeOpts{ + Namespace: Namespace, + Subsystem: "s3", + Name: "in_flight_requests", + Help: "Current number of in-flight requests being handled by s3.", + }, []string{"type"}) ) func init() { @@ -291,10 +322,12 @@ func init() { Gather.MustRegister(MasterReplicaPlacementMismatch) Gather.MustRegister(MasterVolumeLayoutWritable) Gather.MustRegister(MasterVolumeLayoutCrowded) + Gather.MustRegister(MasterBroadcastToFullErrorCounter) Gather.MustRegister(FilerRequestCounter) Gather.MustRegister(FilerHandlerCounter) Gather.MustRegister(FilerRequestHistogram) + Gather.MustRegister(FilerInFlightRequestsGauge) Gather.MustRegister(FilerStoreCounter) Gather.MustRegister(FilerStoreHistogram) Gather.MustRegister(FilerSyncOffsetGauge) @@ -305,6 +338,7 @@ func init() { Gather.MustRegister(VolumeServerRequestCounter) Gather.MustRegister(VolumeServerHandlerCounter) Gather.MustRegister(VolumeServerRequestHistogram) + Gather.MustRegister(VolumeServerInFlightRequestsGauge) Gather.MustRegister(VolumeServerVacuumingCompactCounter) Gather.MustRegister(VolumeServerVacuumingCommitCounter) Gather.MustRegister(VolumeServerVacuumingHistogram) @@ -317,6 +351,7 @@ func init() { Gather.MustRegister(S3RequestCounter) Gather.MustRegister(S3HandlerCounter) Gather.MustRegister(S3RequestHistogram) + Gather.MustRegister(S3InFlightRequestsGauge) Gather.MustRegister(S3TimeToFirstByteHistogram) } diff --git a/weed/storage/erasure_coding/ec_volume.go b/weed/storage/erasure_coding/ec_volume.go index ac25d1112..d3a76b561 100644 --- a/weed/storage/erasure_coding/ec_volume.go +++ b/weed/storage/erasure_coding/ec_volume.go @@ -42,7 +42,7 @@ type EcVolume struct { ecjFileAccessLock sync.Mutex diskType types.DiskType datFileSize int64 - DestroyTime uint64 //ec volume destroy time, calculated from the ec volume was created + ExpireAtSec uint64 //ec volume destroy time, calculated from the ec volume was created } func NewEcVolume(diskType types.DiskType, dir string, dirIdx string, collection string, vid needle.VolumeId) (ev *EcVolume, err error) { @@ -73,7 +73,7 @@ func NewEcVolume(diskType types.DiskType, dir string, dirIdx string, collection if volumeInfo, _, found, _ := volume_info.MaybeLoadVolumeInfo(dataBaseFileName + ".vif"); found { ev.Version = needle.Version(volumeInfo.Version) ev.datFileSize = volumeInfo.DatFileSize - ev.DestroyTime = volumeInfo.DestroyTime + ev.ExpireAtSec = volumeInfo.ExpireAtSec } else { glog.Warningf("vif file not found,volumeId:%d, filename:%s", vid, dataBaseFileName) volume_info.SaveVolumeInfo(dataBaseFileName+".vif", &volume_server_pb.VolumeInfo{Version: uint32(ev.Version)}) @@ -206,7 +206,7 @@ func (ev *EcVolume) ToVolumeEcShardInformationMessage() (messages []*master_pb.V Id: uint32(s.VolumeId), Collection: s.Collection, DiskType: string(ev.diskType), - DestroyTime: ev.DestroyTime, + ExpireAtSec: ev.ExpireAtSec, } messages = append(messages, m) } @@ -277,5 +277,5 @@ func SearchNeedleFromSortedIndex(ecxFile *os.File, ecxFileSize int64, needleId t } func (ev *EcVolume) IsTimeToDestroy() bool { - return ev.DestroyTime > 0 && time.Now().Unix() > (int64(ev.DestroyTime)+destroyDelaySeconds) + return ev.ExpireAtSec > 0 && time.Now().Unix() > (int64(ev.ExpireAtSec)+destroyDelaySeconds) } diff --git a/weed/storage/erasure_coding/ec_volume_info.go b/weed/storage/erasure_coding/ec_volume_info.go index 5bfc8f5f6..f464a6d3d 100644 --- a/weed/storage/erasure_coding/ec_volume_info.go +++ b/weed/storage/erasure_coding/ec_volume_info.go @@ -11,16 +11,16 @@ type EcVolumeInfo struct { Collection string ShardBits ShardBits DiskType string - DestroyTime uint64 //ec volume destroy time, calculated from the ec volume was created + ExpireAtSec uint64 //ec volume destroy time, calculated from the ec volume was created } -func NewEcVolumeInfo(diskType string, collection string, vid needle.VolumeId, shardBits ShardBits, destroyTime uint64) *EcVolumeInfo { +func NewEcVolumeInfo(diskType string, collection string, vid needle.VolumeId, shardBits ShardBits, expireAtSec uint64) *EcVolumeInfo { return &EcVolumeInfo{ Collection: collection, VolumeId: vid, ShardBits: shardBits, DiskType: diskType, - DestroyTime: destroyTime, + ExpireAtSec: expireAtSec, } } @@ -61,7 +61,7 @@ func (ecInfo *EcVolumeInfo) ToVolumeEcShardInformationMessage() (ret *master_pb. EcIndexBits: uint32(ecInfo.ShardBits), Collection: ecInfo.Collection, DiskType: ecInfo.DiskType, - DestroyTime: ecInfo.DestroyTime, + ExpireAtSec: ecInfo.ExpireAtSec, } } diff --git a/weed/storage/store.go b/weed/storage/store.go index e34f0d79a..3e2c8bcca 100644 --- a/weed/storage/store.go +++ b/weed/storage/store.go @@ -535,7 +535,6 @@ func (s *Store) UnmountVolume(i needle.VolumeId) error { err := location.UnloadVolume(i) if err == nil { glog.V(0).Infof("UnmountVolume %d", i) - stats.DeleteCollectionMetrics(v.Collection) s.DeletedVolumesChan <- message return nil } else if err == ErrVolumeNotFound { diff --git a/weed/storage/store_ec.go b/weed/storage/store_ec.go index 67fc01dfc..7f4d9797a 100644 --- a/weed/storage/store_ec.go +++ b/weed/storage/store_ec.go @@ -60,7 +60,7 @@ func (s *Store) MountEcShards(collection string, vid needle.VolumeId, shardId er Collection: collection, EcIndexBits: uint32(shardBits.AddShardId(shardId)), DiskType: string(location.DiskType), - DestroyTime: ecVolume.DestroyTime, + ExpireAtSec: ecVolume.ExpireAtSec, } return nil } else if err == os.ErrNotExist { diff --git a/weed/storage/super_block/replica_placement.go b/weed/storage/super_block/replica_placement.go index 9a59eb258..b2bf21fcb 100644 --- a/weed/storage/super_block/replica_placement.go +++ b/weed/storage/super_block/replica_placement.go @@ -12,6 +12,14 @@ type ReplicaPlacement struct { func NewReplicaPlacementFromString(t string) (*ReplicaPlacement, error) { rp := &ReplicaPlacement{} + switch len(t) { + case 0: + t = "000" + case 1: + t = "00" + t + case 2: + t = "0" + t + } for i, c := range t { count := int(c - '0') if count < 0 { diff --git a/weed/storage/volume_info/volume_info.go b/weed/storage/volume_info/volume_info.go index 59c08a833..24e2b17bc 100644 --- a/weed/storage/volume_info/volume_info.go +++ b/weed/storage/volume_info/volume_info.go @@ -2,9 +2,8 @@ package volume_info import ( "fmt" - "os" - jsonpb "google.golang.org/protobuf/encoding/protojson" + "os" "github.com/seaweedfs/seaweedfs/weed/glog" "github.com/seaweedfs/seaweedfs/weed/pb/volume_server_pb" @@ -35,7 +34,7 @@ func MaybeLoadVolumeInfo(fileName string) (volumeInfo *volume_server_pb.VolumeIn hasVolumeInfoFile = true glog.V(1).Infof("maybeLoadVolumeInfo reads %s", fileName) - tierData, readErr := os.ReadFile(fileName) + fileData, readErr := os.ReadFile(fileName) if readErr != nil { glog.Warningf("fail to read %s : %v", fileName, readErr) err = fmt.Errorf("fail to read %s : %v", fileName, readErr) @@ -44,10 +43,14 @@ func MaybeLoadVolumeInfo(fileName string) (volumeInfo *volume_server_pb.VolumeIn } glog.V(1).Infof("maybeLoadVolumeInfo Unmarshal volume info %v", fileName) - if err = jsonpb.Unmarshal(tierData, volumeInfo); err != nil { - glog.Warningf("unmarshal error: %v", err) - err = fmt.Errorf("unmarshal error: %v", err) - return + if err = jsonpb.Unmarshal(fileData, volumeInfo); err != nil { + if oldVersionErr := tryOldVersionVolumeInfo(fileData, volumeInfo); oldVersionErr != nil { + glog.Warningf("unmarshal error: %v oldFormat: %v", err, oldVersionErr) + err = fmt.Errorf("unmarshal error: %v oldFormat: %v", err, oldVersionErr) + return + } else { + err = nil + } } if len(volumeInfo.GetFiles()) == 0 { @@ -82,3 +85,19 @@ func SaveVolumeInfo(fileName string, volumeInfo *volume_server_pb.VolumeInfo) er return nil } + +func tryOldVersionVolumeInfo(data []byte, volumeInfo *volume_server_pb.VolumeInfo) error { + oldVersionVolumeInfo := &volume_server_pb.OldVersionVolumeInfo{} + if err := jsonpb.Unmarshal(data, oldVersionVolumeInfo); err != nil { + return fmt.Errorf("failed to unmarshal old version volume info: %v", err) + } + volumeInfo.Files = oldVersionVolumeInfo.Files + volumeInfo.Version = oldVersionVolumeInfo.Version + volumeInfo.Replication = oldVersionVolumeInfo.Replication + volumeInfo.BytesOffset = oldVersionVolumeInfo.BytesOffset + volumeInfo.DatFileSize = oldVersionVolumeInfo.DatFileSize + volumeInfo.ExpireAtSec = oldVersionVolumeInfo.DestroyTime + volumeInfo.ReadOnly = oldVersionVolumeInfo.ReadOnly + + return nil +} diff --git a/weed/storage/volume_tier.go b/weed/storage/volume_tier.go index e124bfbe6..198f1e23d 100644 --- a/weed/storage/volume_tier.go +++ b/weed/storage/volume_tier.go @@ -76,7 +76,7 @@ func (v *Volume) SaveVolumeInfo() error { if v.Ttl != nil { ttlSeconds := v.Ttl.ToSeconds() if ttlSeconds > 0 { - v.volumeInfo.DestroyTime = uint64(time.Now().Unix()) + ttlSeconds //calculated destroy time from the ec volume was created + v.volumeInfo.ExpireAtSec = uint64(time.Now().Unix()) + ttlSeconds //calculated destroy time from the ec volume was created } } diff --git a/weed/storage/volume_write.go b/weed/storage/volume_write.go index 8b731e028..434e296d4 100644 --- a/weed/storage/volume_write.go +++ b/weed/storage/volume_write.go @@ -4,11 +4,12 @@ import ( "bytes" "errors" "fmt" + "os" + "github.com/seaweedfs/seaweedfs/weed/glog" "github.com/seaweedfs/seaweedfs/weed/storage/backend" "github.com/seaweedfs/seaweedfs/weed/storage/needle" . "github.com/seaweedfs/seaweedfs/weed/storage/types" - "os" ) var ErrorNotFound = errors.New("not found") @@ -323,6 +324,19 @@ func (v *Volume) WriteNeedleBlob(needleId NeedleId, needleBlob []byte, size Size return fmt.Errorf("volume size limit %d exceeded! current size is %d", MaxPossibleVolumeSize, v.nm.ContentSize()) } + nv, ok := v.nm.Get(needleId) + if ok && nv.Size == size { + oldNeedle := new(needle.Needle) + err := oldNeedle.ReadData(v.DataBackend, nv.Offset.ToActualOffset(), nv.Size, v.Version()) + if err == nil { + newNeedle := new(needle.Needle) + err = newNeedle.ReadBytes(needleBlob, nv.Offset.ToActualOffset(), size, v.Version()) + if err == nil && oldNeedle.Cookie == newNeedle.Cookie && oldNeedle.Checksum == newNeedle.Checksum && bytes.Equal(oldNeedle.Data, newNeedle.Data) { + glog.V(0).Infof("needle %v already exists", needleId) + return nil + } + } + } appendAtNs := needle.GetAppendAtNs(v.lastAppendAtNs) offset, err := needle.WriteNeedleBlob(v.DataBackend, needleBlob, size, appendAtNs, v.Version()) diff --git a/weed/topology/data_node.go b/weed/topology/data_node.go index de428d38f..3103dc207 100644 --- a/weed/topology/data_node.go +++ b/weed/topology/data_node.go @@ -83,8 +83,7 @@ func (dn *DataNode) UpdateVolumes(actualVolumes []storage.VolumeInfo) (newVolume disk.DeleteVolumeById(vid) deletedVolumes = append(deletedVolumes, v) - deltaDiskUsages := newDiskUsages() - deltaDiskUsage := deltaDiskUsages.getOrCreateDisk(types.ToDiskType(v.DiskType)) + deltaDiskUsage := &DiskUsageCounts{} deltaDiskUsage.volumeCount = -1 if v.IsRemote() { deltaDiskUsage.remoteVolumeCount = -1 @@ -92,7 +91,7 @@ func (dn *DataNode) UpdateVolumes(actualVolumes []storage.VolumeInfo) (newVolume if !v.ReadOnly { deltaDiskUsage.activeVolumeCount = -1 } - disk.UpAdjustDiskUsageDelta(deltaDiskUsages) + disk.UpAdjustDiskUsageDelta(types.ToDiskType(v.DiskType), deltaDiskUsage) } } for _, v := range actualVolumes { @@ -120,8 +119,7 @@ func (dn *DataNode) DeltaUpdateVolumes(newVolumes, deletedVolumes []storage.Volu } disk.DeleteVolumeById(v.Id) - deltaDiskUsages := newDiskUsages() - deltaDiskUsage := deltaDiskUsages.getOrCreateDisk(types.ToDiskType(v.DiskType)) + deltaDiskUsage := &DiskUsageCounts{} deltaDiskUsage.volumeCount = -1 if v.IsRemote() { deltaDiskUsage.remoteVolumeCount = -1 @@ -129,7 +127,7 @@ func (dn *DataNode) DeltaUpdateVolumes(newVolumes, deletedVolumes []storage.Volu if !v.ReadOnly { deltaDiskUsage.activeVolumeCount = -1 } - disk.UpAdjustDiskUsageDelta(deltaDiskUsages) + disk.UpAdjustDiskUsageDelta(types.ToDiskType(v.DiskType), deltaDiskUsage) } for _, v := range newVolumes { dn.doAddOrUpdateVolume(v) @@ -143,7 +141,6 @@ func (dn *DataNode) AdjustMaxVolumeCounts(maxVolumeCounts map[string]uint32) { // the volume server may have set the max to zero continue } - deltaDiskUsages := newDiskUsages() dt := types.ToDiskType(diskType) currentDiskUsage := dn.diskUsages.getOrCreateDisk(dt) currentDiskUsageMaxVolumeCount := atomic.LoadInt64(¤tDiskUsage.maxVolumeCount) @@ -151,9 +148,9 @@ func (dn *DataNode) AdjustMaxVolumeCounts(maxVolumeCounts map[string]uint32) { continue } disk := dn.getOrCreateDisk(dt.String()) - deltaDiskUsage := deltaDiskUsages.getOrCreateDisk(dt) - deltaDiskUsage.maxVolumeCount = int64(maxVolumeCount) - currentDiskUsageMaxVolumeCount - disk.UpAdjustDiskUsageDelta(deltaDiskUsages) + disk.UpAdjustDiskUsageDelta(dt, &DiskUsageCounts{ + maxVolumeCount: int64(maxVolumeCount) - currentDiskUsageMaxVolumeCount, + }) } } diff --git a/weed/topology/data_node_ec.go b/weed/topology/data_node_ec.go index 100b44f59..839499982 100644 --- a/weed/topology/data_node_ec.go +++ b/weed/topology/data_node_ec.go @@ -26,12 +26,10 @@ func (dn *DataNode) UpdateEcShards(actualShards []*erasure_coding.EcVolumeInfo) existingEcShards := dn.GetEcShards() // find out the newShards and deletedShards - var newShardCount, deletedShardCount int for _, ecShards := range existingEcShards { + var newShardCount, deletedShardCount int disk := dn.getOrCreateDisk(ecShards.DiskType) - deltaDiskUsages := newDiskUsages() - deltaDiskUsage := deltaDiskUsages.getOrCreateDisk(types.ToDiskType(ecShards.DiskType)) vid := ecShards.VolumeId if actualEcShards, ok := actualEcShardMap[vid]; !ok { @@ -52,8 +50,11 @@ func (dn *DataNode) UpdateEcShards(actualShards []*erasure_coding.EcVolumeInfo) } } - deltaDiskUsage.ecShardCount = int64(newShardCount - deletedShardCount) - disk.UpAdjustDiskUsageDelta(deltaDiskUsages) + if (newShardCount - deletedShardCount) != 0 { + disk.UpAdjustDiskUsageDelta(types.ToDiskType(ecShards.DiskType), &DiskUsageCounts{ + ecShardCount: int64(newShardCount - deletedShardCount), + }) + } } @@ -65,10 +66,9 @@ func (dn *DataNode) UpdateEcShards(actualShards []*erasure_coding.EcVolumeInfo) newShards = append(newShards, ecShards) disk := dn.getOrCreateDisk(ecShards.DiskType) - deltaDiskUsages := newDiskUsages() - deltaDiskUsage := deltaDiskUsages.getOrCreateDisk(types.ToDiskType(ecShards.DiskType)) - deltaDiskUsage.ecShardCount = int64(ecShards.ShardIdCount()) - disk.UpAdjustDiskUsageDelta(deltaDiskUsages) + disk.UpAdjustDiskUsageDelta(types.ToDiskType(ecShards.DiskType), &DiskUsageCounts{ + ecShardCount: int64(ecShards.ShardIdCount()), + }) } if len(newShards) > 0 || len(deletedShards) > 0 { diff --git a/weed/topology/disk.go b/weed/topology/disk.go index 4597bfc29..80a4aaa2d 100644 --- a/weed/topology/disk.go +++ b/weed/topology/disk.go @@ -66,7 +66,7 @@ func (d *DiskUsages) ToDiskInfo() map[string]*master_pb.DiskInfo { m := &master_pb.DiskInfo{ VolumeCount: diskUsageCounts.volumeCount, MaxVolumeCount: diskUsageCounts.maxVolumeCount, - FreeVolumeCount: diskUsageCounts.maxVolumeCount - diskUsageCounts.volumeCount, + FreeVolumeCount: diskUsageCounts.maxVolumeCount - (diskUsageCounts.volumeCount - diskUsageCounts.remoteVolumeCount) - (diskUsageCounts.ecShardCount+1)/erasure_coding.DataShardsCount, ActiveVolumeCount: diskUsageCounts.activeVolumeCount, RemoteVolumeCount: diskUsageCounts.remoteVolumeCount, } @@ -152,8 +152,7 @@ func (d *Disk) AddOrUpdateVolume(v storage.VolumeInfo) (isNew, isChanged bool) { } func (d *Disk) doAddOrUpdateVolume(v storage.VolumeInfo) (isNew, isChanged bool) { - deltaDiskUsages := newDiskUsages() - deltaDiskUsage := deltaDiskUsages.getOrCreateDisk(types.ToDiskType(v.DiskType)) + deltaDiskUsage := &DiskUsageCounts{} if oldV, ok := d.volumes[v.Id]; !ok { d.volumes[v.Id] = v deltaDiskUsage.volumeCount = 1 @@ -164,7 +163,7 @@ func (d *Disk) doAddOrUpdateVolume(v storage.VolumeInfo) (isNew, isChanged bool) deltaDiskUsage.activeVolumeCount = 1 } d.UpAdjustMaxVolumeId(v.Id) - d.UpAdjustDiskUsageDelta(deltaDiskUsages) + d.UpAdjustDiskUsageDelta(types.ToDiskType(v.DiskType), deltaDiskUsage) isNew = true } else { if oldV.IsRemote() != v.IsRemote() { @@ -174,7 +173,7 @@ func (d *Disk) doAddOrUpdateVolume(v storage.VolumeInfo) (isNew, isChanged bool) if oldV.IsRemote() { deltaDiskUsage.remoteVolumeCount = -1 } - d.UpAdjustDiskUsageDelta(deltaDiskUsages) + d.UpAdjustDiskUsageDelta(types.ToDiskType(v.DiskType), deltaDiskUsage) } isChanged = d.volumes[v.Id].ReadOnly != v.ReadOnly d.volumes[v.Id] = v @@ -251,7 +250,7 @@ func (d *Disk) ToDiskInfo() *master_pb.DiskInfo { Type: string(d.Id()), VolumeCount: diskUsage.volumeCount, MaxVolumeCount: diskUsage.maxVolumeCount, - FreeVolumeCount: diskUsage.maxVolumeCount - diskUsage.volumeCount, + FreeVolumeCount: diskUsage.maxVolumeCount - (diskUsage.volumeCount - diskUsage.remoteVolumeCount) - (diskUsage.ecShardCount+1)/erasure_coding.DataShardsCount, ActiveVolumeCount: diskUsage.activeVolumeCount, RemoteVolumeCount: diskUsage.remoteVolumeCount, } diff --git a/weed/topology/disk_ec.go b/weed/topology/disk_ec.go index 4f950025f..1fea29272 100644 --- a/weed/topology/disk_ec.go +++ b/weed/topology/disk_ec.go @@ -29,10 +29,12 @@ func (d *Disk) AddOrUpdateEcShard(s *erasure_coding.EcVolumeInfo) { delta = existing.ShardBits.ShardIdCount() - oldCount } - deltaDiskUsages := newDiskUsages() - deltaDiskUsage := deltaDiskUsages.getOrCreateDisk(types.ToDiskType(string(d.Id()))) - deltaDiskUsage.ecShardCount = int64(delta) - d.UpAdjustDiskUsageDelta(deltaDiskUsages) + if delta == 0 { + return + } + d.UpAdjustDiskUsageDelta(types.ToDiskType(string(d.Id())), &DiskUsageCounts{ + ecShardCount: int64(delta), + }) } @@ -45,10 +47,11 @@ func (d *Disk) DeleteEcShard(s *erasure_coding.EcVolumeInfo) { existing.ShardBits = existing.ShardBits.Minus(s.ShardBits) delta := existing.ShardBits.ShardIdCount() - oldCount - deltaDiskUsages := newDiskUsages() - deltaDiskUsage := deltaDiskUsages.getOrCreateDisk(types.ToDiskType(string(d.Id()))) - deltaDiskUsage.ecShardCount = int64(delta) - d.UpAdjustDiskUsageDelta(deltaDiskUsages) + if delta != 0 { + d.UpAdjustDiskUsageDelta(types.ToDiskType(string(d.Id())), &DiskUsageCounts{ + ecShardCount: int64(delta), + }) + } if existing.ShardBits.ShardIdCount() == 0 { delete(d.ecShards, s.VolumeId) diff --git a/weed/topology/node.go b/weed/topology/node.go index d33bbce2b..aa178b561 100644 --- a/weed/topology/node.go +++ b/weed/topology/node.go @@ -21,7 +21,7 @@ type Node interface { String() string AvailableSpaceFor(option *VolumeGrowOption) int64 ReserveOneVolume(r int64, option *VolumeGrowOption) (*DataNode, error) - UpAdjustDiskUsageDelta(deltaDiskUsages *DiskUsages) + UpAdjustDiskUsageDelta(diskType types.DiskType, diskUsage *DiskUsageCounts) UpAdjustMaxVolumeId(vid needle.VolumeId) GetDiskUsages() *DiskUsages @@ -214,13 +214,11 @@ func (n *NodeImpl) ReserveOneVolume(r int64, option *VolumeGrowOption) (assigned return nil, errors.New("No free volume slot found!") } -func (n *NodeImpl) UpAdjustDiskUsageDelta(deltaDiskUsages *DiskUsages) { //can be negative - for diskType, diskUsage := range deltaDiskUsages.usages { - existingDisk := n.getOrCreateDisk(diskType) - existingDisk.addDiskUsageCounts(diskUsage) - } +func (n *NodeImpl) UpAdjustDiskUsageDelta(diskType types.DiskType, diskUsage *DiskUsageCounts) { //can be negative + existingDisk := n.getOrCreateDisk(diskType) + existingDisk.addDiskUsageCounts(diskUsage) if n.parent != nil { - n.parent.UpAdjustDiskUsageDelta(deltaDiskUsages) + n.parent.UpAdjustDiskUsageDelta(diskType, diskUsage) } } func (n *NodeImpl) UpAdjustMaxVolumeId(vid needle.VolumeId) { //can be negative @@ -244,7 +242,9 @@ func (n *NodeImpl) LinkChildNode(node Node) { func (n *NodeImpl) doLinkChildNode(node Node) { if n.children[node.Id()] == nil { n.children[node.Id()] = node - n.UpAdjustDiskUsageDelta(node.GetDiskUsages()) + for dt, du := range node.GetDiskUsages().usages { + n.UpAdjustDiskUsageDelta(dt, du) + } n.UpAdjustMaxVolumeId(node.GetMaxVolumeId()) node.SetParent(n) glog.V(0).Infoln(n, "adds child", node.Id()) @@ -258,7 +258,9 @@ func (n *NodeImpl) UnlinkChildNode(nodeId NodeId) { if node != nil { node.SetParent(nil) delete(n.children, node.Id()) - n.UpAdjustDiskUsageDelta(node.GetDiskUsages().negative()) + for dt, du := range node.GetDiskUsages().negative().usages { + n.UpAdjustDiskUsageDelta(dt, du) + } glog.V(0).Infoln(n, "removes", node.Id()) } } diff --git a/weed/topology/store_replicate.go b/weed/topology/store_replicate.go index b4a7d649c..a2be991fa 100644 --- a/weed/topology/store_replicate.go +++ b/weed/topology/store_replicate.go @@ -47,6 +47,11 @@ func ReplicatedWrite(masterFn operation.GetMasterFn, grpcDialOption grpc.DialOpt if s.GetVolume(volumeId) != nil { start := time.Now() + + inFlightGauge := stats.VolumeServerInFlightRequestsGauge.WithLabelValues(stats.WriteToLocalDisk) + inFlightGauge.Inc() + defer inFlightGauge.Dec() + isUnchanged, err = s.WriteVolumeNeedle(volumeId, n, true, fsync) stats.VolumeServerRequestHistogram.WithLabelValues(stats.WriteToLocalDisk).Observe(time.Since(start).Seconds()) if err != nil { @@ -59,6 +64,11 @@ func ReplicatedWrite(masterFn operation.GetMasterFn, grpcDialOption grpc.DialOpt if len(remoteLocations) > 0 { //send to other replica locations start := time.Now() + + inFlightGauge := stats.VolumeServerInFlightRequestsGauge.WithLabelValues(stats.WriteToReplicas) + inFlightGauge.Inc() + defer inFlightGauge.Dec() + err = DistributedOperation(remoteLocations, func(location operation.Location) error { u := url.URL{ Scheme: "http", diff --git a/weed/topology/topology_ec.go b/weed/topology/topology_ec.go index 8be62d045..53762b49a 100644 --- a/weed/topology/topology_ec.go +++ b/weed/topology/topology_ec.go @@ -23,7 +23,7 @@ func (t *Topology) SyncDataNodeEcShards(shardInfos []*master_pb.VolumeEcShardInf shardInfo.Collection, needle.VolumeId(shardInfo.Id), erasure_coding.ShardBits(shardInfo.EcIndexBits), - shardInfo.DestroyTime)) + shardInfo.ExpireAtSec)) } // find out the delta volumes newShards, deletedShards = dn.UpdateEcShards(shards) @@ -45,7 +45,7 @@ func (t *Topology) IncrementalSyncDataNodeEcShards(newEcShards, deletedEcShards shardInfo.DiskType, shardInfo.Collection, needle.VolumeId(shardInfo.Id), - erasure_coding.ShardBits(shardInfo.EcIndexBits), shardInfo.DestroyTime)) + erasure_coding.ShardBits(shardInfo.EcIndexBits), shardInfo.ExpireAtSec)) } for _, shardInfo := range deletedEcShards { deletedShards = append(deletedShards, @@ -53,7 +53,7 @@ func (t *Topology) IncrementalSyncDataNodeEcShards(newEcShards, deletedEcShards shardInfo.DiskType, shardInfo.Collection, needle.VolumeId(shardInfo.Id), - erasure_coding.ShardBits(shardInfo.EcIndexBits), shardInfo.DestroyTime)) + erasure_coding.ShardBits(shardInfo.EcIndexBits), shardInfo.ExpireAtSec)) } dn.DeltaUpdateEcShards(newShards, deletedShards) diff --git a/weed/topology/topology_event_handling.go b/weed/topology/topology_event_handling.go index ff1c642a6..109f29ee0 100644 --- a/weed/topology/topology_event_handling.go +++ b/weed/topology/topology_event_handling.go @@ -65,10 +65,9 @@ func (t *Topology) SetVolumeCapacityFull(volumeInfo storage.VolumeInfo) bool { if !volumeInfo.ReadOnly { disk := dn.getOrCreateDisk(volumeInfo.DiskType) - deltaDiskUsages := newDiskUsages() - deltaDiskUsage := deltaDiskUsages.getOrCreateDisk(types.ToDiskType(volumeInfo.DiskType)) - deltaDiskUsage.activeVolumeCount = -1 - disk.UpAdjustDiskUsageDelta(deltaDiskUsages) + disk.UpAdjustDiskUsageDelta(types.ToDiskType(volumeInfo.DiskType), &DiskUsageCounts{ + activeVolumeCount: -1, + }) } } @@ -96,7 +95,9 @@ func (t *Topology) UnRegisterDataNode(dn *DataNode) { } negativeUsages := dn.GetDiskUsages().negative() - dn.UpAdjustDiskUsageDelta(negativeUsages) + for dt, du := range negativeUsages.usages { + dn.UpAdjustDiskUsageDelta(dt, du) + } dn.DeltaUpdateVolumes([]storage.VolumeInfo{}, dn.GetVolumes()) dn.DeltaUpdateEcShards([]*erasure_coding.EcVolumeInfo{}, dn.GetEcShards()) if dn.Parent() != nil { diff --git a/weed/topology/volume_growth_test.go b/weed/topology/volume_growth_test.go index 1624ec32a..49dd0957c 100644 --- a/weed/topology/volume_growth_test.go +++ b/weed/topology/volume_growth_test.go @@ -122,10 +122,9 @@ func setup(topologyLayout string) *Topology { } disk := server.getOrCreateDisk("") - deltaDiskUsages := newDiskUsages() - deltaDiskUsage := deltaDiskUsages.getOrCreateDisk("") - deltaDiskUsage.maxVolumeCount = int64(serverMap["limit"].(float64)) - disk.UpAdjustDiskUsageDelta(deltaDiskUsages) + disk.UpAdjustDiskUsageDelta("", &DiskUsageCounts{ + maxVolumeCount: int64(serverMap["limit"].(float64)), + }) } } diff --git a/weed/util/chunk_cache/chunk_cache_in_memory.go b/weed/util/chunk_cache/chunk_cache_in_memory.go index 2982d0979..dd101996e 100644 --- a/weed/util/chunk_cache/chunk_cache_in_memory.go +++ b/weed/util/chunk_cache/chunk_cache_in_memory.go @@ -5,11 +5,31 @@ import ( "time" ) +var ( + _ ChunkCache = &ChunkCacheInMemory{} +) + // a global cache for recently accessed file chunks type ChunkCacheInMemory struct { cache *ccache.Cache } +func (c *ChunkCacheInMemory) ReadChunkAt(data []byte, fileId string, offset uint64) (n int, err error) { + return c.readChunkAt(data, fileId, offset) +} + +func (c *ChunkCacheInMemory) IsInCache(fileId string, lockNeeded bool) (answer bool) { + item := c.cache.Get(fileId) + if item == nil { + return false + } + return true +} + +func (c *ChunkCacheInMemory) GetMaxFilePartSizeInCache() (answer uint64) { + return 8 * 1024 * 1024 +} + func NewChunkCacheInMemory(maxEntries int64) *ChunkCacheInMemory { pruneCount := maxEntries >> 3 if pruneCount <= 0 { diff --git a/weed/util/constants.go b/weed/util/constants.go index c437ab796..bb36f5e52 100644 --- a/weed/util/constants.go +++ b/weed/util/constants.go @@ -8,7 +8,7 @@ const HttpStatusCancelled = 499 var ( MAJOR_VERSION = int32(3) - MINOR_VERSION = int32(73) + MINOR_VERSION = int32(79) VERSION_NUMBER = fmt.Sprintf("%d.%02d", MAJOR_VERSION, MINOR_VERSION) VERSION = sizeLimit + " " + VERSION_NUMBER COMMIT = "" diff --git a/weed/util/log_buffer/log_buffer.go b/weed/util/log_buffer/log_buffer.go index efe42176e..30498f92d 100644 --- a/weed/util/log_buffer/log_buffer.go +++ b/weed/util/log_buffer/log_buffer.go @@ -2,7 +2,6 @@ package log_buffer import ( "bytes" - "github.com/seaweedfs/seaweedfs/weed/pb/mq_pb" "sync" "sync/atomic" "time" @@ -11,11 +10,12 @@ import ( "github.com/seaweedfs/seaweedfs/weed/glog" "github.com/seaweedfs/seaweedfs/weed/pb/filer_pb" + "github.com/seaweedfs/seaweedfs/weed/pb/mq_pb" "github.com/seaweedfs/seaweedfs/weed/util" ) -const BufferSize = 4 * 1024 * 1024 -const PreviousBufferCount = 3 +const BufferSize = 8 * 1024 * 1024 +const PreviousBufferCount = 32 type dataToFlush struct { startTime time.Time diff --git a/weed/util/time.go b/weed/util/time.go new file mode 100644 index 000000000..8e237b72d --- /dev/null +++ b/weed/util/time.go @@ -0,0 +1,13 @@ +package util + +import ( + "time" +) + +func GetNextDayTsNano(curTs int64) int64 { + curTime := time.Unix(0, curTs) + nextDay := curTime.AddDate(0, 0, 1).Truncate(24 * time.Hour) + nextDayNano := nextDay.UnixNano() + + return nextDayNano +}